Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2024-8244 (GCVE-0-2024-8244)
Vulnerability from cvelistv5 – Published: 2025-08-06 15:32 – Updated: 2025-11-03 19:47- CWE-367 - Time-of-check Time-of-use (TOCTOU) Race Condition
| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Go standard library | path/filepath | guessed |
{
"containers": {
"adp": [
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "HIGH",
"attackVector": "NETWORK",
"availabilityImpact": "NONE",
"baseScore": 3.7,
"baseSeverity": "LOW",
"confidentialityImpact": "LOW",
"integrityImpact": "NONE",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:H/PR:N/UI:N/S:U/C:L/I:N/A:N",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2024-8244",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-11-03T19:47:22.354639Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2025-11-03T19:47:26.652Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"collectionURL": "https://pkg.go.dev",
"defaultStatus": "affected",
"packageName": "path/filepath",
"product": "path/filepath",
"vendor": "Go standard library"
}
],
"descriptions": [
{
"lang": "en",
"value": "The filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "CWE-367: Time-of-check Time-of-use (TOCTOU) Race Condition",
"lang": "en"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2025-08-06T15:32:27.357Z",
"orgId": "1bb62c36-49e3-4200-9d77-64a1400537cc",
"shortName": "Go"
},
"references": [
{
"url": "https://go.dev/issue/70007"
},
{
"url": "https://pkg.go.dev/vuln/GO-2025-9999"
}
],
"title": "Walk/WalkDir in path/filepath susceptible to symlink race"
}
},
"cveMetadata": {
"assignerOrgId": "1bb62c36-49e3-4200-9d77-64a1400537cc",
"assignerShortName": "Go",
"cveId": "CVE-2024-8244",
"datePublished": "2025-08-06T15:32:27.357Z",
"dateReserved": "2024-08-27T19:41:45.564Z",
"dateUpdated": "2025-11-03T19:47:26.652Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2024-8244",
"date": "2026-09-30",
"epss": "0.00203",
"percentile": "0.09278"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"collectionURL": "https://pkg.go.dev",
"defaultStatus": "affected",
"packageName": "path/filepath",
"product": "path/filepath",
"vendor": "Go standard library"
}
],
"source": "security@golang.org"
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "The filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress."
},
{
"lang": "es",
"value": "Las funciones filepath.Walk y filepath.WalkDir est\u00e1n documentadas como que no siguen enlaces simb\u00f3licos, pero ambas funciones son susceptibles a una condici\u00f3n de ejecuci\u00f3n TOCTOU (tiempo de verificaci\u00f3n/tiempo de uso) donde una parte de la ruta que se est\u00e1 recorriendo se reemplaza con un enlace simb\u00f3lico mientras el recorrido est\u00e1 en progreso."
}
],
"id": "CVE-2024-8244",
"lastModified": "2026-06-17T08:22:11.463",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "HIGH",
"attackVector": "NETWORK",
"availabilityImpact": "NONE",
"baseScore": 3.7,
"baseSeverity": "LOW",
"confidentialityImpact": "LOW",
"integrityImpact": "NONE",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:H/PR:N/UI:N/S:U/C:L/I:N/A:N",
"version": "3.1"
},
"exploitabilityScore": 2.2,
"impactScore": 1.4,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-8244",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-11-03T19:47:22.354639Z",
"version": "2.0.3"
}
}
]
},
"published": "2025-08-06T16:15:28.080",
"references": [
{
"source": "security@golang.org",
"url": "https://go.dev/issue/70007"
},
{
"source": "security@golang.org",
"url": "https://pkg.go.dev/vuln/GO-2025-9999"
}
],
"sourceIdentifier": "security@golang.org",
"vulnStatus": "Deferred"
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2026-09-11T06:53:26+00:00",
"cve": "CVE-2024-8244",
"id": "CVE-2024-8244",
"initial_release_date": "2024-01-01T00:00:00+00:00",
"product_status:known_affected": "1534",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "golang:path/filepath: Golang Walk/WalkDir symlink race",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2024/cve-2024-8244.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-09-15T02:24:26Z",
"cve": "CVE-2024-8244",
"id": "CVE-2024-8244",
"initial_release_date": "2025-08-06T23:31:29Z",
"product_status:known_affected": "300",
"product_status:known_not_affected": "62",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2024-8244",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2024-8244.json",
"version": "15"
},
"vulnrichment": {
"containers": {
"adp": [
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "HIGH",
"attackVector": "NETWORK",
"availabilityImpact": "NONE",
"baseScore": 3.7,
"baseSeverity": "LOW",
"confidentialityImpact": "LOW",
"integrityImpact": "NONE",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:H/PR:N/UI:N/S:U/C:L/I:N/A:N",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2024-8244",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-11-03T19:47:22.354639Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2025-08-06T20:27:11.938Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"collectionURL": "https://pkg.go.dev",
"defaultStatus": "affected",
"packageName": "path/filepath",
"product": "path/filepath",
"vendor": "Go standard library"
}
],
"descriptions": [
{
"lang": "en",
"value": "The filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "CWE-367: Time-of-check Time-of-use (TOCTOU) Race Condition",
"lang": "en"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2025-08-06T15:32:27.357Z",
"orgId": "1bb62c36-49e3-4200-9d77-64a1400537cc",
"shortName": "Go"
},
"references": [
{
"url": "https://go.dev/issue/70007"
},
{
"url": "https://pkg.go.dev/vuln/GO-2025-9999"
}
],
"title": "Walk/WalkDir in path/filepath susceptible to symlink race"
}
},
"cveMetadata": {
"assignerOrgId": "1bb62c36-49e3-4200-9d77-64a1400537cc",
"assignerShortName": "Go",
"cveId": "CVE-2024-8244",
"datePublished": "2025-08-06T15:32:27.357Z",
"dateReserved": "2024-08-27T19:41:45.564Z",
"dateUpdated": "2025-11-03T19:47:26.652Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2"
}
}
}
CERTFR-2025-AVI-0967
Vulnerability from certfr_avis - Published: 2025-11-05 - Updated: 2025-11-05
De multiples vulnérabilités ont été découvertes dans les produits VMware. Elles permettent à un attaquant de provoquer un problème de sécurité non spécifié par l'éditeur.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| VMware | Tanzu Platform | File Integrity Monitoring pour VMware Tanzu Platform versions antérieures à 2.1.49 | ||
| VMware | Tanzu Platform | Cloud Service Broker pour Azure pour VMware Tanzu Platform versions antérieures à 1.13.1 | ||
| VMware | Tanzu Platform | AI Services pour VMware Tanzu Platform versions antérieures à 10.3.0 | ||
| VMware | Tanzu Platform | Scheduler pour VMware Tanzu Platform versions antérieures à 2.0.21 | ||
| VMware | Tanzu Platform | Foundation Core pour VMware Tanzu Platform versions antérieures à 3.1.4 | ||
| VMware | Tanzu Platform | Elastic Application Runtime pour VMware Tanzu Platform versions antérieures à 10.2.4+LTS-T | ||
| VMware | Tanzu Platform | Isolation Segmentation pour VMware Tanzu Platform versions antérieures à 6.0.21+LTS-T | ||
| VMware | Tanzu Platform | .NET Core Buildpack versions antérieures à 2.4.64 | ||
| VMware | Tanzu Platform | VMware Tanzu Data Flow sur Tanzu Platform versions antérieures à 2.0.0 | ||
| VMware | Tanzu Platform | Isolation Segmentation pour VMware Tanzu Platform versions antérieures à 10.2.4 | ||
| VMware | Tanzu Platform | CredHub Secrets Management pour VMware Tanzu Platform versions antérieures à 1.6.7 | ||
| VMware | Tanzu Platform | Extended App Support pour Tanzu Platform versions antérieures à 1.0.8 | ||
| VMware | Tanzu Platform | Go Buildpack versions antérieures à 1.10.57 | ||
| VMware | Tanzu Platform | VMware Tanzu RabbitMQ sur Tanzu Platform versions antérieures à 10.1.0 | ||
| VMware | Tanzu Platform | NodeJS Buildpack versions antérieures à 1.8.61 | ||
| VMware | Tanzu Platform | Foundation Core pour VMware Tanzu Platform versions antérieures à 3.2.0 | ||
| VMware | Tanzu Platform | Application Services pour VMware Tanzu Platform versions antérieures à 3.3.11 | ||
| VMware | Tanzu Platform | IPsec Encryption pour VMware Tanzu Platform versions antérieures à 1.9.68 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "File Integrity Monitoring pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 2.1.49",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Cloud Service Broker pour Azure pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 1.13.1",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "AI Services pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 10.3.0",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Scheduler pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 2.0.21",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Foundation Core pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 3.1.4",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Elastic Application Runtime pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 10.2.4+LTS-T",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Isolation Segmentation pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 6.0.21+LTS-T",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": ".NET Core Buildpack versions ant\u00e9rieures \u00e0 2.4.64",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "VMware Tanzu Data Flow sur Tanzu Platform versions ant\u00e9rieures \u00e0 2.0.0",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Isolation Segmentation pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 10.2.4",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "CredHub Secrets Management pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 1.6.7",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Extended App Support pour Tanzu Platform versions ant\u00e9rieures \u00e0 1.0.8",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Go Buildpack versions ant\u00e9rieures \u00e0 1.10.57",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "VMware Tanzu RabbitMQ sur Tanzu Platform versions ant\u00e9rieures \u00e0 10.1.0",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "NodeJS Buildpack versions ant\u00e9rieures \u00e0 1.8.61",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Foundation Core pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Application Services pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 3.3.11",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "IPsec Encryption pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 1.9.68",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-1343",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1343"
},
{
"name": "CVE-2025-8715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8715"
},
{
"name": "CVE-2025-30681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30681"
},
{
"name": "CVE-2023-0216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0216"
},
{
"name": "CVE-2024-20919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20919"
},
{
"name": "CVE-2022-1473",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1473"
},
{
"name": "CVE-2023-21938",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21938"
},
{
"name": "CVE-2023-40217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40217"
},
{
"name": "CVE-2020-14621",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14621"
},
{
"name": "CVE-2023-0401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0401"
},
{
"name": "CVE-2025-59830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59830"
},
{
"name": "CVE-2023-21843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21843"
},
{
"name": "CVE-2024-36138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36138"
},
{
"name": "CVE-2020-2803",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2803"
},
{
"name": "CVE-2024-21235",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21235"
},
{
"name": "CVE-2025-30689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30689"
},
{
"name": "CVE-2024-11168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11168"
},
{
"name": "CVE-2025-9231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9231"
},
{
"name": "CVE-2022-21426",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21426"
},
{
"name": "CVE-2024-22020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22020"
},
{
"name": "CVE-2025-30715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30715"
},
{
"name": "CVE-2025-30682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30682"
},
{
"name": "CVE-2021-35586",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35586"
},
{
"name": "CVE-2025-25186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25186"
},
{
"name": "CVE-2025-50102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50102"
},
{
"name": "CVE-2025-55248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55248"
},
{
"name": "CVE-2024-21144",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21144"
},
{
"name": "CVE-2021-35550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35550"
},
{
"name": "CVE-2025-22872",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22872"
},
{
"name": "CVE-2021-35567",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35567"
},
{
"name": "CVE-2020-14579",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14579"
},
{
"name": "CVE-2025-50100",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50100"
},
{
"name": "CVE-2023-21954",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21954"
},
{
"name": "CVE-2022-4304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4304"
},
{
"name": "CVE-2023-21939",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21939"
},
{
"name": "CVE-2024-20926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20926"
},
{
"name": "CVE-2025-0913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0913"
},
{
"name": "CVE-2021-2163",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-2163"
},
{
"name": "CVE-2024-21890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21890"
},
{
"name": "CVE-2024-21896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21896"
},
{
"name": "CVE-2025-47907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47907"
},
{
"name": "CVE-2025-40026",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40026"
},
{
"name": "CVE-2022-1292",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1292"
},
{
"name": "CVE-2024-21068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21068"
},
{
"name": "CVE-2024-7409",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7409"
},
{
"name": "CVE-2025-30703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30703"
},
{
"name": "CVE-2023-21830",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21830"
},
{
"name": "CVE-2021-2161",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-2161"
},
{
"name": "CVE-2025-6069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6069"
},
{
"name": "CVE-2021-2341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-2341"
},
{
"name": "CVE-2024-6232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6232"
},
{
"name": "CVE-2025-50080",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50080"
},
{
"name": "CVE-2024-6505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6505"
},
{
"name": "CVE-2025-4330",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4330"
},
{
"name": "CVE-2020-14593",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14593"
},
{
"name": "CVE-2025-50078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50078"
},
{
"name": "CVE-2020-14664",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14664"
},
{
"name": "CVE-2024-9287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9287"
},
{
"name": "CVE-2025-4138",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4138"
},
{
"name": "CVE-2020-14797",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14797"
},
{
"name": "CVE-2023-0215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0215"
},
{
"name": "CVE-2023-36632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36632"
},
{
"name": "CVE-2020-14798",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14798"
},
{
"name": "CVE-2023-0286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0286"
},
{
"name": "CVE-2024-43484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43484"
},
{
"name": "CVE-2025-24293",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24293"
},
{
"name": "CVE-2025-30696",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30696"
},
{
"name": "CVE-2025-55752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55752"
},
{
"name": "CVE-2022-21299",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21299"
},
{
"name": "CVE-2020-2773",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2773"
},
{
"name": "CVE-2024-22025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22025"
},
{
"name": "CVE-2024-20921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20921"
},
{
"name": "CVE-2020-14578",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14578"
},
{
"name": "CVE-2025-21584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21584"
},
{
"name": "CVE-2020-2805",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2805"
},
{
"name": "CVE-2025-58767",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58767"
},
{
"name": "CVE-2023-4807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4807"
},
{
"name": "CVE-2024-45341",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45341"
},
{
"name": "CVE-2020-2830",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2830"
},
{
"name": "CVE-2025-54798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54798"
},
{
"name": "CVE-2022-21624",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21624"
},
{
"name": "CVE-2020-2781",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2781"
},
{
"name": "CVE-2022-21305",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21305"
},
{
"name": "CVE-2020-14556",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14556"
},
{
"name": "CVE-2025-50085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50085"
},
{
"name": "CVE-2020-14792",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14792"
},
{
"name": "CVE-2023-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44487"
},
{
"name": "CVE-2025-41248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41248"
},
{
"name": "CVE-2024-3447",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3447"
},
{
"name": "CVE-2022-2068",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2068"
},
{
"name": "CVE-2022-21271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21271"
},
{
"name": "CVE-2025-61919",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61919"
},
{
"name": "CVE-2022-40897",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40897"
},
{
"name": "CVE-2025-0938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0938"
},
{
"name": "CVE-2025-27210",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27210"
},
{
"name": "CVE-2025-61771",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61771"
},
{
"name": "CVE-2025-61770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61770"
},
{
"name": "CVE-2023-22081",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-22081"
},
{
"name": "CVE-2022-4203",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4203"
},
{
"name": "CVE-2025-50106",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50106"
},
{
"name": "CVE-2023-46809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46809"
},
{
"name": "CVE-2024-21510",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21510"
},
{
"name": "CVE-2022-21626",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21626"
},
{
"name": "CVE-2025-58057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58057"
},
{
"name": "CVE-2025-8291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8291"
},
{
"name": "CVE-2020-14781",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14781"
},
{
"name": "CVE-2025-30683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30683"
},
{
"name": "CVE-2025-30699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30699"
},
{
"name": "CVE-2025-61921",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61921"
},
{
"name": "CVE-2025-22866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22866"
},
{
"name": "CVE-2025-30754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30754"
},
{
"name": "CVE-2024-38229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38229"
},
{
"name": "CVE-2025-47910",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47910"
},
{
"name": "CVE-2025-23167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23167"
},
{
"name": "CVE-2023-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27043"
},
{
"name": "CVE-2024-43483",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43483"
},
{
"name": "CVE-2025-50094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50094"
},
{
"name": "CVE-2021-35559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35559"
},
{
"name": "CVE-2023-0217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0217"
},
{
"name": "CVE-2024-58266",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58266"
},
{
"name": "CVE-2025-50098",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50098"
},
{
"name": "CVE-2022-21291",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21291"
},
{
"name": "CVE-2025-50086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50086"
},
{
"name": "CVE-2022-3786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3786"
},
{
"name": "CVE-2023-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38552"
},
{
"name": "CVE-2021-35565",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35565"
},
{
"name": "CVE-2025-47906",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47906"
},
{
"name": "CVE-2025-58446",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58446"
},
{
"name": "CVE-2025-8194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8194"
},
{
"name": "CVE-2024-3446",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3446"
},
{
"name": "CVE-2025-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50082"
},
{
"name": "CVE-2025-40027",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40027"
},
{
"name": "CVE-2025-50097",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50097"
},
{
"name": "CVE-2025-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50181"
},
{
"name": "CVE-2025-50084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50084"
},
{
"name": "CVE-2025-50079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50079"
},
{
"name": "CVE-2025-1795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1795"
},
{
"name": "CVE-2021-35603",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35603"
},
{
"name": "CVE-2023-22067",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-22067"
},
{
"name": "CVE-2025-4517",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4517"
},
{
"name": "CVE-2025-55193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55193"
},
{
"name": "CVE-2025-21574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21574"
},
{
"name": "CVE-2024-22019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22019"
},
{
"name": "CVE-2025-4674",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4674"
},
{
"name": "CVE-2020-2754",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2754"
},
{
"name": "CVE-2020-14796",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14796"
},
{
"name": "CVE-2025-21580",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21580"
},
{
"name": "CVE-2022-29526",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29526"
},
{
"name": "CVE-2025-55754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55754"
},
{
"name": "CVE-2025-53023",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53023"
},
{
"name": "CVE-2025-21575",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21575"
},
{
"name": "CVE-2025-4435",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4435"
},
{
"name": "CVE-2025-21577",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21577"
},
{
"name": "CVE-2022-21628",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21628"
},
{
"name": "CVE-2024-4467",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4467"
},
{
"name": "CVE-2024-21011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21011"
},
{
"name": "CVE-2024-45336",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45336"
},
{
"name": "CVE-2021-2369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-2369"
},
{
"name": "CVE-2025-22868",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22868"
},
{
"name": "CVE-2024-12718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12718"
},
{
"name": "CVE-2024-27983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27983"
},
{
"name": "CVE-2025-23085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23085"
},
{
"name": "CVE-2024-0450",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0450"
},
{
"name": "CVE-2024-5642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5642"
},
{
"name": "CVE-2025-59425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59425"
},
{
"name": "CVE-2024-3219",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3219"
},
{
"name": "CVE-2025-50096",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50096"
},
{
"name": "CVE-2024-47554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47554"
},
{
"name": "CVE-2025-9232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9232"
},
{
"name": "CVE-2025-23165",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23165"
},
{
"name": "CVE-2023-30584",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-30584"
},
{
"name": "CVE-2025-61795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61795"
},
{
"name": "CVE-2025-30705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30705"
},
{
"name": "CVE-2025-8713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8713"
},
{
"name": "CVE-2025-21587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21587"
},
{
"name": "CVE-2025-50088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50088"
},
{
"name": "CVE-2024-21892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21892"
},
{
"name": "CVE-2024-45337",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45337"
},
{
"name": "CVE-2024-21147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21147"
},
{
"name": "CVE-2024-27982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27982"
},
{
"name": "CVE-2020-14581",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14581"
},
{
"name": "CVE-2024-37372",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37372"
},
{
"name": "CVE-2025-50077",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50077"
},
{
"name": "CVE-2025-23083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23083"
},
{
"name": "CVE-2021-2388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-2388"
},
{
"name": "CVE-2025-50092",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50092"
},
{
"name": "CVE-2025-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50099"
},
{
"name": "CVE-2021-35588",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35588"
},
{
"name": "CVE-2025-41244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41244"
},
{
"name": "CVE-2024-21140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21140"
},
{
"name": "CVE-2025-30684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30684"
},
{
"name": "CVE-2024-21094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21094"
},
{
"name": "CVE-2025-48989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48989"
},
{
"name": "CVE-2022-21365",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21365"
},
{
"name": "CVE-2025-50093",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50093"
},
{
"name": "CVE-2025-22874",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22874"
},
{
"name": "CVE-2020-14782",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14782"
},
{
"name": "CVE-2025-50059",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50059"
},
{
"name": "CVE-2025-21579",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21579"
},
{
"name": "CVE-2023-21937",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21937"
},
{
"name": "CVE-2025-30761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30761"
},
{
"name": "CVE-2025-50087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50087"
},
{
"name": "CVE-2024-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47535"
},
{
"name": "CVE-2022-4450",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4450"
},
{
"name": "CVE-2024-7592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7592"
},
{
"name": "CVE-2023-2650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2650"
},
{
"name": "CVE-2022-21434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21434"
},
{
"name": "CVE-2025-54410",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54410"
},
{
"name": "CVE-2023-52970",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52970"
},
{
"name": "CVE-2022-3996",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3996"
},
{
"name": "CVE-2025-52434",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52434"
},
{
"name": "CVE-2022-21294",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21294"
},
{
"name": "CVE-2025-30698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30698"
},
{
"name": "CVE-2020-2755",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2755"
},
{
"name": "CVE-2025-8714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8714"
},
{
"name": "CVE-2024-43485",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43485"
},
{
"name": "CVE-2020-14779",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14779"
},
{
"name": "CVE-2025-4673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4673"
},
{
"name": "CVE-2023-22045",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-22045"
},
{
"name": "CVE-2025-30721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30721"
},
{
"name": "CVE-2025-58056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58056"
},
{
"name": "CVE-2025-22871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22871"
},
{
"name": "CVE-2024-21138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21138"
},
{
"name": "CVE-2025-50091",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50091"
},
{
"name": "CVE-2024-22018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22018"
},
{
"name": "CVE-2023-22049",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-22049"
},
{
"name": "CVE-2022-21341",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21341"
},
{
"name": "CVE-2025-23166",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23166"
},
{
"name": "CVE-2021-35578",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35578"
},
{
"name": "CVE-2024-0397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0397"
},
{
"name": "CVE-2020-14583",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14583"
},
{
"name": "CVE-2022-21340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21340"
},
{
"name": "CVE-2024-12254",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12254"
},
{
"name": "CVE-2025-4516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4516"
},
{
"name": "CVE-2025-22869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22869"
},
{
"name": "CVE-2022-3358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3358"
},
{
"name": "CVE-2022-21293",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21293"
},
{
"name": "CVE-2022-2097",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2097"
},
{
"name": "CVE-2025-50104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50104"
},
{
"name": "CVE-2020-2800",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2800"
},
{
"name": "CVE-2025-6242",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6242"
},
{
"name": "CVE-2025-61772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61772"
},
{
"name": "CVE-2025-30722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30722"
},
{
"name": "CVE-2024-21145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21145"
},
{
"name": "CVE-2022-21282",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21282"
},
{
"name": "CVE-2022-21349",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21349"
},
{
"name": "CVE-2024-50602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50602"
},
{
"name": "CVE-2024-21891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21891"
},
{
"name": "CVE-2025-22870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22870"
},
{
"name": "CVE-2025-30687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30687"
},
{
"name": "CVE-2023-21968",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21968"
},
{
"name": "CVE-2025-50101",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50101"
},
{
"name": "CVE-2025-30749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30749"
},
{
"name": "CVE-2025-61748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61748"
},
{
"name": "CVE-2025-4207",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4207"
},
{
"name": "CVE-2025-9230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9230"
},
{
"name": "CVE-2025-27789",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27789"
},
{
"name": "CVE-2022-21248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21248"
},
{
"name": "CVE-2023-21930",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21930"
},
{
"name": "CVE-2024-22017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22017"
},
{
"name": "CVE-2025-8916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8916"
},
{
"name": "CVE-2025-8885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8885"
},
{
"name": "CVE-2024-20918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20918"
},
{
"name": "CVE-2025-41249",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41249"
},
{
"name": "CVE-2025-30704",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30704"
},
{
"name": "CVE-2021-35564",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35564"
},
{
"name": "CVE-2023-52969",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52969"
},
{
"name": "CVE-2025-46551",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-46551"
},
{
"name": "CVE-2025-30693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30693"
},
{
"name": "CVE-2025-21585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21585"
},
{
"name": "CVE-2025-53506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53506"
},
{
"name": "CVE-2025-23084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23084"
},
{
"name": "CVE-2022-3602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3602"
},
{
"name": "CVE-2025-1094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1094"
},
{
"name": "CVE-2022-1434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1434"
},
{
"name": "CVE-2020-2757",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2757"
},
{
"name": "CVE-2025-53864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53864"
},
{
"name": "CVE-2024-4032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4032"
},
{
"name": "CVE-2025-40025",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40025"
},
{
"name": "CVE-2025-61620",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61620"
},
{
"name": "CVE-2021-35556",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35556"
},
{
"name": "CVE-2024-8244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8244"
},
{
"name": "CVE-2024-21085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21085"
},
{
"name": "CVE-2025-21502",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21502"
},
{
"name": "CVE-2023-39331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39331"
},
{
"name": "CVE-2025-55315",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55315"
},
{
"name": "CVE-2021-35560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35560"
},
{
"name": "CVE-2025-21581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21581"
},
{
"name": "CVE-2024-20945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20945"
},
{
"name": "CVE-2025-58754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58754"
},
{
"name": "CVE-2024-21131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21131"
},
{
"name": "CVE-2025-41242",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41242"
},
{
"name": "CVE-2024-21210",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21210"
},
{
"name": "CVE-2025-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53057"
},
{
"name": "CVE-2023-39332",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39332"
},
{
"name": "CVE-2020-2756",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2756"
},
{
"name": "CVE-2024-27980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27980"
},
{
"name": "CVE-2023-21967",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21967"
},
{
"name": "CVE-2025-30685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30685"
},
{
"name": "CVE-2023-39333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39333"
},
{
"name": "CVE-2022-21619",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21619"
},
{
"name": "CVE-2025-30695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30695"
},
{
"name": "CVE-2025-30688",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30688"
},
{
"name": "CVE-2023-5752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5752"
},
{
"name": "CVE-2025-61780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61780"
},
{
"name": "CVE-2021-35561",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35561"
},
{
"name": "CVE-2022-21476",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21476"
},
{
"name": "CVE-2025-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53066"
},
{
"name": "CVE-2024-21217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21217"
},
{
"name": "CVE-2023-6597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6597"
},
{
"name": "CVE-2024-20952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20952"
},
{
"name": "CVE-2022-21541",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21541"
},
{
"name": "CVE-2025-27221",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27221"
},
{
"name": "CVE-2022-21360",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21360"
},
{
"name": "CVE-2022-21296",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21296"
},
{
"name": "CVE-2022-21540",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21540"
},
{
"name": "CVE-2025-50083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50083"
},
{
"name": "CVE-2024-21208",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21208"
},
{
"name": "CVE-2024-36137",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36137"
},
{
"name": "CVE-2020-14577",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14577"
},
{
"name": "CVE-2025-49014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49014"
},
{
"name": "CVE-2024-6923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6923"
},
{
"name": "CVE-2024-8088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8088"
}
],
"initial_release_date": "2025-11-05T00:00:00",
"last_revision_date": "2025-11-05T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0967",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-11-05T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits VMware. Elles permettent \u00e0 un attaquant de provoquer un probl\u00e8me de s\u00e9curit\u00e9 non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits VMware",
"vendor_advisories": [
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36323",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36323"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36343",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36343"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-99",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36326"
},
{
"published_at": "2025-11-04",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36305",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36305"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36345",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36345"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-53",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36329"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-81",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36316"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2024-41",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36331"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36334",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36334"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36335",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36335"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36340",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36340"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36319",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36319"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36339",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36339"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36322",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36322"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36321",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36321"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-68",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36324"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36336",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36336"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36318",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36318"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36337",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36337"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36346",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36346"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-81",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36315"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36317",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36317"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36344",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36344"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36341",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36341"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36314",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36314"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2024-41",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36330"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36332",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36332"
},
{
"published_at": "2025-11-04",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36304",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36304"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36342",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36342"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36333",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36333"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-99",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36327"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36338",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36338"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-53",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36328"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-68",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36325"
}
]
}
CERTFR-2025-AVI-0967
Vulnerability from certfr_avis - Published: 2025-11-05 - Updated: 2025-11-05
De multiples vulnérabilités ont été découvertes dans les produits VMware. Elles permettent à un attaquant de provoquer un problème de sécurité non spécifié par l'éditeur.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| VMware | Tanzu Platform | File Integrity Monitoring pour VMware Tanzu Platform versions antérieures à 2.1.49 | ||
| VMware | Tanzu Platform | Cloud Service Broker pour Azure pour VMware Tanzu Platform versions antérieures à 1.13.1 | ||
| VMware | Tanzu Platform | AI Services pour VMware Tanzu Platform versions antérieures à 10.3.0 | ||
| VMware | Tanzu Platform | Scheduler pour VMware Tanzu Platform versions antérieures à 2.0.21 | ||
| VMware | Tanzu Platform | Foundation Core pour VMware Tanzu Platform versions antérieures à 3.1.4 | ||
| VMware | Tanzu Platform | Elastic Application Runtime pour VMware Tanzu Platform versions antérieures à 10.2.4+LTS-T | ||
| VMware | Tanzu Platform | Isolation Segmentation pour VMware Tanzu Platform versions antérieures à 6.0.21+LTS-T | ||
| VMware | Tanzu Platform | .NET Core Buildpack versions antérieures à 2.4.64 | ||
| VMware | Tanzu Platform | VMware Tanzu Data Flow sur Tanzu Platform versions antérieures à 2.0.0 | ||
| VMware | Tanzu Platform | Isolation Segmentation pour VMware Tanzu Platform versions antérieures à 10.2.4 | ||
| VMware | Tanzu Platform | CredHub Secrets Management pour VMware Tanzu Platform versions antérieures à 1.6.7 | ||
| VMware | Tanzu Platform | Extended App Support pour Tanzu Platform versions antérieures à 1.0.8 | ||
| VMware | Tanzu Platform | Go Buildpack versions antérieures à 1.10.57 | ||
| VMware | Tanzu Platform | VMware Tanzu RabbitMQ sur Tanzu Platform versions antérieures à 10.1.0 | ||
| VMware | Tanzu Platform | NodeJS Buildpack versions antérieures à 1.8.61 | ||
| VMware | Tanzu Platform | Foundation Core pour VMware Tanzu Platform versions antérieures à 3.2.0 | ||
| VMware | Tanzu Platform | Application Services pour VMware Tanzu Platform versions antérieures à 3.3.11 | ||
| VMware | Tanzu Platform | IPsec Encryption pour VMware Tanzu Platform versions antérieures à 1.9.68 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "File Integrity Monitoring pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 2.1.49",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Cloud Service Broker pour Azure pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 1.13.1",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "AI Services pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 10.3.0",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Scheduler pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 2.0.21",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Foundation Core pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 3.1.4",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Elastic Application Runtime pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 10.2.4+LTS-T",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Isolation Segmentation pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 6.0.21+LTS-T",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": ".NET Core Buildpack versions ant\u00e9rieures \u00e0 2.4.64",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "VMware Tanzu Data Flow sur Tanzu Platform versions ant\u00e9rieures \u00e0 2.0.0",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Isolation Segmentation pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 10.2.4",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "CredHub Secrets Management pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 1.6.7",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Extended App Support pour Tanzu Platform versions ant\u00e9rieures \u00e0 1.0.8",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Go Buildpack versions ant\u00e9rieures \u00e0 1.10.57",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "VMware Tanzu RabbitMQ sur Tanzu Platform versions ant\u00e9rieures \u00e0 10.1.0",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "NodeJS Buildpack versions ant\u00e9rieures \u00e0 1.8.61",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Foundation Core pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Application Services pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 3.3.11",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "IPsec Encryption pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 1.9.68",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-1343",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1343"
},
{
"name": "CVE-2025-8715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8715"
},
{
"name": "CVE-2025-30681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30681"
},
{
"name": "CVE-2023-0216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0216"
},
{
"name": "CVE-2024-20919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20919"
},
{
"name": "CVE-2022-1473",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1473"
},
{
"name": "CVE-2023-21938",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21938"
},
{
"name": "CVE-2023-40217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40217"
},
{
"name": "CVE-2020-14621",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14621"
},
{
"name": "CVE-2023-0401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0401"
},
{
"name": "CVE-2025-59830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59830"
},
{
"name": "CVE-2023-21843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21843"
},
{
"name": "CVE-2024-36138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36138"
},
{
"name": "CVE-2020-2803",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2803"
},
{
"name": "CVE-2024-21235",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21235"
},
{
"name": "CVE-2025-30689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30689"
},
{
"name": "CVE-2024-11168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11168"
},
{
"name": "CVE-2025-9231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9231"
},
{
"name": "CVE-2022-21426",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21426"
},
{
"name": "CVE-2024-22020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22020"
},
{
"name": "CVE-2025-30715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30715"
},
{
"name": "CVE-2025-30682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30682"
},
{
"name": "CVE-2021-35586",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35586"
},
{
"name": "CVE-2025-25186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25186"
},
{
"name": "CVE-2025-50102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50102"
},
{
"name": "CVE-2025-55248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55248"
},
{
"name": "CVE-2024-21144",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21144"
},
{
"name": "CVE-2021-35550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35550"
},
{
"name": "CVE-2025-22872",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22872"
},
{
"name": "CVE-2021-35567",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35567"
},
{
"name": "CVE-2020-14579",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14579"
},
{
"name": "CVE-2025-50100",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50100"
},
{
"name": "CVE-2023-21954",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21954"
},
{
"name": "CVE-2022-4304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4304"
},
{
"name": "CVE-2023-21939",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21939"
},
{
"name": "CVE-2024-20926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20926"
},
{
"name": "CVE-2025-0913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0913"
},
{
"name": "CVE-2021-2163",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-2163"
},
{
"name": "CVE-2024-21890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21890"
},
{
"name": "CVE-2024-21896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21896"
},
{
"name": "CVE-2025-47907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47907"
},
{
"name": "CVE-2025-40026",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40026"
},
{
"name": "CVE-2022-1292",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1292"
},
{
"name": "CVE-2024-21068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21068"
},
{
"name": "CVE-2024-7409",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7409"
},
{
"name": "CVE-2025-30703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30703"
},
{
"name": "CVE-2023-21830",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21830"
},
{
"name": "CVE-2021-2161",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-2161"
},
{
"name": "CVE-2025-6069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6069"
},
{
"name": "CVE-2021-2341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-2341"
},
{
"name": "CVE-2024-6232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6232"
},
{
"name": "CVE-2025-50080",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50080"
},
{
"name": "CVE-2024-6505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6505"
},
{
"name": "CVE-2025-4330",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4330"
},
{
"name": "CVE-2020-14593",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14593"
},
{
"name": "CVE-2025-50078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50078"
},
{
"name": "CVE-2020-14664",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14664"
},
{
"name": "CVE-2024-9287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9287"
},
{
"name": "CVE-2025-4138",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4138"
},
{
"name": "CVE-2020-14797",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14797"
},
{
