Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2026-43153 (GCVE-0-2026-43153)
Vulnerability from cvelistv5 – Published: 2026-05-06 11:27 – Updated: 2026-08-05 12:26| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
07120f1abdff80f3d1351f733661abe28d609535 , < 2fbc8421d1db102c0e5458607e042a23a03648b1
(git)
Affected: 07120f1abdff80f3d1351f733661abe28d609535 , < 457121c01f609b9934addbb04d5c1ef638c71c61 (git) Affected: 07120f1abdff80f3d1351f733661abe28d609535 , < 530082df991903f3330354e99e0cb7b05debfa86 (git) Affected: 07120f1abdff80f3d1351f733661abe28d609535 , < 3a65ea768b8094e4699e72f9ab420eb9e0f3f568 (git) |
guessed | |
| Linux | Linux |
Affected:
5.9
Unaffected: 0 , < 5.9 (semver) Unaffected: 6.12.75 , ≤ 6.12.* (semver) Unaffected: 6.18.16 , ≤ 6.18.* (semver) Unaffected: 6.19.6 , ≤ 6.19.* (semver) Unaffected: 7.0 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/xfs/libxfs/xfs_attr.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "2fbc8421d1db102c0e5458607e042a23a03648b1",
"status": "affected",
"version": "07120f1abdff80f3d1351f733661abe28d609535",
"versionType": "git"
},
{
"lessThan": "457121c01f609b9934addbb04d5c1ef638c71c61",
"status": "affected",
"version": "07120f1abdff80f3d1351f733661abe28d609535",
"versionType": "git"
},
{
"lessThan": "530082df991903f3330354e99e0cb7b05debfa86",
"status": "affected",
"version": "07120f1abdff80f3d1351f733661abe28d609535",
"versionType": "git"
},
{
"lessThan": "3a65ea768b8094e4699e72f9ab420eb9e0f3f568",
"status": "affected",
"version": "07120f1abdff80f3d1351f733661abe28d609535",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/xfs/libxfs/xfs_attr.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.9"
},
{
"lessThan": "5.9",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.75",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.16",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.19.*",
"status": "unaffected",
"version": "6.19.6",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.0",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.12.75",
"versionStartIncluding": "5.9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.18.16",
"versionStartIncluding": "5.9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.19.6",
"versionStartIncluding": "5.9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "7.0",
"versionStartIncluding": "5.9",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nxfs: remove xfs_attr_leaf_hasname\n\nThe calling convention of xfs_attr_leaf_hasname() is problematic, because\nit returns a NULL buffer when xfs_attr3_leaf_read fails, a valid buffer\nwhen xfs_attr3_leaf_lookup_int returns -ENOATTR or -EEXIST, and a\nnon-NULL buffer pointer for an already released buffer when\nxfs_attr3_leaf_lookup_int fails with other error values.\n\nFix this by simply open coding xfs_attr_leaf_hasname in the callers, so\nthat the buffer release code is done by each caller of\nxfs_attr3_leaf_read."
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 7.8,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:L - The vulnerable XFS attr path is reached through local extended-attribute syscalls such as setxattr/removexattr on a mounted XFS filesystem, not through network packet processing.\nAC:L - Given a crafted or corrupted one-block XFS attribute leaf, the erroneous buffer release path is deterministic and does not require winning a race or depending on heap layout to trigger.\nPR:L - An unprivileged local user can reach the update path through user.* xattrs on regular files or directories for which they have normal write permission; the trigger does not require CAP_SYS_ADMIN once the filesystem is mounted.\nUI:N - The attacker can invoke the xattr operation directly; no additional victim action is needed for the vulnerable code path after the XFS filesystem is available.\nS:U - The corruption occurs inside the kernel/XFS buffer management path and does not cross a separate security authority such as a VM or device isolation boundary.\nC:H - The stale xfs_buf pointer can be released a second time, creating use-after-free/refcount corruption in kernel buffer/log-item objects, which can reasonably support kernel memory disclosure primitives.\nI:H - The double release is kernel memory corruption of reusable buffer-management objects, which is reasonably treatable as exploitable for arbitrary write or control-flow impact under the required higher-severity rule.\nA:H - At minimum, the stale or already freed buffer/log-item path can cause a kernel oops, panic, deadlock, or filesystem shutdown when repeatedly triggered."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T12:26:13.566Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/2fbc8421d1db102c0e5458607e042a23a03648b1"
},
{
"url": "https://git.kernel.org/stable/c/457121c01f609b9934addbb04d5c1ef638c71c61"
},
{
"url": "https://git.kernel.org/stable/c/530082df991903f3330354e99e0cb7b05debfa86"
},
{
"url": "https://git.kernel.org/stable/c/3a65ea768b8094e4699e72f9ab420eb9e0f3f568"
}
],
"title": "xfs: remove xfs_attr_leaf_hasname",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2026-43153",
"datePublished": "2026-05-06T11:27:34.446Z",
"dateReserved": "2026-05-01T14:12:55.989Z",
"dateUpdated": "2026-08-05T12:26:13.566Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2026-43153",
"date": "2026-10-02",
"epss": "0.00175",
"percentile": "0.06321"
},
"microsoft_vex": {
"current_release_date": "2026-09-24T01:45:42.000Z",
"cve": "CVE-2026-43153",
"id": "msrc_CVE-2026-43153",
"initial_release_date": "2026-05-07T01:07:17.000Z",
"product_status:known_affected": "10",
"source": "Microsoft CSAF VEX",
"status": "final",
"title": "xfs: remove xfs_attr_leaf_hasname",
"url": "https://msrc.microsoft.com/csaf/vex/2026/msrc_cve-2026-43153.json",
"version": "14"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/xfs/libxfs/xfs_attr.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "2fbc8421d1db102c0e5458607e042a23a03648b1",
"status": "affected",
"version": "07120f1abdff80f3d1351f733661abe28d609535",
"versionType": "git"
},
{
"lessThan": "457121c01f609b9934addbb04d5c1ef638c71c61",
"status": "affected",
"version": "07120f1abdff80f3d1351f733661abe28d609535",
"versionType": "git"
},
{
"lessThan": "530082df991903f3330354e99e0cb7b05debfa86",
"status": "affected",
"version": "07120f1abdff80f3d1351f733661abe28d609535",
"versionType": "git"
},
{
"lessThan": "3a65ea768b8094e4699e72f9ab420eb9e0f3f568",
"status": "affected",
"version": "07120f1abdff80f3d1351f733661abe28d609535",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/xfs/libxfs/xfs_attr.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.9"
},
{
"lessThan": "5.9",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.75",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.16",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.19.*",
"status": "unaffected",
"version": "6.19.6",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.0",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "F0FB6DE3-7F78-4DBC-83E3-1ACA0F4DC0E4",
"versionEndExcluding": "6.12.75",
"versionStartIncluding": "5.9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B4B8CDA9-BADF-4CF5-8B3B-702DE8EEA40B",
"versionEndExcluding": "6.18.16",
"versionStartIncluding": "6.13",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "373EEEDA-FAA1-4FB4-B6ED-DB4DD99DBE67",
"versionEndExcluding": "6.19.6",
"versionStartIncluding": "6.19",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nxfs: remove xfs_attr_leaf_hasname\n\nThe calling convention of xfs_attr_leaf_hasname() is problematic, because\nit returns a NULL buffer when xfs_attr3_leaf_read fails, a valid buffer\nwhen xfs_attr3_leaf_lookup_int returns -ENOATTR or -EEXIST, and a\nnon-NULL buffer pointer for an already released buffer when\nxfs_attr3_leaf_lookup_int fails with other error values.\n\nFix this by simply open coding xfs_attr_leaf_hasname in the callers, so\nthat the buffer release code is done by each caller of\nxfs_attr3_leaf_read."
}
],
"id": "CVE-2026-43153",
"lastModified": "2026-06-17T10:49:02.063",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
}
]
},
"published": "2026-05-06T12:16:33.073",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2fbc8421d1db102c0e5458607e042a23a03648b1"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3a65ea768b8094e4699e72f9ab420eb9e0f3f568"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/457121c01f609b9934addbb04d5c1ef638c71c61"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/530082df991903f3330354e99e0cb7b05debfa86"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-Other"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2026-07-02T21:44:52+00:00",
"cve": "CVE-2026-43153",
"id": "CVE-2026-43153",
"initial_release_date": "2026-05-06T00:00:00+00:00",
"product_status:known_affected": "232",
"product_status:known_not_affected": "42",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: xfs: remove xfs_attr_leaf_hasname",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2026/cve-2026-43153.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "important",
"current_release_date": "2026-09-25T23:56:20Z",
"cve": "CVE-2026-43153",
"id": "CVE-2026-43153",
"initial_release_date": "2026-05-09T02:41:56Z",
"product_status:first_fixed": "2",
"product_status:known_affected": "540",
"product_status:known_not_affected": "224",
"product_status:recommended": "172",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2026-43153",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2026-43153.json",
"version": "10"
}
}
}
BELL-CVE-2026-43153 (CVE-2026-43153)
Vulnerability from osv_bellsoft – Published: 2026-05-07 06:09 – Updated: 2026-06-24 20:14 – Source website| URL | Type | |
|---|---|---|
{
"affected": [
{
"package": {
"ecosystem": "Alpaquita:23",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=23"
},
"ranges": [
{
"events": [
{
"introduced": "6.1.170-r0"
}
],
"type": "ECOSYSTEM"
}
]
},
{
"package": {
"ecosystem": "Alpaquita:25",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=25"
},
"ranges": [
{
"events": [
{
"introduced": "6.12.74-r0"
},
{
"fixed": "6.12.80-r0"
}
],
"type": "ECOSYSTEM"
}
]
},
{
"package": {
"ecosystem": "Alpaquita:stream",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=stream"
},
"ranges": [
{
"events": [
{
"introduced": "6.12.92-r1"
},
{
"fixed": "6.18.35-r1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"id": "BELL-CVE-2026-43153",
"modified": "2026-06-24T20:14:46.337312Z",
"published": "2026-05-07T06:09:00.297062Z",
"references": [
{
"type": "ADVISORY",
"url": "https://docs.bell-sw.com/security/cves/CVE-2026-43153"
}
],
"schema_version": "1.7.4",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"upstream": [
"CVE-2026-43153"
]
}
CERTFR-2026-AVI-0697
Vulnerability from certfr_avis - Published: 2026-06-05 - Updated: 2026-06-05
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une atteinte à la confidentialité des données, une atteinte à l'intégrité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | Public Cloud Module | Public Cloud Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 LTSS | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 | ||
| SUSE | SUSE Linux Micro Extras | SUSE Linux Micro Extras 6.2 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP7 | ||
| SUSE | SUSE Linux Micro | SUSE Linux Micro 6.2 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | SUSE Linux Micro | SUSE Linux Micro 6.1 | ||
| SUSE | Legacy Module | Legacy Module 15-SP7 | ||
| SUSE | SUSE Linux Micro | SUSE Linux Micro 6.0 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 LTSS | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 LTSS | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP7 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Public Cloud Module 15-SP7",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro Extras 6.2",
"product": {
"name": "SUSE Linux Micro Extras",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP7",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.2",
"product": {
"name": "SUSE Linux Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.1",
"product": {
"name": "SUSE Linux Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP7",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.0",
"product": {
"name": "SUSE Linux Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP7",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP7",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-43366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43366"
},
{
"name": "CVE-2026-23260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23260"
},
{
"name": "CVE-2026-23447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23447"
},
{
"name": "CVE-2026-23387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23387"
},
{
"name": "CVE-2026-31658",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31658"
},
{
"name": "CVE-2026-23318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23318"
},
{
"name": "CVE-2026-23368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23368"
},
{
"name": "CVE-2026-23475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23475"
},
{
"name": "CVE-2026-31402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31402"
},
{
"name": "CVE-2025-40219",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40219"
},
{
"name": "CVE-2026-23426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23426"
},
{
"name": "CVE-2026-23450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23450"
},
{
"name": "CVE-2026-31435",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31435"
},
{
"name": "CVE-2026-43060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43060"
},
{
"name": "CVE-2026-31685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31685"
},
{
"name": "CVE-2026-23269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23269"
},
{
"name": "CVE-2026-31416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31416"
},
{
"name": "CVE-2026-31656",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31656"
},
{
"name": "CVE-2026-31453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31453"
},
{
"name": "CVE-2026-23463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23463"
},
{
"name": "CVE-2026-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23454"
},
{
"name": "CVE-2026-31405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31405"
},
{
"name": "CVE-2026-23346",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23346"
},
{
"name": "CVE-2026-23465",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23465"
},
{
"name": "CVE-2023-20585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-20585"
},
{
"name": "CVE-2026-31528",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31528"
},
{
"name": "CVE-2026-31550",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31550"
},
{
"name": "CVE-2026-23290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23290"
},
{
"name": "CVE-2026-31787",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31787"
},
{
"name": "CVE-2026-31456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31456"
},
{
"name": "CVE-2026-23468",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23468"
},
{
"name": "CVE-2026-31691",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31691"
},
{
"name": "CVE-2026-23461",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23461"
},
{
"name": "CVE-2026-43044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43044"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-23340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23340"
},
{
"name": "CVE-2026-31738",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31738"
},
{
"name": "CVE-2026-23441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23441"
},
{
"name": "CVE-2026-23383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23383"
},
{
"name": "CVE-2026-23412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23412"
},
{
"name": "CVE-2026-31547",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31547"
},
{
"name": "CVE-2026-23253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23253"
},
{
"name": "CVE-2026-43025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43025"
},
{
"name": "CVE-2026-23271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23271"
},
{
"name": "CVE-2025-68265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68265"
},
{
"name": "CVE-2026-23434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23434"
},
{
"name": "CVE-2026-23268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23268"
},
{
"name": "CVE-2025-68310",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68310"
},
{
"name": "CVE-2026-23443",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23443"
},
{
"name": "CVE-2026-23470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23470"
},
{
"name": "CVE-2026-23418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23418"
},
{
"name": "CVE-2026-23304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23304"
},
{
"name": "CVE-2026-23357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23357"
},
{
"name": "CVE-2026-23407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23407"
},
{
"name": "CVE-2026-31408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31408"
},
{
"name": "CVE-2026-31505",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31505"
},
{
"name": "CVE-2026-31668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31668"
},
{
"name": "CVE-2026-23209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23209"
},
{
"name": "CVE-2026-43153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43153"
},
{
"name": "CVE-2026-23324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23324"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-23347",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23347"
},
{
"name": "CVE-2026-23373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23373"
},
{
"name": "CVE-2026-23317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23317"
},
{
"name": "CVE-2026-31389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31389"
},
{
"name": "CVE-2026-31394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31394"
},
{
"name": "CVE-2026-31681",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31681"
},
{
"name": "CVE-2026-23456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23456"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-23264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23264"
},
{
"name": "CVE-2026-23457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23457"
},
{
"name": "CVE-2026-43503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43503"
},
{
"name": "CVE-2026-31496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31496"
},
{
"name": "CVE-2026-43009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43009"
},
{
"name": "CVE-2026-23399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23399"
},
{
"name": "CVE-2026-23334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23334"
},
{
"name": "CVE-2026-31420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31420"
},
{
"name": "CVE-2026-23408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23408"
},
{
"name": "CVE-2026-23401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23401"
},
{
"name": "CVE-2026-31525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31525"
},
{
"name": "CVE-2026-43500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43500"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-43334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43334"
},
{
"name": "CVE-2026-23391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23391"
},
{
"name": "CVE-2026-31415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31415"
},
{
"name": "CVE-2026-23406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23406"
},
{
"name": "CVE-2026-23462",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23462"
},
{
"name": "CVE-2026-23273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23273"
},
{
"name": "CVE-2026-23372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23372"
},
{
"name": "CVE-2026-31494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31494"
},
{
"name": "CVE-2026-31565",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31565"
},
{
"name": "CVE-2026-23279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23279"
},
{
"name": "CVE-2026-23466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23466"
},
{
"name": "CVE-2026-23240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23240"
},
{
"name": "CVE-2026-23473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23473"
},
{
"name": "CVE-2026-23246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23246"
},
{
"name": "CVE-2026-31422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31422"
},
{
"name": "CVE-2026-31533",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31533"
},
{
"name": "CVE-2026-23298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23298"
},
{
"name": "CVE-2026-31449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31449"
},
{
"name": "CVE-2026-31427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31427"
},
{
"name": "CVE-2026-31392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31392"
},
{
"name": "CVE-2026-23360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23360"
},
{
"name": "CVE-2026-31515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31515"
},
{
"name": "CVE-2026-23472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23472"
},
{
"name": "CVE-2026-23437",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23437"
},
{
"name": "CVE-2024-14027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-14027"
},
{
"name": "CVE-2026-23308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23308"
},
{
"name": "CVE-2026-31684",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31684"
},
{
"name": "CVE-2026-23396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23396"
},
{
"name": "CVE-2026-31423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31423"
},
{
"name": "CVE-2026-23262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23262"
},
{
"name": "CVE-2026-23370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23370"
},
{
"name": "CVE-2026-23315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23315"
},
{
"name": "CVE-2026-43419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43419"
},
{
"name": "CVE-2026-31669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31669"
},
{
"name": "CVE-2026-23239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23239"
},
{
"name": "CVE-2021-47103",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47103"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-31554",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31554"
},
{
"name": "CVE-2026-23367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23367"
},
{
"name": "CVE-2026-31662",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31662"
},
{
"name": "CVE-2026-43437",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43437"
},
{
"name": "CVE-2026-23446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23446"
},
{
"name": "CVE-2026-46300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46300"
},
{
"name": "CVE-2026-31526",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31526"
},
{
"name": "CVE-2026-23417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23417"
},
{
"name": "CVE-2026-43441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43441"
},
{
"name": "CVE-2025-71269",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71269"
},
{
"name": "CVE-2026-23300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23300"
},
{