"name": "CVE-2023-0215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0215"
},
{
"name": "CVE-2023-36632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36632"
},
{
"name": "CVE-2020-14798",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14798"
},
{
"name": "CVE-2023-0286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0286"
},
{
"name": "CVE-2024-43484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43484"
},
{
"name": "CVE-2025-24293",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24293"
},
{
"name": "CVE-2025-30696",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30696"
},
{
"name": "CVE-2025-55752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55752"
},
{
"name": "CVE-2022-21299",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21299"
},
{
"name": "CVE-2020-2773",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2773"
},
{
"name": "CVE-2024-22025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22025"
},
{
"name": "CVE-2024-20921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20921"
},
{
"name": "CVE-2020-14578",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14578"
},
{
"name": "CVE-2025-21584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21584"
},
{
"name": "CVE-2020-2805",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2805"
},
{
"name": "CVE-2025-58767",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58767"
},
{
"name": "CVE-2023-4807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4807"
},
{
"name": "CVE-2024-45341",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45341"
},
{
"name": "CVE-2020-2830",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2830"
},
{
"name": "CVE-2025-54798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54798"
},
{
"name": "CVE-2022-21624",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21624"
},
{
"name": "CVE-2020-2781",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2781"
},
{
"name": "CVE-2022-21305",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21305"
},
{
"name": "CVE-2020-14556",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14556"
},
{
"name": "CVE-2025-50085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50085"
},
{
"name": "CVE-2020-14792",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14792"
},
{
"name": "CVE-2023-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44487"
},
{
"name": "CVE-2025-41248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41248"
},
{
"name": "CVE-2024-3447",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3447"
},
{
"name": "CVE-2022-2068",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2068"
},
{
"name": "CVE-2022-21271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21271"
},
{
"name": "CVE-2025-61919",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61919"
},
{
"name": "CVE-2022-40897",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40897"
},
{
"name": "CVE-2025-0938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0938"
},
{
"name": "CVE-2025-27210",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27210"
},
{
"name": "CVE-2025-61771",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61771"
},
{
"name": "CVE-2025-61770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61770"
},
{
"name": "CVE-2023-22081",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-22081"
},
{
"name": "CVE-2022-4203",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4203"
},
{
"name": "CVE-2025-50106",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50106"
},
{
"name": "CVE-2023-46809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46809"
},
{
"name": "CVE-2024-21510",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21510"
},
{
"name": "CVE-2022-21626",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21626"
},
{
"name": "CVE-2025-58057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58057"
},
{
"name": "CVE-2025-8291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8291"
},
{
"name": "CVE-2020-14781",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14781"
},
{
"name": "CVE-2025-30683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30683"
},
{
"name": "CVE-2025-30699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30699"
},
{
"name": "CVE-2025-61921",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61921"
},
{
"name": "CVE-2025-22866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22866"
},
{
"name": "CVE-2025-30754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30754"
},
{
"name": "CVE-2024-38229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38229"
},
{
"name": "CVE-2025-47910",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47910"
},
{
"name": "CVE-2025-23167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23167"
},
{
"name": "CVE-2023-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27043"
},
{
"name": "CVE-2024-43483",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43483"
},
{
"name": "CVE-2025-50094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50094"
},
{
"name": "CVE-2021-35559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35559"
},
{
"name": "CVE-2023-0217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0217"
},
{
"name": "CVE-2024-58266",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58266"
},
{
"name": "CVE-2025-50098",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50098"
},
{
"name": "CVE-2022-21291",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21291"
},
{
"name": "CVE-2025-50086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50086"
},
{
"name": "CVE-2022-3786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3786"
},
{
"name": "CVE-2023-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38552"
},
{
"name": "CVE-2021-35565",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35565"
},
{
"name": "CVE-2025-47906",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47906"
},
{
"name": "CVE-2025-58446",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58446"
},
{
"name": "CVE-2025-8194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8194"
},
{
"name": "CVE-2024-3446",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3446"
},
{
"name": "CVE-2025-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50082"
},
{
"name": "CVE-2025-40027",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40027"
},
{
"name": "CVE-2025-50097",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50097"
},
{
"name": "CVE-2025-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50181"
},
{
"name": "CVE-2025-50084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50084"
},
{
"name": "CVE-2025-50079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50079"
},
{
"name": "CVE-2025-1795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1795"
},
{
"name": "CVE-2021-35603",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35603"
},
{
"name": "CVE-2023-22067",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-22067"
},
{
"name": "CVE-2025-4517",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4517"
},
{
"name": "CVE-2025-55193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55193"
},
{
"name": "CVE-2025-21574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21574"
},
{
"name": "CVE-2024-22019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22019"
},
{
"name": "CVE-2025-4674",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4674"
},
{
"name": "CVE-2020-2754",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2754"
},
{
"name": "CVE-2020-14796",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14796"
},
{
"name": "CVE-2025-21580",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21580"
},
{
"name": "CVE-2022-29526",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29526"
},
{
"name": "CVE-2025-55754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55754"
},
{
"name": "CVE-2025-53023",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53023"
},
{
"name": "CVE-2025-21575",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21575"
},
{
"name": "CVE-2025-4435",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4435"
},
{
"name": "CVE-2025-21577",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21577"
},
{
"name": "CVE-2022-21628",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21628"
},
{
"name": "CVE-2024-4467",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4467"
},
{
"name": "CVE-2024-21011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21011"
},
{
"name": "CVE-2024-45336",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45336"
},
{
"name": "CVE-2021-2369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-2369"
},
{
"name": "CVE-2025-22868",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22868"
},
{
"name": "CVE-2024-12718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12718"
},
{
"name": "CVE-2024-27983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27983"
},
{
"name": "CVE-2025-23085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23085"
},
{
"name": "CVE-2024-0450",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0450"
},
{
"name": "CVE-2024-5642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5642"
},
{
"name": "CVE-2025-59425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59425"
},
{
"name": "CVE-2024-3219",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3219"
},
{
"name": "CVE-2025-50096",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50096"
},
{
"name": "CVE-2024-47554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47554"
},
{
"name": "CVE-2025-9232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9232"
},
{
"name": "CVE-2025-23165",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23165"
},
{
"name": "CVE-2023-30584",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-30584"
},
{
"name": "CVE-2025-61795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61795"
},
{
"name": "CVE-2025-30705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30705"
},
{
"name": "CVE-2025-8713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8713"
},
{
"name": "CVE-2025-21587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21587"
},
{
"name": "CVE-2025-50088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50088"
},
{
"name": "CVE-2024-21892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21892"
},
{
"name": "CVE-2024-45337",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45337"
},
{
"name": "CVE-2024-21147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21147"
},
{
"name": "CVE-2024-27982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27982"
},
{
"name": "CVE-2020-14581",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14581"
},
{
"name": "CVE-2024-37372",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37372"
},
{
"name": "CVE-2025-50077",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50077"
},
{
"name": "CVE-2025-23083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23083"
},
{
"name": "CVE-2021-2388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-2388"
},
{
"name": "CVE-2025-50092",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50092"
},
{
"name": "CVE-2025-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50099"
},
{
"name": "CVE-2021-35588",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35588"
},
{
"name": "CVE-2025-41244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41244"
},
{
"name": "CVE-2024-21140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21140"
},
{
"name": "CVE-2025-30684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30684"
},
{
"name": "CVE-2024-21094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21094"
},
{
"name": "CVE-2025-48989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48989"
},
{
"name": "CVE-2022-21365",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21365"
},
{
"name": "CVE-2025-50093",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50093"
},
{
"name": "CVE-2025-22874",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22874"
},
{
"name": "CVE-2020-14782",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14782"
},
{
"name": "CVE-2025-50059",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50059"
},
{
"name": "CVE-2025-21579",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21579"
},
{
"name": "CVE-2023-21937",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21937"
},
{
"name": "CVE-2025-30761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30761"
},
{
"name": "CVE-2025-50087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50087"
},
{
"name": "CVE-2024-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47535"
},
{
"name": "CVE-2022-4450",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4450"
},
{
"name": "CVE-2024-7592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7592"
},
{
"name": "CVE-2023-2650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2650"
},
{
"name": "CVE-2022-21434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21434"
},
{
"name": "CVE-2025-54410",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54410"
},
{
"name": "CVE-2023-52970",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52970"
},
{
"name": "CVE-2022-3996",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3996"
},
{
"name": "CVE-2025-52434",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52434"
},
{
"name": "CVE-2022-21294",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21294"
},
{
"name": "CVE-2025-30698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30698"
},
{
"name": "CVE-2020-2755",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2755"
},
{
"name": "CVE-2025-8714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8714"
},
{
"name": "CVE-2024-43485",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43485"
},
{
"name": "CVE-2020-14779",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14779"
},
{
"name": "CVE-2025-4673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4673"
},
{
"name": "CVE-2023-22045",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-22045"
},
{
"name": "CVE-2025-30721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30721"
},
{
"name": "CVE-2025-58056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58056"
},
{
"name": "CVE-2025-22871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22871"
},
{
"name": "CVE-2024-21138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21138"
},
{
"name": "CVE-2025-50091",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50091"
},
{
"name": "CVE-2024-22018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22018"
},
{
"name": "CVE-2023-22049",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-22049"
},
{
"name": "CVE-2022-21341",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21341"
},
{
"name": "CVE-2025-23166",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23166"
},
{
"name": "CVE-2021-35578",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35578"
},
{
"name": "CVE-2024-0397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0397"
},
{
"name": "CVE-2020-14583",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14583"
},
{
"name": "CVE-2022-21340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21340"
},
{
"name": "CVE-2024-12254",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12254"
},
{
"name": "CVE-2025-4516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4516"
},
{
"name": "CVE-2025-22869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22869"
},
{
"name": "CVE-2022-3358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3358"
},
{
"name": "CVE-2022-21293",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21293"
},
{
"name": "CVE-2022-2097",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2097"
},
{
"name": "CVE-2025-50104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50104"
},
{
"name": "CVE-2020-2800",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2800"
},
{
"name": "CVE-2025-6242",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6242"
},
{
"name": "CVE-2025-61772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61772"
},
{
"name": "CVE-2025-30722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30722"
},
{
"name": "CVE-2024-21145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21145"
},
{
"name": "CVE-2022-21282",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21282"
},
{
"name": "CVE-2022-21349",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21349"
},
{
"name": "CVE-2024-50602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50602"
},
{
"name": "CVE-2024-21891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21891"
},
{
"name": "CVE-2025-22870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22870"
},
{
"name": "CVE-2025-30687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30687"
},
{
"name": "CVE-2023-21968",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21968"
},
{
"name": "CVE-2025-50101",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50101"
},
{
"name": "CVE-2025-30749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30749"
},
{
"name": "CVE-2025-61748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61748"
},
{
"name": "CVE-2025-4207",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4207"
},
{
"name": "CVE-2025-9230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9230"
},
{
"name": "CVE-2025-27789",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27789"
},
{
"name": "CVE-2022-21248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21248"
},
{
"name": "CVE-2023-21930",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21930"
},
{
"name": "CVE-2024-22017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22017"
},
{
"name": "CVE-2025-8916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8916"
},
{
"name": "CVE-2025-8885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8885"
},
{
"name": "CVE-2024-20918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20918"
},
{
"name": "CVE-2025-41249",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41249"
},
{
"name": "CVE-2025-30704",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30704"
},
{
"name": "CVE-2021-35564",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35564"
},
{
"name": "CVE-2023-52969",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52969"
},
{
"name": "CVE-2025-46551",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-46551"
},
{
"name": "CVE-2025-30693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30693"
},
{
"name": "CVE-2025-21585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21585"
},
{
"name": "CVE-2025-53506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53506"
},
{
"name": "CVE-2025-23084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23084"
},
{
"name": "CVE-2022-3602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3602"
},
{
"name": "CVE-2025-1094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1094"
},
{
"name": "CVE-2022-1434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1434"
},
{
"name": "CVE-2020-2757",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2757"
},
{
"name": "CVE-2025-53864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53864"
},
{
"name": "CVE-2024-4032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4032"
},
{
"name": "CVE-2025-40025",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40025"
},
{
"name": "CVE-2025-61620",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61620"
},
{
"name": "CVE-2021-35556",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35556"
},
{
"name": "CVE-2024-8244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8244"
},
{
"name": "CVE-2024-21085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21085"
},
{
"name": "CVE-2025-21502",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21502"
},
{
"name": "CVE-2023-39331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39331"
},
{
"name": "CVE-2025-55315",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55315"
},
{
"name": "CVE-2021-35560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35560"
},
{
"name": "CVE-2025-21581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21581"
},
{
"name": "CVE-2024-20945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20945"
},
{
"name": "CVE-2025-58754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58754"
},
{
"name": "CVE-2024-21131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21131"
},
{
"name": "CVE-2025-41242",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41242"
},
{
"name": "CVE-2024-21210",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21210"
},
{
"name": "CVE-2025-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53057"
},
{
"name": "CVE-2023-39332",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39332"
},
{
"name": "CVE-2020-2756",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2756"
},
{
"name": "CVE-2024-27980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27980"
},
{
"name": "CVE-2023-21967",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-21967"
},
{
"name": "CVE-2025-30685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30685"
},
{
"name": "CVE-2023-39333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39333"
},
{
"name": "CVE-2022-21619",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21619"
},
{
"name": "CVE-2025-30695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30695"
},
{
"name": "CVE-2025-30688",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30688"
},
{
"name": "CVE-2023-5752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5752"
},
{
"name": "CVE-2025-61780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61780"
},
{
"name": "CVE-2021-35561",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35561"
},
{
"name": "CVE-2022-21476",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21476"
},
{
"name": "CVE-2025-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53066"
},
{
"name": "CVE-2024-21217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21217"
},
{
"name": "CVE-2023-6597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6597"
},
{
"name": "CVE-2024-20952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20952"
},
{
"name": "CVE-2022-21541",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21541"
},
{
"name": "CVE-2025-27221",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27221"
},
{
"name": "CVE-2022-21360",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21360"
},
{
"name": "CVE-2022-21296",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21296"
},
{
"name": "CVE-2022-21540",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21540"
},
{
"name": "CVE-2025-50083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50083"
},
{
"name": "CVE-2024-21208",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21208"
},
{
"name": "CVE-2024-36137",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36137"
},
{
"name": "CVE-2020-14577",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14577"
},
{
"name": "CVE-2025-49014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49014"
},
{
"name": "CVE-2024-6923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6923"
},
{
"name": "CVE-2024-8088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8088"
}
],
"initial_release_date": "2025-11-05T00:00:00",
"last_revision_date": "2025-11-05T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0967",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-11-05T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits VMware. Elles permettent \u00e0 un attaquant de provoquer un probl\u00e8me de s\u00e9curit\u00e9 non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits VMware",
"vendor_advisories": [
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36323",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36323"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36343",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36343"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-99",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36326"
},
{
"published_at": "2025-11-04",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36305",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36305"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36345",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36345"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-53",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36329"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-81",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36316"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2024-41",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36331"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36334",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36334"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36335",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36335"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36340",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36340"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36319",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36319"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36339",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36339"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36322",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36322"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36321",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36321"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-68",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36324"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36336",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36336"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36318",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36318"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36337",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36337"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36346",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36346"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-81",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36315"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36317",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36317"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36344",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36344"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36341",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36341"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36314",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36314"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2024-41",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36330"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36332",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36332"
},
{
"published_at": "2025-11-04",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36304",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36304"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36342",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36342"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36333",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36333"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-99",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36327"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36338",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36338"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-53",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36328"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-68",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36325"
}
]
}
CERTFR-2026-AVI-0218
Vulnerability from certfr_avis - Published: 2026-02-26 - Updated: 2026-02-26
De multiples vulnérabilités ont été découvertes dans les produits VMware. Certaines d'entre elles permettent à un attaquant de provoquer un déni de service à distance, une atteinte à la confidentialité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| VMware | Tanzu Kubernetes Runtime | Platform Services pour Tanzu Platform versions antérieures à 10.3.5 | ||
| VMware | Tanzu Kubernetes Runtime | Tanzu Hub versions antérieures à 10.3.5 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 16.x antérieures à 16.12.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions antérieures à 4.3.2 sur Kubernetes | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 18.x antérieures à 18.2.0 | ||
| VMware | Tanzu Kubernetes Runtime | Stemcells (Ubuntu Noble) versions antérieures à 1.238.x | ||
| VMware | Workstation | Workstation versions antérieures à 25H2u1 | ||
| VMware | Fusion | Fusion versions antérieures à 25H2u1 sur MacOS | ||
| VMware | Tanzu Kubernetes Runtime | Stemcells (Ubuntu Jammy) versions antérieures à 1.1065.x | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 15.x antérieures à 15.16.0 | ||
| VMware | Tanzu Kubernetes Runtime | Stemcells (Windows) versions antérieures à 2019.95.x | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 17.x antérieures à 17.8.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions antérieures à 14.21.0 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Platform Services pour Tanzu Platform versions ant\u00e9rieures \u00e0 10.3.5",
"product": {
"name": "Tanzu Kubernetes Runtime",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu Hub versions ant\u00e9rieures \u00e0 10.3.5",
"product": {
"name": "Tanzu Kubernetes Runtime",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 16.x ant\u00e9rieures \u00e0 16.12.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions ant\u00e9rieures \u00e0 4.3.2 sur Kubernetes",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 18.x ant\u00e9rieures \u00e0 18.2.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Stemcells (Ubuntu Noble) versions ant\u00e9rieures \u00e0 1.238.x",
"product": {
"name": "Tanzu Kubernetes Runtime",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Workstation versions ant\u00e9rieures \u00e0 25H2u1",
"product": {
"name": "Workstation",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Fusion versions ant\u00e9rieures \u00e0 25H2u1 sur MacOS",
"product": {
"name": "Fusion",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Stemcells (Ubuntu Jammy) versions ant\u00e9rieures \u00e0 1.1065.x",
"product": {
"name": "Tanzu Kubernetes Runtime",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 15.x ant\u00e9rieures \u00e0 15.16.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Stemcells (Windows) versions ant\u00e9rieures \u00e0 2019.95.x",
"product": {
"name": "Tanzu Kubernetes Runtime",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 17.x ant\u00e9rieures \u00e0 17.8.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions ant\u00e9rieures \u00e0 14.21.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2019-25013",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-25013"
},
{
"name": "CVE-2017-9937",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-9937"
},
{
"name": "CVE-2025-6395",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6395"
},
{
"name": "CVE-2026-22722",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22722"
},
{
"name": "CVE-2023-52356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52356"
},
{
"name": "CVE-2013-4235",
"url": "https://www.cve.org/CVERecord?id=CVE-2013-4235"
},
{
"name": "CVE-2025-8715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8715"
},
{
"name": "CVE-2017-3613",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3613"
},
{
"name": "CVE-2021-22898",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22898"
},
{
"name": "CVE-2025-38490",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38490"
},
{
"name": "CVE-2025-37850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37850"
},
{
"name": "CVE-2025-66865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66865"
},
{
"name": "CVE-2022-35252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-35252"
},
{
"name": "CVE-2005-0602",
"url": "https://www.cve.org/CVERecord?id=CVE-2005-0602"
},
{
"name": "CVE-2025-61730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61730"
},
{
"name": "CVE-2025-38485",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38485"
},
{
"name": "CVE-2025-22026",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22026"
},
{
"name": "CVE-2025-39987",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39987"
},
{
"name": "CVE-2025-62727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62727"
},
{
"name": "CVE-2015-4789",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4789"
},
{
"name": "CVE-2025-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38579"
},
{
"name": "CVE-2025-37761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37761"
},
{
"name": "CVE-2025-21861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21861"
},
{
"name": "CVE-2025-37865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37865"
},
{
"name": "CVE-2025-38328",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38328"
},
{
"name": "CVE-2026-21933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21933"
},
{
"name": "CVE-2025-58183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58183"
},
{
"name": "CVE-2024-7006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7006"
},
{
"name": "CVE-2026-21932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21932"
},
{
"name": "CVE-2023-3316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3316"
},
{
"name": "CVE-2025-15282",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15282"
},
{
"name": "CVE-2025-38711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38711"
},
{
"name": "CVE-2025-38487",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38487"
},
{
"name": "CVE-2024-9681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9681"
},
{
"name": "CVE-2025-58190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58190"
},
{
"name": "CVE-2025-37775",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37775"
},
{
"name": "CVE-2025-38335",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38335"
},
{
"name": "CVE-2024-11168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11168"
},
{
"name": "CVE-2025-38304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38304"
},
{
"name": "CVE-2025-37892",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37892"
},
{
"name": "CVE-2025-38100",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38100"
},
{
"name": "CVE-2025-37859",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37859"
},
{
"name": "CVE-2025-9231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9231"
},
{
"name": "CVE-2025-1372",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1372"
},
{
"name": "CVE-2025-8851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8851"
},
{
"name": "CVE-2025-38043",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38043"
},
{
"name": "CVE-2025-68973",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68973"
},
{
"name": "CVE-2025-38471",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38471"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2025-37792",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37792"
},
{
"name": "CVE-2022-3626",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3626"
},
{
"name": "CVE-2024-28834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28834"
},
{
"name": "CVE-2021-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-38604"
},
{
"name": "CVE-2001-1268",
"url": "https://www.cve.org/CVERecord?id=CVE-2001-1268"
},
{
"name": "CVE-2024-37891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37891"
},
{
"name": "CVE-2025-38108",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38108"
},
{
"name": "CVE-2025-38230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38230"
},
{
"name": "CVE-2025-38229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38229"
},
{
"name": "CVE-2023-46218",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46218"
},
{
"name": "CVE-2025-40055",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40055"
},
{
"name": "CVE-2025-38158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38158"
},
{
"name": "CVE-2025-37872",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37872"
},
{
"name": "CVE-2025-9714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9714"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2026-22801",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22801"
},
{
"name": "CVE-2025-39876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39876"
},
{
"name": "CVE-2025-40029",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40029"
},
{
"name": "CVE-2025-38279",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38279"
},
{
"name": "CVE-2025-38561",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38561"
},
{
"name": "CVE-2014-8141",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-8141"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2022-2255",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2255"
},
{
"name": "CVE-2025-10148",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10148"
},
{
"name": "CVE-2025-25724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25724"
},
{
"name": "CVE-2025-27818",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27818"
},
{
"name": "CVE-2025-14087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14087"
},
{
"name": "CVE-2025-40048",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40048"
},
{
"name": "CVE-2025-5222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5222"
},
{
"name": "CVE-2025-38147",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38147"
},
{
"name": "CVE-2023-6780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6780"
},
{
"name": "CVE-2022-48468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48468"
},
{
"name": "CVE-2025-23155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23155"
},
{
"name": "CVE-2025-38286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38286"
},
{
"name": "CVE-2025-40219",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40219"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-38501",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38501"
},
{
"name": "CVE-2025-38474",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38474"
},
{
"name": "CVE-2025-7545",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7545"
},
{
"name": "CVE-2025-37979",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37979"
},
{
"name": "CVE-2025-40043",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40043"
},
{
"name": "CVE-2024-3220",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3220"
},
{
"name": "CVE-2022-3599",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3599"
},
{
"name": "CVE-2025-37777",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37777"
},
{
"name": "CVE-2021-39537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39537"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-37936",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37936"
},
{
"name": "CVE-2015-4787",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4787"
},
{
"name": "CVE-2022-27781",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27781"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2021-22925",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22925"
},
{
"name": "CVE-2025-37766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37766"
},
{
"name": "CVE-2022-47008",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47008"
},
{
"name": "CVE-2023-0796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0796"
},
{
"name": "CVE-2025-38104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38104"
},
{
"name": "CVE-2025-37844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37844"
},
{
"name": "CVE-2016-0682",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-0682"
},
{
"name": "CVE-2025-21931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21931"
},
{
"name": "CVE-2025-37871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37871"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2025-39716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39716"
},
{
"name": "CVE-2025-39702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39702"
},
{
"name": "CVE-2025-39973",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39973"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-22872",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22872"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2025-8941",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8941"
},
{
"name": "CVE-2023-52425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52425"
},
{
"name": "CVE-2025-38163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38163"
},
{
"name": "CVE-2025-22126",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22126"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2025-38109",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38109"
},
{
"name": "CVE-2023-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38546"
},
{
"name": "CVE-2025-39779",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39779"
},
{
"name": "CVE-2025-66866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66866"
},
{
"name": "CVE-2025-28164",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-28164"
},
{
"name": "CVE-2025-37755",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37755"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2025-39943",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39943"
},
{
"name": "CVE-2025-39945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39945"
},
{
"name": "CVE-2025-11840",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11840"
},
{
"name": "CVE-2025-11731",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11731"
},
{
"name": "CVE-2024-33602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33602"
},
{
"name": "CVE-2022-47629",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47629"
},
{
"name": "CVE-2025-39883",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39883"
},
{
"name": "CVE-2025-39720",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39720"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2025-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38388"
},
{
"name": "CVE-2022-48554",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48554"
},
{
"name": "CVE-2022-0563",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0563"
},
{
"name": "CVE-2025-38157",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38157"
},
{
"name": "CVE-2025-4056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4056"
},
{
"name": "CVE-2025-37790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37790"
},
{
"name": "CVE-2024-28757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28757"
},
{
"name": "CVE-2020-29562",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-29562"
},
{
"name": "CVE-2025-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38417"
},
{
"name": "CVE-2025-0913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0913"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2015-4776",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4776"
},
{
"name": "CVE-2025-38323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38323"
},
{
"name": "CVE-2025-40019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40019"
},
{
"name": "CVE-2017-3616",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3616"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2025-27817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27817"
},
{
"name": "CVE-2023-30086",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-30086"
},
{
"name": "CVE-2025-40240",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40240"
},
{
"name": "CVE-2025-38219",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38219"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2015-4785",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4785"
},
{
"name": "CVE-2025-38099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38099"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2025-37758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37758"
},
{
"name": "CVE-2022-32208",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32208"
},
{
"name": "CVE-2025-40081",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40081"
},
{
"name": "CVE-2025-38087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38087"
},
{
"name": "CVE-2025-47907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47907"
},
{
"name": "CVE-2025-1181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1181"
},
{
"name": "CVE-2022-41409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-41409"
},
{
"name": "CVE-2023-25586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25586"
},
{
"name": "CVE-2024-12797",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12797"
},
{
"name": "CVE-2024-58011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58011"
},
{
"name": "CVE-2025-12084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12084"
},
{
"name": "CVE-2025-38039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38039"
},
{
"name": "CVE-2017-20052",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-20052"
},
{
"name": "CVE-2025-40026",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40026"
},
{
"name": "CVE-2025-40153",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40153"
},
{
"name": "CVE-2025-0840",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0840"
},
{
"name": "CVE-2022-2057",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2057"
},
{
"name": "CVE-2023-45853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45853"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2024-47611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47611"
},
{
"name": "CVE-2025-38626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38626"
},
{
"name": "CVE-2025-40121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40121"
},
{
"name": "CVE-2025-45582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-45582"
},
{
"name": "CVE-2025-11468",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11468"
},
{
"name": "CVE-2025-40204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40204"
},
{
"name": "CVE-2025-37852",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37852"
},
{
"name": "CVE-2025-37841",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37841"
},
{
"name": "CVE-2025-40171",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40171"
},
{
"name": "CVE-2025-37918",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37918"
},
{
"name": "CVE-2025-37917",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37917"
},
{
"name": "CVE-2025-38290",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38290"
},
{
"name": "CVE-2021-22901",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22901"
},
{
"name": "CVE-2025-38063",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38063"
},
{
"name": "CVE-2021-3998",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3998"
},
{
"name": "CVE-2025-1179",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1179"
},
{
"name": "CVE-2025-37770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37770"
},
{
"name": "CVE-2025-37773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37773"
},
{
"name": "CVE-2023-26965",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26965"
},
{
"name": "CVE-2023-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2602"
},
{
"name": "CVE-2025-6069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6069"
},
{
"name": "CVE-2017-10140",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-10140"
},
{
"name": "CVE-2024-6232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6232"
},
{
"name": "CVE-2025-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38578"
},
{
"name": "CVE-2025-38675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38675"
},
{
"name": "CVE-2025-39911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39911"
},
{
"name": "CVE-2025-69419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69419"
},
{
"name": "CVE-2025-6052",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6052"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38708",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38708"
},
{
"name": "CVE-2025-37961",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37961"
},
{
"name": "CVE-2025-40125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40125"
},
{
"name": "CVE-2023-52426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52426"
},
{
"name": "CVE-2025-38313",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38313"
},
{
"name": "CVE-2025-38336",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38336"
},
{
"name": "CVE-2025-40349",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40349"
},
{
"name": "CVE-2025-6075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6075"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2022-2058",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2058"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-38061",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38061"
},
{
"name": "CVE-2024-45492",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45492"
},
{
"name": "CVE-2025-37983",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37983"
},
{
"name": "CVE-2015-4764",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4764"
},
{
"name": "CVE-2025-38127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38127"
},
{
"name": "CVE-2026-22715",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22715"
},
{
"name": "CVE-2020-1752",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-1752"
},
{
"name": "CVE-2025-38375",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38375"
},
{
"name": "CVE-2025-37784",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37784"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2015-4779",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4779"
},
{
"name": "CVE-2025-4330",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4330"
},
{
"name": "CVE-2025-40187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40187"
},
{
"name": "CVE-2025-37920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37920"
},
{
"name": "CVE-2025-58185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58185"
},
{
"name": "CVE-2025-37815",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37815"
},
{
"name": "CVE-2025-38686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38686"
},
{
"name": "CVE-2025-37819",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37819"
},
{
"name": "CVE-2025-49794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49794"
},
{
"name": "CVE-2024-57970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57970"
},
{
"name": "CVE-2025-39913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39913"
},
{
"name": "CVE-2024-9287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9287"
},
{
"name": "CVE-2022-32207",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32207"
},
{
"name": "CVE-2025-40092",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40092"
},
{
"name": "CVE-2022-47007",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47007"
},
{
"name": "CVE-2025-4138",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4138"
},
{
"name": "CVE-2025-61731",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61731"
},
{
"name": "CVE-2022-3627",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3627"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2025-39967",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39967"
},
{
"name": "CVE-2023-36632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36632"
},
{
"name": "CVE-2025-38463",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38463"
},
{
"name": "CVE-2025-40115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40115"
},
{
"name": "CVE-2023-25433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25433"
},
{
"name": "CVE-2025-38112",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38112"
},
{
"name": "CVE-2025-66863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66863"
},
{
"name": "CVE-2015-4780",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4780"
},
{
"name": "CVE-2025-38521",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38521"
},
{
"name": "CVE-2025-38023",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38023"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-38282",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38282"
},
{
"name": "CVE-2024-56171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56171"
},
{
"name": "CVE-2025-39689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39689"
},
{
"name": "CVE-2025-38215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38215"
},
{
"name": "CVE-2022-3598",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3598"
},
{
"name": "CVE-2023-0798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0798"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-37943",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37943"
},
{
"name": "CVE-2025-37745",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37745"
},
{
"name": "CVE-2025-8176",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8176"
},
{
"name": "CVE-2025-13837",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13837"
},
{