"name": "CVE-2026-31406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31406"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-23410",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23410"
},
{
"name": "CVE-2026-31675",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31675"
},
{
"name": "CVE-2026-23363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23363"
},
{
"name": "CVE-2026-23445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23445"
},
{
"name": "CVE-2026-31412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31412"
},
{
"name": "CVE-2026-23362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23362"
},
{
"name": "CVE-2026-31421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31421"
},
{
"name": "CVE-2026-43365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43365"
},
{
"name": "CVE-2026-31470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31470"
},
{
"name": "CVE-2026-43126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43126"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-23245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23245"
},
{
"name": "CVE-2026-31403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31403"
},
{
"name": "CVE-2026-31400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31400"
},
{
"name": "CVE-2026-31512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31512"
},
{
"name": "CVE-2026-31504",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31504"
},
{
"name": "CVE-2026-31607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31607"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-31679",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31679"
},
{
"name": "CVE-2026-43120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43120"
},
{
"name": "CVE-2026-43265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43265"
},
{
"name": "CVE-2026-31404",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31404"
},
{
"name": "CVE-2026-43330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43330"
},
{
"name": "CVE-2026-23274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23274"
},
{
"name": "CVE-2026-31417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31417"
},
{
"name": "CVE-2026-23448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23448"
},
{
"name": "CVE-2025-54518",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54518"
},
{
"name": "CVE-2025-71268",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71268"
},
{
"name": "CVE-2026-31426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31426"
},
{
"name": "CVE-2026-23354",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23354"
},
{
"name": "CVE-2026-23325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23325"
},
{
"name": "CVE-2026-23405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23405"
},
{
"name": "CVE-2026-23440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23440"
},
{
"name": "CVE-2026-23403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23403"
},
{
"name": "CVE-2026-31488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31488"
},
{
"name": "CVE-2026-23397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23397"
},
{
"name": "CVE-2026-23452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23452"
},
{
"name": "CVE-2026-23474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23474"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-23343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23343"
},
{
"name": "CVE-2026-23336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23336"
},
{
"name": "CVE-2026-23168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23168"
},
{
"name": "CVE-2026-31682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31682"
},
{
"name": "CVE-2026-31570",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31570"
},
{
"name": "CVE-2026-31395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31395"
},
{
"name": "CVE-2026-23455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23455"
},
{
"name": "CVE-2026-23316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23316"
},
{
"name": "CVE-2026-23261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23261"
},
{
"name": "CVE-2026-23335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23335"
},
{
"name": "CVE-2026-23369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23369"
},
{
"name": "CVE-2026-43110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43110"
},
{
"name": "CVE-2026-31507",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31507"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2025-71302",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71302"
},
{
"name": "CVE-2026-46333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46333"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-31428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31428"
},
{
"name": "CVE-2026-23420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23420"
},
{
"name": "CVE-2026-23411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23411"
},
{
"name": "CVE-2026-23449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23449"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-31666",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31666"
},
{
"name": "CVE-2026-23409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23409"
},
{
"name": "CVE-2026-23442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23442"
},
{
"name": "CVE-2026-23393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23393"
},
{
"name": "CVE-2026-23458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23458"
},
{
"name": "CVE-2026-23313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23313"
},
{
"name": "CVE-2026-31649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31649"
},
{
"name": "CVE-2026-31393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31393"
},
{
"name": "CVE-2026-43027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43027"
},
{
"name": "CVE-2026-23339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23339"
},
{
"name": "CVE-2026-23404",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23404"
},
{
"name": "CVE-2026-23436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23436"
},
{
"name": "CVE-2026-23321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23321"
},
{
"name": "CVE-2026-23460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23460"
},
{
"name": "CVE-2026-31678",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31678"
},
{
"name": "CVE-2026-23395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23395"
},
{
"name": "CVE-2026-31503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31503"
},
{
"name": "CVE-2026-23306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23306"
},
{
"name": "CVE-2026-23374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23374"
},
{
"name": "CVE-2026-23378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23378"
},
{
"name": "CVE-2026-31519",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31519"
},
{
"name": "CVE-2025-40181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40181"
},
{
"name": "CVE-2026-23464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23464"
},
{
"name": "CVE-2026-43045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43045"
},
{
"name": "CVE-2026-23291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23291"
},
{
"name": "CVE-2026-31436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31436"
},
{
"name": "CVE-2026-23382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23382"
},
{
"name": "CVE-2026-43214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43214"
},
{
"name": "CVE-2026-43082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43082"
},
{
"name": "CVE-2026-31644",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31644"
},
{
"name": "CVE-2026-31700",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31700"
},
{
"name": "CVE-2026-23312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23312"
},
{
"name": "CVE-2026-23365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23365"
},
{
"name": "CVE-2026-23419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23419"
},
{
"name": "CVE-2026-43329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43329"
},
{
"name": "CVE-2026-31424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31424"
},
{
"name": "CVE-2026-23375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23375"
},
{
"name": "CVE-2026-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23307"
},
{
"name": "CVE-2025-71183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71183"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2022-49979",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49979"
},
{
"name": "CVE-2026-31407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31407"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-31425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31425"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-23276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23276"
},
{
"name": "CVE-2026-31579",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31579"
},
{
"name": "CVE-2023-2058",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2058"
},
{
"name": "CVE-2026-23351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23351"
},
{
"name": "CVE-2026-43050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43050"
},
{
"name": "CVE-2026-43088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43088"
},
{
"name": "CVE-2026-43494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43494"
}
],
"initial_release_date": "2026-06-05T00:00:00",
"last_revision_date": "2026-06-05T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0697",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-06-05T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es, une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21930-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621930-1"
},
{
"published_at": "2026-05-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21841-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621841-1"
},
{
"published_at": "2026-06-03",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2238-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262238-1"
},
{
"published_at": "2026-06-02",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21974-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621974-1"
},
{
"published_at": "2026-06-02",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2217-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262217-1"
},
{
"published_at": "2026-06-02",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21979-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621979-1"
},
{
"published_at": "2026-05-31",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2149-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262149-1"
},
{
"published_at": "2026-05-31",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2158-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262158-1"
},
{
"published_at": "2026-06-02",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21973-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621973-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2189-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262189-1"
},
{
"published_at": "2026-05-31",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2159-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262159-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21942-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621942-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21964-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621964-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21939-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621939-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2202-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262202-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21910-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621910-1"
},
{
"published_at": "2026-05-29",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2134-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262134-1"
},
{
"published_at": "2026-05-30",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2137-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262137-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21963-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621963-1"
},
{
"published_at": "2026-06-02",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21978-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621978-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2191-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262191-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21972-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621972-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2207-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262207-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21969-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621969-1"
},
{
"published_at": "2026-06-02",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21983-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621983-1"
},
{
"published_at": "2026-06-02",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21982-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621982-1"
},
{
"published_at": "2026-05-31",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2141-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262141-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21936-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621936-1"
},
{
"published_at": "2026-05-31",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2148-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262148-1"
},
{
"published_at": "2026-05-29",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2131-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262131-1"
},
{
"published_at": "2026-05-29",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2133-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262133-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21968-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621968-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21909-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621909-1"
},
{
"published_at": "2026-05-31",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2176-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262176-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21941-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621941-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21932-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621932-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21929-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621929-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2212-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262212-1"
},
{
"published_at": "2026-05-31",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2153-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262153-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2199-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262199-1"
},
{
"published_at": "2026-05-31",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2168-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262168-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21940-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621940-1"
},
{
"published_at": "2026-05-31",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2178-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262178-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2181-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262181-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2200-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262200-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2214-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262214-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21938-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621938-1"
},
{
"published_at": "2026-06-02",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2216-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262216-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21931-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621931-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21933-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621933-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21896-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621896-1"
},
{
"published_at": "2026-05-29",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2111-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262111-1"
},
{
"published_at": "2026-05-31",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2172-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262172-1"
},
{
"published_at": "2026-06-02",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21975-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621975-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21971-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621971-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21935-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621935-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21937-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621937-1"
},
{
"published_at": "2026-06-02",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2215-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262215-1"
},
{
"published_at": "2026-05-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21834-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621834-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21962-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621962-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21970-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621970-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:21934-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202621934-1"
},
{
"published_at": "2026-06-01",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:2195-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20262195-1"
}
]
}
CERTFR-2026-AVI-0831
Vulnerability from certfr_avis - Published: 2026-07-03 - Updated: 2026-07-03
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 26.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 25.10",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 14.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-46325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46325"
},
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-23198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23198"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-45864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45864"
},
{
"name": "CVE-2026-43078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43078"
},
{
"name": "CVE-2026-31713",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31713"
},
{
"name": "CVE-2026-23202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23202"
},
{
"name": "CVE-2026-23260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23260"
},
{
"name": "CVE-2026-23167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23167"
},
{
"name": "CVE-2026-45905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45905"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-43414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43414"
},
{
"name": "CVE-2026-46010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46010"
},
{
"name": "CVE-2026-23129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23129"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2026-31582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31582"
},
{
"name": "CVE-2026-46045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46045"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2026-23098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23098"
},
{
"name": "CVE-2026-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47329"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2025-68749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68749"
},
{
"name": "CVE-2026-46081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46081"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-45884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45884"
},
{
"name": "CVE-2026-46087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46087"
},
{
"name": "CVE-2026-43315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43315"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-23126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23126"
},
{
"name": "CVE-2026-46255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46255"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2026-23054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23054"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-31402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31402"
},
{
"name": "CVE-2026-46042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46042"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-43317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43317"
},
{
"name": "CVE-2026-23159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23159"
},
{
"name": "CVE-2025-68725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68725"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2025-71265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71265"
},
{
"name": "CVE-2026-46076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46076"
},
{
"name": "CVE-2026-23450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23450"
},
{
"name": "CVE-2026-31696",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31696"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2026-31704",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31704"
},
{
"name": "CVE-2026-31685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31685"
},
{
"name": "CVE-2026-43073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43073"
},
{
"name": "CVE-2026-43143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43143"
},
{
"name": "CVE-2026-46013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46013"
},
{
"name": "CVE-2026-23069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23069"
},
{
"name": "CVE-2026-22992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22992"
},
{
"name": "CVE-2026-46065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46065"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2025-71191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71191"
},
{
"name": "CVE-2026-31593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31593"
},
{
"name": "CVE-2026-46007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46007"
},
{
"name": "CVE-2026-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47330"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-45923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45923"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-45910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45910"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-31600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31600"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-45928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45928"
},
{
"name": "CVE-2026-45988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45988"
},
{