"name": "CVE-2025-39731",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39731"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38653",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38653"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2025-37789",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37789"
},
{
"name": "CVE-2025-24970",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24970"
},
{
"name": "CVE-2022-38476",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-38476"
},
{
"name": "CVE-2021-45078",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-45078"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2022-3515",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3515"
},
{
"name": "CVE-2025-38004",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38004"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2025-39949",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39949"
},
{
"name": "CVE-2015-7696",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-7696"
},
{
"name": "CVE-2022-4285",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4285"
},
{
"name": "CVE-2025-38387",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38387"
},
{
"name": "CVE-2015-4754",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4754"
},
{
"name": "CVE-2025-38362",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38362"
},
{
"name": "CVE-2022-27776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27776"
},
{
"name": "CVE-2023-45322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45322"
},
{
"name": "CVE-2025-40173",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40173"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2026-22716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22716"
},
{
"name": "CVE-2024-8176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8176"
},
{
"name": "CVE-2025-38371",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38371"
},
{
"name": "CVE-2023-2731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2731"
},
{
"name": "CVE-2025-58767",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58767"
},
{
"name": "CVE-2024-56538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56538"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2021-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35939"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2024-38819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38819"
},
{
"name": "CVE-2023-0803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0803"
},
{
"name": "CVE-2025-37867",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37867"
},
{
"name": "CVE-2025-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23160"
},
{
"name": "CVE-2025-6176",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6176"
},
{
"name": "CVE-2022-47695",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47695"
},
{
"name": "CVE-2025-38295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38295"
},
{
"name": "CVE-2025-15367",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15367"
},
{
"name": "CVE-2025-38461",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38461"
},
{
"name": "CVE-2025-37857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37857"
},
{
"name": "CVE-2023-30774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-30774"
},
{
"name": "CVE-2024-13176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-13176"
},
{
"name": "CVE-2025-37842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37842"
},
{
"name": "CVE-2025-39953",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39953"
},
{
"name": "CVE-2022-50458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50458"
},
{
"name": "CVE-2025-15467",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15467"
},
{
"name": "CVE-2024-58251",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58251"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2026-2006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2006"
},
{
"name": "CVE-2023-28322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28322"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2025-1180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1180"
},
{
"name": "CVE-2025-38060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38060"
},
{
"name": "CVE-2025-40167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40167"
},
{
"name": "CVE-2025-38159",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38159"
},
{
"name": "CVE-2021-3421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3421"
},
{
"name": "CVE-2025-38066",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38066"
},
{
"name": "CVE-2025-4373",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4373"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2015-4790",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4790"
},
{
"name": "CVE-2026-0994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0994"
},
{
"name": "CVE-2025-39969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39969"
},
{
"name": "CVE-2025-37744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37744"
},
{
"name": "CVE-2025-4598",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4598"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2025-40194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40194"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38305"
},
{
"name": "CVE-2025-37884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37884"
},
{
"name": "CVE-2025-38067",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38067"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-38699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38699"
},
{
"name": "CVE-2025-37927",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37927"
},
{
"name": "CVE-2025-38707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38707"
},
{
"name": "CVE-2025-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38562"
},
{
"name": "CVE-2025-37897",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37897"
},
{
"name": "CVE-2016-9840",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-9840"
},
{
"name": "CVE-2025-37911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37911"
},
{
"name": "CVE-2025-40245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40245"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2023-6779",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6779"
},
{
"name": "CVE-2025-37869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37869"
},
{
"name": "CVE-2025-39692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39692"
},
{
"name": "CVE-2025-5115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5115"
},
{
"name": "CVE-2023-53107",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53107"
},
{
"name": "CVE-2024-13009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-13009"
},
{
"name": "CVE-2022-49043",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49043"
},
{
"name": "CVE-2025-55198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55198"
},
{
"name": "CVE-2021-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46195"
},
{
"name": "CVE-2015-2624",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-2624"
},
{
"name": "CVE-2023-29491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29491"
},
{
"name": "CVE-2025-38068",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38068"
},
{
"name": "CVE-2025-38436",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38436"
},
{
"name": "CVE-2025-37930",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37930"
},
{
"name": "CVE-2025-38401",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38401"
},
{
"name": "CVE-2025-38677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38677"
},
{
"name": "CVE-2025-38097",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38097"
},
{
"name": "CVE-2021-20266",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20266"
},
{
"name": "CVE-2025-1182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1182"
},
{
"name": "CVE-2025-37810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37810"
},
{
"name": "CVE-2025-38253",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38253"
},
{
"name": "CVE-2025-38123",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38123"
},
{
"name": "CVE-2025-38338",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38338"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2025-38239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38239"
},
{
"name": "CVE-2025-1371",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1371"
},
{
"name": "CVE-2025-40001",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40001"
},
{
"name": "CVE-2022-40897",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40897"
},
{
"name": "CVE-2026-1485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1485"
},
{
"name": "CVE-2025-0938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0938"
},
{
"name": "CVE-2022-27782",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27782"
},
{
"name": "CVE-2008-0888",
"url": "https://www.cve.org/CVERecord?id=CVE-2008-0888"
},
{
"name": "CVE-2019-13232",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-13232"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38027",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38027"
},
{
"name": "CVE-2025-38102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38102"
},
{
"name": "CVE-2024-33600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33600"
},
{
"name": "CVE-2015-2654",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-2654"
},
{
"name": "CVE-2022-1210",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1210"
},
{
"name": "CVE-2025-40035",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40035"
},
{
"name": "CVE-2025-38283",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38283"
},
{
"name": "CVE-2023-25584",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25584"
},
{
"name": "CVE-2025-23159",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23159"
},
{
"name": "CVE-2025-39988",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39988"
},
{
"name": "CVE-2026-2005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2005"
},
{
"name": "CVE-2025-38455",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38455"
},
{
"name": "CVE-2015-4778",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4778"
},
{
"name": "CVE-2025-1152",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1152"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2025-38015",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38015"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-11082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11082"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-38449",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38449"
},
{
"name": "CVE-2025-40233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40233"
},
{
"name": "CVE-2023-32636",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32636"
},
{
"name": "CVE-2025-37853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37853"
},
{
"name": "CVE-2023-6277",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6277"
},
{
"name": "CVE-2025-38126",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38126"
},
{
"name": "CVE-2025-48060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48060"
},
{
"name": "CVE-2025-38149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38149"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-38399",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38399"
},
{
"name": "CVE-2025-40020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40020"
},
{
"name": "CVE-2025-38065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38065"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2025-40188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40188"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2023-3618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3618"
},
{
"name": "CVE-2025-38412",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38412"
},
{
"name": "CVE-2025-38031",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38031"
},
{
"name": "CVE-2023-4813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4813"
},
{
"name": "CVE-2017-3617",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3617"
},
{
"name": "CVE-2025-14512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14512"
},
{
"name": "CVE-2025-38293",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38293"
},
{
"name": "CVE-2025-58057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58057"
},
{
"name": "CVE-2025-1149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1149"
},
{
"name": "CVE-2025-38648",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38648"
},
{
"name": "CVE-2025-38278",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38278"
},
{
"name": "CVE-2025-8291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8291"
},
{
"name": "CVE-2025-37764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37764"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2017-3615",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3615"
},
{
"name": "CVE-2022-44840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-44840"
},
{
"name": "CVE-2023-28320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28320"
},
{
"name": "CVE-2025-37741",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37741"
},
{
"name": "CVE-2026-22795",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22795"
},
{
"name": "CVE-2025-38053",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38053"
},
{
"name": "CVE-2025-27587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27587"
},
{
"name": "CVE-2026-0988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0988"
},
{
"name": "CVE-2025-8534",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8534"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2025-61727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61727"
},
{
"name": "CVE-2025-37912",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37912"
},
{
"name": "CVE-2025-38482",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38482"
},
{
"name": "CVE-2023-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39810"
},
{
"name": "CVE-2025-37820",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37820"
},
{
"name": "CVE-2025-37985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37985"
},
{
"name": "CVE-2025-1390",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1390"
},
{
"name": "CVE-2024-33599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33599"
},
{
"name": "CVE-2024-0743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0743"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2025-37787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37787"
},
{
"name": "CVE-2026-21925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21925"
},
{
"name": "CVE-2025-38008",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38008"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-38011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38011"
},
{
"name": "CVE-2025-64718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-64718"
},
{
"name": "CVE-2022-50444",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50444"
},
{
"name": "CVE-2025-38034",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38034"
},
{
"name": "CVE-2017-3608",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3608"
},
{
"name": "CVE-2025-38135",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38135"
},
{
"name": "CVE-2023-28484",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28484"
},
{
"name": "CVE-2025-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38619"
},
{
"name": "CVE-2019-2708",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-2708"
},
{
"name": "CVE-2025-38312",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38312"
},
{
"name": "CVE-2025-38095",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38095"
},
{
"name": "CVE-2016-0692",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-0692"
},
{
"name": "CVE-2025-37878",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37878"
},
{
"name": "CVE-2025-39737",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39737"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2021-46174",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46174"
},
{
"name": "CVE-2026-0861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0861"
},
{
"name": "CVE-2025-40049",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40049"
},
{
"name": "CVE-2023-0802",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0802"
},
{
"name": "CVE-2023-53164",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53164"
},
{
"name": "CVE-2025-47910",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47910"
},
{
"name": "CVE-2021-22924",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22924"
},
{
"name": "CVE-2023-47038",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47038"
},
{
"name": "CVE-2025-38363",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38363"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38319",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38319"
},
{
"name": "CVE-2020-10878",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10878"
},
{
"name": "CVE-2022-0529",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0529"
},
{
"name": "CVE-2015-4782",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4782"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2022-2056",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2056"
},
{
"name": "CVE-2023-26966",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26966"
},
{
"name": "CVE-2025-40070",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40070"
},
{
"name": "CVE-2025-38250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38250"
},
{
"name": "CVE-2025-38457",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38457"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2025-37813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37813"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38212",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38212"
},
{
"name": "CVE-2025-40106",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40106"
},
{
"name": "CVE-2017-3610",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3610"
},
{
"name": "CVE-2025-38298",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38298"
},
{
"name": "CVE-2022-43552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43552"
},
{
"name": "CVE-2025-5915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5915"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2022-48065",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48065"
},
{
"name": "CVE-2025-38024",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38024"
},
{
"name": "CVE-2025-38496",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38496"
},
{
"name": "CVE-2022-49063",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49063"
},
{
"name": "CVE-2025-5917",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5917"
},
{
"name": "CVE-2025-38078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38078"
},
{
"name": "CVE-2022-47696",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47696"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2024-45490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45490"
},
{
"name": "CVE-2024-51744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-51744"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2021-22947",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22947"
},
{
"name": "CVE-2025-40205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40205"
},
{
"name": "CVE-2015-4788",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4788"
},
{
"name": "CVE-2025-38169",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38169"
},
{
"name": "CVE-2025-37931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37931"
},
{
"name": "CVE-2025-38511",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38511"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2025-38211",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38211"
},
{
"name": "CVE-2025-6965",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6965"
},
{
"name": "CVE-2023-28319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28319"
},
{
"name": "CVE-2025-10966",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10966"
},
{
"name": "CVE-2021-22922",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22922"
},
{
"name": "CVE-2025-38057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38057"
},
{
"name": "CVE-2024-45491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45491"
},
{
"name": "CVE-2025-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50182"
},
{
"name": "CVE-2025-47906",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47906"
},
{
"name": "CVE-2020-2981",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2981"
},
{
"name": "CVE-2025-37887",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37887"
},
{
"name": "CVE-2025-38077",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38077"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2022-22576",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-22576"
},
{
"name": "CVE-2025-37861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37861"
},
{
"name": "CVE-2025-38120",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38120"
},
{
"name": "CVE-2025-38285",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38285"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2025-37938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37938"
},
{
"name": "CVE-2025-38005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38005"
},
{
"name": "CVE-2025-38368",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38368"
},
{
"name": "CVE-2025-59375",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59375"
},
{
"name": "CVE-2025-31133",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-31133"
},
{
"name": "CVE-2022-35205",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-35205"
},
{
"name": "CVE-2025-8194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8194"
},
{
"name": "CVE-2025-38161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38161"
},
{
"name": "CVE-2025-38331",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38331"
},
{
"name": "CVE-2025-38354",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38354"
},
{
"name": "CVE-2016-3418",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-3418"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2022-29824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29824"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2024-11053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11053"
},
{
"name": "CVE-2025-38696",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38696"
},
{
"name": "CVE-2024-7264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7264"
},
{
"name": "CVE-2025-38274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38274"
},
{
"name": "CVE-2025-40027",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40027"
},
{
"name": "CVE-2025-64505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-64505"
},
{
"name": "CVE-2025-39885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39885"
},
{
"name": "CVE-2021-4214",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4214"
},
{
"name": "CVE-2025-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50181"
},
{
"name": "CVE-2015-2656",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-2656"
},
{
"name": "CVE-2025-37874",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37874"
},
{
"name": "CVE-2025-38115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38115"
},
{
"name": "CVE-2025-66382",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66382"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2021-22946",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22946"
},
{
"name": "CVE-2023-0767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0767"
},
{
"name": "CVE-2025-37988",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37988"
},
{
"name": "CVE-2025-1795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1795"
},
{
"name": "CVE-2025-23158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23158"
},
{
"name": "CVE-2017-3612",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3612"
},
{
"name": "CVE-2025-23144",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23144"
},
{
"name": "CVE-2025-38153",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38153"
},
{
"name": "CVE-2025-37969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37969"
},
{
"name": "CVE-2025-69421",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69421"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2025-37816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37816"
},
{
"name": "CVE-2025-37742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37742"
},
{
"name": "CVE-2025-4517",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4517"
},
{
"name": "CVE-2025-58188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58188"
},
{
"name": "CVE-2025-37765",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37765"
},
{
"name": "CVE-2016-9843",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-9843"
},
{
"name": "CVE-2025-1178",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1178"
},
{
"name": "CVE-2025-38395",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38395"
},
{
"name": "CVE-2025-37921",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37921"
},
{
"name": "CVE-2023-29499",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29499"
},
{
"name": "CVE-2025-38507",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38507"
},
{
"name": "CVE-2025-39989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39989"
},
{
"name": "CVE-2025-38337",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38337"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-38258",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38258"
},
{
"name": "CVE-2024-1013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-1013"
},
{
"name": "CVE-2025-37828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37828"
},
{
"name": "CVE-2025-4674",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4674"
},
{
"name": "CVE-2025-30258",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30258"
},
{
"name": "CVE-2025-1176",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1176"
},
{
"name": "CVE-2025-37769",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37769"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2024-56406",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56406"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2025-39970",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39970"
},
{
"name": "CVE-2025-38086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38086"
},
{
"name": "CVE-2025-37935",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37935"
},
{
"name": "CVE-2025-38396",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38396"
},
{
"name": "CVE-2025-23161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23161"
},
{
"name": "CVE-2025-38407",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38407"
},
{
"name": "CVE-2025-39994",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39994"
},
{
"name": "CVE-2015-4784",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4784"
},
{
"name": "CVE-2025-12119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12119"
},
{
"name": "CVE-2023-4527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4527"
},
{
"name": "CVE-2025-38493",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38493"
},
{
"name": "CVE-2025-37803",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37803"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2024-56433",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56433"
},
{
"name": "CVE-2025-37824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37824"
},
{
"name": "CVE-2023-34410",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34410"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2023-4156",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4156"
},
{
"name": "CVE-2014-8139",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-8139"
},
{
"name": "CVE-2025-47911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47911"
},
{
"name": "CVE-2022-29526",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29526"
},
{
"name": "CVE-2025-38003",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38003"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2025-28162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-28162"
},
{
"name": "CVE-2025-38007",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38007"
},
{
"name": "CVE-2025-37923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37923"
},
{
"name": "CVE-2025-40088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40088"
},
{
"name": "CVE-2025-40220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40220"
},
{
"name": "CVE-2022-2519",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2519"
},
{
"name": "CVE-2025-38142",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38142"
},
{
"name": "CVE-2022-23990",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23990"
},
{
"name": "CVE-2022-49920",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49920"
},
{
"name": "CVE-2025-37739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37739"
},
{
"name": "CVE-2022-0530",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0530"
},
{
"name": "CVE-2025-13151",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13151"
},
{
"name": "CVE-2025-38478",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38478"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2025-39788",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39788"
},
{
"name": "CVE-2025-22058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22058"
},
{
"name": "CVE-2025-37831",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37831"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-4435",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4435"
},
{
"name": "CVE-2025-38269",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38269"
},
{
"name": "CVE-2025-38079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38079"
},
{
"name": "CVE-2025-37940",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37940"
},
{
"name": "CVE-2022-28391",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28391"
},
{
"name": "CVE-2021-46828",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46828"
},
{
"name": "CVE-2023-2804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2804"
},
{
"name": "CVE-2025-37945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37945"
},
{
"name": "CVE-2025-6141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6141"
},
{
"name": "CVE-2025-40109",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40109"
},
{
"name": "CVE-2024-13978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-13978"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2022-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50247"
},
{
"name": "CVE-2025-40006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40006"
},
{
"name": "CVE-2025-12383",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12383"
},
{
"name": "CVE-2025-38652",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38652"
},
{
"name": "CVE-2025-38110",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38110"
},
{
"name": "CVE-2025-38422",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38422"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2021-3520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3520"
},
{
"name": "CVE-2025-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39698"
},
{
"name": "CVE-2025-64506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-64506"
},
{
"name": "CVE-2025-37915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37915"
},
{
"name": "CVE-2025-6020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6020"
},
{
"name": "CVE-2015-2626",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-2626"
},
{
"name": "CVE-2025-23146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23146"
},
{
"name": "CVE-2022-48064",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48064"
},
{
"name": "CVE-2025-37903",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37903"
},
{
"name": "CVE-2025-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52881"
},
{
"name": "CVE-2025-23142",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23142"
},
{
"name": "CVE-2020-10029",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10029"
},
{
"name": "CVE-2025-7425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7425"
},
{
"name": "CVE-2022-36227",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36227"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2025-40011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40011"
},
{
"name": "CVE-2025-21883",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21883"
},
{
"name": "CVE-2025-38303",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38303"
},
{
"name": "CVE-2023-29469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29469"
},
{
"name": "CVE-2024-5535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5535"
},
{
"name": "CVE-2025-38074",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38074"
},
{
"name": "CVE-2023-52355",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52355"
},
{
"name": "CVE-2025-40085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40085"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38232"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-40231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40231"
},
{
"name": "CVE-2021-36770",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36770"
},
{
"name": "CVE-2025-38324",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38324"
},
{
"name": "CVE-2025-22868",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22868"
},
{
"name": "CVE-2021-36976",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36976"
},
{
"name": "CVE-2025-38018",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38018"
},
{
"name": "CVE-2023-3164",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3164"
},
{
"name": "CVE-2022-3597",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3597"
},
{
"name": "CVE-2023-27535",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27535"
},
{
"name": "CVE-2022-27775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27775"
},
{
"name": "CVE-2024-12718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12718"
},
{
"name": "CVE-2025-37830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37830"
},
{
"name": "CVE-2018-25032",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-25032"
},
{
"name": "CVE-2025-3360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-3360"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2025-37991",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37991"
},
{
"name": "CVE-2026-22796",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22796"
},
{
"name": "CVE-2025-64720",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-64720"
},
{
"name": "CVE-2025-38425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38425"
},
{
"name": "CVE-2022-3970",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3970"
},
{
"name": "CVE-2025-9165",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9165"
},
{
"name": "CVE-2023-30571",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-30571"
},
{
"name": "CVE-2022-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50249"
},
{
"name": "CVE-2025-61724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61724"
},
{
"name": "CVE-2025-37978",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37978"
},
{
"name": "CVE-2025-37781",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37781"
},
{
"name": "CVE-2024-5642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5642"
},
{
"name": "CVE-2024-3219",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3219"
},
{
"name": "CVE-2015-4781",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4781"
},
{
"name": "CVE-2025-38210",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38210"
},
{
"name": "CVE-2025-38542",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38542"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2025-38344",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38344"
},
{
"name": "CVE-2025-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23145"
},
{
"name": "CVE-2025-23143",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23143"
},
{
"name": "CVE-2021-3999",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3999"
},
{
"name": "CVE-2023-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53182"
},
{
"name": "CVE-2025-38322",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38322"
},
{
"name": "CVE-2025-38088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38088"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2025-37823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37823"
},
{
"name": "CVE-2022-27774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27774"
},
{
"name": "CVE-2025-38332",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38332"
},
{
"name": "CVE-2025-38386",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38386"
},
{
"name": "CVE-2025-61732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61732"
},
{
"name": "CVE-2017-3605",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3605"
},
{
"name": "CVE-2025-61723",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61723"
},
{
"name": "CVE-2025-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38385"
},
{
"name": "CVE-2022-40303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40303"
},
{
"name": "CVE-2025-11083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11083"
},
{
"name": "CVE-2025-37952",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37952"
},
{
"name": "CVE-2023-45803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45803"
},
{
"name": "CVE-2024-6763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6763"
},
{
"name": "CVE-2023-0801",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0801"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-37793",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37793"
},
{
"name": "CVE-2020-10543",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10543"
},
{
"name": "CVE-2025-1377",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1377"
},
{
"name": "CVE-2025-37740",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37740"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2022-4645",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4645"
},
{
"name": "CVE-2025-38174",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38174"
},
{
"name": "CVE-2025-8713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8713"
},
{
"name": "CVE-2025-37826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37826"
},
{
"name": "CVE-2025-37986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37986"
},
{
"name": "CVE-2025-37829",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37829"
},
{
"name": "CVE-2025-46394",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-46394"
},
{
"name": "CVE-2025-66471",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66471"
},
{
"name": "CVE-2025-38409",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38409"
},
{
"name": "CVE-2025-6170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6170"
},
{
"name": "CVE-2022-3479",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3479"
},
{
"name": "CVE-2021-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35937"
},
{
"name": "CVE-2025-9900",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9900"
},
{
"name": "CVE-2025-40183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40183"
},
{
"name": "CVE-2025-38019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38019"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-14017",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14017"
},
{
"name": "CVE-2023-40745",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40745"
},
{
"name": "CVE-2026-21441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21441"
},
{
"name": "CVE-2024-45337",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45337"
},
{
"name": "CVE-2025-23151",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23151"
},
{
"name": "CVE-2025-38037",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38037"
},
{
"name": "CVE-2017-3609",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3609"
},
{
"name": "CVE-2025-39998",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39998"
},
{
"name": "CVE-2014-9636",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-9636"
},
{
"name": "CVE-2025-13836",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13836"
},
{
"name": "CVE-2017-3611",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3611"
},
{
"name": "CVE-2022-2521",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2521"
},
{
"name": "CVE-2023-28321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28321"
},
{
"name": "CVE-2025-37796",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37796"
},
{
"name": "CVE-2025-37962",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37962"
},
{
"name": "CVE-2026-1002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1002"
},
{
"name": "CVE-2025-40134",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40134"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2023-25435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25435"
},
{
"name": "CVE-2025-37799",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37799"
},
{
"name": "CVE-2022-29155",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29155"
},
{
"name": "CVE-2025-61725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61725"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2026-25210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25210"
},
{
"name": "CVE-2022-2309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2309"
},
{
"name": "CVE-2025-39968",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39968"
},
{
"name": "CVE-2023-33285",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-33285"
},
{
"name": "CVE-2024-52533",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52533"
},
{
"name": "CVE-2025-38342",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38342"
},
{
"name": "CVE-2025-65018",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-65018"
},
{
"name": "CVE-2025-39795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39795"
},
{
"name": "CVE-2015-4777",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4777"
},
{
"name": "CVE-2025-37801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37801"
},
{
"name": "CVE-2025-7039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7039"
},
{
"name": "CVE-2025-38167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38167"
},
{
"name": "CVE-2025-37883",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37883"
},
{
"name": "CVE-2025-37863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37863"
},
{
"name": "CVE-2023-0687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0687"
},
{
"name": "CVE-2025-37901",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37901"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2022-32221",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32221"
},
{
"name": "CVE-2025-37811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37811"
},
{
"name": "CVE-2022-37434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-37434"
},
{
"name": "CVE-2025-38257",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38257"
},
{
"name": "CVE-2022-29458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29458"
},
{
"name": "CVE-2023-5156",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5156"
},
{
"name": "CVE-2025-22104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22104"
},
{
"name": "CVE-2025-37864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37864"
},
{
"name": "CVE-2021-32256",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-32256"
},
{
"name": "CVE-2025-38307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38307"
},
{
"name": "CVE-2025-11081",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11081"
},
{
"name": "CVE-2025-55163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55163"
},
{
"name": "CVE-2025-37916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37916"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2025-39986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39986"
},
{
"name": "CVE-2026-22184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22184"
},
{
"name": "CVE-2025-37767",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37767"
},
{
"name": "CVE-2025-5918",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5918"
},
{
"name": "CVE-2025-39955",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39955"
},
{
"name": "CVE-2025-66293",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66293"
},
{
"name": "CVE-2017-3614",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3614"
},
{
"name": "CVE-2025-37989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37989"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2025-38326",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38326"
},
{
"name": "CVE-2025-38055",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38055"
},
{
"name": "CVE-2025-12818",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12818"
},
{
"name": "CVE-2025-38129",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38129"
},
{
"name": "CVE-2025-32990",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32990"
},
{
"name": "CVE-2025-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38384"
},
{
"name": "CVE-2025-38334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38334"
},
{
"name": "CVE-2025-38728",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38728"
},
{
"name": "CVE-2025-38424",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38424"
},
{
"name": "CVE-2025-38430",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38430"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2021-22897",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22897"
},
{
"name": "CVE-2025-39734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39734"
},
{
"name": "CVE-2025-38089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38089"
},
{
"name": "CVE-2025-40078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40078"
},
{
"name": "CVE-2025-38382",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38382"
},
{
"name": "CVE-2025-15366",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15366"
},
{
"name": "CVE-2023-2603",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2603"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-4802",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4802"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-40116",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40116"
},
{
"name": "CVE-2025-68249",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68249"
},
{
"name": "CVE-2026-0990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0990"
},
{
"name": "CVE-2025-38124",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38124"
},
{
"name": "CVE-2025-39934",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39934"
},
{
"name": "CVE-2025-37925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37925"
},
{
"name": "CVE-2026-0865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0865"
},
{
"name": "CVE-2024-9143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9143"
},
{
"name": "CVE-2023-0799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0799"
},
{
"name": "CVE-2020-12723",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-12723"
},
{
"name": "CVE-2025-39683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39683"
},
{
"name": "CVE-2025-38420",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38420"
},
{
"name": "CVE-2025-38071",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38071"
},
{
"name": "CVE-2021-3521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3521"
},
{
"name": "CVE-2025-40179",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40179"
},
{
"name": "CVE-2025-37972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37972"
},
{
"name": "CVE-2025-38183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38183"
},
{
"name": "CVE-2025-40127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40127"
},
{
"name": "CVE-2025-37768",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37768"
},
{
"name": "CVE-2025-39794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39794"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2024-33601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33601"
},
{
"name": "CVE-2025-32989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32989"
},
{
"name": "CVE-2022-48063",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48063"
},
{
"name": "CVE-2024-53589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53589"
},
{
"name": "CVE-2025-37984",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37984"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2025-39996",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39996"
},
{
"name": "CVE-2025-37856",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37856"
},
{
"name": "CVE-2025-38107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38107"
},
{
"name": "CVE-2025-22874",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22874"
},
{
"name": "CVE-2023-32181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32181"
},
{
"name": "CVE-2025-38292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38292"
},
{
"name": "CVE-2025-40053",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40053"
},
{
"name": "CVE-2025-38085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38085"
},
{
"name": "CVE-2026-24515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-24515"
},
{
"name": "CVE-2025-38222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38222"
},
{
"name": "CVE-2025-38010",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38010"
},
{
"name": "CVE-2025-38197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38197"
},
{
"name": "CVE-2025-39951",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39951"
},
{
"name": "CVE-2025-38468",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38468"
},
{
"name": "CVE-2022-1271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1271"
},
{
"name": "CVE-2025-40120",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40120"
},
{
"name": "CVE-2024-28085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28085"
},
{
"name": "CVE-2025-11495",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11495"
},
{
"name": "CVE-2025-38688",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38688"
},
{
"name": "CVE-2025-38333",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38333"
},
{
"name": "CVE-2019-9076",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-9076"
},
{
"name": "CVE-2025-37970",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37970"
},
{
"name": "CVE-2025-55199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55199"
},
{
"name": "CVE-2025-21884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21884"
},
{
"name": "CVE-2025-37905",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37905"
},
{
"name": "CVE-2025-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38390"
},
{
"name": "CVE-2025-38013",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38013"
},
{
"name": "CVE-2021-20205",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20205"
},
{
"name": "CVE-2025-38059",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38059"
},
{
"name": "CVE-2025-5025",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5025"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-37956",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37956"
},
{
"name": "CVE-2025-40243",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40243"
},
{
"name": "CVE-2025-38148",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38148"
},
{
"name": "CVE-2025-38467",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38467"
},
{
"name": "CVE-2024-34459",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34459"
},
{
"name": "CVE-2025-38117",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38117"
},
{
"name": "CVE-2025-38094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38094"
},
{
"name": "CVE-2025-49795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49795"
},
{
"name": "CVE-2025-14104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14104"
},
{
"name": "CVE-2014-9913",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-9913"
},
{
"name": "CVE-2025-38072",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38072"
},
{
"name": "CVE-2024-37407",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37407"
},
{
"name": "CVE-2015-4775",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4775"
},
{
"name": "CVE-2025-37967",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37967"
},
{
"name": "CVE-2025-38300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38300"
},
{
"name": "CVE-2016-0694",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-0694"
},
{
"name": "CVE-2025-38289",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38289"
},
{
"name": "CVE-2023-6228",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6228"
},
{
"name": "CVE-2021-46848",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46848"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-1376",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1376"
},
{
"name": "CVE-2025-47912",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47912"
},
{
"name": "CVE-2025-37949",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37949"
},
{
"name": "CVE-2001-1269",
"url": "https://www.cve.org/CVERecord?id=CVE-2001-1269"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-38373",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38373"
},
{
"name": "CVE-2025-11414",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11414"
},
{
"name": "CVE-2025-38489",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38489"
},
{
"name": "CVE-2025-66861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66861"
},
{
"name": "CVE-2025-37957",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37957"
},
{
"name": "CVE-2024-22365",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22365"
},
{
"name": "CVE-2025-38058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38058"
},
{
"name": "CVE-2025-38483",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38483"
},
{
"name": "CVE-2025-38369",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38369"
},
{
"name": "CVE-2024-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47535"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38122",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38122"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2022-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50250"
},
{
"name": "CVE-2023-0795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0795"
},
{
"name": "CVE-2025-68160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68160"
},
{
"name": "CVE-2015-2583",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-2583"
},
{
"name": "CVE-2025-38173",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38173"
},
{
"name": "CVE-2021-29390",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-29390"
},
{
"name": "CVE-2024-2236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2236"
},
{
"name": "CVE-2025-38143",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38143"
},
{
"name": "CVE-2025-45768",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-45768"
},
{
"name": "CVE-2025-38098",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38098"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-1365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1365"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2024-25062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25062"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-40118",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40118"
},
{
"name": "CVE-2022-32205",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32205"
},
{
"name": "CVE-2025-38718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38718"
},
{
"name": "CVE-2023-27534",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27534"
},
{
"name": "CVE-2024-2398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2398"
},
{
"name": "CVE-2025-38392",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38392"
},
{
"name": "CVE-2025-60753",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-60753"
},
{
"name": "CVE-2025-39673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39673"
},
{
"name": "CVE-2023-27536",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27536"
},
{
"name": "CVE-2025-52565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52565"
},
{
"name": "CVE-2025-38259",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38259"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2015-4783",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4783"
},
{
"name": "CVE-2025-40021",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40021"
},
{
"name": "CVE-2025-67735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-67735"
},
{
"name": "CVE-2025-38156",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38156"
},
{
"name": "CVE-2015-4774",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4774"
},
{
"name": "CVE-2025-37951",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37951"
},
{
"name": "CVE-2023-50495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50495"
},
{
"name": "CVE-2025-37840",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37840"
},
{
"name": "CVE-2017-11164",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-11164"
},
{
"name": "CVE-2025-37947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37947"
},
{
"name": "CVE-2025-61728",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61728"
},
{
"name": "CVE-2022-43551",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43551"
},
{
"name": "CVE-2025-68972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68972"
},
{
"name": "CVE-2025-26519",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-26519"
},
{
"name": "CVE-2025-38416",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38416"
},
{
"name": "CVE-2025-58186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58186"
},
{
"name": "CVE-2025-37846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37846"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-38192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38192"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-40044",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40044"
},
{
"name": "CVE-2025-13034",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13034"
},
{
"name": "CVE-2021-20284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20284"
},
{
"name": "CVE-2025-8714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8714"
},
{
"name": "CVE-2025-38343",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38343"
},
{
"name": "CVE-2023-27533",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27533"
},
{
"name": "CVE-2025-40105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40105"
},
{
"name": "CVE-2025-38202",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38202"
},
{
"name": "CVE-2017-7500",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7500"
},
{
"name": "CVE-2025-9086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9086"
},
{
"name": "CVE-2025-40112",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40112"
},
{
"name": "CVE-2025-22101",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22101"
},
{
"name": "CVE-2021-32292",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-32292"
},
{
"name": "CVE-2025-38374",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38374"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2025-38194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38194"
},
{
"name": "CVE-2025-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38549"
},
{
"name": "CVE-2024-10041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-10041"
},
{
"name": "CVE-2023-1972",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1972"
},
{
"name": "CVE-2025-8869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8869"
},
{
"name": "CVE-2025-58187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58187"
},
{
"name": "CVE-2022-34903",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-34903"
},
{
"name": "CVE-2022-2953",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2953"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2024-20696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20696"
},
{
"name": "CVE-2025-38101",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38101"
},
{
"name": "CVE-2023-32573",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32573"
},
{
"name": "CVE-2025-37982",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37982"
},
{
"name": "CVE-2025-37992",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37992"
},
{
"name": "CVE-2025-38577",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38577"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2020-19726",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-19726"
},
{
"name": "CVE-2022-3219",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3219"
},
{
"name": "CVE-2025-39971",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39971"
},
{
"name": "CVE-2025-38299",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38299"
},
{
"name": "CVE-2025-40154",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40154"
},
{
"name": "CVE-2025-13601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13601"
},
{
"name": "CVE-2025-12817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12817"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2025-4673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4673"
},
{
"name": "CVE-2022-47010",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47010"
},
{
"name": "CVE-2025-38704",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38704"
},
{
"name": "CVE-2025-38348",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38348"
},
{
"name": "CVE-2020-22916",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-22916"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2025-5916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5916"
},
{
"name": "CVE-2025-38040",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38040"
},
{
"name": "CVE-2025-38265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38265"
},
{
"name": "CVE-2025-23149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23149"
},
{
"name": "CVE-2022-33070",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-33070"
},
{
"name": "CVE-2025-38403",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38403"
},
{
"name": "CVE-2022-23308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23308"
},
{
"name": "CVE-2025-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38552"
},
{
"name": "CVE-2025-58056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58056"
},
{
"name": "CVE-2025-37914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37914"
},
{
"name": "CVE-2025-22871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22871"
},
{
"name": "CVE-2025-10911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10911"
},
{
"name": "CVE-2025-32988",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32988"
},
{
"name": "CVE-2022-28805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28805"
},
{
"name": "CVE-2025-37873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37873"
},
{
"name": "CVE-2024-57360",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57360"
},
{
"name": "CVE-2025-37928",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37928"
},
{
"name": "CVE-2017-3604",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3604"
},
{
"name": "CVE-2023-0804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0804"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-37922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37922"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2024-38828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38828"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2023-27538",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27538"
},
{
"name": "CVE-2025-39687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39687"
},
{
"name": "CVE-2025-37794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37794"
},
{
"name": "CVE-2023-4641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4641"
},
{
"name": "CVE-2025-14524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14524"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-27113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27113"
},
{
"name": "CVE-2025-38246",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38246"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-38220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38220"
},
{
"name": "CVE-2025-38405",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38405"
},
{
"name": "CVE-2026-0915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0915"
},
{
"name": "CVE-2025-15281",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15281"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-38090",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38090"
},
{
"name": "CVE-2022-23218",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23218"
},
{
"name": "CVE-2025-38429",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38429"
},
{
"name": "CVE-2022-25236",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25236"
},
{
"name": "CVE-2023-30775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-30775"
},
{
"name": "CVE-2025-38225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38225"
},
{
"name": "CVE-2025-47913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47913"
},
{
"name": "CVE-2025-38155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38155"
},
{
"name": "CVE-2023-0797",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0797"
},
{
"name": "CVE-2025-37977",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37977"
},
{
"name": "CVE-2023-37369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37369"
},
{
"name": "CVE-2024-48615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48615"
},
{
"name": "CVE-2025-38365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38365"
},
{
"name": "CVE-2025-38415",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38415"
},
{
"name": "CVE-2024-55549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55549"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-37973",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37973"
},
{
"name": "CVE-2025-68750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68750"
},
{
"name": "CVE-2025-38260",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38260"
},
{
"name": "CVE-2024-6119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6119"
},
{
"name": "CVE-2025-37827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37827"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2025-38244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38244"
},
{
"name": "CVE-2023-1916",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1916"
},
{
"name": "CVE-2025-38080",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38080"
},
{
"name": "CVE-2025-40126",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40126"
},
{
"name": "CVE-2025-39972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39972"
},
{
"name": "CVE-2025-37748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37748"
},
{
"name": "CVE-2025-38364",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38364"
},
{
"name": "CVE-2025-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38615"
},
{
"name": "CVE-2025-58181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58181"
},
{
"name": "CVE-2025-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40909"
},
{
"name": "CVE-2023-25588",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25588"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-37836",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37836"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2017-3607",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3607"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2022-2520",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2520"
},
{
"name": "CVE-2025-8959",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8959"
},
{
"name": "CVE-2025-37944",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37944"
},
{
"name": "CVE-2025-47914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47914"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-38494",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38494"
},
{
"name": "CVE-2025-39753",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39753"
},
{
"name": "CVE-2025-69418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69418"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2025-38193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38193"
},
{
"name": "CVE-2025-38400",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38400"
},
{
"name": "CVE-2025-4516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4516"
},
{
"name": "CVE-2025-38136",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38136"
},
{
"name": "CVE-2025-66864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66864"
},
{
"name": "CVE-2025-58058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58058"
},
{
"name": "CVE-2025-22869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22869"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-37771",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37771"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-40200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40200"
},
{
"name": "CVE-2025-38236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38236"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-37975",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37975"
},
{
"name": "CVE-2023-41175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-41175"
},
{
"name": "CVE-2025-40124",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40124"
},
{
"name": "CVE-2025-38347",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38347"
},
{
"name": "CVE-2025-39776",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39776"
},
{
"name": "CVE-2025-1150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1150"
},
{
"name": "CVE-2025-39880",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39880"
},
{
"name": "CVE-2025-37998",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37998"
},
{
"name": "CVE-2025-38198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38198"
},
{
"name": "CVE-2025-58189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58189"
},
{
"name": "CVE-2025-6021",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6021"
},
{
"name": "CVE-2025-23163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23163"
},
{
"name": "CVE-2025-40094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40094"
},
{
"name": "CVE-2025-37968",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37968"
},
{
"name": "CVE-2025-38376",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38376"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2022-26280",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26280"
},
{
"name": "CVE-2025-0665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0665"
},
{
"name": "CVE-2025-38437",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38437"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2024-4603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4603"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2025-38048",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38048"
},
{
"name": "CVE-2025-25193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25193"
},
{
"name": "CVE-2024-8096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8096"
},
{
"name": "CVE-2012-0880",
"url": "https://www.cve.org/CVERecord?id=CVE-2012-0880"
},
{
"name": "CVE-2023-3576",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3576"
},
{
"name": "CVE-2023-4806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4806"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2026-21945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21945"
},
{
"name": "CVE-2023-47039",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47039"
},
{
"name": "CVE-2025-39736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39736"
},
{
"name": "CVE-2025-37757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37757"
},
{
"name": "CVE-2018-9996",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-9996"
},
{
"name": "CVE-2023-31484",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31484"
},
{
"name": "CVE-2025-8225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8225"
},
{
"name": "CVE-2023-29383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29383"
},
{
"name": "CVE-2022-32206",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32206"
},
{
"name": "CVE-2025-8224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8224"
},
{
"name": "CVE-2024-50602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50602"
},
{
"name": "CVE-2015-7697",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-7697"
},
{
"name": "CVE-2025-38009",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38009"
},
{
"name": "CVE-2025-22870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22870"
},
{
"name": "CVE-2025-40215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40215"
},
{
"name": "CVE-2025-40111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40111"
},
{
"name": "CVE-2025-38081",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38081"
},
{
"name": "CVE-2025-37809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37809"
},
{
"name": "CVE-2025-40068",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40068"
},
{
"name": "CVE-2025-5245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5245"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-38406",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38406"
},
{
"name": "CVE-2021-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35942"
},
{
"name": "CVE-2025-40042",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40042"
},
{
"name": "CVE-2025-32415",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32415"
},
{
"name": "CVE-2025-24855",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24855"
},
{
"name": "CVE-2025-37817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37817"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-5889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5889"
},
{
"name": "CVE-2025-22102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22102"
},
{
"name": "CVE-2025-37987",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37987"
},
{
"name": "CVE-2024-23337",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23337"
},
{
"name": "CVE-2016-0689",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-0689"
},
{
"name": "CVE-2025-37749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37749"
},
{
"name": "CVE-2026-22695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22695"
},
{
"name": "CVE-2026-23490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23490"
},
{
"name": "CVE-2025-11966",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11966"
},
{
"name": "CVE-2024-36331",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36331"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2014-8140",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-8140"
},
{
"name": "CVE-2026-0992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0992"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2022-47011",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47011"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-37772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37772"
},
{
"name": "CVE-2025-9230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9230"
},
{
"name": "CVE-2025-38214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38214"
},
{
"name": "CVE-2025-12194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12194"
},
{
"name": "CVE-2021-3549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3549"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2025-37994",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37994"
},
{
"name": "CVE-2025-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38551"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2025-38218",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38218"
},
{
"name": "CVE-2025-66564",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66564"
},
{
"name": "CVE-2025-38349",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38349"
},
{
"name": "CVE-2025-5244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5244"
},
{
"name": "CVE-2021-37972",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37972"
},
{
"name": "CVE-2025-1352",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1352"
},
{
"name": "CVE-2024-4741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4741"
},
{
"name": "CVE-2021-33574",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33574"
},
{
"name": "CVE-2018-1000035",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1000035"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2023-4863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4863"
},
{
"name": "CVE-2025-48924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48924"
},
{
"name": "CVE-2025-38393",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38393"
},
{
"name": "CVE-2024-26256",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26256"
},
{
"name": "CVE-2021-3326",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3326"
},
{
"name": "CVE-2021-22926",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22926"
},
{
"name": "CVE-2025-32414",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32414"
},
{
"name": "CVE-2025-37891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37891"
},
{
"name": "CVE-2025-38249",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38249"
},
{
"name": "CVE-2025-38716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38716"
},
{
"name": "CVE-2025-39937",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39937"
},
{
"name": "CVE-2025-37858",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37858"
},
{
"name": "CVE-2023-40403",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40403"
},
{
"name": "CVE-2025-22013",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22013"
},
{
"name": "CVE-2025-38154",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38154"
},
{
"name": "CVE-2025-38469",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38469"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2021-30560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-30560"
},
{
"name": "CVE-2025-1153",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1153"
},
{
"name": "CVE-2025-62408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62408"
},
{
"name": "CVE-2025-40060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40060"
},
{
"name": "CVE-2026-2003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2003"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-38389",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38389"
},
{
"name": "CVE-2025-38448",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38448"
},
{
"name": "CVE-2022-48281",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48281"
},
{
"name": "CVE-2021-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35938"
},
{
"name": "CVE-2025-15079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15079"
},
{
"name": "CVE-2025-37780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37780"
},
{
"name": "CVE-2025-37995",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37995"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-37754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37754"
},
{
"name": "CVE-2025-1632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1632"
},
{
"name": "CVE-2025-11412",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11412"
},
{
"name": "CVE-2025-38497",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38497"
},
{
"name": "CVE-2025-23156",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23156"
},
{
"name": "CVE-2025-23157",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23157"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-38165",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38165"
},
{
"name": "CVE-2022-28321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28321"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-38495",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38495"
},
{
"name": "CVE-2025-37808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37808"
},
{
"name": "CVE-2017-3606",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3606"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2025-38052",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38052"
},
{
"name": "CVE-2025-38377",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38377"
},
{
"name": "CVE-2024-3651",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3651"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2022-40090",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40090"
},
{
"name": "CVE-2025-68121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68121"
},
{
"name": "CVE-2023-25434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25434"
},
{
"name": "CVE-2024-12243",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12243"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2025-38462",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38462"
},
{
"name": "CVE-2025-38428",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38428"
},
{
"name": "CVE-2018-13410",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-13410"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-38262",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38262"
},
{
"name": "CVE-2025-60876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-60876"
},
{
"name": "CVE-2025-38138",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38138"
},
{
"name": "CVE-2025-38035",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38035"
},
{
"name": "CVE-2025-14819",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14819"
},
{
"name": "CVE-2025-37759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37759"
},
{
"name": "CVE-2025-24928",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24928"
},
{
"name": "CVE-2025-38414",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38414"
},
{
"name": "CVE-2022-35206",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-35206"
},
{
"name": "CVE-2025-0395",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0395"
},
{
"name": "CVE-2025-11065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11065"
},
{
"name": "CVE-2025-37933",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37933"
},
{
"name": "CVE-2025-38310",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38310"
},
{
"name": "CVE-2015-4786",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4786"
},
{
"name": "CVE-2025-37886",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37886"
},
{
"name": "CVE-2022-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-38533"
},
{
"name": "CVE-2025-37963",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37963"
},
{
"name": "CVE-2025-40297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40297"
},
{
"name": "CVE-2026-1484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1484"
},
{
"name": "CVE-2022-40304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40304"
},
{
"name": "CVE-2025-38226",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38226"
},
{
"name": "CVE-2025-4947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4947"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-40178",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40178"
},
{
"name": "CVE-2023-4911",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4911"
},
{
"name": "CVE-2025-38443",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38443"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2025-0725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0725"
},
{
"name": "CVE-2025-37800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37800"
},
{
"name": "CVE-2025-39985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39985"
},
{
"name": "CVE-2025-61726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61726"
},
{
"name": "CVE-2023-36660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36660"
},
{
"name": "CVE-2025-37900",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37900"
},
{
"name": "CVE-2025-7424",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7424"
},
{
"name": "CVE-2025-1094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1094"
},
{
"name": "CVE-2023-25585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25585"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-37805",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37805"
},
{
"name": "CVE-2021-22923",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22923"
},
{
"name": "CVE-2025-41254",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41254"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-37990",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37990"
},
{
"name": "CVE-2020-12762",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-12762"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-3198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-3198"
},
{
"name": "CVE-2025-38180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38180"
},
{
"name": "CVE-2025-53864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53864"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2026-2007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2007"
},
{
"name": "CVE-2025-38145",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38145"
},
{
"name": "CVE-2023-2953",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2953"
},
{
"name": "CVE-2024-4032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4032"
},
{
"name": "CVE-2025-37948",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37948"
},
{
"name": "CVE-2021-27645",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-27645"
},
{
"name": "CVE-2025-38166",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38166"
},
{
"name": "CVE-2025-37862",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37862"
},
{
"name": "CVE-2025-38321",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38321"
},
{
"name": "CVE-2024-28835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28835"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2025-37960",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37960"
},
{
"name": "CVE-2025-38045",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38045"
},
{
"name": "CVE-2025-38051",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38051"
},
{
"name": "CVE-2025-59419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59419"
},
{
"name": "CVE-2025-49796",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49796"
},
{
"name": "CVE-2022-34526",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-34526"
},
{
"name": "CVE-2025-8058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8058"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-37763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37763"
},
{
"name": "CVE-2025-11839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11839"
},
{
"name": "CVE-2025-37954",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37954"
},
{
"name": "CVE-2024-8244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8244"
},
{
"name": "CVE-2025-22128",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22128"
},
{
"name": "CVE-2026-1489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1489"
},
{
"name": "CVE-2025-37839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37839"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2025-38277",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38277"
},
{
"name": "CVE-2025-37913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37913"
},
{
"name": "CVE-2025-39756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39756"
},
{
"name": "CVE-2025-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38539"
},
{
"name": "CVE-2026-2004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2004"
},
{
"name": "CVE-2026-0672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0672"
},
{
"name": "CVE-2025-8732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8732"
},
{
"name": "CVE-2025-38044",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38044"
},
{
"name": "CVE-2022-1586",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1586"
},
{
"name": "CVE-2025-37786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37786"
},
{
"name": "CVE-2026-0900",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0900"
},
{
"name": "CVE-2020-16599",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-16599"
},
{
"name": "CVE-2021-46822",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46822"
},
{
"name": "CVE-2022-45703",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45703"
},
{
"name": "CVE-2025-38200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38200"
},
{
"name": "CVE-2025-38480",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38480"
},
{
"name": "CVE-2025-38346",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38346"
},
{
"name": "CVE-2025-30204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30204"
},
{
"name": "CVE-2025-37959",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37959"
},
{
"name": "CVE-2025-38191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38191"
},
{
"name": "CVE-2025-39946",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39946"
},
{
"name": "CVE-2025-38062",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38062"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2025-5914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5914"
},
{
"name": "CVE-2023-39804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39804"
},
{
"name": "CVE-2025-21919",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21919"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2025-38131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38131"
},
{
"name": "CVE-2023-2908",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2908"
},
{
"name": "CVE-2023-39615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39615"
},
{
"name": "CVE-2017-7501",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7501"
},
{
"name": "CVE-2022-47673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47673"
},
{
"name": "CVE-2023-31486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31486"
},
{
"name": "CVE-2025-39980",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39980"
},
{
"name": "CVE-2021-20197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20197"
},
{
"name": "CVE-2023-24056",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24056"
},
{
"name": "CVE-2026-0902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0902"
},
{
"name": "CVE-2013-0340",
"url": "https://www.cve.org/CVERecord?id=CVE-2013-0340"
},
{
"name": "CVE-2025-37851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37851"
},
{
"name": "CVE-2025-38481",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38481"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2023-32611",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32611"
},
{
"name": "CVE-2024-38816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38816"
},
{
"name": "CVE-2026-22717",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22717"
},
{
"name": "CVE-2024-34397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34397"
},
{
"name": "CVE-2025-38320",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38320"
},
{
"name": "CVE-2025-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53057"
},
{
"name": "CVE-2025-1151",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1151"
},
{
"name": "CVE-2025-38625",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38625"
},
{
"name": "CVE-2025-38164",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38164"
},
{
"name": "CVE-2025-8177",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8177"
},
{
"name": "CVE-2025-29480",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29480"
},
{
"name": "CVE-2025-40346",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40346"
},
{
"name": "CVE-2025-38264",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38264"
},
{
"name": "CVE-2023-1999",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1999"
},
{
"name": "CVE-2020-27618",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-27618"
},
{
"name": "CVE-2025-39676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39676"
},
{
"name": "CVE-2025-37980",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37980"
},
{
"name": "CVE-2023-0800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0800"
},
{
"name": "CVE-2025-7546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7546"
},
{
"name": "CVE-2025-38280",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38280"
},
{
"name": "CVE-2023-5388",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5388"
},
{
"name": "CVE-2025-1148",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1148"
},
{
"name": "CVE-2025-37788",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37788"
},
{
"name": "CVE-2025-38427",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38427"
},
{
"name": "CVE-2025-38084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38084"
},
{
"name": "CVE-2022-23219",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23219"
},
{
"name": "CVE-2015-2640",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-2640"
},
{
"name": "CVE-2025-37879",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37879"
},
{
"name": "CVE-2025-38217",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38217"
},
{
"name": "CVE-2023-5752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5752"
},
{
"name": "CVE-2025-40030",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40030"
},
{
"name": "CVE-2025-40244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40244"
},
{
"name": "CVE-2025-66862",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66862"
},
{
"name": "CVE-2025-37881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37881"
},
{
"name": "CVE-2025-39995",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39995"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39715"
},
{
"name": "CVE-2025-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38569"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2023-1579",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1579"
},
{
"name": "CVE-2025-68119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68119"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2021-4217",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4217"
},
{
"name": "CVE-2023-32643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32643"
},
{
"name": "CVE-2025-37909",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37909"
},
{
"name": "CVE-2025-38700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38700"
},
{
"name": "CVE-2021-43396",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43396"
},
{
"name": "CVE-2025-37849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37849"
},
{
"name": "CVE-2025-38162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38162"
},
{
"name": "CVE-2025-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53066"
},
{
"name": "CVE-2025-22873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22873"
},
{
"name": "CVE-2025-38532",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38532"
},
{
"name": "CVE-2024-2961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2961"
},
{
"name": "CVE-2025-39712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39712"
},
{
"name": "CVE-2024-12133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12133"
},
{
"name": "CVE-2025-37812",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37812"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2021-22945",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22945"
},
{
"name": "CVE-2025-37875",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37875"
},
{
"name": "CVE-2025-38410",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38410"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2023-42366",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42366"
},
{
"name": "CVE-2025-39781",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39781"
},
{
"name": "CVE-2025-0167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0167"
},
{
"name": "CVE-2026-25547",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25547"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2023-38197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38197"
},
{
"name": "CVE-2025-38476",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38476"
},
{
"name": "CVE-2025-69420",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69420"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-64702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-64702"
},
{
"name": "CVE-2025-47273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47273"
},
{
"name": "CVE-2025-40140",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40140"
},
{
"name": "CVE-2025-38020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38020"
},
{
"name": "CVE-2025-15224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15224"
},
{
"name": "CVE-2025-40223",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40223"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2025-23140",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23140"
},
{
"name": "CVE-2025-23150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23150"
},
{
"name": "CVE-2025-38460",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38460"
},
{
"name": "CVE-2025-38182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38182"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2024-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53114"
},
{
"name": "CVE-2025-38275",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38275"
},
{
"name": "CVE-2022-48303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48303"
},
{
"name": "CVE-2025-38345",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38345"
},
{
"name": "CVE-2024-37371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37371"
},
{
"name": "CVE-2023-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38545"
},
{
"name": "CVE-2021-43618",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43618"
},
{
"name": "CVE-2026-0989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0989"
},
{
"name": "CVE-2025-38170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38170"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2025-22115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22115"
},
{
"name": "CVE-2025-22120",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22120"
},
{
"name": "CVE-2025-61729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61729"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2025-38231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38231"
},
{
"name": "CVE-2022-26488",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26488"
},
{
"name": "CVE-2025-37854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37854"
},
{
"name": "CVE-2025-11494",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11494"
},
{
"name": "CVE-2024-6345",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6345"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2018-18384",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-18384"
},
{
"name": "CVE-2025-38473",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38473"
},
{
"name": "CVE-2025-38113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38113"
},
{
"name": "CVE-2020-11023",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11023"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2023-32665",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32665"
},
{
"name": "CVE-2025-23148",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23148"
},
{
"name": "CVE-2025-38361",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38361"
},
{
"name": "CVE-2025-38470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38470"
},
{
"name": "CVE-2023-23916",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23916"
},
{
"name": "CVE-2025-38181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38181"
},
{
"name": "CVE-2025-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38391"
},
{
"name": "CVE-2025-38248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38248"
},
{
"name": "CVE-2025-66418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66418"
},
{
"name": "CVE-2025-40351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40351"
},
{
"name": "CVE-2022-3570",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3570"
},
{
"name": "CVE-2016-9844",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-9844"
},
{
"name": "CVE-2025-40087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40087"
},
{
"name": "CVE-2025-23147",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23147"
},
{
"name": "CVE-2024-8088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8088"
},
{
"name": "CVE-2025-48734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48734"
},
{
"name": "CVE-2025-39752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39752"
},
{
"name": "CVE-2026-25646",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25646"
}
],
"initial_release_date": "2026-02-26T00:00:00",
"last_revision_date": "2026-02-26T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0218",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-02-26T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits VMware. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer un d\u00e9ni de service \u00e0 distance, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits VMware",
"vendor_advisories": [
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37096",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37096"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37092",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37092"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37102",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37102"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37078",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37078"
},
{
"published_at": "2026-02-26",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37109",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37109"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37087",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37087"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37090",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37090"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37077",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37077"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37098",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37098"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37079",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37079"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37101",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37101"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37104",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37104"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37080",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37080"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37097",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37097"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37083",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37083"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37086",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37086"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37082",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37082"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37100",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37100"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37099",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37099"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37081",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37081"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37089",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37089"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37076",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37076"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37088",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37088"
},
{
"published_at": "2026-02-26",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36986",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36986"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-27",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37103"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37084",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37084"
},
{
"published_at": "2026-02-26",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37110",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37110"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37093",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37093"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37085",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37085"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37095",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37095"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37094",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37094"
}
]
}
FKIE_CVE-2024-8244
Vulnerability from fkie_nvd - Published: 2025-08-06 16:15 - Updated: 2026-06-17 08:22| Vendor | Product | Version |
|---|
{
"affected": [
{
"affectedData": [
{
"collectionURL": "https://pkg.go.dev",
"defaultStatus": "affected",
"packageName": "path/filepath",
"product": "path/filepath",
"vendor": "Go standard library"
}
],
"source": "security@golang.org"
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "The filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress."