"name": "CVE-2026-31698",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31698"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2025-40039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40039"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-31448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31448"
},
{
"name": "CVE-2026-31597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31597"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2026-23020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23020"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-46063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46063"
},
{
"name": "CVE-2026-23187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23187"
},
{
"name": "CVE-2026-46280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46280"
},
{
"name": "CVE-2026-43011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43011"
},
{
"name": "CVE-2026-43167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43167"
},
{
"name": "CVE-2026-45976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45976"
},
{
"name": "CVE-2026-43248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43248"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-23136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23136"
},
{
"name": "CVE-2026-23139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23139"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-46287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46287"
},
{
"name": "CVE-2025-71189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71189"
},
{
"name": "CVE-2026-23179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23179"
},
{
"name": "CVE-2026-31613",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31613"
},
{
"name": "CVE-2026-23090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23090"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-46032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46032"
},
{
"name": "CVE-2026-23035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23035"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2026-31574",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31574"
},
{
"name": "CVE-2026-46057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46057"
},
{
"name": "CVE-2026-23258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23258"
},
{
"name": "CVE-2026-46080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46080"
},
{
"name": "CVE-2026-23064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23064"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2026-43284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43284"
},
{
"name": "CVE-2026-45995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45995"
},
{
"name": "CVE-2026-46034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46034"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-23061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23061"
},
{
"name": "CVE-2026-23059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23059"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-45996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45996"
},
{
"name": "CVE-2026-46286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46286"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-23135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23135"
},
{
"name": "CVE-2026-23047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23047"
},
{
"name": "CVE-2025-68365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68365"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-43244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43244"
},
{
"name": "CVE-2026-23119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23119"
},
{
"name": "CVE-2026-23173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23173"
},
{
"name": "CVE-2026-31711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31711"
},
{
"name": "CVE-2026-31611",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31611"
},
{
"name": "CVE-2026-23123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23123"
},
{
"name": "CVE-2026-43201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43201"
},
{
"name": "CVE-2026-31714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31714"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2026-46260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46260"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-31431",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31431"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-43319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43319"
},
{
"name": "CVE-2026-23094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23094"
},
{
"name": "CVE-2026-23049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23049"
},
{
"name": "CVE-2026-46092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46092"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2026-31614",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31614"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2026-43262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43262"
},
{
"name": "CVE-2026-23101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23101"
},
{
"name": "CVE-2026-46001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46001"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-46071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46071"
},
{
"name": "CVE-2026-23099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23099"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-46137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46137"
},
{
"name": "CVE-2026-46072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46072"
},
{
"name": "CVE-2026-45851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45851"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-31668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31668"
},
{
"name": "CVE-2026-31478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31478"
},
{
"name": "CVE-2026-45859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45859"
},
{
"name": "CVE-2026-23085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23085"
},
{
"name": "CVE-2026-46066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46066"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-54505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54505"
},
{
"name": "CVE-2026-43153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43153"
},
{
"name": "CVE-2026-23150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23150"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-45917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45917"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-46031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46031"
},
{
"name": "CVE-2026-46277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46277"
},
{
"name": "CVE-2026-23163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23163"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-23057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23057"
},
{
"name": "CVE-2025-37926",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37926"
},
{
"name": "CVE-2026-45865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45865"
},
{
"name": "CVE-2026-31635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31635"
},
{
"name": "CVE-2026-31598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31598"
},
{
"name": "CVE-2026-43033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43033"
},
{
"name": "CVE-2026-46265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46265"
},
{
"name": "CVE-2026-45972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45972"
},
{
"name": "CVE-2026-23166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23166"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-22991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22991"
},
{
"name": "CVE-2026-23264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23264"
},
{
"name": "CVE-2026-46002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46002"
},
{
"name": "CVE-2026-46074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46074"
},
{
"name": "CVE-2026-47331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47331"
},
{
"name": "CVE-2026-31595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31595"
},
{
"name": "CVE-2026-46332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46332"
},
{
"name": "CVE-2026-43503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43503"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-45989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45989"
},
{
"name": "CVE-2026-46091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46091"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-45881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45881"
},
{
"name": "CVE-2026-43350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43350"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2026-43376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43376"
},
{
"name": "CVE-2026-23256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23256"
},
{
"name": "CVE-2026-23116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23116"
},
{
"name": "CVE-2026-46261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46261"
},
{
"name": "CVE-2026-31659",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31659"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-45847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45847"
},
{
"name": "CVE-2026-45861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45861"
},
{
"name": "CVE-2026-31591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31591"
},
{
"name": "CVE-2026-46041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46041"
},
{
"name": "CVE-2025-71239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71239"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2025-71200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71200"
},
{
"name": "CVE-2026-43117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43117"
},
{
"name": "CVE-2026-46083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46083"
},
{
"name": "CVE-2026-22980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22980"
},
{
"name": "CVE-2026-45914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45914"
},
{
"name": "CVE-2026-23172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23172"
},
{
"name": "CVE-2026-43493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43493"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-43383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43383"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-43500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43500"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2026-23133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23133"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-31703",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31703"
},
{
"name": "CVE-2026-23131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23131"
},
{
"name": "CVE-2026-23212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23212"
},
{
"name": "CVE-2026-23032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23032"
},
{
"name": "CVE-2026-23170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23170"
},
{
"name": "CVE-2026-46097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46097"
},
{
"name": "CVE-2026-23204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23204"
},
{
"name": "CVE-2026-23019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23019"
},
{
"name": "CVE-2026-23230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23230"
},
{
"name": "CVE-2025-71188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71188"
},
{
"name": "CVE-2026-46030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46030"
},
{
"name": "CVE-2026-43170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43170"
},
{
"name": "CVE-2026-31693",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31693"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-43499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43499"
},
{
"name": "CVE-2026-23125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23125"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-43150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43150"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45913"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-23005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23005"
},
{
"name": "CVE-2026-47328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47328"
},
{
"name": "CVE-2026-23214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23214"
},
{
"name": "CVE-2026-46005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46005"
},
{
"name": "CVE-2026-45962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45962"
},
{
"name": "CVE-2026-31718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31718"
},
{
"name": "CVE-2026-31697",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31697"
},
{
"name": "CVE-2026-23030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23030"
},
{
"name": "CVE-2026-46247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46247"
},
{
"name": "CVE-2026-46069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46069"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2026-23178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23178"
},
{
"name": "CVE-2026-46288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46288"
},
{
"name": "CVE-2026-43288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43288"
},
{
"name": "CVE-2026-22997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22997"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2025-71294",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71294"
},
{
"name": "CVE-2026-31609",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31609"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2026-46022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46022"
},
{
"name": "CVE-2025-71196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71196"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-31533",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31533"
},
{
"name": "CVE-2026-46059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46059"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-46323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46323"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-46103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46103"
},
{
"name": "CVE-2026-43348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43348"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-46043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46043"
},
{
"name": "CVE-2026-23191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23191"
},
{
"name": "CVE-2026-31601",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31601"
},
{
"name": "CVE-2026-23078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23078"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-31418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31418"
},
{
"name": "CVE-2026-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47332"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2026-45981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45981"
},
{
"name": "CVE-2026-31620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31620"
},
{
"name": "CVE-2026-43197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43197"
},
{
"name": "CVE-2026-46278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46278"
},
{
"name": "CVE-2026-46011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46011"
},
{
"name": "CVE-2026-46095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46095"
},
{
"name": "CVE-2026-43253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43253"
},
{
"name": "CVE-2026-31594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31594"
},
{
"name": "CVE-2025-71220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71220"
},
{
"name": "CVE-2025-71295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71295"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-23103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23103"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-43491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43491"
},
{
"name": "CVE-2026-46100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46100"
},
{
"name": "CVE-2025-71199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71199"
},
{
"name": "CVE-2026-46012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46012"
},
{
"name": "CVE-2026-31606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31606"
},
{
"name": "CVE-2025-68358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68358"
},
{
"name": "CVE-2026-23180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23180"
},
{
"name": "CVE-2026-45999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45999"
},
{
"name": "CVE-2026-45973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45973"
},
{
"name": "CVE-2026-23006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23006"
},
{
"name": "CVE-2026-43249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43249"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2025-71267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71267"
},
{
"name": "CVE-2026-46243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46243"
},
{
"name": "CVE-2025-71195",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71195"
},
{
"name": "CVE-2026-22994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22994"
},
{
"name": "CVE-2026-31705",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31705"
},
{
"name": "CVE-2026-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52905"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-23083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23083"
},
{
"name": "CVE-2026-23262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23262"
},
{
"name": "CVE-2026-23088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23088"
},
{
"name": "CVE-2026-46038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46038"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-45878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45878"
},
{
"name": "CVE-2026-23108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23108"
},
{
"name": "CVE-2026-23267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23267"
},
{
"name": "CVE-2025-71180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71180"
},
{
"name": "CVE-2026-46000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46000"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47334"
},
{
"name": "CVE-2025-71194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71194"
},
{
"name": "CVE-2026-45982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45982"
},
{
"name": "CVE-2026-31669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31669"
},
{
"name": "CVE-2026-23200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23200"
},
{
"name": "CVE-2026-22999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22999"
},
{
"name": "CVE-2026-46250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46250"
},
{
"name": "CVE-2026-23068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23068"
},
{
"name": "CVE-2026-23089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23089"
},
{
"name": "CVE-2026-46062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46062"
},
{
"name": "CVE-2026-23216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23216"
},
{
"name": "CVE-2025-71225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71225"
},
{
"name": "CVE-2026-46276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46276"
},
{
"name": "CVE-2026-23071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23071"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2026-23056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23056"
},
{
"name": "CVE-2026-31608",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31608"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-43173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43173"
},
{
"name": "CVE-2026-31699",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31699"
},
{
"name": "CVE-2026-43077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43077"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-46289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46289"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-46283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46283"
},
{
"name": "CVE-2026-45957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45957"
},
{
"name": "CVE-2026-43407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43407"
},
{
"name": "CVE-2026-23063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23063"
},
{
"name": "CVE-2026-23427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23427"
},
{
"name": "CVE-2026-47335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47335"
},
{
"name": "CVE-2026-23073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23073"
},
{
"name": "CVE-2026-46020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46020"
},
{
"name": "CVE-2026-23058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23058"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2025-71182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71182"
},
{
"name": "CVE-2026-45997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45997"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-23038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23038"
},
{
"name": "CVE-2026-43402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43402"
},
{
"name": "CVE-2025-71286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71286"
},
{
"name": "CVE-2026-46090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46090"
},
{
"name": "CVE-2026-22990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22990"
},
{
"name": "CVE-2026-23000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23000"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2025-71186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71186"
},
{
"name": "CVE-2026-47336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47336"
},
{
"name": "CVE-2026-23176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23176"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-23026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23026"
},
{
"name": "CVE-2026-46044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46044"
},
{
"name": "CVE-2026-23128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23128"
},
{
"name": "CVE-2026-46300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46300"
},
{
"name": "CVE-2026-43271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43271"
},
{
"name": "CVE-2025-71190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71190"
},
{
"name": "CVE-2026-23140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23140"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2025-71089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71089"
},
{
"name": "CVE-2026-46026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46026"
},
{
"name": "CVE-2026-43258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43258"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-23107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23107"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-43304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43304"
},
{
"name": "CVE-2026-45886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45886"
},
{
"name": "CVE-2026-22978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22978"
},
{
"name": "CVE-2026-43378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43378"
},
{
"name": "CVE-2026-43384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43384"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2026-23146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23146"
},
{
"name": "CVE-2026-43501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43501"
},
{
"name": "CVE-2026-45998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45998"
},
{
"name": "CVE-2026-23037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23037"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2026-23001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23001"
},
{
"name": "CVE-2025-71224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71224"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2026-23193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23193"
},
{
"name": "CVE-2026-31610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31610"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2026-46008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46008"
},
{
"name": "CVE-2026-23215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23215"
},
{
"name": "CVE-2026-43238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43238"
},
{
"name": "CVE-2026-31592",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31592"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-45991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45991"
},
{
"name": "CVE-2026-23025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23025"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-31712",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31712"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2026-31686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31686"
},
{
"name": "CVE-2026-31707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31707"
},
{
"name": "CVE-2026-23151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23151"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-45880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45880"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-46067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46067"
},
{
"name": "CVE-2026-43349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43349"
},
{
"name": "CVE-2026-22982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22982"
},
{
"name": "CVE-2026-46290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46290"
},
{
"name": "CVE-2026-23205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23205"
},
{
"name": "CVE-2026-46036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46036"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-46279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46279"
},
{
"name": "CVE-2026-46135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46135"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-45990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45990"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2025-71222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71222"
},
{
"name": "CVE-2026-31504",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31504"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-45895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45895"
},
{
"name": "CVE-2026-46075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46075"
},
{
"name": "CVE-2026-23142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23142"
},
{
"name": "CVE-2025-71229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71229"
},
{
"name": "CVE-2026-23213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23213"
},
{
"name": "CVE-2026-31607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31607"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-23091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23091"
},
{
"name": "CVE-2026-46054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46054"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-45877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45877"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-46282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46282"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2025-71192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71192"
},
{
"name": "CVE-2026-47327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47327"
},
{
"name": "CVE-2026-31716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31716"
},
{
"name": "CVE-2026-23121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23121"
},
{
"name": "CVE-2026-31637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31637"
},
{
"name": "CVE-2026-31612",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31612"
},
{
"name": "CVE-2026-23428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23428"
},
{
"name": "CVE-2026-23274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23274"
},
{
"name": "CVE-2026-43199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43199"
},
{
"name": "CVE-2026-31590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31590"
},
{
"name": "CVE-2026-46073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46073"
},
{
"name": "CVE-2026-31621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31621"
},
{
"name": "CVE-2025-71297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71297"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2026-47326",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47326"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-31604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31604"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2026-23144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23144"
},
{
"name": "CVE-2026-23087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23087"
},
{
"name": "CVE-2026-46244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46244"
},
{
"name": "CVE-2026-31584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31584"
},
{
"name": "CVE-2026-31419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31419"
},
{
"name": "CVE-2025-71185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71185"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-43221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43221"
},
{
"name": "CVE-2025-71268",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71268"
},
{
"name": "CVE-2026-46281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46281"
},
{
"name": "CVE-2026-23096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23096"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2025-68351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68351"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-31717",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31717"
},
{
"name": "CVE-2026-43300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43300"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-43189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43189"
},
{
"name": "CVE-2025-40149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40149"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-23164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23164"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-46035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46035"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-31715",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31715"
},
{
"name": "CVE-2026-23278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23278"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-23124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23124"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-23257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23257"
},
{
"name": "CVE-2025-71160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71160"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2024-58096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58096"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2025-71162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71162"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-23075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23075"
},
{
"name": "CVE-2026-23120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23120"
},
{
"name": "CVE-2026-43222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43222"
},
{
"name": "CVE-2025-68803",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68803"
},
{
"name": "CVE-2026-22996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22996"
},
{
"name": "CVE-2026-46115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46115"
},
{
"name": "CVE-2026-46016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46016"
},
{
"name": "CVE-2026-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47337"
},
{
"name": "CVE-2026-46015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46015"
},
{
"name": "CVE-2026-23168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23168"
},
{
"name": "CVE-2024-50004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50004"
},
{
"name": "CVE-2026-46316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46316"
},
{
"name": "CVE-2026-23105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23105"
},
{
"name": "CVE-2026-31682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31682"
},
{
"name": "CVE-2026-22976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22976"
},
{
"name": "CVE-2026-46068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46068"
},
{
"name": "CVE-2026-43406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43406"
},
{
"name": "CVE-2026-45893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45893"
},
{
"name": "CVE-2026-46056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46056"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2026-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23141"
},
{
"name": "CVE-2026-23065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23065"
},
{
"name": "CVE-2026-23182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23182"
},
{
"name": "CVE-2026-31709",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31709"
},
{
"name": "CVE-2026-43215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43215"
},
{
"name": "CVE-2026-23086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23086"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-52904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52904"
},
{
"name": "CVE-2026-46004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46004"
},
{
"name": "CVE-2026-46086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46086"
},
{
"name": "CVE-2025-71273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71273"
},
{
"name": "CVE-2025-71291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71291"
},
{
"name": "CVE-2026-46094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46094"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-23455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23455"
},
{
"name": "CVE-2026-23233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23233"
},
{
"name": "CVE-2026-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53174"
},
{
"name": "CVE-2026-23261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23261"
},
{
"name": "CVE-2026-43341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43341"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-43239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43239"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-23156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23156"
},
{
"name": "CVE-2026-46060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46060"
},
{
"name": "CVE-2025-71193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71193"
},
{
"name": "CVE-2026-23095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23095"
},
{
"name": "CVE-2026-45882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45882"
},
{
"name": "CVE-2026-46084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46084"
},
{
"name": "CVE-2026-46079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46079"
},
{
"name": "CVE-2025-71163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71163"
},
{
"name": "CVE-2026-23062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23062"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23160"
},
{
"name": "CVE-2026-46333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46333"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-43071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43071"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-46085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46085"
},
{
"name": "CVE-2026-22984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22984"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47333"
},
{
"name": "CVE-2026-46029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46029"
},
{
"name": "CVE-2025-71266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71266"
},
{
"name": "CVE-2026-45898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45898"
},
{
"name": "CVE-2026-23206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23206"
},
{
"name": "CVE-2024-58097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58097"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-46021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46021"
},
{
"name": "CVE-2026-23241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23241"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-23033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23033"
},
{
"name": "CVE-2026-31676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31676"
},
{
"name": "CVE-2026-43318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43318"
},
{
"name": "CVE-2026-22977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22977"
},
{
"name": "CVE-2026-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23145"
},
{
"name": "CVE-2026-43186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43186"
},
{
"name": "CVE-2026-43083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43083"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-46047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46047"
},
{
"name": "CVE-2026-23003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23003"
},
{
"name": "CVE-2026-31649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31649"
},
{
"name": "CVE-2026-31719",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31719"
},
{
"name": "CVE-2026-23076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23076"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2025-68823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68823"
},
{
"name": "CVE-2026-31577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31577"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43256"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-23394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23394"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-23010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23010"
},
{
"name": "CVE-2026-43148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43148"
},
{
"name": "CVE-2026-23272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23272"
},
{
"name": "CVE-2026-45935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45935"
},
{
"name": "CVE-2026-45872",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45872"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-31575",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31575"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-31589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31589"
},
{
"name": "CVE-2026-23084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23084"
},
{
"name": "CVE-2026-23190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23190"
},
{
"name": "CVE-2026-22979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22979"
},
{
"name": "CVE-2026-43114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43114"
},
{
"name": "CVE-2026-31702",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31702"
},
{
"name": "CVE-2026-23011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23011"
},
{
"name": "CVE-2026-31587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31587"
},
{
"name": "CVE-2026-43278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43278"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52906"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-31708",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31708"
},
{
"name": "CVE-2026-23110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23110"
},
{
"name": "CVE-2026-46093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46093"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2026-31657",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31657"
},
{
"name": "CVE-2026-43125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43125"
},
{
"name": "CVE-2026-46025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46025"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2026-46246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46246"
},
{
"name": "CVE-2026-46003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46003"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2026-45921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45921"
},
{
"name": "CVE-2026-23148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23148"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2026-43169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43169"
},
{
"name": "CVE-2025-71197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71197"
},
{
"name": "CVE-2026-43175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43175"
},
{
"name": "CVE-2026-43320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43320"
},
{
"name": "CVE-2026-23031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23031"
},
{
"name": "CVE-2026-52907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52907"
},
{
"name": "CVE-2026-23102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23102"
},
{
"name": "CVE-2026-22998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22998"
},
{
"name": "CVE-2026-23050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23050"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-46096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46096"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2026-45849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45849"
},
{
"name": "CVE-2026-31706",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31706"
},
{
"name": "CVE-2026-31436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31436"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-43214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43214"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2025-71272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71272"
},
{
"name": "CVE-2026-23113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23113"
},
{
"name": "CVE-2025-71231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71231"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-46251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46251"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-23097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23097"
},
{
"name": "CVE-2026-31700",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31700"
},
{
"name": "CVE-2026-43212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43212"
},
{
"name": "CVE-2026-46089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46089"
},
{
"name": "CVE-2025-71198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71198"
},
{
"name": "CVE-2026-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52933"
},
{
"name": "CVE-2026-43128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43128"
},
{
"name": "CVE-2026-23021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23021"
},
{
"name": "CVE-2026-43250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43250"
},
{
"name": "CVE-2026-43275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43275"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-23093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23093"
},
{
"name": "CVE-2026-46028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46028"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-46098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46098"
},
{
"name": "CVE-2025-71183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71183"
},
{
"name": "CVE-2026-23249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23249"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2026-31710",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31710"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-43072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43072"
},
{
"name": "CVE-2026-23053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23053"
},
{
"name": "CVE-2026-46014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46014"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2025-71184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71184"
},
{
"name": "CVE-2026-46052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46052"
},
{
"name": "CVE-2026-46061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46061"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2025-71305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71305"
},
{
"name": "CVE-2026-43297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43297"
},
{
"name": "CVE-2025-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68263"
},
{
"name": "CVE-2026-45938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45938"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2026-43157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43157"
},
{
"name": "CVE-2026-45947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45947"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-46284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46284"
},
{
"name": "CVE-2026-46039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46039"
},
{
"name": "CVE-2026-46155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46155"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-31579",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31579"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-46048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46048"
},
{
"name": "CVE-2026-43137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43137"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-46254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46254"
},
{
"name": "CVE-2026-23080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23080"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-23351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23351"
},
{
"name": "CVE-2026-46078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46078"
},
{
"name": "CVE-2026-23254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23254"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-46058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46058"
},
{
"name": "CVE-2026-43494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43494"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
}
],
"initial_release_date": "2026-07-03T00:00:00",
"last_revision_date": "2026-07-03T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0831",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-07-03T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8491-1",
"url": "https://ubuntu.com/security/notices/USN-8491-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8497-1",