},
{
"lang": "es",
"value": "Las funciones filepath.Walk y filepath.WalkDir est\u00e1n documentadas como que no siguen enlaces simb\u00f3licos, pero ambas funciones son susceptibles a una condici\u00f3n de ejecuci\u00f3n TOCTOU (tiempo de verificaci\u00f3n/tiempo de uso) donde una parte de la ruta que se est\u00e1 recorriendo se reemplaza con un enlace simb\u00f3lico mientras el recorrido est\u00e1 en progreso."
}
],
"id": "CVE-2024-8244",
"lastModified": "2026-06-17T08:22:11.463",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "HIGH",
"attackVector": "NETWORK",
"availabilityImpact": "NONE",
"baseScore": 3.7,
"baseSeverity": "LOW",
"confidentialityImpact": "LOW",
"integrityImpact": "NONE",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:H/PR:N/UI:N/S:U/C:L/I:N/A:N",
"version": "3.1"
},
"exploitabilityScore": 2.2,
"impactScore": 1.4,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-8244",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-11-03T19:47:22.354639Z",
"version": "2.0.3"
}
}
]
},
"published": "2025-08-06T16:15:28.080",
"references": [
{
"source": "security@golang.org",
"url": "https://go.dev/issue/70007"
},
{
"source": "security@golang.org",
"url": "https://pkg.go.dev/vuln/GO-2025-9999"
}
],
"sourceIdentifier": "security@golang.org",
"vulnStatus": "Deferred"
}
GHSA-V9VR-W93G-QPH7
Vulnerability from github – Published: 2025-08-06 18:31 – Updated: 2025-08-06 21:31The filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress.
{
"affected": [],
"aliases": [
"CVE-2024-8244"
],
"database_specific": {
"cwe_ids": [],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2025-08-06T16:15:28Z",
"severity": "MODERATE"
},
"details": "The filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress.",
"id": "GHSA-v9vr-w93g-qph7",
"modified": "2025-08-06T21:31:39Z",
"published": "2025-08-06T18:31:20Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-8244"
},
{
"type": "WEB",
"url": "https://go.dev/issue/70007"
},
{
"type": "WEB",
"url": "https://pkg.go.dev/vuln/GO-2025-9999"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:L/I:L/A:N",
"type": "CVSS_V3"
}
]
}
OESA-2026-3879 (CVE-2024-8244)
Vulnerability from osv_openeuler – Published: 2026-09-20 13:22 – Updated: 2026-09-20 13:22 – Source websiteGit Large File Storage (LFS) replaces large files such as audio samples, videos, datasets, and graphics with text pointers inside Git, while storing the file contents on a remote server.
Security Fix(es):
The filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress.(CVE-2024-8244)
Gitk is a Tcl/Tk based Git history browser. Starting with 1.7.0, when a user clones an untrusted repository and runs gitk without additional command arguments, files for which the user has write permission can be created and truncated. The option Support per-file encoding must have been enabled before in Gitk's Preferences. This option is disabled by default. The same happens when Show origin of this line is used in the main window (regardless of whether Support per-file encoding is enabled or not). This vulnerability is fixed in 2.43.7, 2.44.4, 2.45.4, 2.46.4, 2.47.3, 2.48.2, 2.49.1, and 2.50.1.(CVE-2025-27613)
Proxy-Authorization and Proxy-Authenticate headers persisted on cross-origin redirects potentially leaking sensitive information.(CVE-2025-4673)
If the PATH environment variable contains paths which are executables (rather than just directories), passing certain strings to LookPath ("", ".", and ".."), can result in the binaries listed in the PATH being unexpectedly returned.(CVE-2025-47906)
When using http.CrossOriginProtection, the AddInsecureBypassPattern method can unexpectedly bypass more requests than intended. CrossOriginProtection then skips validation, but forwards the original request path, which may be served by a different handler without the intended security protections.(CVE-2025-47910)
The Parse function permits values other than IPv6 addresses to be included in square brackets within the host component of a URL. RFC 3986 permits IPv6 addresses to be included within the host component, enclosed within square brackets. For example: "http://[::1]/". IPv4 addresses and hostnames must not appear within square brackets. Parse did not enforce this requirement.(CVE-2025-47912)
SSH Agent servers do not validate the size of messages when processing new identity requests, which may cause the program to panic if the message is malformed due to an out of bounds read.(CVE-2025-47914)
Git is a fast, scalable, distributed revision control system with an unusually rich command set that provides both high-level operations and full access to internals. When cloning a repository Git knows to optionally fetch a bundle advertised by the remote server, which allows the server-side to offload parts of the clone to a CDN. The Git client does not perform sufficient validation of the advertised bundles, which allows the remote side to perform protocol injection. This protocol injection can cause the client to write the fetched bundle to a location controlled by the adversary. The fetched content is fully controlled by the server, which can in the worst case lead to arbitrary code execution. The use of bundle URIs is not enabled by default and can be controlled by the bundle.heuristic config option. Some cases of the vulnerability require that the adversary is in control of where a repository will be cloned to. This either requires social engineering or a recursive clone with submodules. These cases can thus be avoided by disabling recursive clones. This vulnerability is fixed in v2.43.7, v2.44.4, v2.45.4, v2.46.4, v2.47.3, v2.48.2, v2.49.1, and v2.50.1.(CVE-2025-48385)
SSH servers parsing GSSAPI authentication requests do not validate the number of mechanisms specified in the request, allowing an attacker to cause unbounded memory consumption.(CVE-2025-58181)
A vulnerability was found in Google Go up to 1.25.1 (Programming Language Software). It has been rated as problematic.Using CWE to declare the problem leads to CWE-770. The product allocates a reusable resource or group of resources on behalf of an actor without imposing any restrictions on the size or number of resources that can be allocated, in violation of the intended security policy for that actor.Impacted is availability.Upgrading to version 1.25.2 eliminates this vulnerability.(CVE-2025-58183)
Parsing a maliciously crafted DER payload could allocate large amounts of memory, causing memory exhaustion.(CVE-2025-58185)
Despite HTTP headers having a default limit of 1MB, the number of cookies that can be parsed does not have a limit. By sending a lot of very small cookies such as "a=;", an attacker can make an HTTP server allocate a large amount of structs, causing large memory consumption.(CVE-2025-58186)
Due to the design of the name constraint checking algorithm, the processing time of some inputs scale non-linearly with respect to the size of the certificate. This affects programs which validate arbitrary certificate chains.(CVE-2025-58187)
When Conn.Handshake fails during ALPN negotiation the error contains attacker controlled information (the ALPN protocols sent by the client) which is not escaped.(CVE-2025-58189)
The processing time for parsing some invalid inputs scales non-linearly with respect to the size of the input. This affects programs which parse untrusted PEM inputs.(CVE-2025-61723)
The Reader.ReadResponse function constructs a response string through repeated string concatenation of lines. When the number of lines in a response is large, this can cause excessive CPU consumption.(CVE-2025-61724)
The net/url package in the Go standard library does not impose a limit on the number of query parameters in a query string. While the overall size of query parameters in URLs is generally constrained by the maximum request header size, the net/http.Request.ParseForm method is capable of parsing large URL-encoded forms. An attacker can exploit this by submitting a form containing an excessive number of unique query parameters, leading to disproportionate memory consumption and potentially causing a Denial of Service (DoS) condition in the affected application.(CVE-2025-61726)
An excluded subdomain constraint in a certificate chain does not restrict the usage of wildcard SANs in the leaf certificate. For example a constraint that excludes the subdomain test.example.com does not prevent a leaf certificate from claiming the SAN *.example.com.(CVE-2025-61727)
Within HostnameError.Error(), when constructing an error string, there is no limit to the number of hosts that will be printed out. Furthermore, the error string is constructed by repeated string concatenation, leading to quadratic runtime. Therefore, a certificate provided by a malicious actor can result in excessive resource consumption.(CVE-2025-61729)
During session resumption in crypto/tls, if the underlying Config has its ClientCAs or RootCAs fields mutated between the initial handshake and the resumed handshake, the resumed handshake may succeed when it should have failed. This may happen when a user calls Config.Clone and mutates the returned Config, or uses Config.GetConfigForClient. This can cause a client to resume a session with a server that it would not have resumed with during the initial handshake, or cause a server to resume a session with a client that it would not have resumed with during the initial handshake.(CVE-2025-68121)
['announces:', "We have just released Go versions 1.26.1 and 1.25.8, minor point releases.\n\nThese releases include 5 security fixes following the security policy:\n\n * crypto/x509: incorrect enforcement of email constraints\n\n When verifying a certificate chain which contains a certificate containing\n multiple email address constraints (composed of the full email address)\n which share common local portions (the portion of the address before the '@'\n character) but different domain portions (the portion of the address after\n the '@' character), these constraints will not be properly applied, and only\n the last constraint will be considered.\n\n This can allow certificates in the chain containing email addresses which\n are either not permitted or excluded by the relevant constraints to be\n returned by calls to Certificate.Verify. Since the name constraint checks\n happen after chain building is complete, this only applies to certificate\n chains which chain to trusted roots (root certificates either in\n VerifyOptions.Roots or in the system root certificate pool), requiring a\n trusted CA to issue certificates containing either not permitted or\n excluded email addresses.\n\n This issue only affects Go 1.26.\n\n Thanks to Jakub Ciolek for reporting this issue.\n\n This is CVE-2026-27137 and Go issue", '.\n\n * crypto/x509: panic in name constraint checking for malformed certificates\n\n Certificate verification can panic when a certificate in the chain has an\n empty DNS name and another certificate in the chain has excluded name\n constraints. This can crash programs that are either directly verifying\n X.509 certificate chains, or those that use TLS.\n\n Since the name constraint checks happen after chain building is complete,\n this only applies to certificate chains which chain to trusted roots (root\n certificates either in VerifyOptions.Roots or in the system root certificate\n pool), requiring a trusted CA to issue certificates containing malformed DNS\n names.\n\n This issue only affects Go 1.26.\n\n Thanks to Jakub Ciolek for reporting this issue.\n\n This is CVE-2026-27138 and Go issue', '.\n\n * html/template: URLs in meta content attribute actions are not escaped\n\n Actions which insert URLs into the content attribute of HTML meta tags are\n not escaped. This can allow XSS if the meta tag also has an http-equiv\n attribute with the value "refresh".\n\n A new GODEBUG setting has been added, htmlmetacontenturlescape, which can be\n used to disable escaping URLs in actions in the meta content attribute which\n follow "url=" by setting htmlmetacontenturlescape=0.\n\n This is CVE-2026-27142 and Go issue', '.\n\n * net/url: reject IPv6 literal not at start of host\n\n The Go standard library function net/url.Parse insufficiently\n validated the host/authority component and accepted some invalid URLs\n by effectively treating garbage before an IP-literal as ignorable.\n The function should have rejected this as invalid.\n\n To prevent this behavior, net/url.Parse now rejects IPv6 literals\n that do not appear at the start of the host subcomponent of a URL.\n\n Thanks to Masaki Hara (', ') of Wantedly.\n\n This is CVE-2026-25679 and Go issue', '.\n\n * os: FileInfo can escape from a Root\n\n On Unix platforms, when listing the contents of a directory using\n File.ReadDir or File.Readdir the returned FileInfo could reference\n a file outside of the Root in which the File was opened.\n\n The contents of the FileInfo were populated using the lstat system\n call, which takes the path to the file as a parameter. If a component\n of the full path of the file described by the FileInfo is replaced with\n a symbolic link, the target of the lstat can be directed to another\n location on the filesystem.\n\n The impact of this escape is limited to reading metadata provided by\n lstat from arbitrary locations on the filesystem. This could be used\n to p(CVE-2026-25679)
When verifying a certificate chain which contains a certificate containing multiple email address constraints which share common local portions but different domain portions, these constraints will not be properly applied, and only the last constraint will be considered.(CVE-2026-27137)
Due to missing nil check, sending 0x0a-0x0f HTTP/2 frames will cause a running server to panic(CVE-2026-27141)
During chain building, the amount of work that is done is not correctly limited when a large number of intermediate certificates are passed in VerifyOptions.Intermediates, which can lead to a denial of service. This affects both direct users of crypto/x509 and users of crypto/tls.(CVE-2026-32280)
Validating certificate chains which use policies is unexpectedly inefficient when certificates in the chain contain a very large number of policy mappings, possibly causing denial of service. This only affects validation of otherwise trusted certificate chains, issued by a root CA in the VerifyOptions.Roots CertPool, or in the system certificate pool.(CVE-2026-32281)
On Linux, if the target of Root.Chmod is replaced with a symlink while the chmod operation is in progress, Chmod can operate on the target of the symlink, even when the target lies outside the root. The Linux fchmodat syscall silently ignores the AT_SYMLINK_NOFOLLOW flag, which Root.Chmod uses to avoid symlink traversal. Root.Chmod checks its target before acting and returns an error if the target is a symlink lying outside the root, so the impact is limited to cases where the target is replaced with a symlink between the check and operation.(CVE-2026-32282)
When verifying a certificate chain containing excluded DNS constraints, these constraints are not correctly applied to wildcard DNS SANs which use a different case than the constraint. This only affects validation of otherwise trusted certificate chains, issued by a root CA in the VerifyOptions.Roots CertPool, or in the system certificate pool.(CVE-2026-33810)
When using LookupCNAME with the cgo DNS resolver, a very long CNAME response can trigger a double-free of C memory and a crash.(CVE-2026-33811)
A vulnerability was found in the encoding/asn1 package in Go. Enforce a recursion limit in Unmarshal to prevent stack exhaustion when parsing deeply-nested, recursive structures. An attacker could provide a specially crafted, deeply-nested Abstract Syntax Notation One (ASN.1) structure, leading to excessive recursion during the Unmarshal operation. This could result in stack exhaustion and a Denial of Service (DoS) condition.(CVE-2026-33818)
When returning errors, functions in the net/textproto package would include its input as part of the error. This might allow an attacker to inject misleading content to errors that are printed or logged.(CVE-2026-42507)
Parsing an invalid SVCB or HTTPS RR can panic when the size of a parameter value overflows the message buffer.(CVE-2026-46600)
When a server is configured to support unencrypted HTTP/2, it reads a few bytes from each new connection to see if they contain the HTTP/2 client preface. ReadHeaderTimeout is unexpectedly not being applied when doing this. This oversight could allow a remote attacker to maintain open connections indefinitely, potentially leading to a Denial of Service (DoS) by exhausting server resources.(CVE-2026-56853)
A flaw was found in the encoding/xml package of Go. The DecodeElement function failed to correctly track recursion depth, causing the depth counter to reset and never fire, which could lead to stack exhaustion. A remote attacker could exploit this vulnerability by providing a specially crafted XML input, resulting in a Denial of Service (DoS) for the affected application.(CVE-2026-56859)
Handshake messages, such as KeyUpdate, are always considered as state-advancing, regardless of whether a handshake has been completed or not. As a result, a malicious client can keep sending KeyUpdate messages to force the server to keep performing key derivation operations indefinitely.(CVE-2026-56862)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"git-lfs-3.6.1-2.oe2403sp1.aarch64.rpm"
],
"src": [
"git-lfs-3.6.1-2.oe2403sp1.src.rpm"
],
"x86_64": [
"git-lfs-3.6.1-2.oe2403sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:24.03-LTS-SP1",
"name": "git-lfs",
"purl": "pkg:rpm/openEuler/git-lfs\u0026distro=openEuler-24.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "3.6.1-2.oe2403sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "Git Large File Storage (LFS) replaces large files such as audio samples, videos, datasets, and graphics with text pointers inside Git, while storing the file contents on a remote server.\r\n\r\nSecurity Fix(es):\n\nThe filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress.(CVE-2024-8244)\n\nGitk is a Tcl/Tk based Git history browser. Starting with 1.7.0, when a user clones an untrusted repository and runs gitk without additional command arguments, files for which the user has write permission can be created and truncated. The option Support per-file encoding must have been enabled before in Gitk\u0026apos;s Preferences. This option is disabled by default. The same happens when Show origin of this line is used in the main window (regardless of whether Support per-file encoding is enabled or not). This vulnerability is fixed in 2.43.7, 2.44.4, 2.45.4, 2.46.4, 2.47.3, 2.48.2, 2.49.1, and 2.50.1.(CVE-2025-27613)\n\nProxy-Authorization and Proxy-Authenticate headers persisted on cross-origin redirects potentially leaking sensitive information.(CVE-2025-4673)\n\nIf the PATH environment variable contains paths which are executables (rather than just directories), passing certain strings to LookPath (\u0026quot;\u0026quot;, \u0026quot;.\u0026quot;, and \u0026quot;..\u0026quot;), can result in the binaries listed in the PATH being unexpectedly returned.(CVE-2025-47906)\n\nWhen using http.CrossOriginProtection, the AddInsecureBypassPattern method can unexpectedly bypass more requests than intended. CrossOriginProtection then skips validation, but forwards the original request path, which may be served by a different handler without the intended security protections.(CVE-2025-47910)\n\nThe Parse function permits values other than IPv6 addresses to be included in square brackets within the host component of a URL. RFC 3986 permits IPv6 addresses to be included within the host component, enclosed within square brackets. For example: \u0026quot;http://[::1]/\u0026quot;. IPv4 addresses and hostnames must not appear within square brackets. Parse did not enforce this requirement.(CVE-2025-47912)\n\nSSH Agent servers do not validate the size of messages when processing new identity requests, which may cause the program to panic if the message is malformed due to an out of bounds read.(CVE-2025-47914)\n\nGit is a fast, scalable, distributed revision control system with an unusually rich command set that provides both high-level operations and full access to internals. When cloning a repository Git knows to optionally fetch a bundle advertised by the remote server, which allows the server-side to offload parts of the clone to a CDN. The Git client does not perform sufficient validation of the advertised bundles, which allows the remote side to perform protocol injection. This protocol injection can cause the client to write the fetched bundle to a location controlled by the adversary. The fetched content is fully controlled by the server, which can in the worst case lead to arbitrary code execution. The use of bundle URIs is not enabled by default and can be controlled by the bundle.heuristic config option. Some cases of the vulnerability require that the adversary is in control of where a repository will be cloned to. This either requires social engineering or a recursive clone with submodules. These cases can thus be avoided by disabling recursive clones. This vulnerability is fixed in v2.43.7, v2.44.4, v2.45.4, v2.46.4, v2.47.3, v2.48.2, v2.49.1, and v2.50.1.(CVE-2025-48385)\n\nSSH servers parsing GSSAPI authentication requests do not validate the number of mechanisms specified in the request, allowing an attacker to cause unbounded memory consumption.(CVE-2025-58181)\n\nA vulnerability was found in Google Go up to 1.25.1 (Programming Language Software). It has been rated as problematic.Using CWE to declare the problem leads to CWE-770. The product allocates a reusable resource or group of resources on behalf of an actor without imposing any restrictions on the size or number of resources that can be allocated, in violation of the intended security policy for that actor.Impacted is availability.Upgrading to version 1.25.2 eliminates this vulnerability.(CVE-2025-58183)\n\nParsing a maliciously crafted DER payload could allocate large amounts of memory, causing memory exhaustion.(CVE-2025-58185)\n\nDespite HTTP headers having a default limit of 1MB, the number of cookies that can be parsed does not have a limit. By sending a lot of very small cookies such as \u0026quot;a=;\u0026quot;, an attacker can make an HTTP server allocate a large amount of structs, causing large memory consumption.(CVE-2025-58186)\n\nDue to the design of the name constraint checking algorithm, the processing time of some inputs scale non-linearly with respect to the size of the certificate. This affects programs which validate arbitrary certificate chains.(CVE-2025-58187)\n\nWhen Conn.Handshake fails during ALPN negotiation the error contains attacker controlled information (the ALPN protocols sent by the client) which is not escaped.(CVE-2025-58189)\n\nThe processing time for parsing some invalid inputs scales non-linearly with respect to the size of the input. This affects programs which parse untrusted PEM inputs.(CVE-2025-61723)\n\nThe Reader.ReadResponse function constructs a response string through repeated string concatenation of lines. When the number of lines in a response is large, this can cause excessive CPU consumption.(CVE-2025-61724)\n\nThe net/url package in the Go standard library does not impose a limit on the number of query parameters in a query string. While the overall size of query parameters in URLs is generally constrained by the maximum request header size, the net/http.Request.ParseForm method is capable of parsing large URL-encoded forms. An attacker can exploit this by submitting a form containing an excessive number of unique query parameters, leading to disproportionate memory consumption and potentially causing a Denial of Service (DoS) condition in the affected application.(CVE-2025-61726)\n\nAn excluded subdomain constraint in a certificate chain does not restrict the usage of wildcard SANs in the leaf certificate. For example a constraint that excludes the subdomain test.example.com does not prevent a leaf certificate from claiming the SAN *.example.com.(CVE-2025-61727)\n\nWithin HostnameError.Error(), when constructing an error string, there is no limit to the number of hosts that will be printed out. Furthermore, the error string is constructed by repeated string concatenation, leading to quadratic runtime. Therefore, a certificate provided by a malicious actor can result in excessive resource consumption.(CVE-2025-61729)\n\nDuring session resumption in crypto/tls, if the underlying Config has its ClientCAs or RootCAs fields mutated between the initial handshake and the resumed handshake, the resumed handshake may succeed when it should have failed. This may happen when a user calls Config.Clone and mutates the returned Config, or uses Config.GetConfigForClient. This can cause a client to resume a session with a server that it would not have resumed with during the initial handshake, or cause a server to resume a session with a client that it would not have resumed with during the initial handshake.(CVE-2025-68121)\n\n[\u0026apos;announces:\u0026apos;, \u0026quot;We have just released Go versions 1.26.1 and 1.25.8, minor point releases.\\n\\nThese releases include 5 security fixes following the security policy:\\n\\n * crypto/x509: incorrect enforcement of email constraints\\n\\n When verifying a certificate chain which contains a certificate containing\\n multiple email address constraints (composed of the full email address)\\n which share common local portions (the portion of the address before the \u0026apos;@\u0026apos;\\n character) but different domain portions (the portion of the address after\\n the \u0026apos;@\u0026apos; character), these constraints will not be properly applied, and only\\n the last constraint will be considered.\\n\\n This can allow certificates in the chain containing email addresses which\\n are either not permitted or excluded by the relevant constraints to be\\n returned by calls to Certificate.Verify. Since the name constraint checks\\n happen after chain building is complete, this only applies to certificate\\n chains which chain to trusted roots (root certificates either in\\n VerifyOptions.Roots or in the system root certificate pool), requiring a\\n trusted CA to issue certificates containing either not permitted or\\n excluded email addresses.\\n\\n This issue only affects Go 1.26.\\n\\n Thanks to Jakub Ciolek for reporting this issue.\\n\\n This is CVE-2026-27137 and Go issue\u0026quot;, \u0026apos;.\\n\\n * crypto/x509: panic in name constraint checking for malformed certificates\\n\\n Certificate verification can panic when a certificate in the chain has an\\n empty DNS name and another certificate in the chain has excluded name\\n constraints. This can crash programs that are either directly verifying\\n X.509 certificate chains, or those that use TLS.\\n\\n Since the name constraint checks happen after chain building is complete,\\n this only applies to certificate chains which chain to trusted roots (root\\n certificates either in VerifyOptions.Roots or in the system root certificate\\n pool), requiring a trusted CA to issue certificates containing malformed DNS\\n names.\\n\\n This issue only affects Go 1.26.\\n\\n Thanks to Jakub Ciolek for reporting this issue.\\n\\n This is CVE-2026-27138 and Go issue\u0026apos;, \u0026apos;.\\n\\n * html/template: URLs in meta content attribute actions are not escaped\\n\\n Actions which insert URLs into the content attribute of HTML meta tags are\\n not escaped. This can allow XSS if the meta tag also has an http-equiv\\n attribute with the value \u0026quot;refresh\u0026quot;.\\n\\n A new GODEBUG setting has been added, htmlmetacontenturlescape, which can be\\n used to disable escaping URLs in actions in the meta content attribute which\\n follow \u0026quot;url=\u0026quot; by setting htmlmetacontenturlescape=0.\\n\\n This is CVE-2026-27142 and Go issue\u0026apos;, \u0026apos;.\\n\\n * net/url: reject IPv6 literal not at start of host\\n\\n The Go standard library function net/url.Parse insufficiently\\n validated the host/authority component and accepted some invalid URLs\\n by effectively treating garbage before an IP-literal as ignorable.\\n The function should have rejected this as invalid.\\n\\n To prevent this behavior, net/url.Parse now rejects IPv6 literals\\n that do not appear at the start of the host subcomponent of a URL.\\n\\n Thanks to Masaki Hara (\u0026apos;, \u0026apos;) of Wantedly.\\n\\n This is CVE-2026-25679 and Go issue\u0026apos;, \u0026apos;.\\n\\n * os: FileInfo can escape from a Root\\n\\n On Unix platforms, when listing the contents of a directory using\\n File.ReadDir or File.Readdir the returned FileInfo could reference\\n a file outside of the Root in which the File was opened.\\n\\n The contents of the FileInfo were populated using the lstat system\\n call, which takes the path to the file as a parameter. If a component\\n of the full path of the file described by the FileInfo is replaced with\\n a symbolic link, the target of the lstat can be directed to another\\n location on the filesystem.\\n\\n The impact of this escape is limited to reading metadata provided by\\n lstat from arbitrary locations on the filesystem. This could be used\\n to p(CVE-2026-25679)\n\nWhen verifying a certificate chain which contains a certificate containing multiple email address constraints which share common local portions but different domain portions, these constraints will not be properly applied, and only the last constraint will be considered.(CVE-2026-27137)\n\nDue to missing nil check, sending 0x0a-0x0f HTTP/2 frames will cause a running server to panic(CVE-2026-27141)\n\nDuring chain building, the amount of work that is done is not correctly limited when a large number of intermediate certificates are passed in VerifyOptions.Intermediates, which can lead to a denial of service. This affects both direct users of crypto/x509 and users of crypto/tls.(CVE-2026-32280)\n\nValidating certificate chains which use policies is unexpectedly inefficient when certificates in the chain contain a very large number of policy mappings, possibly causing denial of service. This only affects validation of otherwise trusted certificate chains, issued by a root CA in the VerifyOptions.Roots CertPool, or in the system certificate pool.(CVE-2026-32281)\n\nOn Linux, if the target of Root.Chmod is replaced with a symlink while the chmod operation is in progress, Chmod can operate on the target of the symlink, even when the target lies outside the root. The Linux fchmodat syscall silently ignores the AT_SYMLINK_NOFOLLOW flag, which Root.Chmod uses to avoid symlink traversal. Root.Chmod checks its target before acting and returns an error if the target is a symlink lying outside the root, so the impact is limited to cases where the target is replaced with a symlink between the check and operation.(CVE-2026-32282)\n\nWhen verifying a certificate chain containing excluded DNS constraints, these constraints are not correctly applied to wildcard DNS SANs which use a different case than the constraint. This only affects validation of otherwise trusted certificate chains, issued by a root CA in the VerifyOptions.Roots CertPool, or in the system certificate pool.(CVE-2026-33810)\n\nWhen using LookupCNAME with the cgo DNS resolver, a very long CNAME response can trigger a double-free of C memory and a crash.(CVE-2026-33811)\n\nA vulnerability was found in the encoding/asn1 package in Go. Enforce a recursion limit in Unmarshal to prevent stack exhaustion when parsing deeply-nested, recursive structures. An attacker could provide a specially crafted, deeply-nested Abstract Syntax Notation One (ASN.1) structure, leading to excessive recursion during the Unmarshal operation. This could result in stack exhaustion and a Denial of Service (DoS) condition.(CVE-2026-33818)\n\nWhen returning errors, functions in the net/textproto package would include its input as part of the error. This might allow an attacker to inject misleading content to errors that are printed or logged.(CVE-2026-42507)\n\nParsing an invalid SVCB or HTTPS RR can panic when the size of a parameter value overflows the message buffer.(CVE-2026-46600)\n\nWhen a server is configured to support unencrypted HTTP/2, it reads a few bytes from each new connection to see if they contain the HTTP/2 client preface. ReadHeaderTimeout is unexpectedly not being applied when doing this. This oversight could allow a remote attacker to maintain open connections indefinitely, potentially leading to a Denial of Service (DoS) by exhausting server resources.(CVE-2026-56853)\n\nA flaw was found in the encoding/xml package of Go. The DecodeElement function failed to correctly track recursion depth, causing the depth counter to reset and never fire, which could lead to stack exhaustion. A remote attacker could exploit this vulnerability by providing a specially crafted XML input, resulting in a Denial of Service (DoS) for the affected application.(CVE-2026-56859)\n\nHandshake messages, such as KeyUpdate, are always considered as state-advancing, regardless of whether a handshake has been completed or not. As a result, a malicious client can keep sending KeyUpdate messages to force the server to keep performing key derivation operations indefinitely.(CVE-2026-56862)",
"id": "OESA-2026-3879",
"modified": "2026-09-20T13:22:51Z",
"published": "2026-09-20T13:22:51Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2026-3879"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-8244"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-27613"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-4673"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-47906"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-47910"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-47912"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-47914"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-48385"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58181"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58183"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58185"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58186"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58187"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58189"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61723"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61724"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61726"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61727"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61729"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-68121"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-25679"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-27137"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-27141"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-32280"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-32281"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-32282"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-33810"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-33811"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-33818"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-42507"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46600"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-56853"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-56859"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-56862"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:C/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "git-lfs security update",
"upstream": [
"CVE-2024-8244",
"CVE-2025-27613",
"CVE-2025-4673",
"CVE-2025-47906",
"CVE-2025-47910",
"CVE-2025-47912",
"CVE-2025-47914",
"CVE-2025-48385",
"CVE-2025-58181",
"CVE-2025-58183",
"CVE-2025-58185",
"CVE-2025-58186",
"CVE-2025-58187",
"CVE-2025-58189",
"CVE-2025-61723",
"CVE-2025-61724",
"CVE-2025-61726",
"CVE-2025-61727",
"CVE-2025-61729",
"CVE-2025-68121",
"CVE-2026-25679",
"CVE-2026-27137",
"CVE-2026-27141",
"CVE-2026-32280",
"CVE-2026-32281",
"CVE-2026-32282",
"CVE-2026-33810",
"CVE-2026-33811",
"CVE-2026-33818",
"CVE-2026-42507",
"CVE-2026-46600",
"CVE-2026-56853",
"CVE-2026-56859",
"CVE-2026-56862"
]
}
OESA-2026-3880 (CVE-2024-8244)
Vulnerability from osv_openeuler – Published: 2026-09-20 13:22 – Updated: 2026-09-20 13:22 – Source websiteGit Large File Storage (LFS) replaces large files such as audio samples, videos, datasets, and graphics with text pointers inside Git, while storing the file contents on a remote server.