"url": "https://ubuntu.com/security/notices/USN-8497-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8499-1",
"url": "https://ubuntu.com/security/notices/USN-8499-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8493-2",
"url": "https://ubuntu.com/security/notices/USN-8493-2"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8488-1",
"url": "https://ubuntu.com/security/notices/USN-8488-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-2",
"url": "https://ubuntu.com/security/notices/USN-8492-2"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8498-1",
"url": "https://ubuntu.com/security/notices/USN-8498-1"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8489-1",
"url": "https://ubuntu.com/security/notices/USN-8489-1"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-1",
"url": "https://ubuntu.com/security/notices/USN-8492-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8488-2",
"url": "https://ubuntu.com/security/notices/USN-8488-2"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8493-1",
"url": "https://ubuntu.com/security/notices/USN-8493-1"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8490-1",
"url": "https://ubuntu.com/security/notices/USN-8490-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8501-1",
"url": "https://ubuntu.com/security/notices/USN-8501-1"
}
]
}
CERTFR-2026-AVI-0861
Vulnerability from certfr_avis - Published: 2026-07-10 - Updated: 2026-07-10
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 26.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 25.10",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-46325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46325"
},
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-23198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23198"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-45864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45864"
},
{
"name": "CVE-2026-43078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43078"
},
{
"name": "CVE-2026-31713",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31713"
},
{
"name": "CVE-2026-23202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23202"
},
{
"name": "CVE-2026-45905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45905"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-43414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43414"
},
{
"name": "CVE-2026-46010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46010"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2026-31582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31582"
},
{
"name": "CVE-2026-46045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46045"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2025-71134",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71134"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2026-46081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46081"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-45884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45884"
},
{
"name": "CVE-2026-46087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46087"
},
{
"name": "CVE-2026-43315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43315"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-46255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46255"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2021-47202",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47202"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-31402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31402"
},
{
"name": "CVE-2026-46042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46042"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-43317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43317"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2025-71265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71265"
},
{
"name": "CVE-2026-46076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46076"
},
{
"name": "CVE-2026-23450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23450"
},
{
"name": "CVE-2026-31696",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31696"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2026-31704",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31704"
},
{
"name": "CVE-2026-31685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31685"
},
{
"name": "CVE-2026-43073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43073"
},
{
"name": "CVE-2026-43143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43143"
},
{
"name": "CVE-2026-46013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46013"
},
{
"name": "CVE-2026-46065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46065"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2026-31593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31593"
},
{
"name": "CVE-2026-46007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46007"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-45923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45923"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-45910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45910"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-31600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31600"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-45928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45928"
},
{
"name": "CVE-2026-45988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45988"
},
{
"name": "CVE-2026-31698",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31698"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-31448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31448"
},
{
"name": "CVE-2026-31597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31597"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-46063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46063"
},
{
"name": "CVE-2026-46280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46280"
},
{
"name": "CVE-2026-43011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43011"
},
{
"name": "CVE-2026-43167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43167"
},
{
"name": "CVE-2026-45976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45976"
},
{
"name": "CVE-2026-43248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43248"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-46287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46287"
},
{
"name": "CVE-2025-71088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71088"
},
{
"name": "CVE-2026-31613",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31613"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-46032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46032"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2026-31574",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31574"
},
{
"name": "CVE-2026-46057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46057"
},
{
"name": "CVE-2026-23258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23258"
},
{
"name": "CVE-2026-46080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46080"
},
{
"name": "CVE-2026-43284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43284"
},
{
"name": "CVE-2026-45995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45995"
},
{
"name": "CVE-2026-46034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46034"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-45996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45996"
},
{
"name": "CVE-2026-46286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46286"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-43244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43244"
},
{
"name": "CVE-2026-31711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31711"
},
{
"name": "CVE-2026-31611",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31611"
},
{
"name": "CVE-2026-43201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43201"
},
{
"name": "CVE-2024-56643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56643"
},
{
"name": "CVE-2026-31714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31714"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2026-46260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46260"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-31431",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31431"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-43319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43319"
},
{
"name": "CVE-2026-46092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46092"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2026-31614",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31614"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2026-43262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43262"
},
{
"name": "CVE-2025-71090",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71090"
},
{
"name": "CVE-2026-46001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46001"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-46071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46071"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-46137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46137"
},
{
"name": "CVE-2026-46072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46072"
},
{
"name": "CVE-2026-45851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45851"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-31668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31668"
},
{
"name": "CVE-2026-31478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31478"
},
{
"name": "CVE-2025-71142",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71142"
},
{
"name": "CVE-2026-45859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45859"
},
{
"name": "CVE-2026-46066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46066"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-54505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54505"
},
{
"name": "CVE-2026-43153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43153"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-45917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45917"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-46031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46031"
},
{
"name": "CVE-2026-46277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46277"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-45865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45865"
},
{
"name": "CVE-2026-31635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31635"
},
{
"name": "CVE-2026-31598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31598"
},
{
"name": "CVE-2026-43033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43033"
},
{
"name": "CVE-2026-46265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46265"
},
{
"name": "CVE-2026-45972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45972"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-46002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46002"
},
{
"name": "CVE-2026-46074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46074"
},
{
"name": "CVE-2026-31595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31595"
},
{
"name": "CVE-2026-46332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46332"
},
{
"name": "CVE-2026-43503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43503"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-45989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45989"
},
{
"name": "CVE-2026-46091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46091"
},
{
"name": "CVE-2025-71144",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71144"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-45881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45881"
},
{
"name": "CVE-2026-43350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43350"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2026-43376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43376"
},
{
"name": "CVE-2026-23256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23256"
},
{
"name": "CVE-2026-46261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46261"
},
{
"name": "CVE-2026-31659",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31659"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-45847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45847"
},
{
"name": "CVE-2026-45861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45861"
},
{
"name": "CVE-2026-31591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31591"
},
{
"name": "CVE-2026-46041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46041"
},
{
"name": "CVE-2025-71239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71239"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2026-43117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43117"
},
{
"name": "CVE-2026-46083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46083"
},
{
"name": "CVE-2026-45914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45914"
},
{
"name": "CVE-2026-43493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43493"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-43383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43383"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-43500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43500"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-31703",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31703"
},
{
"name": "CVE-2026-46097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46097"
},
{
"name": "CVE-2026-23273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23273"
},
{
"name": "CVE-2026-23230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23230"
},
{
"name": "CVE-2026-46030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46030"
},
{
"name": "CVE-2026-43170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43170"
},
{
"name": "CVE-2026-31693",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31693"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-43499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43499"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-43150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43150"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45913"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-46005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46005"
},
{
"name": "CVE-2026-45962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45962"
},
{
"name": "CVE-2026-31718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31718"
},
{
"name": "CVE-2026-31697",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31697"
},
{
"name": "CVE-2026-46247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46247"
},
{
"name": "CVE-2026-46069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46069"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2026-46288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46288"
},
{
"name": "CVE-2026-43288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43288"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2025-71294",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71294"
},
{
"name": "CVE-2026-31609",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31609"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2026-46022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46022"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-31533",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31533"
},
{
"name": "CVE-2026-46059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46059"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-46103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46103"
},
{
"name": "CVE-2026-43348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43348"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-46043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46043"
},
{
"name": "CVE-2026-31601",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31601"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-31418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31418"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2026-45981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45981"
},
{
"name": "CVE-2026-31620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31620"
},
{
"name": "CVE-2026-43197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43197"
},
{
"name": "CVE-2026-46278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46278"
},
{
"name": "CVE-2026-46011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46011"
},
{
"name": "CVE-2026-46095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46095"
},
{
"name": "CVE-2026-43253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43253"
},
{
"name": "CVE-2026-31594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31594"
},
{
"name": "CVE-2025-71220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71220"
},
{
"name": "CVE-2025-71295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71295"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-43491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43491"
},
{
"name": "CVE-2026-46100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46100"
},
{
"name": "CVE-2026-46012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46012"
},
{
"name": "CVE-2026-31606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31606"
},
{
"name": "CVE-2026-23180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23180"
},
{
"name": "CVE-2026-45999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45999"
},
{
"name": "CVE-2026-45973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45973"
},
{
"name": "CVE-2026-43249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43249"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2025-71267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71267"
},
{
"name": "CVE-2026-46243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46243"
},
{
"name": "CVE-2026-31705",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31705"
},
{
"name": "CVE-2026-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52905"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-45966",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45966"
},
{
"name": "CVE-2026-23262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23262"
},
{
"name": "CVE-2026-46038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46038"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-45878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45878"
},
{
"name": "CVE-2026-23267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23267"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-45982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45982"
},
{
"name": "CVE-2026-31669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31669"
},
{
"name": "CVE-2026-46250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46250"
},
{
"name": "CVE-2026-46062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46062"
},
{
"name": "CVE-2026-23216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23216"
},
{
"name": "CVE-2026-46276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46276"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2026-31608",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31608"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-43173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43173"
},
{
"name": "CVE-2026-31699",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31699"
},
{
"name": "CVE-2026-43077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43077"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-46289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46289"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-46283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46283"
},
{
"name": "CVE-2026-45957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45957"
},
{
"name": "CVE-2026-43407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43407"
},
{
"name": "CVE-2026-23427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23427"
},
{
"name": "CVE-2026-46020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46020"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2026-45997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45997"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-43402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43402"
},
{
"name": "CVE-2025-71286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71286"
},
{
"name": "CVE-2026-46090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46090"
},
{
"name": "CVE-2026-23176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23176"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-46044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46044"
},
{
"name": "CVE-2026-46300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46300"
},
{
"name": "CVE-2026-43271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43271"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2025-71089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71089"
},
{
"name": "CVE-2026-46026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46026"
},
{
"name": "CVE-2026-43258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43258"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-43304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43304"
},
{
"name": "CVE-2026-45886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45886"
},
{
"name": "CVE-2026-43378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43378"
},
{
"name": "CVE-2026-43384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43384"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2025-71141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71141"
},
{
"name": "CVE-2026-43501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43501"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2025-71224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71224"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2026-23193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23193"
},
{
"name": "CVE-2026-31610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31610"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2026-46008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46008"
},
{
"name": "CVE-2026-43238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43238"
},
{
"name": "CVE-2026-31592",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31592"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-45991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45991"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-31712",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31712"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2026-31686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31686"
},
{
"name": "CVE-2026-31707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31707"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-45880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45880"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-46067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46067"
},
{
"name": "CVE-2026-43349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43349"
},
{
"name": "CVE-2026-46036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46036"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-46279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46279"
},
{
"name": "CVE-2026-46135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46135"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-45990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45990"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2025-71222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71222"
},
{
"name": "CVE-2026-31504",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31504"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-45895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45895"
},
{
"name": "CVE-2026-46075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46075"
},
{
"name": "CVE-2025-71229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71229"
},
{
"name": "CVE-2026-31607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31607"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-46054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46054"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-45877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45877"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-46282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46282"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2026-31716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31716"
},
{
"name": "CVE-2026-31637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31637"
},
{
"name": "CVE-2026-31612",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31612"
},
{
"name": "CVE-2026-23428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23428"
},
{
"name": "CVE-2026-23274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23274"
},
{
"name": "CVE-2026-43199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43199"
},
{
"name": "CVE-2026-31590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31590"
},
{
"name": "CVE-2026-46073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46073"
},
{
"name": "CVE-2026-31621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31621"
},
{
"name": "CVE-2025-71297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71297"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-31604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31604"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2025-71152",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71152"
},
{
"name": "CVE-2026-46244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46244"
},
{
"name": "CVE-2026-31584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31584"
},
{
"name": "CVE-2026-31419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31419"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-43221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43221"
},
{
"name": "CVE-2026-46281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46281"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-31717",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31717"
},
{
"name": "CVE-2026-43300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43300"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-43189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43189"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-46035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46035"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-31715",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31715"
},
{
"name": "CVE-2026-23278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23278"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-23257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23257"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-43222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43222"
},
{
"name": "CVE-2026-46115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46115"
},
{
"name": "CVE-2026-46016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46016"
},
{
"name": "CVE-2026-46015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46015"
},
{
"name": "CVE-2026-46316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46316"
},
{
"name": "CVE-2026-31682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31682"
},
{
"name": "CVE-2026-46068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46068"
},
{
"name": "CVE-2026-43406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43406"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2026-45893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45893"
},
{
"name": "CVE-2026-46056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46056"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2026-23182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23182"
},
{
"name": "CVE-2026-31709",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31709"
},
{
"name": "CVE-2026-43215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43215"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-52904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52904"
},
{
"name": "CVE-2026-46004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46004"
},
{
"name": "CVE-2026-46086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46086"
},
{
"name": "CVE-2025-71273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71273"
},
{
"name": "CVE-2025-71291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71291"
},
{
"name": "CVE-2026-46094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46094"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-23455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23455"
},
{
"name": "CVE-2026-23233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23233"
},
{
"name": "CVE-2026-43341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43341"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-43239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43239"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-46060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46060"
},
{
"name": "CVE-2026-45882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45882"
},
{
"name": "CVE-2026-46084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46084"
},
{
"name": "CVE-2026-46079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46079"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-46333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46333"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-43071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43071"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-46085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46085"
},
{
"name": "CVE-2025-71155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71155"
},
{
"name": "CVE-2026-22984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22984"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-46029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46029"
},
{
"name": "CVE-2025-71266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71266"
},
{
"name": "CVE-2026-45898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45898"
},
{
"name": "CVE-2026-23206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23206"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-46021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46021"
},
{
"name": "CVE-2026-23241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23241"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-43318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43318"
},
{
"name": "CVE-2026-43186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43186"
},
{
"name": "CVE-2026-43083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43083"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-46047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46047"
},
{
"name": "CVE-2026-31649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31649"
},
{
"name": "CVE-2026-31719",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31719"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2026-31577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31577"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43256"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-23394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23394"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-43148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43148"
},
{
"name": "CVE-2026-23272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23272"
},
{
"name": "CVE-2026-23112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23112"
},
{
"name": "CVE-2026-45935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45935"
},
{
"name": "CVE-2026-45872",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45872"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-31575",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31575"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-31589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31589"
},
{
"name": "CVE-2026-23190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23190"
},
{
"name": "CVE-2026-43114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43114"
},
{
"name": "CVE-2026-31702",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31702"
},
{
"name": "CVE-2026-31587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31587"
},
{
"name": "CVE-2026-43278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43278"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52906"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-31708",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31708"
},
{
"name": "CVE-2026-46093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46093"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2026-31657",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31657"
},
{
"name": "CVE-2026-43125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43125"
},
{
"name": "CVE-2026-46025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46025"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2026-46246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46246"
},
{
"name": "CVE-2026-46003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46003"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2026-45921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45921"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2026-43169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43169"
},
{
"name": "CVE-2026-43175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43175"
},
{
"name": "CVE-2026-43320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43320"
},
{
"name": "CVE-2025-71127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71127"
},
{
"name": "CVE-2026-52907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52907"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-46096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46096"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2026-45849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45849"
},
{
"name": "CVE-2026-31706",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31706"
},
{
"name": "CVE-2026-31436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31436"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-43214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43214"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2025-71272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71272"
},
{
"name": "CVE-2025-71231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71231"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-46251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46251"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-31700",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31700"
},
{
"name": "CVE-2026-43212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43212"
},
{
"name": "CVE-2026-46089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46089"
},
{
"name": "CVE-2026-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52933"
},
{
"name": "CVE-2026-43128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43128"
},
{
"name": "CVE-2026-23231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23231"
},
{
"name": "CVE-2026-43250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43250"
},
{
"name": "CVE-2026-43275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43275"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-46028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46028"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-46098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46098"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2026-23249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23249"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2026-31710",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31710"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-43072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43072"
},
{
"name": "CVE-2026-46014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46014"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2026-46052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46052"
},
{
"name": "CVE-2026-46061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46061"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2025-71305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71305"
},
{
"name": "CVE-2026-43297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43297"
},
{
"name": "CVE-2025-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68263"
},
{
"name": "CVE-2026-45938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45938"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2026-43157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43157"
},
{
"name": "CVE-2026-45947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45947"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-46284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46284"
},
{
"name": "CVE-2026-46039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46039"
},
{
"name": "CVE-2026-46155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46155"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-31579",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31579"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-43137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43137"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-46254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46254"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-23351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23351"
},
{
"name": "CVE-2026-46078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46078"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-46058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46058"
},
{
"name": "CVE-2026-43494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43494"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
}
],
"initial_release_date": "2026-07-10T00:00:00",
"last_revision_date": "2026-07-10T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0861",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-07-10T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8527-1",
"url": "https://ubuntu.com/security/notices/USN-8527-1"
},
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8528-1",
"url": "https://ubuntu.com/security/notices/USN-8528-1"
},
{
"published_at": "2026-07-06",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8507-1",
"url": "https://ubuntu.com/security/notices/USN-8507-1"
},
{
"published_at": "2026-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8490-2",
"url": "https://ubuntu.com/security/notices/USN-8490-2"
},
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8530-1",
"url": "https://ubuntu.com/security/notices/USN-8530-1"
},
{
"published_at": "2026-07-06",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8508-1",
"url": "https://ubuntu.com/security/notices/USN-8508-1"
},
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8529-1",
"url": "https://ubuntu.com/security/notices/USN-8529-1"
},
{
"published_at": "2026-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-4",
"url": "https://ubuntu.com/security/notices/USN-8492-4"
},
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-5",
"url": "https://ubuntu.com/security/notices/USN-8492-5"
},
{
"published_at": "2026-07-06",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-3",
"url": "https://ubuntu.com/security/notices/USN-8492-3"
}
]
}
CERTFR-2026-AVI-0954
Vulnerability from certfr_avis - Published: 2026-07-31 - Updated: 2026-07-31
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 26.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2025-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38562"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2025-40016",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40016"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2025-40103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40103"
},
{
"name": "CVE-2023-53545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53545"
},
{
"name": "CVE-2023-53596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53596"
},
{
"name": "CVE-2024-41079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41079"
},
{
"name": "CVE-2024-46715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46715"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-38626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38626"
},
{
"name": "CVE-2025-21709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21709"
},
{
"name": "CVE-2025-62626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62626"
},
{
"name": "CVE-2025-40323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40323"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2023-45896",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45896"
},
{
"name": "CVE-2024-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47809"
},
{
"name": "CVE-2024-56557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56557"
},
{
"name": "CVE-2024-56584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56584"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2024-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53221"
},
{
"name": "CVE-2024-56657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56657"
},
{
"name": "CVE-2024-56719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56719"
},
{
"name": "CVE-2025-21739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21739"
},
{
"name": "CVE-2025-21712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21712"
},
{
"name": "CVE-2025-21863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21863"
},
{
"name": "CVE-2025-22107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22107"
},
{
"name": "CVE-2025-22116",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22116"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2025-37786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37786"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2022-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50073"
},
{
"name": "CVE-2022-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50116"
},
{
"name": "CVE-2025-38250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38250"
},
{
"name": "CVE-2025-38105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38105"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2025-38192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38192"
},
{
"name": "CVE-2025-38426",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38426"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2025-40135",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40135"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2025-68307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68307"
},
{
"name": "CVE-2025-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68206"
},
{
"name": "CVE-2025-68239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68239"
},
{
"name": "CVE-2025-68256",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68256"
},
{
"name": "CVE-2025-68736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68736"
},
{
"name": "CVE-2025-40150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40150"
},
{
"name": "CVE-2025-68175",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68175"
},
{
"name": "CVE-2025-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68263"
},
{
"name": "CVE-2025-68358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68358"
},
{
"name": "CVE-2026-22985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22985"
},
{
"name": "CVE-2025-71089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71089"
},
{
"name": "CVE-2025-71150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71150"
},
{
"name": "CVE-2025-71160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71160"
},
{
"name": "CVE-2025-71162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71162"
},
{
"name": "CVE-2025-71163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71163"
},
{
"name": "CVE-2025-71180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71180"
},
{
"name": "CVE-2025-71182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71182"
},
{
"name": "CVE-2025-71183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71183"
},
{
"name": "CVE-2025-71184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71184"
},
{
"name": "CVE-2025-71185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71185"
},
{
"name": "CVE-2025-71186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71186"
},
{
"name": "CVE-2025-71189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71189"
},
{
"name": "CVE-2025-71190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71190"
},
{
"name": "CVE-2025-71191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71191"
},
{
"name": "CVE-2025-71192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71192"
},
{
"name": "CVE-2025-71193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71193"
},
{
"name": "CVE-2025-71194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71194"
},
{
"name": "CVE-2025-71195",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71195"
},
{
"name": "CVE-2025-71196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71196"
},
{
"name": "CVE-2025-71197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71197"
},
{
"name": "CVE-2025-71198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71198"
},
{
"name": "CVE-2025-71199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71199"
},
{
"name": "CVE-2026-22976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22976"
},
{
"name": "CVE-2026-22977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22977"
},
{
"name": "CVE-2026-22978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22978"
},
{
"name": "CVE-2026-22979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22979"
},
{
"name": "CVE-2026-22980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22980"
},
{
"name": "CVE-2026-22982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22982"
},
{
"name": "CVE-2026-22984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22984"
},
{
"name": "CVE-2026-22989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22989"
},
{
"name": "CVE-2026-22990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22990"
},
{
"name": "CVE-2026-22991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22991"
},
{
"name": "CVE-2026-22992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22992"
},
{
"name": "CVE-2026-22994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22994"
},
{
"name": "CVE-2026-22996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22996"
},
{
"name": "CVE-2026-22997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22997"
},
{
"name": "CVE-2026-22998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22998"