Security Fix(es):
The filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress.(CVE-2024-8244)
Gitk is a Tcl/Tk based Git history browser. Starting with 1.7.0, when a user clones an untrusted repository and runs gitk without additional command arguments, files for which the user has write permission can be created and truncated. The option Support per-file encoding must have been enabled before in Gitk's Preferences. This option is disabled by default. The same happens when Show origin of this line is used in the main window (regardless of whether Support per-file encoding is enabled or not). This vulnerability is fixed in 2.43.7, 2.44.4, 2.45.4, 2.46.4, 2.47.3, 2.48.2, 2.49.1, and 2.50.1.(CVE-2025-27613)
Proxy-Authorization and Proxy-Authenticate headers persisted on cross-origin redirects potentially leaking sensitive information.(CVE-2025-4673)
If the PATH environment variable contains paths which are executables (rather than just directories), passing certain strings to LookPath ("", ".", and ".."), can result in the binaries listed in the PATH being unexpectedly returned.(CVE-2025-47906)
When using http.CrossOriginProtection, the AddInsecureBypassPattern method can unexpectedly bypass more requests than intended. CrossOriginProtection then skips validation, but forwards the original request path, which may be served by a different handler without the intended security protections.(CVE-2025-47910)
The Parse function permits values other than IPv6 addresses to be included in square brackets within the host component of a URL. RFC 3986 permits IPv6 addresses to be included within the host component, enclosed within square brackets. For example: "http://[::1]/". IPv4 addresses and hostnames must not appear within square brackets. Parse did not enforce this requirement.(CVE-2025-47912)
SSH Agent servers do not validate the size of messages when processing new identity requests, which may cause the program to panic if the message is malformed due to an out of bounds read.(CVE-2025-47914)
Git is a fast, scalable, distributed revision control system with an unusually rich command set that provides both high-level operations and full access to internals. When cloning a repository Git knows to optionally fetch a bundle advertised by the remote server, which allows the server-side to offload parts of the clone to a CDN. The Git client does not perform sufficient validation of the advertised bundles, which allows the remote side to perform protocol injection. This protocol injection can cause the client to write the fetched bundle to a location controlled by the adversary. The fetched content is fully controlled by the server, which can in the worst case lead to arbitrary code execution. The use of bundle URIs is not enabled by default and can be controlled by the bundle.heuristic config option. Some cases of the vulnerability require that the adversary is in control of where a repository will be cloned to. This either requires social engineering or a recursive clone with submodules. These cases can thus be avoided by disabling recursive clones. This vulnerability is fixed in v2.43.7, v2.44.4, v2.45.4, v2.46.4, v2.47.3, v2.48.2, v2.49.1, and v2.50.1.(CVE-2025-48385)
SSH servers parsing GSSAPI authentication requests do not validate the number of mechanisms specified in the request, allowing an attacker to cause unbounded memory consumption.(CVE-2025-58181)
A vulnerability was found in Google Go up to 1.25.1 (Programming Language Software). It has been rated as problematic.Using CWE to declare the problem leads to CWE-770. The product allocates a reusable resource or group of resources on behalf of an actor without imposing any restrictions on the size or number of resources that can be allocated, in violation of the intended security policy for that actor.Impacted is availability.Upgrading to version 1.25.2 eliminates this vulnerability.(CVE-2025-58183)
Parsing a maliciously crafted DER payload could allocate large amounts of memory, causing memory exhaustion.(CVE-2025-58185)
Despite HTTP headers having a default limit of 1MB, the number of cookies that can be parsed does not have a limit. By sending a lot of very small cookies such as "a=;", an attacker can make an HTTP server allocate a large amount of structs, causing large memory consumption.(CVE-2025-58186)
Due to the design of the name constraint checking algorithm, the processing time of some inputs scale non-linearly with respect to the size of the certificate. This affects programs which validate arbitrary certificate chains.(CVE-2025-58187)
When Conn.Handshake fails during ALPN negotiation the error contains attacker controlled information (the ALPN protocols sent by the client) which is not escaped.(CVE-2025-58189)
The processing time for parsing some invalid inputs scales non-linearly with respect to the size of the input. This affects programs which parse untrusted PEM inputs.(CVE-2025-61723)
The Reader.ReadResponse function constructs a response string through repeated string concatenation of lines. When the number of lines in a response is large, this can cause excessive CPU consumption.(CVE-2025-61724)
The net/url package in the Go standard library does not impose a limit on the number of query parameters in a query string. While the overall size of query parameters in URLs is generally constrained by the maximum request header size, the net/http.Request.ParseForm method is capable of parsing large URL-encoded forms. An attacker can exploit this by submitting a form containing an excessive number of unique query parameters, leading to disproportionate memory consumption and potentially causing a Denial of Service (DoS) condition in the affected application.(CVE-2025-61726)
An excluded subdomain constraint in a certificate chain does not restrict the usage of wildcard SANs in the leaf certificate. For example a constraint that excludes the subdomain test.example.com does not prevent a leaf certificate from claiming the SAN *.example.com.(CVE-2025-61727)
Within HostnameError.Error(), when constructing an error string, there is no limit to the number of hosts that will be printed out. Furthermore, the error string is constructed by repeated string concatenation, leading to quadratic runtime. Therefore, a certificate provided by a malicious actor can result in excessive resource consumption.(CVE-2025-61729)
During session resumption in crypto/tls, if the underlying Config has its ClientCAs or RootCAs fields mutated between the initial handshake and the resumed handshake, the resumed handshake may succeed when it should have failed. This may happen when a user calls Config.Clone and mutates the returned Config, or uses Config.GetConfigForClient. This can cause a client to resume a session with a server that it would not have resumed with during the initial handshake, or cause a server to resume a session with a client that it would not have resumed with during the initial handshake.(CVE-2025-68121)
['announces:', "We have just released Go versions 1.26.1 and 1.25.8, minor point releases.\n\nThese releases include 5 security fixes following the security policy:\n\n * crypto/x509: incorrect enforcement of email constraints\n\n When verifying a certificate chain which contains a certificate containing\n multiple email address constraints (composed of the full email address)\n which share common local portions (the portion of the address before the '@'\n character) but different domain portions (the portion of the address after\n the '@' character), these constraints will not be properly applied, and only\n the last constraint will be considered.\n\n This can allow certificates in the chain containing email addresses which\n are either not permitted or excluded by the relevant constraints to be\n returned by calls to Certificate.Verify. Since the name constraint checks\n happen after chain building is complete, this only applies to certificate\n chains which chain to trusted roots (root certificates either in\n VerifyOptions.Roots or in the system root certificate pool), requiring a\n trusted CA to issue certificates containing either not permitted or\n excluded email addresses.\n\n This issue only affects Go 1.26.\n\n Thanks to Jakub Ciolek for reporting this issue.\n\n This is CVE-2026-27137 and Go issue", '.\n\n * crypto/x509: panic in name constraint checking for malformed certificates\n\n Certificate verification can panic when a certificate in the chain has an\n empty DNS name and another certificate in the chain has excluded name\n constraints. This can crash programs that are either directly verifying\n X.509 certificate chains, or those that use TLS.\n\n Since the name constraint checks happen after chain building is complete,\n this only applies to certificate chains which chain to trusted roots (root\n certificates either in VerifyOptions.Roots or in the system root certificate\n pool), requiring a trusted CA to issue certificates containing malformed DNS\n names.\n\n This issue only affects Go 1.26.\n\n Thanks to Jakub Ciolek for reporting this issue.\n\n This is CVE-2026-27138 and Go issue', '.\n\n * html/template: URLs in meta content attribute actions are not escaped\n\n Actions which insert URLs into the content attribute of HTML meta tags are\n not escaped. This can allow XSS if the meta tag also has an http-equiv\n attribute with the value "refresh".\n\n A new GODEBUG setting has been added, htmlmetacontenturlescape, which can be\n used to disable escaping URLs in actions in the meta content attribute which\n follow "url=" by setting htmlmetacontenturlescape=0.\n\n This is CVE-2026-27142 and Go issue', '.\n\n * net/url: reject IPv6 literal not at start of host\n\n The Go standard library function net/url.Parse insufficiently\n validated the host/authority component and accepted some invalid URLs\n by effectively treating garbage before an IP-literal as ignorable.\n The function should have rejected this as invalid.\n\n To prevent this behavior, net/url.Parse now rejects IPv6 literals\n that do not appear at the start of the host subcomponent of a URL.\n\n Thanks to Masaki Hara (', ') of Wantedly.\n\n This is CVE-2026-25679 and Go issue', '.\n\n * os: FileInfo can escape from a Root\n\n On Unix platforms, when listing the contents of a directory using\n File.ReadDir or File.Readdir the returned FileInfo could reference\n a file outside of the Root in which the File was opened.\n\n The contents of the FileInfo were populated using the lstat system\n call, which takes the path to the file as a parameter. If a component\n of the full path of the file described by the FileInfo is replaced with\n a symbolic link, the target of the lstat can be directed to another\n location on the filesystem.\n\n The impact of this escape is limited to reading metadata provided by\n lstat from arbitrary locations on the filesystem. This could be used\n to p(CVE-2026-25679)
When verifying a certificate chain which contains a certificate containing multiple email address constraints which share common local portions but different domain portions, these constraints will not be properly applied, and only the last constraint will be considered.(CVE-2026-27137)
Due to missing nil check, sending 0x0a-0x0f HTTP/2 frames will cause a running server to panic(CVE-2026-27141)
During chain building, the amount of work that is done is not correctly limited when a large number of intermediate certificates are passed in VerifyOptions.Intermediates, which can lead to a denial of service. This affects both direct users of crypto/x509 and users of crypto/tls.(CVE-2026-32280)
Validating certificate chains which use policies is unexpectedly inefficient when certificates in the chain contain a very large number of policy mappings, possibly causing denial of service. This only affects validation of otherwise trusted certificate chains, issued by a root CA in the VerifyOptions.Roots CertPool, or in the system certificate pool.(CVE-2026-32281)
On Linux, if the target of Root.Chmod is replaced with a symlink while the chmod operation is in progress, Chmod can operate on the target of the symlink, even when the target lies outside the root. The Linux fchmodat syscall silently ignores the AT_SYMLINK_NOFOLLOW flag, which Root.Chmod uses to avoid symlink traversal. Root.Chmod checks its target before acting and returns an error if the target is a symlink lying outside the root, so the impact is limited to cases where the target is replaced with a symlink between the check and operation.(CVE-2026-32282)
When verifying a certificate chain containing excluded DNS constraints, these constraints are not correctly applied to wildcard DNS SANs which use a different case than the constraint. This only affects validation of otherwise trusted certificate chains, issued by a root CA in the VerifyOptions.Roots CertPool, or in the system certificate pool.(CVE-2026-33810)
When using LookupCNAME with the cgo DNS resolver, a very long CNAME response can trigger a double-free of C memory and a crash.(CVE-2026-33811)
A vulnerability was found in the encoding/asn1 package in Go. Enforce a recursion limit in Unmarshal to prevent stack exhaustion when parsing deeply-nested, recursive structures. An attacker could provide a specially crafted, deeply-nested Abstract Syntax Notation One (ASN.1) structure, leading to excessive recursion during the Unmarshal operation. This could result in stack exhaustion and a Denial of Service (DoS) condition.(CVE-2026-33818)
When returning errors, functions in the net/textproto package would include its input as part of the error. This might allow an attacker to inject misleading content to errors that are printed or logged.(CVE-2026-42507)
Parsing an invalid SVCB or HTTPS RR can panic when the size of a parameter value overflows the message buffer.(CVE-2026-46600)
When a server is configured to support unencrypted HTTP/2, it reads a few bytes from each new connection to see if they contain the HTTP/2 client preface. ReadHeaderTimeout is unexpectedly not being applied when doing this. This oversight could allow a remote attacker to maintain open connections indefinitely, potentially leading to a Denial of Service (DoS) by exhausting server resources.(CVE-2026-56853)
A flaw was found in the encoding/xml package of Go. The DecodeElement function failed to correctly track recursion depth, causing the depth counter to reset and never fire, which could lead to stack exhaustion. A remote attacker could exploit this vulnerability by providing a specially crafted XML input, resulting in a Denial of Service (DoS) for the affected application.(CVE-2026-56859)
Handshake messages, such as KeyUpdate, are always considered as state-advancing, regardless of whether a handshake has been completed or not. As a result, a malicious client can keep sending KeyUpdate messages to force the server to keep performing key derivation operations indefinitely.(CVE-2026-56862)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"git-lfs-3.6.1-3.oe2403sp3.aarch64.rpm"
],
"src": [
"git-lfs-3.6.1-3.oe2403sp3.src.rpm"
],
"x86_64": [
"git-lfs-3.6.1-3.oe2403sp3.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:24.03-LTS-SP3",
"name": "git-lfs",
"purl": "pkg:rpm/openEuler/git-lfs\u0026distro=openEuler-24.03-LTS-SP3"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "3.6.1-3.oe2403sp3"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "Git Large File Storage (LFS) replaces large files such as audio samples, videos, datasets, and graphics with text pointers inside Git, while storing the file contents on a remote server.\r\n\r\nSecurity Fix(es):\n\nThe filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress.(CVE-2024-8244)\n\nGitk is a Tcl/Tk based Git history browser. Starting with 1.7.0, when a user clones an untrusted repository and runs gitk without additional command arguments, files for which the user has write permission can be created and truncated. The option Support per-file encoding must have been enabled before in Gitk\u0026apos;s Preferences. This option is disabled by default. The same happens when Show origin of this line is used in the main window (regardless of whether Support per-file encoding is enabled or not). This vulnerability is fixed in 2.43.7, 2.44.4, 2.45.4, 2.46.4, 2.47.3, 2.48.2, 2.49.1, and 2.50.1.(CVE-2025-27613)\n\nProxy-Authorization and Proxy-Authenticate headers persisted on cross-origin redirects potentially leaking sensitive information.(CVE-2025-4673)\n\nIf the PATH environment variable contains paths which are executables (rather than just directories), passing certain strings to LookPath (\u0026quot;\u0026quot;, \u0026quot;.\u0026quot;, and \u0026quot;..\u0026quot;), can result in the binaries listed in the PATH being unexpectedly returned.(CVE-2025-47906)\n\nWhen using http.CrossOriginProtection, the AddInsecureBypassPattern method can unexpectedly bypass more requests than intended. CrossOriginProtection then skips validation, but forwards the original request path, which may be served by a different handler without the intended security protections.(CVE-2025-47910)\n\nThe Parse function permits values other than IPv6 addresses to be included in square brackets within the host component of a URL. RFC 3986 permits IPv6 addresses to be included within the host component, enclosed within square brackets. For example: \u0026quot;http://[::1]/\u0026quot;. IPv4 addresses and hostnames must not appear within square brackets. Parse did not enforce this requirement.(CVE-2025-47912)\n\nSSH Agent servers do not validate the size of messages when processing new identity requests, which may cause the program to panic if the message is malformed due to an out of bounds read.(CVE-2025-47914)\n\nGit is a fast, scalable, distributed revision control system with an unusually rich command set that provides both high-level operations and full access to internals. When cloning a repository Git knows to optionally fetch a bundle advertised by the remote server, which allows the server-side to offload parts of the clone to a CDN. The Git client does not perform sufficient validation of the advertised bundles, which allows the remote side to perform protocol injection. This protocol injection can cause the client to write the fetched bundle to a location controlled by the adversary. The fetched content is fully controlled by the server, which can in the worst case lead to arbitrary code execution. The use of bundle URIs is not enabled by default and can be controlled by the bundle.heuristic config option. Some cases of the vulnerability require that the adversary is in control of where a repository will be cloned to. This either requires social engineering or a recursive clone with submodules. These cases can thus be avoided by disabling recursive clones. This vulnerability is fixed in v2.43.7, v2.44.4, v2.45.4, v2.46.4, v2.47.3, v2.48.2, v2.49.1, and v2.50.1.(CVE-2025-48385)\n\nSSH servers parsing GSSAPI authentication requests do not validate the number of mechanisms specified in the request, allowing an attacker to cause unbounded memory consumption.(CVE-2025-58181)\n\nA vulnerability was found in Google Go up to 1.25.1 (Programming Language Software). It has been rated as problematic.Using CWE to declare the problem leads to CWE-770. The product allocates a reusable resource or group of resources on behalf of an actor without imposing any restrictions on the size or number of resources that can be allocated, in violation of the intended security policy for that actor.Impacted is availability.Upgrading to version 1.25.2 eliminates this vulnerability.(CVE-2025-58183)\n\nParsing a maliciously crafted DER payload could allocate large amounts of memory, causing memory exhaustion.(CVE-2025-58185)\n\nDespite HTTP headers having a default limit of 1MB, the number of cookies that can be parsed does not have a limit. By sending a lot of very small cookies such as \u0026quot;a=;\u0026quot;, an attacker can make an HTTP server allocate a large amount of structs, causing large memory consumption.(CVE-2025-58186)\n\nDue to the design of the name constraint checking algorithm, the processing time of some inputs scale non-linearly with respect to the size of the certificate. This affects programs which validate arbitrary certificate chains.(CVE-2025-58187)\n\nWhen Conn.Handshake fails during ALPN negotiation the error contains attacker controlled information (the ALPN protocols sent by the client) which is not escaped.(CVE-2025-58189)\n\nThe processing time for parsing some invalid inputs scales non-linearly with respect to the size of the input. This affects programs which parse untrusted PEM inputs.(CVE-2025-61723)\n\nThe Reader.ReadResponse function constructs a response string through repeated string concatenation of lines. When the number of lines in a response is large, this can cause excessive CPU consumption.(CVE-2025-61724)\n\nThe net/url package in the Go standard library does not impose a limit on the number of query parameters in a query string. While the overall size of query parameters in URLs is generally constrained by the maximum request header size, the net/http.Request.ParseForm method is capable of parsing large URL-encoded forms. An attacker can exploit this by submitting a form containing an excessive number of unique query parameters, leading to disproportionate memory consumption and potentially causing a Denial of Service (DoS) condition in the affected application.(CVE-2025-61726)\n\nAn excluded subdomain constraint in a certificate chain does not restrict the usage of wildcard SANs in the leaf certificate. For example a constraint that excludes the subdomain test.example.com does not prevent a leaf certificate from claiming the SAN *.example.com.(CVE-2025-61727)\n\nWithin HostnameError.Error(), when constructing an error string, there is no limit to the number of hosts that will be printed out. Furthermore, the error string is constructed by repeated string concatenation, leading to quadratic runtime. Therefore, a certificate provided by a malicious actor can result in excessive resource consumption.(CVE-2025-61729)\n\nDuring session resumption in crypto/tls, if the underlying Config has its ClientCAs or RootCAs fields mutated between the initial handshake and the resumed handshake, the resumed handshake may succeed when it should have failed. This may happen when a user calls Config.Clone and mutates the returned Config, or uses Config.GetConfigForClient. This can cause a client to resume a session with a server that it would not have resumed with during the initial handshake, or cause a server to resume a session with a client that it would not have resumed with during the initial handshake.(CVE-2025-68121)\n\n[\u0026apos;announces:\u0026apos;, \u0026quot;We have just released Go versions 1.26.1 and 1.25.8, minor point releases.\\n\\nThese releases include 5 security fixes following the security policy:\\n\\n * crypto/x509: incorrect enforcement of email constraints\\n\\n When verifying a certificate chain which contains a certificate containing\\n multiple email address constraints (composed of the full email address)\\n which share common local portions (the portion of the address before the \u0026apos;@\u0026apos;\\n character) but different domain portions (the portion of the address after\\n the \u0026apos;@\u0026apos; character), these constraints will not be properly applied, and only\\n the last constraint will be considered.\\n\\n This can allow certificates in the chain containing email addresses which\\n are either not permitted or excluded by the relevant constraints to be\\n returned by calls to Certificate.Verify. Since the name constraint checks\\n happen after chain building is complete, this only applies to certificate\\n chains which chain to trusted roots (root certificates either in\\n VerifyOptions.Roots or in the system root certificate pool), requiring a\\n trusted CA to issue certificates containing either not permitted or\\n excluded email addresses.\\n\\n This issue only affects Go 1.26.\\n\\n Thanks to Jakub Ciolek for reporting this issue.\\n\\n This is CVE-2026-27137 and Go issue\u0026quot;, \u0026apos;.\\n\\n * crypto/x509: panic in name constraint checking for malformed certificates\\n\\n Certificate verification can panic when a certificate in the chain has an\\n empty DNS name and another certificate in the chain has excluded name\\n constraints. This can crash programs that are either directly verifying\\n X.509 certificate chains, or those that use TLS.\\n\\n Since the name constraint checks happen after chain building is complete,\\n this only applies to certificate chains which chain to trusted roots (root\\n certificates either in VerifyOptions.Roots or in the system root certificate\\n pool), requiring a trusted CA to issue certificates containing malformed DNS\\n names.\\n\\n This issue only affects Go 1.26.\\n\\n Thanks to Jakub Ciolek for reporting this issue.\\n\\n This is CVE-2026-27138 and Go issue\u0026apos;, \u0026apos;.\\n\\n * html/template: URLs in meta content attribute actions are not escaped\\n\\n Actions which insert URLs into the content attribute of HTML meta tags are\\n not escaped. This can allow XSS if the meta tag also has an http-equiv\\n attribute with the value \u0026quot;refresh\u0026quot;.\\n\\n A new GODEBUG setting has been added, htmlmetacontenturlescape, which can be\\n used to disable escaping URLs in actions in the meta content attribute which\\n follow \u0026quot;url=\u0026quot; by setting htmlmetacontenturlescape=0.\\n\\n This is CVE-2026-27142 and Go issue\u0026apos;, \u0026apos;.\\n\\n * net/url: reject IPv6 literal not at start of host\\n\\n The Go standard library function net/url.Parse insufficiently\\n validated the host/authority component and accepted some invalid URLs\\n by effectively treating garbage before an IP-literal as ignorable.\\n The function should have rejected this as invalid.\\n\\n To prevent this behavior, net/url.Parse now rejects IPv6 literals\\n that do not appear at the start of the host subcomponent of a URL.\\n\\n Thanks to Masaki Hara (\u0026apos;, \u0026apos;) of Wantedly.\\n\\n This is CVE-2026-25679 and Go issue\u0026apos;, \u0026apos;.\\n\\n * os: FileInfo can escape from a Root\\n\\n On Unix platforms, when listing the contents of a directory using\\n File.ReadDir or File.Readdir the returned FileInfo could reference\\n a file outside of the Root in which the File was opened.\\n\\n The contents of the FileInfo were populated using the lstat system\\n call, which takes the path to the file as a parameter. If a component\\n of the full path of the file described by the FileInfo is replaced with\\n a symbolic link, the target of the lstat can be directed to another\\n location on the filesystem.\\n\\n The impact of this escape is limited to reading metadata provided by\\n lstat from arbitrary locations on the filesystem. This could be used\\n to p(CVE-2026-25679)\n\nWhen verifying a certificate chain which contains a certificate containing multiple email address constraints which share common local portions but different domain portions, these constraints will not be properly applied, and only the last constraint will be considered.(CVE-2026-27137)\n\nDue to missing nil check, sending 0x0a-0x0f HTTP/2 frames will cause a running server to panic(CVE-2026-27141)\n\nDuring chain building, the amount of work that is done is not correctly limited when a large number of intermediate certificates are passed in VerifyOptions.Intermediates, which can lead to a denial of service. This affects both direct users of crypto/x509 and users of crypto/tls.(CVE-2026-32280)\n\nValidating certificate chains which use policies is unexpectedly inefficient when certificates in the chain contain a very large number of policy mappings, possibly causing denial of service. This only affects validation of otherwise trusted certificate chains, issued by a root CA in the VerifyOptions.Roots CertPool, or in the system certificate pool.(CVE-2026-32281)\n\nOn Linux, if the target of Root.Chmod is replaced with a symlink while the chmod operation is in progress, Chmod can operate on the target of the symlink, even when the target lies outside the root. The Linux fchmodat syscall silently ignores the AT_SYMLINK_NOFOLLOW flag, which Root.Chmod uses to avoid symlink traversal. Root.Chmod checks its target before acting and returns an error if the target is a symlink lying outside the root, so the impact is limited to cases where the target is replaced with a symlink between the check and operation.(CVE-2026-32282)\n\nWhen verifying a certificate chain containing excluded DNS constraints, these constraints are not correctly applied to wildcard DNS SANs which use a different case than the constraint. This only affects validation of otherwise trusted certificate chains, issued by a root CA in the VerifyOptions.Roots CertPool, or in the system certificate pool.(CVE-2026-33810)\n\nWhen using LookupCNAME with the cgo DNS resolver, a very long CNAME response can trigger a double-free of C memory and a crash.(CVE-2026-33811)\n\nA vulnerability was found in the encoding/asn1 package in Go. Enforce a recursion limit in Unmarshal to prevent stack exhaustion when parsing deeply-nested, recursive structures. An attacker could provide a specially crafted, deeply-nested Abstract Syntax Notation One (ASN.1) structure, leading to excessive recursion during the Unmarshal operation. This could result in stack exhaustion and a Denial of Service (DoS) condition.(CVE-2026-33818)\n\nWhen returning errors, functions in the net/textproto package would include its input as part of the error. This might allow an attacker to inject misleading content to errors that are printed or logged.(CVE-2026-42507)\n\nParsing an invalid SVCB or HTTPS RR can panic when the size of a parameter value overflows the message buffer.(CVE-2026-46600)\n\nWhen a server is configured to support unencrypted HTTP/2, it reads a few bytes from each new connection to see if they contain the HTTP/2 client preface. ReadHeaderTimeout is unexpectedly not being applied when doing this. This oversight could allow a remote attacker to maintain open connections indefinitely, potentially leading to a Denial of Service (DoS) by exhausting server resources.(CVE-2026-56853)\n\nA flaw was found in the encoding/xml package of Go. The DecodeElement function failed to correctly track recursion depth, causing the depth counter to reset and never fire, which could lead to stack exhaustion. A remote attacker could exploit this vulnerability by providing a specially crafted XML input, resulting in a Denial of Service (DoS) for the affected application.(CVE-2026-56859)\n\nHandshake messages, such as KeyUpdate, are always considered as state-advancing, regardless of whether a handshake has been completed or not. As a result, a malicious client can keep sending KeyUpdate messages to force the server to keep performing key derivation operations indefinitely.(CVE-2026-56862)",
"id": "OESA-2026-3880",
"modified": "2026-09-20T13:22:51Z",
"published": "2026-09-20T13:22:51Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2026-3880"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-8244"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-27613"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-4673"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-47906"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-47910"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-47912"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-47914"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-48385"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58181"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58183"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58185"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58186"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58187"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58189"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61723"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61724"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61726"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61727"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61729"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-68121"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-25679"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-27137"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-27141"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-32280"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-32281"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-32282"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-33810"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-33811"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-33818"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-42507"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46600"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-56853"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-56859"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-56862"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:C/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "git-lfs security update",
"upstream": [
"CVE-2024-8244",
"CVE-2025-27613",
"CVE-2025-4673",
"CVE-2025-47906",
"CVE-2025-47910",
"CVE-2025-47912",
"CVE-2025-47914",
"CVE-2025-48385",
"CVE-2025-58181",
"CVE-2025-58183",
"CVE-2025-58185",
"CVE-2025-58186",
"CVE-2025-58187",
"CVE-2025-58189",
"CVE-2025-61723",
"CVE-2025-61724",
"CVE-2025-61726",
"CVE-2025-61727",
"CVE-2025-61729",
"CVE-2025-68121",
"CVE-2026-25679",
"CVE-2026-27137",
"CVE-2026-27141",
"CVE-2026-32280",
"CVE-2026-32281",
"CVE-2026-32282",
"CVE-2026-33810",
"CVE-2026-33811",
"CVE-2026-33818",
"CVE-2026-42507",
"CVE-2026-46600",
"CVE-2026-56853",
"CVE-2026-56859",
"CVE-2026-56862"
]
}
OESA-2026-4068 (CVE-2023-39321)
Vulnerability from osv_openeuler – Published: 2026-09-25 01:28 – Updated: 2026-09-25 01:28 – Source websiteGit Large File Storage (LFS) replaces large files such as audio samples, videos, datasets, and graphics with text pointers inside Git, while storing the file contents on a remote server.