},
{
"name": "CVE-2026-22999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22999"
},
{
"name": "CVE-2026-23000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23000"
},
{
"name": "CVE-2026-23001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23001"
},
{
"name": "CVE-2026-23002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23002"
},
{
"name": "CVE-2026-23003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23003"
},
{
"name": "CVE-2026-23005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23005"
},
{
"name": "CVE-2026-23006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23006"
},
{
"name": "CVE-2026-23010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23010"
},
{
"name": "CVE-2026-23011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23011"
},
{
"name": "CVE-2026-23013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23013"
},
{
"name": "CVE-2026-23019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23019"
},
{
"name": "CVE-2026-23020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23020"
},
{
"name": "CVE-2026-23021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23021"
},
{
"name": "CVE-2026-23023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23023"
},
{
"name": "CVE-2026-23025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23025"
},
{
"name": "CVE-2026-23026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23026"
},
{
"name": "CVE-2026-23030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23030"
},
{
"name": "CVE-2026-23031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23031"
},
{
"name": "CVE-2026-23032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23032"
},
{
"name": "CVE-2026-23033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23033"
},
{
"name": "CVE-2026-23035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23035"
},
{
"name": "CVE-2026-23037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23037"
},
{
"name": "CVE-2026-23038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23038"
},
{
"name": "CVE-2026-23047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23047"
},
{
"name": "CVE-2026-23049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23049"
},
{
"name": "CVE-2026-23050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23050"
},
{
"name": "CVE-2026-23053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23053"
},
{
"name": "CVE-2026-23054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23054"
},
{
"name": "CVE-2026-23055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23055"
},
{
"name": "CVE-2026-23056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23056"
},
{
"name": "CVE-2026-23057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23057"
},
{
"name": "CVE-2026-23058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23058"
},
{
"name": "CVE-2026-23059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23059"
},
{
"name": "CVE-2026-23061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23061"
},
{
"name": "CVE-2026-23062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23062"
},
{
"name": "CVE-2026-23063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23063"
},
{
"name": "CVE-2026-23064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23064"
},
{
"name": "CVE-2026-23065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23065"
},
{
"name": "CVE-2026-23068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23068"
},
{
"name": "CVE-2026-23069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23069"
},
{
"name": "CVE-2026-23071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23071"
},
{
"name": "CVE-2026-23072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23072"
},
{
"name": "CVE-2026-23073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23073"
},
{
"name": "CVE-2026-23075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23075"
},
{
"name": "CVE-2026-23076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23076"
},
{
"name": "CVE-2026-23078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23078"
},
{
"name": "CVE-2026-23080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23080"
},
{
"name": "CVE-2026-23083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23083"
},
{
"name": "CVE-2026-23084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23084"
},
{
"name": "CVE-2026-23085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23085"
},
{
"name": "CVE-2026-23086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23086"
},
{
"name": "CVE-2026-23087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23087"
},
{
"name": "CVE-2026-23088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23088"
},
{
"name": "CVE-2026-23089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23089"
},
{
"name": "CVE-2026-23090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23090"
},
{
"name": "CVE-2026-23093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23093"
},
{
"name": "CVE-2026-23094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23094"
},
{
"name": "CVE-2026-23095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23095"
},
{
"name": "CVE-2026-23096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23096"
},
{
"name": "CVE-2026-23097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23097"
},
{
"name": "CVE-2026-23098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23098"
},
{
"name": "CVE-2026-23099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23099"
},
{
"name": "CVE-2026-23101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23101"
},
{
"name": "CVE-2026-23102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23102"
},
{
"name": "CVE-2026-23103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23103"
},
{
"name": "CVE-2026-23105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23105"
},
{
"name": "CVE-2026-23107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23107"
},
{
"name": "CVE-2026-23108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23108"
},
{
"name": "CVE-2026-23110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23110"
},
{
"name": "CVE-2026-22993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22993"
},
{
"name": "CVE-2025-71203",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71203"
},
{
"name": "CVE-2025-71220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71220"
},
{
"name": "CVE-2025-71222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71222"
},
{
"name": "CVE-2025-71224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71224"
},
{
"name": "CVE-2025-71229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71229"
},
{
"name": "CVE-2025-71231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71231"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2026-23176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23176"
},
{
"name": "CVE-2026-23180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23180"
},
{
"name": "CVE-2026-23182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23182"
},
{
"name": "CVE-2026-23190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23190"
},
{
"name": "CVE-2026-23193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23193"
},
{
"name": "CVE-2026-23198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23198"
},
{
"name": "CVE-2026-23202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23202"
},
{
"name": "CVE-2026-23204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23204"
},
{
"name": "CVE-2026-23206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23206"
},
{
"name": "CVE-2026-23216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23216"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2026-23230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23230"
},
{
"name": "CVE-2026-23212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23212"
},
{
"name": "CVE-2026-22981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22981"
},
{
"name": "CVE-2026-22986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22986"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2026-23233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23233"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2022-49803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49803"
},
{
"name": "CVE-2022-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49961"
},
{
"name": "CVE-2022-50552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50552"
},
{
"name": "CVE-2023-52682",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52682"
},
{
"name": "CVE-2023-53629",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53629"
},
{
"name": "CVE-2025-68334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68334"
},
{
"name": "CVE-2025-71152",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71152"
},
{
"name": "CVE-2025-71158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71158"
},
{
"name": "CVE-2025-71161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71161"
},
{
"name": "CVE-2025-71188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71188"
},
{
"name": "CVE-2025-71221",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71221"
},
{
"name": "CVE-2026-23004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23004"
},
{
"name": "CVE-2026-23066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23066"
},
{
"name": "CVE-2026-23113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23113"
},
{
"name": "CVE-2026-23118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23118"
},
{
"name": "CVE-2026-23119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23119"
},
{
"name": "CVE-2026-23120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23120"
},
{
"name": "CVE-2026-23121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23121"
},
{
"name": "CVE-2026-23124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23124"
},
{
"name": "CVE-2026-23125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23125"
},
{
"name": "CVE-2026-23126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23126"
},
{
"name": "CVE-2026-23128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23128"
},
{
"name": "CVE-2026-23133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23133"
},
{
"name": "CVE-2026-23137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23137"
},
{
"name": "CVE-2026-23138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23138"
},
{
"name": "CVE-2026-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23141"
},
{
"name": "CVE-2026-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23145"
},
{
"name": "CVE-2026-23146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23146"
},
{
"name": "CVE-2026-23150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23150"
},
{
"name": "CVE-2026-23154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23154"
},
{
"name": "CVE-2026-23157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23157"
},
{
"name": "CVE-2026-23164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23164"
},
{
"name": "CVE-2026-23167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23167"
},
{
"name": "CVE-2026-23170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23170"
},
{
"name": "CVE-2026-23171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23171"
},
{
"name": "CVE-2026-23207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23207"
},
{
"name": "CVE-2026-23226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23226"
},
{
"name": "CVE-2026-23227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23227"
},
{
"name": "CVE-2025-71200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71200"
},
{
"name": "CVE-2026-23017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23017"
},
{
"name": "CVE-2026-23104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23104"
},
{
"name": "CVE-2026-23116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23116"
},
{
"name": "CVE-2026-23129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23129"
},
{
"name": "CVE-2026-23135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23135"
},
{
"name": "CVE-2026-23139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23139"
},
{
"name": "CVE-2026-23151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23151"
},
{
"name": "CVE-2026-23152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23152"
},
{
"name": "CVE-2026-23156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23156"
},
{
"name": "CVE-2026-23163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23163"
},
{
"name": "CVE-2026-23166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23166"
},
{
"name": "CVE-2026-23172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23172"
},
{
"name": "CVE-2026-23173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23173"
},
{
"name": "CVE-2025-71239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71239"
},
{
"name": "CVE-2025-71265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71265"
},
{
"name": "CVE-2025-71266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71266"
},
{
"name": "CVE-2025-71267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71267"
},
{
"name": "CVE-2026-23241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23241"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2026-23267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23267"
},
{
"name": "CVE-2026-31788",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31788"
},
{
"name": "CVE-2026-23070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23070"
},
{
"name": "CVE-2026-23131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23131"
},
{
"name": "CVE-2026-23244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23244"
},
{
"name": "CVE-2026-23245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23245"
},
{
"name": "CVE-2026-23246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23246"
},
{
"name": "CVE-2026-23253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23253"
},
{
"name": "CVE-2026-23271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23271"
},
{
"name": "CVE-2026-23277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23277"
},
{
"name": "CVE-2026-23279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23279"
},
{
"name": "CVE-2026-23281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23281"
},
{
"name": "CVE-2026-23284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23284"
},
{
"name": "CVE-2026-23285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23285"
},
{
"name": "CVE-2026-23286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23286"
},
{
"name": "CVE-2026-23289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23289"
},
{
"name": "CVE-2026-23290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23290"
},
{
"name": "CVE-2026-23291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23291"
},
{
"name": "CVE-2026-23292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23292"
},
{
"name": "CVE-2026-23293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23293"
},
{
"name": "CVE-2026-23296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23296"
},
{
"name": "CVE-2026-23298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23298"
},
{
"name": "CVE-2026-23300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23300"
},
{
"name": "CVE-2026-23303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23303"
},
{
"name": "CVE-2026-23304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23304"
},
{
"name": "CVE-2026-23306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23306"
},
{
"name": "CVE-2026-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23307"
},
{
"name": "CVE-2026-23310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23310"
},
{
"name": "CVE-2026-23312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23312"
},
{
"name": "CVE-2026-23315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23315"
},
{
"name": "CVE-2026-23317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23317"
},
{
"name": "CVE-2026-23318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23318"
},
{
"name": "CVE-2026-23319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23319"
},
{
"name": "CVE-2026-23324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23324"
},
{
"name": "CVE-2026-23334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23334"
},
{
"name": "CVE-2026-23336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23336"
},
{
"name": "CVE-2026-23340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23340"
},
{
"name": "CVE-2026-23343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23343"
},
{
"name": "CVE-2026-23347",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23347"
},
{
"name": "CVE-2026-23352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23352"
},
{
"name": "CVE-2026-23356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23356"
},
{
"name": "CVE-2026-23357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23357"
},
{
"name": "CVE-2026-23359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23359"
},
{
"name": "CVE-2026-23364",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23364"
},
{
"name": "CVE-2026-23365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23365"
},
{
"name": "CVE-2026-23367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23367"
},
{
"name": "CVE-2026-23368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23368"
},
{
"name": "CVE-2026-23370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23370"
},
{
"name": "CVE-2026-23379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23379"
},
{
"name": "CVE-2026-23381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23381"
},
{
"name": "CVE-2026-23382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23382"
},
{
"name": "CVE-2026-23388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23388"
},
{
"name": "CVE-2026-23391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23391"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-23395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23395"
},
{
"name": "CVE-2026-23396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23396"
},
{
"name": "CVE-2026-23397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23397"
},
{
"name": "CVE-2026-23398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23398"
},
{
"name": "CVE-2026-31394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31394"
},
{
"name": "CVE-2026-23144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23144"
},
{
"name": "CVE-2026-23272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23272"
},
{
"name": "CVE-2025-54505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54505"
},
{
"name": "CVE-2026-31408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31408"
},
{
"name": "CVE-2026-31414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31414"
},
{
"name": "CVE-2026-31416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31416"
},
{
"name": "CVE-2026-31417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31417"
},
{
"name": "CVE-2026-31418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31418"
},
{
"name": "CVE-2026-31421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31421"
},
{
"name": "CVE-2026-31422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31422"
},
{
"name": "CVE-2026-31423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31423"
},
{
"name": "CVE-2026-31424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31424"
},
{
"name": "CVE-2026-31426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31426"
},
{
"name": "CVE-2026-31427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31427"
},
{
"name": "CVE-2026-31428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31428"
},
{
"name": "CVE-2025-71269",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71269"
},
{
"name": "CVE-2026-23136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23136"
},
{
"name": "CVE-2026-23140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23140"
},
{
"name": "CVE-2026-23255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23255"
},
{
"name": "CVE-2026-23262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23262"
},
{
"name": "CVE-2026-23270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23270"
},
{
"name": "CVE-2026-23278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23278"
},
{
"name": "CVE-2026-23335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23335"
},
{
"name": "CVE-2026-23361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23361"
},
{
"name": "CVE-2026-23383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23383"
},
{
"name": "CVE-2026-23386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23386"
},
{
"name": "CVE-2026-23412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23412"
},
{
"name": "CVE-2026-23413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23413"
},
{
"name": "CVE-2026-23414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23414"
},
{
"name": "CVE-2026-23419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23419"
},
{
"name": "CVE-2026-31402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31402"
},
{
"name": "CVE-2026-23360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23360"
},
{
"name": "CVE-2026-31439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31439"
},
{
"name": "CVE-2026-31441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31441"
},
{
"name": "CVE-2026-31444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31444"
},
{
"name": "CVE-2026-31446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31446"
},
{
"name": "CVE-2026-31447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31447"
},
{
"name": "CVE-2026-31448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31448"
},
{
"name": "CVE-2026-31450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31450"
},
{
"name": "CVE-2026-31451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31451"
},
{
"name": "CVE-2026-31452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31452"
},
{
"name": "CVE-2026-31453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31453"
},
{
"name": "CVE-2026-31454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31454"
},
{
"name": "CVE-2026-31455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31455"
},
{
"name": "CVE-2026-31458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31458"
},
{
"name": "CVE-2026-31467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31467"
},
{
"name": "CVE-2026-31469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31469"
},
{
"name": "CVE-2026-31473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31473"
},
{
"name": "CVE-2026-31474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31474"
},
{
"name": "CVE-2026-31476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31476"
},
{
"name": "CVE-2026-31483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31483"
},
{
"name": "CVE-2026-31485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31485"
},
{
"name": "CVE-2026-31494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31494"
},
{
"name": "CVE-2026-31495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31495"
},
{
"name": "CVE-2026-31496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31496"
},
{
"name": "CVE-2026-31497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31497"
},
{
"name": "CVE-2026-31500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31500"
},
{
"name": "CVE-2026-31503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31503"
},
{
"name": "CVE-2026-31507",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31507"
},
{
"name": "CVE-2026-31509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31509"
},
{
"name": "CVE-2026-31510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31510"
},
{