Security Fix(es):
Processing an incomplete post-handshake message for a QUIC connection can cause a panic.(CVE-2023-39321)
QUIC connections do not set an upper bound on the amount of data buffered when reading post-handshake messages, allowing a malicious QUIC connection to cause unbounded memory growth. With fix, connections now consistently reject messages larger than 65KiB in size.(CVE-2023-39322)
The filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress.(CVE-2024-8244)
Calling Verify with a VerifyOptions.KeyUsages that contains ExtKeyUsageAny unintentionally disabledpolicy validation. This only affected certificate chains which contain policy graphs, which are rather uncommon.(CVE-2025-22874)
Git LFS is a Git extension for versioning large files. In Git LFS versions 0.5.2 through 3.7.0, when populating a Git repository's working tree with the contents of Git LFS objects, certain Git LFS commands may write to files visible outside the current Git working tree if symbolic or hard links exist which collide with the paths of files tracked by Git LFS. The git lfs checkout and git lfs pull commands do not check for symbolic links before writing to files in the working tree, allowing an attacker to craft a repository containing symbolic or hard links that cause Git LFS to write to arbitrary file system locations accessible to the user running these commands. As well, when the git lfs checkout and git lfs pull commands are run in a bare repository, they could write to files visible outside the repository. The vulnerability is fixed in version 3.7.1. As a workaround, support for symlinks in Git may be disabled by setting the core.symlinks configuration option to false, after which further clones and fetches will not create symbolic links. However, any symbolic or hard links in existing repositories will still provide the opportunity for Git LFS to write to their targets.(CVE-2025-26625)
Gitk is a Tcl/Tk based Git history browser. Starting with 1.7.0, when a user clones an untrusted repository and runs gitk without additional command arguments, files for which the user has write permission can be created and truncated. The option Support per-file encoding must have been enabled before in Gitk's Preferences. This option is disabled by default. The same happens when Show origin of this line is used in the main window (regardless of whether Support per-file encoding is enabled or not). This vulnerability is fixed in 2.43.7, 2.44.4, 2.45.4, 2.46.4, 2.47.3, 2.48.2, 2.49.1, and 2.50.1.(CVE-2025-27613)
Gitk is a Tcl/Tk based Git history browser. Starting with 2.41.0, a Git repository can be crafted in such a way that with some social engineering a user who has cloned the repository can be tricked into running any script (e.g., Bourne shell, Perl, Python, ...) supplied by the attacker by invoking gitk filename, where filename has a particular structure. The script is run with the privileges of the user. This vulnerability is fixed in 2.43.7, 2.44.4, 2.45.4, 2.46.4, 2.47.3, 2.48.2, 2.49.1, and 2.50.(CVE-2025-27614)
Proxy-Authorization and Proxy-Authenticate headers persisted on cross-origin redirects potentially leaking sensitive information.(CVE-2025-4673)
The go command may execute unexpected commands when operating in untrusted VCS repositories. This occurs when possibly dangerous VCS configuration is present in repositories. This can happen when a repository was fetched via one VCS (e.g. Git), but contains metadata for another VCS (e.g. Mercurial). Modules which are retrieved using the go command line, i.e. via "go get", are not affected.(CVE-2025-4674)
Git GUI allows you to use the Git source control management tools via a GUI. When a user clones an untrusted repository and is tricked into editing a file located in a maliciously named directory in the repository, then Git GUI can create and overwrite files for which the user has write permission. This vulnerability is fixed in 2.43.7, 2.44.4, 2.45.4, 2.46.4, 2.47.3, 2.48.2, 2.49.1, and 2.50.1.(CVE-2025-46835)
If the PATH environment variable contains paths which are executables (rather than just directories), passing certain strings to LookPath ("", ".", and ".."), can result in the binaries listed in the PATH being unexpectedly returned.(CVE-2025-47906)
Cancelling a query (e.g. by cancelling the context passed to one of the query methods) during a call to the Scan method of the returned Rows can result in unexpected results if other queries are being made in parallel. This can result in a race condition that may overwrite the expected results with those of another query, causing the call to Scan to return either unexpected results from the other query or an error.(CVE-2025-47907)
When using http.CrossOriginProtection, the AddInsecureBypassPattern method can unexpectedly bypass more requests than intended. CrossOriginProtection then skips validation, but forwards the original request path, which may be served by a different handler without the intended security protections.(CVE-2025-47910)
The Parse function permits values other than IPv6 addresses to be included in square brackets within the host component of a URL. RFC 3986 permits IPv6 addresses to be included within the host component, enclosed within square brackets. For example: "http://[::1]/". IPv4 addresses and hostnames must not appear within square brackets. Parse did not enforce this requirement.(CVE-2025-47912)
SSH Agent servers do not validate the size of messages when processing new identity requests, which may cause the program to panic if the message is malformed due to an out of bounds read.(CVE-2025-47914)
Git is a fast, scalable, distributed revision control system with an unusually rich command set that provides both high-level operations and full access to internals. When reading a config value, Git strips any trailing carriage return and line feed (CRLF). When writing a config entry, values with a trailing CR are not quoted, causing the CR to be lost when the config is later read. When initializing a submodule, if the submodule path contains a trailing CR, the altered path is read resulting in the submodule being checked out to an incorrect location. If a symlink exists that points the altered path to the submodule hooks directory, and the submodule contains an executable post-checkout hook, the script may be unintentionally executed after checkout. This vulnerability is fixed in v2.43.7, v2.44.4, v2.45.4, v2.46.4, v2.47.3, v2.48.2, v2.49.1, and v2.50.1.(CVE-2025-48384)
Git is a fast, scalable, distributed revision control system with an unusually rich command set that provides both high-level operations and full access to internals. When cloning a repository Git knows to optionally fetch a bundle advertised by the remote server, which allows the server-side to offload parts of the clone to a CDN. The Git client does not perform sufficient validation of the advertised bundles, which allows the remote side to perform protocol injection. This protocol injection can cause the client to write the fetched bundle to a location controlled by the adversary. The fetched content is fully controlled by the server, which can in the worst case lead to arbitrary code execution. The use of bundle URIs is not enabled by default and can be controlled by the bundle.heuristic config option. Some cases of the vulnerability require that the adversary is in control of where a repository will be cloned to. This either requires social engineering or a recursive clone with submodules. These cases can thus be avoided by disabling recursive clones. This vulnerability is fixed in v2.43.7, v2.44.4, v2.45.4, v2.46.4, v2.47.3, v2.48.2, v2.49.1, and v2.50.1.(CVE-2025-48385)
SSH servers parsing GSSAPI authentication requests do not validate the number of mechanisms specified in the request, allowing an attacker to cause unbounded memory consumption.(CVE-2025-58181)
A vulnerability was found in Google Go up to 1.25.1 (Programming Language Software). It has been rated as problematic.Using CWE to declare the problem leads to CWE-770. The product allocates a reusable resource or group of resources on behalf of an actor without imposing any restrictions on the size or number of resources that can be allocated, in violation of the intended security policy for that actor.Impacted is availability.Upgrading to version 1.25.2 eliminates this vulnerability.(CVE-2025-58183)
Parsing a maliciously crafted DER payload could allocate large amounts of memory, causing memory exhaustion.(CVE-2025-58185)
Despite HTTP headers having a default limit of 1MB, the number of cookies that can be parsed does not have a limit. By sending a lot of very small cookies such as "a=;", an attacker can make an HTTP server allocate a large amount of structs, causing large memory consumption.(CVE-2025-58186)
Due to the design of the name constraint checking algorithm, the processing time of some inputs scale non-linearly with respect to the size of the certificate. This affects programs which validate arbitrary certificate chains.(CVE-2025-58187)
Validating certificate chains which contain DSA public keys can cause programs to panic, due to a interface cast that assumes they implement the Equal method. This affects programs which validate arbitrary certificate chains.(CVE-2025-58188)
When Conn.Handshake fails during ALPN negotiation the error contains attacker controlled information (the ALPN protocols sent by the client) which is not escaped.(CVE-2025-58189)
The processing time for parsing some invalid inputs scales non-linearly with respect to the size of the input. This affects programs which parse untrusted PEM inputs.(CVE-2025-61723)
The Reader.ReadResponse function constructs a response string through repeated string concatenation of lines. When the number of lines in a response is large, this can cause excessive CPU consumption.(CVE-2025-61724)
The ParseAddress function constructs domain-literal address components through repeated string concatenation. When parsing large domain-literal components, this can cause excessive CPU consumption.(CVE-2025-61725)
The net/url package in the Go standard library does not impose a limit on the number of query parameters in a query string. While the overall size of query parameters in URLs is generally constrained by the maximum request header size, the net/http.Request.ParseForm method is capable of parsing large URL-encoded forms. An attacker can exploit this by submitting a form containing an excessive number of unique query parameters, leading to disproportionate memory consumption and potentially causing a Denial of Service (DoS) condition in the affected application.(CVE-2025-61726)
An excluded subdomain constraint in a certificate chain does not restrict the usage of wildcard SANs in the leaf certificate. For example a constraint that excludes the subdomain test.example.com does not prevent a leaf certificate from claiming the SAN *.example.com.(CVE-2025-61727)
Within HostnameError.Error(), when constructing an error string, there is no limit to the number of hosts that will be printed out. Furthermore, the error string is constructed by repeated string concatenation, leading to quadratic runtime. Therefore, a certificate provided by a malicious actor can result in excessive resource consumption.(CVE-2025-61729)
During session resumption in crypto/tls, if the underlying Config has its ClientCAs or RootCAs fields mutated between the initial handshake and the resumed handshake, the resumed handshake may succeed when it should have failed. This may happen when a user calls Config.Clone and mutates the returned Config, or uses Config.GetConfigForClient. This can cause a client to resume a session with a server that it would not have resumed with during the initial handshake, or cause a server to resume a session with a client that it would not have resumed with during the initial handshake.(CVE-2025-68121)
['announces:', "We have just released Go versions 1.26.1 and 1.25.8, minor point releases.\n\nThese releases include 5 security fixes following the security policy:\n\n * crypto/x509: incorrect enforcement of email constraints\n\n When verifying a certificate chain which contains a certificate containing\n multiple email address constraints (composed of the full email address)\n which share common local portions (the portion of the address before the '@'\n character) but different domain portions (the portion of the address after\n the '@' character), these constraints will not be properly applied, and only\n the last constraint will be considered.\n\n This can allow certificates in the chain containing email addresses which\n are either not permitted or excluded by the relevant constraints to be\n returned by calls to Certificate.Verify. Since the name constraint checks\n happen after chain building is complete, this only applies to certificate\n chains which chain to trusted roots (root certificates either in\n VerifyOptions.Roots or in the system root certificate pool), requiring a\n trusted CA to issue certificates containing either not permitted or\n excluded email addresses.\n\n This issue only affects Go 1.26.\n\n Thanks to Jakub Ciolek for reporting this issue.\n\n This is CVE-2026-27137 and Go issue", '.\n\n * crypto/x509: panic in name constraint checking for malformed certificates\n\n Certificate verification can panic when a certificate in the chain has an\n empty DNS name and another certificate in the chain has excluded name\n constraints. This can crash programs that are either directly verifying\n X.509 certificate chains, or those that use TLS.\n\n Since the name constraint checks happen after chain building is complete,\n this only applies to certificate chains which chain to trusted roots (root\n certificates either in VerifyOptions.Roots or in the system root certificate\n pool), requiring a trusted CA to issue certificates containing malformed DNS\n names.\n\n This issue only affects Go 1.26.\n\n Thanks to Jakub Ciolek for reporting this issue.\n\n This is CVE-2026-27138 and Go issue', '.\n\n * html/template: URLs in meta content attribute actions are not escaped\n\n Actions which insert URLs into the content attribute of HTML meta tags are\n not escaped. This can allow XSS if the meta tag also has an http-equiv\n attribute with the value "refresh".\n\n A new GODEBUG setting has been added, htmlmetacontenturlescape, which can be\n used to disable escaping URLs in actions in the meta content attribute which\n follow "url=" by setting htmlmetacontenturlescape=0.\n\n This is CVE-2026-27142 and Go issue', '.\n\n * net/url: reject IPv6 literal not at start of host\n\n The Go standard library function net/url.Parse insufficiently\n validated the host/authority component and accepted some invalid URLs\n by effectively treating garbage before an IP-literal as ignorable.\n The function should have rejected this as invalid.\n\n To prevent this behavior, net/url.Parse now rejects IPv6 literals\n that do not appear at the start of the host subcomponent of a URL.\n\n Thanks to Masaki Hara (', ') of Wantedly.\n\n This is CVE-2026-25679 and Go issue', '.\n\n * os: FileInfo can escape from a Root\n\n On Unix platforms, when listing the contents of a directory using\n File.ReadDir or File.Readdir the returned FileInfo could reference\n a file outside of the Root in which the File was opened.\n\n The contents of the FileInfo were populated using the lstat system\n call, which takes the path to the file as a parameter. If a component\n of the full path of the file described by the FileInfo is replaced with\n a symbolic link, the target of the lstat can be directed to another\n location on the filesystem.\n\n The impact of this escape is limited to reading metadata provided by\n lstat from arbitrary locations on the filesystem. This could be used\n to p(CVE-2026-25679)
When verifying a certificate chain which contains a certificate containing multiple email address constraints which share common local portions but different domain portions, these constraints will not be properly applied, and only the last constraint will be considered.(CVE-2026-27137)
Due to missing nil check, sending 0x0a-0x0f HTTP/2 frames will cause a running server to panic(CVE-2026-27141)
During chain building, the amount of work that is done is not correctly limited when a large number of intermediate certificates are passed in VerifyOptions.Intermediates, which can lead to a denial of service. This affects both direct users of crypto/x509 and users of crypto/tls.(CVE-2026-32280)
Validating certificate chains which use policies is unexpectedly inefficient when certificates in the chain contain a very large number of policy mappings, possibly causing denial of service. This only affects validation of otherwise trusted certificate chains, issued by a root CA in the VerifyOptions.Roots CertPool, or in the system certificate pool.(CVE-2026-32281)
On Linux, if the target of Root.Chmod is replaced with a symlink while the chmod operation is in progress, Chmod can operate on the target of the symlink, even when the target lies outside the root. The Linux fchmodat syscall silently ignores the AT_SYMLINK_NOFOLLOW flag, which Root.Chmod uses to avoid symlink traversal. Root.Chmod checks its target before acting and returns an error if the target is a symlink lying outside the root, so the impact is limited to cases where the target is replaced with a symlink between the check and operation.(CVE-2026-32282)
When verifying a certificate chain containing excluded DNS constraints, these constraints are not correctly applied to wildcard DNS SANs which use a different case than the constraint. This only affects validation of otherwise trusted certificate chains, issued by a root CA in the VerifyOptions.Roots CertPool, or in the system certificate pool.(CVE-2026-33810)
When using LookupCNAME with the cgo DNS resolver, a very long CNAME response can trigger a double-free of C memory and a crash.(CVE-2026-33811)
A vulnerability was found in the encoding/asn1 package in Go. Enforce a recursion limit in Unmarshal to prevent stack exhaustion when parsing deeply-nested, recursive structures. An attacker could provide a specially crafted, deeply-nested Abstract Syntax Notation One (ASN.1) structure, leading to excessive recursion during the Unmarshal operation. This could result in stack exhaustion and a Denial of Service (DoS) condition.(CVE-2026-33818)
When returning errors, functions in the net/textproto package would include its input as part of the error. This might allow an attacker to inject misleading content to errors that are printed or logged.(CVE-2026-42507)
Parsing an invalid SVCB or HTTPS RR can panic when the size of a parameter value overflows the message buffer.(CVE-2026-46600)
When a server is configured to support unencrypted HTTP/2, it reads a few bytes from each new connection to see if they contain the HTTP/2 client preface. ReadHeaderTimeout is unexpectedly not being applied when doing this. This oversight could allow a remote attacker to maintain open connections indefinitely, potentially leading to a Denial of Service (DoS) by exhausting server resources.(CVE-2026-56853)
A flaw was found in the encoding/xml package of Go. The DecodeElement function failed to correctly track recursion depth, causing the depth counter to reset and never fire, which could lead to stack exhaustion. A remote attacker could exploit this vulnerability by providing a specially crafted XML input, resulting in a Denial of Service (DoS) for the affected application.(CVE-2026-56859)
Handshake messages, such as KeyUpdate, are always considered as state-advancing, regardless of whether a handshake has been completed or not. As a result, a malicious client can keep sending KeyUpdate messages to force the server to keep performing key derivation operations indefinitely.(CVE-2026-56862)
| URL | Type | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"git-lfs-3.6.1-2.oe2403sp4.aarch64.rpm"
],
"src": [
"git-lfs-3.6.1-2.oe2403sp4.src.rpm"
],
"x86_64": [
"git-lfs-3.6.1-2.oe2403sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:24.03-LTS-SP4",
"name": "git-lfs",
"purl": "pkg:rpm/openEuler/git-lfs\u0026distro=openEuler-24.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "3.6.1-2.oe2403sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "Git Large File Storage (LFS) replaces large files such as audio samples, videos, datasets, and graphics with text pointers inside Git, while storing the file contents on a remote server.\r\n\r\nSecurity Fix(es):\n\nProcessing an incomplete post-handshake message for a QUIC connection can cause a panic.(CVE-2023-39321)\n\nQUIC connections do not set an upper bound on the amount of data buffered when reading post-handshake messages, allowing a malicious QUIC connection to cause unbounded memory growth. With fix, connections now consistently reject messages larger than 65KiB in size.(CVE-2023-39322)\n\nThe filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress.(CVE-2024-8244)\n\nCalling Verify with a VerifyOptions.KeyUsages that contains ExtKeyUsageAny unintentionally disabledpolicy validation. This only affected certificate chains which contain policy graphs, which are rather uncommon.(CVE-2025-22874)\n\nGit LFS is a Git extension for versioning large files. In Git LFS versions 0.5.2 through 3.7.0, when populating a Git repository\u0026apos;s working tree with the contents of Git LFS objects, certain Git LFS commands may write to files visible outside the current Git working tree if symbolic or hard links exist which collide with the paths of files tracked by Git LFS. The git lfs checkout and git lfs pull commands do not check for symbolic links before writing to files in the working tree, allowing an attacker to craft a repository containing symbolic or hard links that cause Git LFS to write to arbitrary file system locations accessible to the user running these commands. As well, when the git lfs checkout and git lfs pull commands are run in a bare repository, they could write to files visible outside the repository. The vulnerability is fixed in version 3.7.1. As a workaround, support for symlinks in Git may be disabled by setting the core.symlinks configuration option to false, after which further clones and fetches will not create symbolic links. However, any symbolic or hard links in existing repositories will still provide the opportunity for Git LFS to write to their targets.(CVE-2025-26625)\n\nGitk is a Tcl/Tk based Git history browser. Starting with 1.7.0, when a user clones an untrusted repository and runs gitk without additional command arguments, files for which the user has write permission can be created and truncated. The option Support per-file encoding must have been enabled before in Gitk\u0026apos;s Preferences. This option is disabled by default. The same happens when Show origin of this line is used in the main window (regardless of whether Support per-file encoding is enabled or not). This vulnerability is fixed in 2.43.7, 2.44.4, 2.45.4, 2.46.4, 2.47.3, 2.48.2, 2.49.1, and 2.50.1.(CVE-2025-27613)\n\nGitk is a Tcl/Tk based Git history browser. Starting with 2.41.0, a Git repository can be crafted in such a way that with some social engineering a user who has cloned the repository can be tricked into running any script (e.g., Bourne shell, Perl, Python, ...) supplied by the attacker by invoking gitk filename, where filename has a particular structure. The script is run with the privileges of the user. This vulnerability is fixed in 2.43.7, 2.44.4, 2.45.4, 2.46.4, 2.47.3, 2.48.2, 2.49.1, and 2.50.(CVE-2025-27614)\n\nProxy-Authorization and Proxy-Authenticate headers persisted on cross-origin redirects potentially leaking sensitive information.(CVE-2025-4673)\n\nThe go command may execute unexpected commands when operating in untrusted VCS repositories. This occurs when possibly dangerous VCS configuration is present in repositories. This can happen when a repository was fetched via one VCS (e.g. Git), but contains metadata for another VCS (e.g. Mercurial). Modules which are retrieved using the go command line, i.e. via \u0026quot;go get\u0026quot;, are not affected.(CVE-2025-4674)\n\nGit GUI allows you to use the Git source control management tools via a GUI. When a user clones an untrusted repository and is tricked into editing a file located in a maliciously named directory in the repository, then Git GUI can create and overwrite files for which the user has write permission. This vulnerability is fixed in 2.43.7, 2.44.4, 2.45.4, 2.46.4, 2.47.3, 2.48.2, 2.49.1, and 2.50.1.(CVE-2025-46835)\n\nIf the PATH environment variable contains paths which are executables (rather than just directories), passing certain strings to LookPath (\u0026quot;\u0026quot;, \u0026quot;.\u0026quot;, and \u0026quot;..\u0026quot;), can result in the binaries listed in the PATH being unexpectedly returned.(CVE-2025-47906)\n\nCancelling a query (e.g. by cancelling the context passed to one of the query methods) during a call to the Scan method of the returned Rows can result in unexpected results if other queries are being made in parallel. This can result in a race condition that may overwrite the expected results with those of another query, causing the call to Scan to return either unexpected results from the other query or an error.(CVE-2025-47907)\n\nWhen using http.CrossOriginProtection, the AddInsecureBypassPattern method can unexpectedly bypass more requests than intended. CrossOriginProtection then skips validation, but forwards the original request path, which may be served by a different handler without the intended security protections.(CVE-2025-47910)\n\nThe Parse function permits values other than IPv6 addresses to be included in square brackets within the host component of a URL. RFC 3986 permits IPv6 addresses to be included within the host component, enclosed within square brackets. For example: \u0026quot;http://[::1]/\u0026quot;. IPv4 addresses and hostnames must not appear within square brackets. Parse did not enforce this requirement.(CVE-2025-47912)\n\nSSH Agent servers do not validate the size of messages when processing new identity requests, which may cause the program to panic if the message is malformed due to an out of bounds read.(CVE-2025-47914)\n\nGit is a fast, scalable, distributed revision control system with an unusually rich command set that provides both high-level operations and full access to internals. When reading a config value, Git strips any trailing carriage return and line feed (CRLF). When writing a config entry, values with a trailing CR are not quoted, causing the CR to be lost when the config is later read. When initializing a submodule, if the submodule path contains a trailing CR, the altered path is read resulting in the submodule being checked out to an incorrect location. If a symlink exists that points the altered path to the submodule hooks directory, and the submodule contains an executable post-checkout hook, the script may be unintentionally executed after checkout. This vulnerability is fixed in v2.43.7, v2.44.4, v2.45.4, v2.46.4, v2.47.3, v2.48.2, v2.49.1, and v2.50.1.(CVE-2025-48384)\n\nGit is a fast, scalable, distributed revision control system with an unusually rich command set that provides both high-level operations and full access to internals. When cloning a repository Git knows to optionally fetch a bundle advertised by the remote server, which allows the server-side to offload parts of the clone to a CDN. The Git client does not perform sufficient validation of the advertised bundles, which allows the remote side to perform protocol injection. This protocol injection can cause the client to write the fetched bundle to a location controlled by the adversary. The fetched content is fully controlled by the server, which can in the worst case lead to arbitrary code execution. The use of bundle URIs is not enabled by default and can be controlled by the bundle.heuristic config option. Some cases of the vulnerability require that the adversary is in control of where a repository will be cloned to. This either requires social engineering or a recursive clone with submodules. These cases can thus be avoided by disabling recursive clones. This vulnerability is fixed in v2.43.7, v2.44.4, v2.45.4, v2.46.4, v2.47.3, v2.48.2, v2.49.1, and v2.50.1.(CVE-2025-48385)\n\nSSH servers parsing GSSAPI authentication requests do not validate the number of mechanisms specified in the request, allowing an attacker to cause unbounded memory consumption.(CVE-2025-58181)\n\nA vulnerability was found in Google Go up to 1.25.1 (Programming Language Software). It has been rated as problematic.Using CWE to declare the problem leads to CWE-770. The product allocates a reusable resource or group of resources on behalf of an actor without imposing any restrictions on the size or number of resources that can be allocated, in violation of the intended security policy for that actor.Impacted is availability.Upgrading to version 1.25.2 eliminates this vulnerability.(CVE-2025-58183)\n\nParsing a maliciously crafted DER payload could allocate large amounts of memory, causing memory exhaustion.(CVE-2025-58185)\n\nDespite HTTP headers having a default limit of 1MB, the number of cookies that can be parsed does not have a limit. By sending a lot of very small cookies such as \u0026quot;a=;\u0026quot;, an attacker can make an HTTP server allocate a large amount of structs, causing large memory consumption.(CVE-2025-58186)\n\nDue to the design of the name constraint checking algorithm, the processing time of some inputs scale non-linearly with respect to the size of the certificate. This affects programs which validate arbitrary certificate chains.(CVE-2025-58187)\n\nValidating certificate chains which contain DSA public keys can cause programs to panic, due to a interface cast that assumes they implement the Equal method. This affects programs which validate arbitrary certificate chains.(CVE-2025-58188)\n\nWhen Conn.Handshake fails during ALPN negotiation the error contains attacker controlled information (the ALPN protocols sent by the client) which is not escaped.(CVE-2025-58189)\n\nThe processing time for parsing some invalid inputs scales non-linearly with respect to the size of the input. This affects programs which parse untrusted PEM inputs.(CVE-2025-61723)\n\nThe Reader.ReadResponse function constructs a response string through repeated string concatenation of lines. When the number of lines in a response is large, this can cause excessive CPU consumption.(CVE-2025-61724)\n\nThe ParseAddress function constructs domain-literal address components through repeated string concatenation. When parsing large domain-literal components, this can cause excessive CPU consumption.(CVE-2025-61725)\n\nThe net/url package in the Go standard library does not impose a limit on the number of query parameters in a query string. While the overall size of query parameters in URLs is generally constrained by the maximum request header size, the net/http.Request.ParseForm method is capable of parsing large URL-encoded forms. An attacker can exploit this by submitting a form containing an excessive number of unique query parameters, leading to disproportionate memory consumption and potentially causing a Denial of Service (DoS) condition in the affected application.(CVE-2025-61726)\n\nAn excluded subdomain constraint in a certificate chain does not restrict the usage of wildcard SANs in the leaf certificate. For example a constraint that excludes the subdomain test.example.com does not prevent a leaf certificate from claiming the SAN *.example.com.(CVE-2025-61727)\n\nWithin HostnameError.Error(), when constructing an error string, there is no limit to the number of hosts that will be printed out. Furthermore, the error string is constructed by repeated string concatenation, leading to quadratic runtime. Therefore, a certificate provided by a malicious actor can result in excessive resource consumption.(CVE-2025-61729)\n\nDuring session resumption in crypto/tls, if the underlying Config has its ClientCAs or RootCAs fields mutated between the initial handshake and the resumed handshake, the resumed handshake may succeed when it should have failed. This may happen when a user calls Config.Clone and mutates the returned Config, or uses Config.GetConfigForClient. This can cause a client to resume a session with a server that it would not have resumed with during the initial handshake, or cause a server to resume a session with a client that it would not have resumed with during the initial handshake.(CVE-2025-68121)\n\n[\u0026apos;announces:\u0026apos;, \u0026quot;We have just released Go versions 1.26.1 and 1.25.8, minor point releases.\\n\\nThese releases include 5 security fixes following the security policy:\\n\\n * crypto/x509: incorrect enforcement of email constraints\\n\\n When verifying a certificate chain which contains a certificate containing\\n multiple email address constraints (composed of the full email address)\\n which share common local portions (the portion of the address before the \u0026apos;@\u0026apos;\\n character) but different domain portions (the portion of the address after\\n the \u0026apos;@\u0026apos; character), these constraints will not be properly applied, and only\\n the last constraint will be considered.\\n\\n This can allow certificates in the chain containing email addresses which\\n are either not permitted or excluded by the relevant constraints to be\\n returned by calls to Certificate.Verify. Since the name constraint checks\\n happen after chain building is complete, this only applies to certificate\\n chains which chain to trusted roots (root certificates either in\\n VerifyOptions.Roots or in the system root certificate pool), requiring a\\n trusted CA to issue certificates containing either not permitted or\\n excluded email addresses.\\n\\n This issue only affects Go 1.26.\\n\\n Thanks to Jakub Ciolek for reporting this issue.\\n\\n This is CVE-2026-27137 and Go issue\u0026quot;, \u0026apos;.\\n\\n * crypto/x509: panic in name constraint checking for malformed certificates\\n\\n Certificate verification can panic when a certificate in the chain has an\\n empty DNS name and another certificate in the chain has excluded name\\n constraints. This can crash programs that are either directly verifying\\n X.509 certificate chains, or those that use TLS.\\n\\n Since the name constraint checks happen after chain building is complete,\\n this only applies to certificate chains which chain to trusted roots (root\\n certificates either in VerifyOptions.Roots or in the system root certificate\\n pool), requiring a trusted CA to issue certificates containing malformed DNS\\n names.\\n\\n This issue only affects Go 1.26.\\n\\n Thanks to Jakub Ciolek for reporting this issue.\\n\\n This is CVE-2026-27138 and Go issue\u0026apos;, \u0026apos;.\\n\\n * html/template: URLs in meta content attribute actions are not escaped\\n\\n Actions which insert URLs into the content attribute of HTML meta tags are\\n not escaped. This can allow XSS if the meta tag also has an http-equiv\\n attribute with the value \u0026quot;refresh\u0026quot;.\\n\\n A new GODEBUG setting has been added, htmlmetacontenturlescape, which can be\\n used to disable escaping URLs in actions in the meta content attribute which\\n follow \u0026quot;url=\u0026quot; by setting htmlmetacontenturlescape=0.\\n\\n This is CVE-2026-27142 and Go issue\u0026apos;, \u0026apos;.\\n\\n * net/url: reject IPv6 literal not at start of host\\n\\n The Go standard library function net/url.Parse insufficiently\\n validated the host/authority component and accepted some invalid URLs\\n by effectively treating garbage before an IP-literal as ignorable.\\n The function should have rejected this as invalid.\\n\\n To prevent this behavior, net/url.Parse now rejects IPv6 literals\\n that do not appear at the start of the host subcomponent of a URL.\\n\\n Thanks to Masaki Hara (\u0026apos;, \u0026apos;) of Wantedly.\\n\\n This is CVE-2026-25679 and Go issue\u0026apos;, \u0026apos;.\\n\\n * os: FileInfo can escape from a Root\\n\\n On Unix platforms, when listing the contents of a directory using\\n File.ReadDir or File.Readdir the returned FileInfo could reference\\n a file outside of the Root in which the File was opened.\\n\\n The contents of the FileInfo were populated using the lstat system\\n call, which takes the path to the file as a parameter. If a component\\n of the full path of the file described by the FileInfo is replaced with\\n a symbolic link, the target of the lstat can be directed to another\\n location on the filesystem.\\n\\n The impact of this escape is limited to reading metadata provided by\\n lstat from arbitrary locations on the filesystem. This could be used\\n to p(CVE-2026-25679)\n\nWhen verifying a certificate chain which contains a certificate containing multiple email address constraints which share common local portions but different domain portions, these constraints will not be properly applied, and only the last constraint will be considered.(CVE-2026-27137)\n\nDue to missing nil check, sending 0x0a-0x0f HTTP/2 frames will cause a running server to panic(CVE-2026-27141)\n\nDuring chain building, the amount of work that is done is not correctly limited when a large number of intermediate certificates are passed in VerifyOptions.Intermediates, which can lead to a denial of service. This affects both direct users of crypto/x509 and users of crypto/tls.(CVE-2026-32280)\n\nValidating certificate chains which use policies is unexpectedly inefficient when certificates in the chain contain a very large number of policy mappings, possibly causing denial of service. This only affects validation of otherwise trusted certificate chains, issued by a root CA in the VerifyOptions.Roots CertPool, or in the system certificate pool.(CVE-2026-32281)\n\nOn Linux, if the target of Root.Chmod is replaced with a symlink while the chmod operation is in progress, Chmod can operate on the target of the symlink, even when the target lies outside the root. The Linux fchmodat syscall silently ignores the AT_SYMLINK_NOFOLLOW flag, which Root.Chmod uses to avoid symlink traversal. Root.Chmod checks its target before acting and returns an error if the target is a symlink lying outside the root, so the impact is limited to cases where the target is replaced with a symlink between the check and operation.(CVE-2026-32282)\n\nWhen verifying a certificate chain containing excluded DNS constraints, these constraints are not correctly applied to wildcard DNS SANs which use a different case than the constraint. This only affects validation of otherwise trusted certificate chains, issued by a root CA in the VerifyOptions.Roots CertPool, or in the system certificate pool.(CVE-2026-33810)\n\nWhen using LookupCNAME with the cgo DNS resolver, a very long CNAME response can trigger a double-free of C memory and a crash.(CVE-2026-33811)\n\nA vulnerability was found in the encoding/asn1 package in Go. Enforce a recursion limit in Unmarshal to prevent stack exhaustion when parsing deeply-nested, recursive structures. An attacker could provide a specially crafted, deeply-nested Abstract Syntax Notation One (ASN.1) structure, leading to excessive recursion during the Unmarshal operation. This could result in stack exhaustion and a Denial of Service (DoS) condition.(CVE-2026-33818)\n\nWhen returning errors, functions in the net/textproto package would include its input as part of the error. This might allow an attacker to inject misleading content to errors that are printed or logged.(CVE-2026-42507)\n\nParsing an invalid SVCB or HTTPS RR can panic when the size of a parameter value overflows the message buffer.(CVE-2026-46600)\n\nWhen a server is configured to support unencrypted HTTP/2, it reads a few bytes from each new connection to see if they contain the HTTP/2 client preface. ReadHeaderTimeout is unexpectedly not being applied when doing this. This oversight could allow a remote attacker to maintain open connections indefinitely, potentially leading to a Denial of Service (DoS) by exhausting server resources.(CVE-2026-56853)\n\nA flaw was found in the encoding/xml package of Go. The DecodeElement function failed to correctly track recursion depth, causing the depth counter to reset and never fire, which could lead to stack exhaustion. A remote attacker could exploit this vulnerability by providing a specially crafted XML input, resulting in a Denial of Service (DoS) for the affected application.(CVE-2026-56859)\n\nHandshake messages, such as KeyUpdate, are always considered as state-advancing, regardless of whether a handshake has been completed or not. As a result, a malicious client can keep sending KeyUpdate messages to force the server to keep performing key derivation operations indefinitely.(CVE-2026-56862)",
"id": "OESA-2026-4068",
"modified": "2026-09-25T01:28:01Z",
"published": "2026-09-25T01:28:01Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2026-4068"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-39321"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-39322"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-8244"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22874"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-26625"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-27613"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-27614"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-4673"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-4674"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-46835"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-47906"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-47907"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-47910"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-47912"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-47914"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-48384"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-48385"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58181"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58183"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58185"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58186"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58187"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58188"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-58189"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61723"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61724"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61725"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61726"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61727"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-61729"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-68121"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-25679"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-27137"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-27141"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-32280"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-32281"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-32282"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-33810"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-33811"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-33818"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-42507"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46600"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-56853"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-56859"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-56862"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:C/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "git-lfs security update",
"upstream": [
"CVE-2023-39321",
"CVE-2023-39322",
"CVE-2024-8244",
"CVE-2025-22874",
"CVE-2025-26625",
"CVE-2025-27613",
"CVE-2025-27614",
"CVE-2025-4673",
"CVE-2025-4674",
"CVE-2025-46835",
"CVE-2025-47906",
"CVE-2025-47907",
"CVE-2025-47910",
"CVE-2025-47912",
"CVE-2025-47914",
"CVE-2025-48384",
"CVE-2025-48385",
"CVE-2025-58181",
"CVE-2025-58183",
"CVE-2025-58185",
"CVE-2025-58186",
"CVE-2025-58187",
"CVE-2025-58188",
"CVE-2025-58189",
"CVE-2025-61723",
"CVE-2025-61724",
"CVE-2025-61725",
"CVE-2025-61726",
"CVE-2025-61727",
"CVE-2025-61729",
"CVE-2025-68121",
"CVE-2026-25679",
"CVE-2026-27137",
"CVE-2026-27141",
"CVE-2026-32280",
"CVE-2026-32281",
"CVE-2026-32282",
"CVE-2026-33810",
"CVE-2026-33811",
"CVE-2026-33818",
"CVE-2026-42507",
"CVE-2026-46600",
"CVE-2026-56853",
"CVE-2026-56859",
"CVE-2026-56862"
]
}
UBUNTU-CVE-2024-8244 (CVE-2024-8244)
Vulnerability from osv_ubuntu – Published: 2025-08-06 16:15 – Updated: 2026-09-23 15:48 – Source websiteThe filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress.
| URL | Type | |
|---|---|---|
{
"affected": [
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.10",
"binary_version": "1.10.4-2ubuntu1~14.04.1"
},
{
"binary_name": "golang-1.10-go",
"binary_version": "1.10.4-2ubuntu1~14.04.1"
},
{
"binary_name": "golang-1.10-src",
"binary_version": "1.10.4-2ubuntu1~14.04.1"
}
]
},
"package": {
"ecosystem": "Ubuntu:14.04:LTS",
"name": "golang-1.10",
"purl": "pkg:deb/ubuntu/golang-1.10@1.10.4-2ubuntu1~14.04.1?arch=source\u0026distro=trusty"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.10.4-2ubuntu1~14.04.1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.10",
"binary_version": "1.10.4-2ubuntu1~16.04.2"
},
{
"binary_name": "golang-1.10-go",
"binary_version": "1.10.4-2ubuntu1~16.04.2"
},
{
"binary_name": "golang-1.10-src",
"binary_version": "1.10.4-2ubuntu1~16.04.2"
}
]
},
"package": {
"ecosystem": "Ubuntu:16.04:LTS",
"name": "golang-1.10",
"purl": "pkg:deb/ubuntu/golang-1.10@1.10.4-2ubuntu1~16.04.2?arch=source\u0026distro=xenial"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.10.4-2ubuntu1~16.04.1",
"1.10.4-2ubuntu1~16.04.2"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.13",
"binary_version": "1.13.8-1ubuntu1~16.04.3+esm3"
},
{
"binary_name": "golang-1.13-go",
"binary_version": "1.13.8-1ubuntu1~16.04.3+esm3"
},
{
"binary_name": "golang-1.13-src",
"binary_version": "1.13.8-1ubuntu1~16.04.3+esm3"
}
]
},
"package": {
"ecosystem": "Ubuntu:Pro:16.04:LTS",
"name": "golang-1.13",
"purl": "pkg:deb/ubuntu/golang-1.13@1.13.8-1ubuntu1~16.04.3+esm3?arch=source\u0026distro=esm-apps/xenial"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.13.8-1ubuntu1~16.04.2",
"1.13.8-1ubuntu1~16.04.3",
"1.13.8-1ubuntu1~16.04.3+esm2",
"1.13.8-1ubuntu1~16.04.3+esm3"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.18",
"binary_version": "1.18.1-1ubuntu1~16.04.6+esm1"
},
{
"binary_name": "golang-1.18-go",
"binary_version": "1.18.1-1ubuntu1~16.04.6+esm1"
},
{
"binary_name": "golang-1.18-src",
"binary_version": "1.18.1-1ubuntu1~16.04.6+esm1"
}
]
},
"package": {
"ecosystem": "Ubuntu:Pro:16.04:LTS",
"name": "golang-1.18",
"purl": "pkg:deb/ubuntu/golang-1.18@1.18.1-1ubuntu1~16.04.6+esm1?arch=source\u0026distro=esm-apps/xenial"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.18.1-1ubuntu1~16.04.6",
"1.18.1-1ubuntu1~16.04.6+esm1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.10",
"binary_version": "1.10.4-2ubuntu1~18.04.2"
},
{
"binary_name": "golang-1.10-go",
"binary_version": "1.10.4-2ubuntu1~18.04.2"
},
{
"binary_name": "golang-1.10-src",
"binary_version": "1.10.4-2ubuntu1~18.04.2"
}
]
},
"package": {
"ecosystem": "Ubuntu:18.04:LTS",
"name": "golang-1.10",
"purl": "pkg:deb/ubuntu/golang-1.10@1.10.4-2ubuntu1~18.04.2?arch=source\u0026distro=bionic"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.10~rc1-1",
"1.10~rc1-1ubuntu1",
"1.10~rc1-2ubuntu1",
"1.10~rc2-1ubuntu1",
"1.10-1ubuntu1",
"1.10.1-1ubuntu2",
"1.10.4-2ubuntu1~18.04.1",
"1.10.4-2ubuntu1~18.04.2"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.13",
"binary_version": "1.13.8-1ubuntu1~18.04.4+esm1"
},
{
"binary_name": "golang-1.13-go",
"binary_version": "1.13.8-1ubuntu1~18.04.4+esm1"
},
{
"binary_name": "golang-1.13-src",
"binary_version": "1.13.8-1ubuntu1~18.04.4+esm1"
}
]
},
"package": {
"ecosystem": "Ubuntu:Pro:18.04:LTS",
"name": "golang-1.13",
"purl": "pkg:deb/ubuntu/golang-1.13@1.13.8-1ubuntu1~18.04.4+esm1?arch=source\u0026distro=esm-apps/bionic"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.13.8-1ubuntu1~18.04.2",
"1.13.8-1ubuntu1~18.04.3",
"1.13.8-1ubuntu1~18.04.4",
"1.13.8-1ubuntu1~18.04.4+esm1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.16",
"binary_version": "1.16.2-0ubuntu1~18.04.2+esm1"
},
{
"binary_name": "golang-1.16-go",
"binary_version": "1.16.2-0ubuntu1~18.04.2+esm1"
},
{
"binary_name": "golang-1.16-src",
"binary_version": "1.16.2-0ubuntu1~18.04.2+esm1"
}
]
},
"package": {
"ecosystem": "Ubuntu:Pro:18.04:LTS",
"name": "golang-1.16",
"purl": "pkg:deb/ubuntu/golang-1.16@1.16.2-0ubuntu1~18.04.2+esm1?arch=source\u0026distro=esm-apps/bionic"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.16.2-0ubuntu1~18.04.2",
"1.16.2-0ubuntu1~18.04.2+esm1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.18",
"binary_version": "1.18.1-1ubuntu1~18.04.4+esm1"
},
{
"binary_name": "golang-1.18-go",
"binary_version": "1.18.1-1ubuntu1~18.04.4+esm1"
},
{
"binary_name": "golang-1.18-src",
"binary_version": "1.18.1-1ubuntu1~18.04.4+esm1"
}
]
},
"package": {
"ecosystem": "Ubuntu:Pro:18.04:LTS",
"name": "golang-1.18",
"purl": "pkg:deb/ubuntu/golang-1.18@1.18.1-1ubuntu1~18.04.4+esm1?arch=source\u0026distro=esm-apps/bionic"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.18.1-1ubuntu1~18.04.3",
"1.18.1-1ubuntu1~18.04.4",
"1.18.1-1ubuntu1~18.04.4+esm1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.13",
"binary_version": "1.13.8-1ubuntu1.2"
},
{
"binary_name": "golang-1.13-go",
"binary_version": "1.13.8-1ubuntu1.2"
},
{
"binary_name": "golang-1.13-src",
"binary_version": "1.13.8-1ubuntu1.2"
}
]
},
"package": {
"ecosystem": "Ubuntu:20.04:LTS",
"name": "golang-1.13",
"purl": "pkg:deb/ubuntu/golang-1.13@1.13.8-1ubuntu1.2?arch=source\u0026distro=focal"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.13.1-1ubuntu1",
"1.13.3-1ubuntu1",
"1.13.4-1ubuntu1",
"1.13.5-1ubuntu1",
"1.13.6-1ubuntu1",
"1.13.6-2ubuntu1",
"1.13.7-1ubuntu1",
"1.13.8-1ubuntu1",
"1.13.8-1ubuntu1.1",
"1.13.8-1ubuntu1.2"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.14",
"binary_version": "1.14.3-2ubuntu2~20.04.2"
},
{
"binary_name": "golang-1.14-go",
"binary_version": "1.14.3-2ubuntu2~20.04.2"
},
{
"binary_name": "golang-1.14-src",
"binary_version": "1.14.3-2ubuntu2~20.04.2"
}
]
},
"package": {
"ecosystem": "Ubuntu:20.04:LTS",
"name": "golang-1.14",
"purl": "pkg:deb/ubuntu/golang-1.14@1.14.3-2ubuntu2~20.04.2?arch=source\u0026distro=focal"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.14~beta1-1",
"1.14~beta1-2",
"1.14~rc1-1",
"1.14-1",
"1.14.1-1",
"1.14.2-1",
"1.14.2-1ubuntu1",
"1.14.3-2ubuntu2~20.04.1",
"1.14.3-2ubuntu2~20.04.2"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.16",
"binary_version": "1.16.2-0ubuntu1~20.04.1+esm1"
},
{
"binary_name": "golang-1.16-go",
"binary_version": "1.16.2-0ubuntu1~20.04.1+esm1"
},
{
"binary_name": "golang-1.16-src",
"binary_version": "1.16.2-0ubuntu1~20.04.1+esm1"
}
]
},
"package": {
"ecosystem": "Ubuntu:Pro:20.04:LTS",
"name": "golang-1.16",
"purl": "pkg:deb/ubuntu/golang-1.16@1.16.2-0ubuntu1~20.04.1+esm1?arch=source\u0026distro=esm-apps/focal"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.16.2-0ubuntu1~20.04",
"1.16.2-0ubuntu1~20.04.1",
"1.16.2-0ubuntu1~20.04.1+esm1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.18",
"binary_version": "1.18.1-1ubuntu1~20.04.3"
},
{
"binary_name": "golang-1.18-go",
"binary_version": "1.18.1-1ubuntu1~20.04.3"
},
{
"binary_name": "golang-1.18-src",
"binary_version": "1.18.1-1ubuntu1~20.04.3"
}
]
},
"package": {
"ecosystem": "Ubuntu:20.04:LTS",
"name": "golang-1.18",
"purl": "pkg:deb/ubuntu/golang-1.18@1.18.1-1ubuntu1~20.04.3?arch=source\u0026distro=focal"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.18.1-1ubuntu1~20.04.1",
"1.18.1-1ubuntu1~20.04.2",
"1.18.1-1ubuntu1~20.04.3"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.20",
"binary_version": "1.20.3-1ubuntu0.1~20.04.1"
},
{
"binary_name": "golang-1.20-go",
"binary_version": "1.20.3-1ubuntu0.1~20.04.1"
},
{
"binary_name": "golang-1.20-src",
"binary_version": "1.20.3-1ubuntu0.1~20.04.1"
}
]
},
"package": {
"ecosystem": "Ubuntu:20.04:LTS",
"name": "golang-1.20",
"purl": "pkg:deb/ubuntu/golang-1.20@1.20.3-1ubuntu0.1~20.04.1?arch=source\u0026distro=focal"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.20.3-1ubuntu0.1~20.04",
"1.20.3-1ubuntu0.1~20.04.1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.21",
"binary_version": "1.21.1-1~ubuntu20.04.3"
},
{
"binary_name": "golang-1.21-go",
"binary_version": "1.21.1-1~ubuntu20.04.3"
},
{
"binary_name": "golang-1.21-src",
"binary_version": "1.21.1-1~ubuntu20.04.3"
}
]
},
"package": {
"ecosystem": "Ubuntu:20.04:LTS",
"name": "golang-1.21",
"purl": "pkg:deb/ubuntu/golang-1.21@1.21.1-1~ubuntu20.04.3?arch=source\u0026distro=focal"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.21.1-1~ubuntu20.04.1",
"1.21.1-1~ubuntu20.04.2",
"1.21.1-1~ubuntu20.04.3"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.22",
"binary_version": "1.22.2-2~20.04.2"
},
{
"binary_name": "golang-1.22-go",
"binary_version": "1.22.2-2~20.04.2"
},
{
"binary_name": "golang-1.22-src",
"binary_version": "1.22.2-2~20.04.2"
}
]
},
"package": {
"ecosystem": "Ubuntu:20.04:LTS",
"name": "golang-1.22",
"purl": "pkg:deb/ubuntu/golang-1.22@1.22.2-2~20.04.2?arch=source\u0026distro=focal"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.22.2-2~20.04.1",
"1.22.2-2~20.04.2"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.17",
"binary_version": "1.17.13-3ubuntu1.3"
},
{
"binary_name": "golang-1.17-go",
"binary_version": "1.17.13-3ubuntu1.3"
},
{
"binary_name": "golang-1.17-src",
"binary_version": "1.17.13-3ubuntu1.3"
}
]
},
"package": {
"ecosystem": "Ubuntu:22.04:LTS",
"name": "golang-1.17",
"purl": "pkg:deb/ubuntu/golang-1.17@1.17.13-3ubuntu1.3?arch=source\u0026distro=jammy"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.17-1ubuntu2",
"1.17.3-1ubuntu1",
"1.17.3-1ubuntu2",
"1.17.13-3ubuntu1",
"1.17.13-3ubuntu1.2",
"1.17.13-3ubuntu1.3"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.18",
"binary_version": "1.18.1-1ubuntu1.2"
},
{
"binary_name": "golang-1.18-go",
"binary_version": "1.18.1-1ubuntu1.2"
},
{
"binary_name": "golang-1.18-src",
"binary_version": "1.18.1-1ubuntu1.2"
}
]
},
"package": {
"ecosystem": "Ubuntu:22.04:LTS",
"name": "golang-1.18",
"purl": "pkg:deb/ubuntu/golang-1.18@1.18.1-1ubuntu1.2?arch=source\u0026distro=jammy"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.18~beta1-0ubuntu1",
"1.18~beta2-1ubuntu1",
"1.18~beta2-1ubuntu2",
"1.18~rc1-1ubuntu1",
"1.18-1ubuntu1",
"1.18.1-1ubuntu1",
"1.18.1-1ubuntu1.1",
"1.18.1-1ubuntu1.2"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.20",
"binary_version": "1.20.3-1ubuntu0.1~22.04.1"
},
{
"binary_name": "golang-1.20-go",
"binary_version": "1.20.3-1ubuntu0.1~22.04.1"
},
{
"binary_name": "golang-1.20-src",
"binary_version": "1.20.3-1ubuntu0.1~22.04.1"
}
]
},
"package": {
"ecosystem": "Ubuntu:22.04:LTS",
"name": "golang-1.20",
"purl": "pkg:deb/ubuntu/golang-1.20@1.20.3-1ubuntu0.1~22.04.1?arch=source\u0026distro=jammy"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.20.3-1ubuntu0.1~22.04",
"1.20.3-1ubuntu0.1~22.04.1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.21",
"binary_version": "1.21.1-1~ubuntu22.04.3"
},
{
"binary_name": "golang-1.21-go",
"binary_version": "1.21.1-1~ubuntu22.04.3"
},
{
"binary_name": "golang-1.21-src",
"binary_version": "1.21.1-1~ubuntu22.04.3"
}
]
},
"package": {
"ecosystem": "Ubuntu:22.04:LTS",
"name": "golang-1.21",
"purl": "pkg:deb/ubuntu/golang-1.21@1.21.1-1~ubuntu22.04.3?arch=source\u0026distro=jammy"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.21.1-1~ubuntu22.04.1",
"1.21.1-1~ubuntu22.04.2",
"1.21.1-1~ubuntu22.04.3"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.22",
"binary_version": "1.22.2-2~22.04.3"
},
{
"binary_name": "golang-1.22-go",
"binary_version": "1.22.2-2~22.04.3"
},
{
"binary_name": "golang-1.22-src",
"binary_version": "1.22.2-2~22.04.3"
}
]
},
"package": {
"ecosystem": "Ubuntu:22.04:LTS",
"name": "golang-1.22",
"purl": "pkg:deb/ubuntu/golang-1.22@1.22.2-2~22.04.3?arch=source\u0026distro=jammy"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.22.2-2~22.04",
"1.22.2-2~22.04.1",
"1.22.2-2~22.04.2",
"1.22.2-2~22.04.3"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.23",
"binary_version": "1.23.1-1~22.04.2"
},
{
"binary_name": "golang-1.23-go",
"binary_version": "1.23.1-1~22.04.2"
},
{
"binary_name": "golang-1.23-src",
"binary_version": "1.23.1-1~22.04.2"
}
]
},
"package": {
"ecosystem": "Ubuntu:22.04:LTS",
"name": "golang-1.23",
"purl": "pkg:deb/ubuntu/golang-1.23@1.23.1-1~22.04.2?arch=source\u0026distro=jammy"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.23.1-1~22.04",
"1.23.1-1~22.04.2"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.24",
"binary_version": "1.24.13-2~22.04.1"
},
{
"binary_name": "golang-1.24-go",
"binary_version": "1.24.13-2~22.04.1"
},
{
"binary_name": "golang-1.24-src",
"binary_version": "1.24.13-2~22.04.1"
}
]
},
"package": {
"ecosystem": "Ubuntu:22.04:LTS",
"name": "golang-1.24",
"purl": "pkg:deb/ubuntu/golang-1.24@1.24.13-2~22.04.1?arch=source\u0026distro=jammy"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.24.4-1ubuntu1~22.04.1",
"1.24.4-1ubuntu1~22.04.2",
"1.24.13-2~22.04.1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.13",
"binary_version": "1.13.8-1ubuntu2.22.04.2"
},
{
"binary_name": "golang-1.13-go",
"binary_version": "1.13.8-1ubuntu2.22.04.2"
},
{
"binary_name": "golang-1.13-src",
"binary_version": "1.13.8-1ubuntu2.22.04.2"
}
]
},
"package": {
"ecosystem": "Ubuntu:Pro:22.04:LTS",
"name": "golang-1.13",
"purl": "pkg:deb/ubuntu/golang-1.13@1.13.8-1ubuntu2.22.04.2?arch=source\u0026distro=esm-apps/jammy"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.13.8-1ubuntu2",
"1.13.8-1ubuntu2.22.04.1",
"1.13.8-1ubuntu2.22.04.1+esm1",
"1.13.8-1ubuntu2.22.04.2"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.21",
"binary_version": "1.21.9-1ubuntu0.1"
},
{
"binary_name": "golang-1.21-go",
"binary_version": "1.21.9-1ubuntu0.1"
},
{
"binary_name": "golang-1.21-src",
"binary_version": "1.21.9-1ubuntu0.1"
}
]
},
"package": {
"ecosystem": "Ubuntu:24.04:LTS",
"name": "golang-1.21",
"purl": "pkg:deb/ubuntu/golang-1.21@1.21.9-1ubuntu0.1?arch=source\u0026distro=noble"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.21.1-1",
"1.21.3-1",
"1.21.4-1",
"1.21.5-1",
"1.21.6-1",
"1.21.7-1",
"1.21.7-2",
"1.21.8-1",
"1.21.8-1build1",
"1.21.9-1",
"1.21.9-1ubuntu0.1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.22",
"binary_version": "1.22.2-2ubuntu0.4"
},
{
"binary_name": "golang-1.22-go",
"binary_version": "1.22.2-2ubuntu0.4"
},
{
"binary_name": "golang-1.22-src",
"binary_version": "1.22.2-2ubuntu0.4"
}
]
},
"package": {
"ecosystem": "Ubuntu:24.04:LTS",
"name": "golang-1.22",
"purl": "pkg:deb/ubuntu/golang-1.22@1.22.2-2ubuntu0.4?arch=source\u0026distro=noble"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.22~rc1-2",
"1.22.0-1",
"1.22.0-2",
"1.22.1-1",
"1.22.1-1build1",
"1.22.2-2",
"1.22.2-2ubuntu0.1",
"1.22.2-2ubuntu0.2",
"1.22.2-2ubuntu0.3",
"1.22.2-2ubuntu0.4"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.23",
"binary_version": "1.23.1-1~24.04.1"
},
{
"binary_name": "golang-1.23-go",
"binary_version": "1.23.1-1~24.04.1"
},
{
"binary_name": "golang-1.23-src",
"binary_version": "1.23.1-1~24.04.1"
}
]
},
"package": {
"ecosystem": "Ubuntu:24.04:LTS",
"name": "golang-1.23",
"purl": "pkg:deb/ubuntu/golang-1.23@1.23.1-1~24.04.1?arch=source\u0026distro=noble"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.23.1-1~24.04",
"1.23.1-1~24.04.1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.24",
"binary_version": "1.24.13-2~24.04.1"
},
{
"binary_name": "golang-1.24-go",
"binary_version": "1.24.13-2~24.04.1"
},
{
"binary_name": "golang-1.24-src",
"binary_version": "1.24.13-2~24.04.1"
}
]
},
"package": {
"ecosystem": "Ubuntu:24.04:LTS",
"name": "golang-1.24",
"purl": "pkg:deb/ubuntu/golang-1.24@1.24.13-2~24.04.1?arch=source\u0026distro=noble"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.24.4-1ubuntu1~24.04.1",
"1.24.4-1ubuntu1~24.04.2",
"1.24.13-2~24.04.1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.23",
"binary_version": "1.23.10-1ubuntu0.2"
},
{
"binary_name": "golang-1.23-go",
"binary_version": "1.23.10-1ubuntu0.2"
},
{
"binary_name": "golang-1.23-src",
"binary_version": "1.23.10-1ubuntu0.2"
}
]
},
"package": {
"ecosystem": "Ubuntu:25.10",
"name": "golang-1.23",
"purl": "pkg:deb/ubuntu/golang-1.23@1.23.10-1ubuntu0.2?arch=source\u0026distro=questing"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.23.8-1",
"1.23.10-1",
"1.23.10-1ubuntu0.2"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.24",
"binary_version": "1.24.4-1ubuntu1"
},
{
"binary_name": "golang-1.24-go",
"binary_version": "1.24.4-1ubuntu1"
},
{
"binary_name": "golang-1.24-src",
"binary_version": "1.24.4-1ubuntu1"
}
]
},
"package": {
"ecosystem": "Ubuntu:25.10",
"name": "golang-1.24",
"purl": "pkg:deb/ubuntu/golang-1.24@1.24.4-1ubuntu1?arch=source\u0026distro=questing"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.24.2-1",
"1.24.2-2",
"1.24.4-1",
"1.24.4-1ubuntu1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.23",
"binary_version": "1.23.10-1"
},
{
"binary_name": "golang-1.23-go",
"binary_version": "1.23.10-1"
},
{
"binary_name": "golang-1.23-src",
"binary_version": "1.23.10-1"
}
]
},
"package": {
"ecosystem": "Ubuntu:26.04:LTS",
"name": "golang-1.23",
"purl": "pkg:deb/ubuntu/golang-1.23@1.23.10-1?arch=source\u0026distro=resolute"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.23.10-1"
]
},
{
"ecosystem_specific": {
"binaries": [
{
"binary_name": "golang-1.24",
"binary_version": "1.24.13-2"
},
{
"binary_name": "golang-1.24-go",
"binary_version": "1.24.13-2"
},
{
"binary_name": "golang-1.24-src",
"binary_version": "1.24.13-2"
}
]
},
"package": {
"ecosystem": "Ubuntu:26.04:LTS",
"name": "golang-1.24",
"purl": "pkg:deb/ubuntu/golang-1.24@1.24.13-2?arch=source\u0026distro=resolute"
},
"ranges": [
{
"events": [
{
"introduced": "0"
}
],
"type": "ECOSYSTEM"
}
],
"versions": [
"1.24.4-1ubuntu1",
"1.24.9-1",
"1.24.13-2"
]
}
],
"aliases": [],
"details": "The filepath.Walk and filepath.WalkDir functions are documented as not following symbolic links, but both functions are susceptible to a TOCTOU (time of check/time of use) race condition where a portion of the path being walked is replaced with a symbolic link while the walk is in progress.",
"id": "UBUNTU-CVE-2024-8244",
"modified": "2026-09-23T15:48:39Z",
"published": "2025-08-06T16:15:00Z",
"references": [
{
"type": "REPORT",
"url": "https://ubuntu.com/security/CVE-2024-8244"
},
{
"type": "REPORT",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8244"
},
{
"type": "REPORT",
"url": "https://go.dev/issue/70007"
},
{
"type": "REPORT",
"url": "https://pkg.go.dev/vuln/GO-2025-9999"
}
],
"related": [],
"schema_version": "1.7.0",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:H/PR:N/UI:N/S:U/C:L/I:N/A:N",
"type": "CVSS_V3"
},
{
"score": "medium",
"type": "Ubuntu"
}
],
"upstream": [
"CVE-2024-8244"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.