"name": "CVE-2026-31515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31515"
},
{
"name": "CVE-2026-31518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31518"
},
{
"name": "CVE-2026-31519",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31519"
},
{
"name": "CVE-2026-31520",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31520"
},
{
"name": "CVE-2026-31521",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31521"
},
{
"name": "CVE-2026-31522",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31522"
},
{
"name": "CVE-2026-31523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31523"
},
{
"name": "CVE-2026-31524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31524"
},
{
"name": "CVE-2026-31525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31525"
},
{
"name": "CVE-2026-31528",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31528"
},
{
"name": "CVE-2026-31555",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31555"
},
{
"name": "CVE-2026-31563",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31563"
},
{
"name": "CVE-2026-31565",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31565"
},
{
"name": "CVE-2026-31566",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31566"
},
{
"name": "CVE-2026-31570",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31570"
},
{
"name": "CVE-2026-31589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31589"
},
{
"name": "CVE-2026-31591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31591"
},
{
"name": "CVE-2026-31593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31593"
},
{
"name": "CVE-2026-31600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31600"
},
{
"name": "CVE-2026-31601",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31601"
},
{
"name": "CVE-2026-31608",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31608"
},
{
"name": "CVE-2026-31609",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31609"
},
{
"name": "CVE-2026-31620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31620"
},
{
"name": "CVE-2026-31621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31621"
},
{
"name": "CVE-2026-31674",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31674"
},
{
"name": "CVE-2026-31675",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31675"
},
{
"name": "CVE-2026-31678",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31678"
},
{
"name": "CVE-2026-31679",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31679"
},
{
"name": "CVE-2026-31680",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31680"
},
{
"name": "CVE-2026-31682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31682"
},
{
"name": "CVE-2026-31430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31430"
},
{
"name": "CVE-2026-31508",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31508"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-31577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31577"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-31587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31587"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-31590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31590"
},
{
"name": "CVE-2026-31594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31594"
},
{
"name": "CVE-2026-31595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31595"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-31597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31597"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-31604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31604"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-31607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31607"
},
{
"name": "CVE-2026-31610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31610"
},
{
"name": "CVE-2026-31611",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31611"
},
{
"name": "CVE-2026-31612",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31612"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-31634",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31634"
},
{
"name": "CVE-2026-31637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31637"
},
{
"name": "CVE-2026-31638",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31638"
},
{
"name": "CVE-2026-31639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31639"
},
{
"name": "CVE-2026-31642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31642"
},
{
"name": "CVE-2026-31646",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31646"
},
{
"name": "CVE-2026-31648",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31648"
},
{
"name": "CVE-2026-31649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31649"
},
{
"name": "CVE-2026-31651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31651"
},
{
"name": "CVE-2026-31655",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31655"
},
{
"name": "CVE-2026-31656",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31656"
},
{
"name": "CVE-2026-31657",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31657"
},
{
"name": "CVE-2026-31658",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31658"
},
{
"name": "CVE-2026-31659",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31659"
},
{
"name": "CVE-2026-31660",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31660"
},
{
"name": "CVE-2026-31661",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31661"
},
{
"name": "CVE-2026-31662",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31662"
},
{
"name": "CVE-2026-31664",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31664"
},
{
"name": "CVE-2026-31665",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31665"
},
{
"name": "CVE-2026-31667",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31667"
},
{
"name": "CVE-2026-31668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31668"
},
{
"name": "CVE-2026-31669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31669"
},
{
"name": "CVE-2026-31670",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31670"
},
{
"name": "CVE-2026-31671",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31671"
},
{
"name": "CVE-2026-31672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31672"
},
{
"name": "CVE-2026-31673",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31673"
},
{
"name": "CVE-2026-31676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31676"
},
{
"name": "CVE-2026-31681",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31681"
},
{
"name": "CVE-2026-31684",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31684"
},
{
"name": "CVE-2026-31685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31685"
},
{
"name": "CVE-2026-31689",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31689"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-31696",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31696"
},
{
"name": "CVE-2026-31697",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31697"
},
{
"name": "CVE-2026-31698",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31698"
},
{
"name": "CVE-2026-31699",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31699"
},
{
"name": "CVE-2026-31700",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31700"
},
{
"name": "CVE-2026-31702",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31702"
},
{
"name": "CVE-2026-31704",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31704"
},
{
"name": "CVE-2026-31705",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31705"
},
{
"name": "CVE-2026-31708",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31708"
},
{
"name": "CVE-2026-31711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31711"
},
{
"name": "CVE-2026-31721",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31721"
},
{
"name": "CVE-2026-23362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23362"
},
{
"name": "CVE-2026-23287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23287"
},
{
"name": "CVE-2026-23321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23321"
},
{
"name": "CVE-2026-23339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23339"
},
{
"name": "CVE-2026-23372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23372"
},
{
"name": "CVE-2026-23378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23378"
},
{
"name": "CVE-2026-23401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23401"
},
{
"name": "CVE-2026-23420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23420"
},
{
"name": "CVE-2026-23426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23426"
},
{
"name": "CVE-2026-23428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23428"
},
{
"name": "CVE-2026-23434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23434"
},
{
"name": "CVE-2026-23438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23438"
},
{
"name": "CVE-2026-23439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23439"
},
{
"name": "CVE-2026-23446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23446"
},
{
"name": "CVE-2026-23449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23449"
},
{
"name": "CVE-2026-23450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23450"
},
{
"name": "CVE-2026-23452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23452"
},
{
"name": "CVE-2026-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23454"
},
{
"name": "CVE-2026-23455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23455"
},
{
"name": "CVE-2026-23456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23456"
},
{
"name": "CVE-2026-23457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23457"
},
{
"name": "CVE-2026-23458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23458"
},
{
"name": "CVE-2026-23460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23460"
},
{
"name": "CVE-2026-23462",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23462"
},
{
"name": "CVE-2026-23463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23463"
},
{
"name": "CVE-2026-23474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23474"
},
{
"name": "CVE-2026-23475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23475"
},
{
"name": "CVE-2026-31389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31389"
},
{
"name": "CVE-2026-31391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31391"
},
{
"name": "CVE-2026-31392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31392"
},
{
"name": "CVE-2026-31393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31393"
},
{
"name": "CVE-2026-31396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31396"
},
{
"name": "CVE-2026-31399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31399"
},
{
"name": "CVE-2026-31400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31400"
},
{
"name": "CVE-2026-31403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31403"
},
{
"name": "CVE-2026-31405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31405"
},
{
"name": "CVE-2026-31409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31409"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-31412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31412"
},
{
"name": "CVE-2026-31415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31415"
},
{
"name": "CVE-2026-31425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31425"
},
{
"name": "CVE-2026-31433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31433"
},
{
"name": "CVE-2026-31434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31434"
},
{
"name": "CVE-2026-31464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31464"
},
{
"name": "CVE-2026-31466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31466"
},
{
"name": "CVE-2026-31477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31477"
},
{
"name": "CVE-2026-31478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31478"
},
{
"name": "CVE-2026-31480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31480"
},
{
"name": "CVE-2026-31492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31492"
},
{
"name": "CVE-2026-31498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31498"
},
{
"name": "CVE-2026-31512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31512"
},
{
"name": "CVE-2026-31540",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31540"
},
{
"name": "CVE-2026-31545",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31545"
},
{
"name": "CVE-2026-31546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31546"
},
{
"name": "CVE-2026-31548",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31548"
},
{
"name": "CVE-2026-31549",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31549"
},
{
"name": "CVE-2026-31550",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31550"
},
{
"name": "CVE-2026-31551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31551"
},
{
"name": "CVE-2026-31552",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31552"
},
{
"name": "CVE-2026-31683",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31683"
},
{
"name": "CVE-2026-31695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31695"
},
{
"name": "CVE-2026-31720",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31720"
},
{
"name": "CVE-2026-31726",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31726"
},
{
"name": "CVE-2026-31728",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31728"
},
{
"name": "CVE-2026-31737",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31737"
},
{
"name": "CVE-2026-31738",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31738"
},
{
"name": "CVE-2026-31747",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31747"
},
{
"name": "CVE-2026-31748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31748"
},
{
"name": "CVE-2026-31749",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31749"
},
{
"name": "CVE-2026-31751",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31751"
},
{
"name": "CVE-2026-31752",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31752"
},
{
"name": "CVE-2026-31754",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31754"
},
{
"name": "CVE-2026-31755",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31755"
},
{
"name": "CVE-2026-31756",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31756"
},
{
"name": "CVE-2026-31758",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31758"
},
{
"name": "CVE-2026-31759",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31759"
},
{
"name": "CVE-2026-31761",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31761"
},
{
"name": "CVE-2026-31762",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31762"
},
{
"name": "CVE-2026-31763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31763"
},
{
"name": "CVE-2026-31768",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31768"
},
{
"name": "CVE-2026-31770",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31770"
},
{
"name": "CVE-2026-31773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31773"
},
{
"name": "CVE-2026-31778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31778"
},
{
"name": "CVE-2026-31779",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31779"
},
{
"name": "CVE-2026-31780",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31780"
},
{
"name": "CVE-2026-31781",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31781"
},
{
"name": "CVE-2026-43011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43011"
},
{
"name": "CVE-2026-43013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43013"
},
{
"name": "CVE-2026-43014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43014"
},
{
"name": "CVE-2026-43015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43015"
},
{
"name": "CVE-2026-43017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43017"
},
{
"name": "CVE-2026-43018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43018"
},
{
"name": "CVE-2026-43020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43020"
},
{
"name": "CVE-2026-43023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43023"
},
{
"name": "CVE-2026-43024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43024"
},
{
"name": "CVE-2026-43025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43025"
},
{
"name": "CVE-2026-43026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43026"
},
{
"name": "CVE-2026-43027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43027"
},
{
"name": "CVE-2026-43028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43028"
},
{
"name": "CVE-2026-43030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43030"
},
{
"name": "CVE-2026-43032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43032"
},
{
"name": "CVE-2026-43035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43035"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2026-43040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43040"
},
{
"name": "CVE-2026-43041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43041"
},
{
"name": "CVE-2026-43043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43043"
},
{
"name": "CVE-2026-43046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43046"
},
{
"name": "CVE-2026-43047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43047"
},
{
"name": "CVE-2026-43050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43050"
},
{
"name": "CVE-2026-43051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43051"
},
{
"name": "CVE-2026-43054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43054"
},
{
"name": "CVE-2026-43057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43057"
},
{
"name": "CVE-2026-23249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23249"
},
{
"name": "CVE-2026-23276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23276"
},
{
"name": "CVE-2026-23302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23302"
},
{
"name": "CVE-2026-23308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23308"
},
{
"name": "CVE-2026-23313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23313"
},
{
"name": "CVE-2026-23325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23325"
},
{
"name": "CVE-2026-23330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23330"
},
{
"name": "CVE-2026-23363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23363"
},
{
"name": "CVE-2026-23369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23369"
},
{
"name": "CVE-2026-23374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23374"
},
{
"name": "CVE-2026-23375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23375"
},
{
"name": "CVE-2026-23387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23387"
},
{
"name": "CVE-2026-23389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23389"
},
{
"name": "CVE-2026-23399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23399"
},
{
"name": "CVE-2026-23427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23427"
},
{
"name": "CVE-2026-23440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23440"
},
{
"name": "CVE-2026-23441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23441"
},
{
"name": "CVE-2026-23442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23442"
},
{
"name": "CVE-2026-23444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23444"
},
{
"name": "CVE-2026-23447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23447"
},
{
"name": "CVE-2026-23448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23448"
},
{
"name": "CVE-2026-23461",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23461"
},
{
"name": "CVE-2026-23464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23464"
},
{
"name": "CVE-2026-23465",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23465"
},
{
"name": "CVE-2026-23470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23470"
},
{
"name": "CVE-2026-31407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31407"
},
{
"name": "CVE-2026-31429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31429"
},
{
"name": "CVE-2026-31432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31432"
},
{
"name": "CVE-2026-31436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31436"
},
{
"name": "CVE-2026-31438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31438"
},
{
"name": "CVE-2026-31440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31440"
},
{
"name": "CVE-2026-31449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31449"
},
{
"name": "CVE-2026-31470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31470"
},
{
"name": "CVE-2026-31482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31482"
},
{
"name": "CVE-2026-31487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31487"
},
{
"name": "CVE-2026-31488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31488"
},
{
"name": "CVE-2026-31489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31489"
},
{
"name": "CVE-2026-31502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31502"
},
{
"name": "CVE-2026-31505",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31505"
},
{
"name": "CVE-2026-31506",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31506"
},
{
"name": "CVE-2026-31511",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31511"
},
{
"name": "CVE-2026-31516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31516"
},
{
"name": "CVE-2026-31527",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31527"
},
{
"name": "CVE-2026-31530",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31530"
},
{
"name": "CVE-2026-31542",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31542"
},
{
"name": "CVE-2026-31554",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31554"
},
{
"name": "CVE-2026-31556",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31556"
},
{
"name": "CVE-2026-31557",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31557"
},
{
"name": "CVE-2026-31575",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31575"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-31582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31582"
},
{
"name": "CVE-2026-31584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31584"
},
{
"name": "CVE-2026-31598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31598"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-31606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31606"
},
{
"name": "CVE-2026-31614",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31614"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-31645",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31645"
},
{
"name": "CVE-2026-31677",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31677"
},
{
"name": "CVE-2026-31686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31686"
},
{
"name": "CVE-2026-31693",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31693"
},
{
"name": "CVE-2025-71294",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71294"
},
{
"name": "CVE-2026-43201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43201"
},
{
"name": "CVE-2026-43300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43300"
},
{
"name": "CVE-2026-43320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43320"
},
{
"name": "CVE-2025-54518",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54518"
},
{
"name": "CVE-2026-43284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43284"
},
{
"name": "CVE-2026-43500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43500"
},
{
"name": "CVE-2026-23468",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23468"
},
{
"name": "CVE-2026-31709",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31709"
},
{
"name": "CVE-2026-31715",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31715"
},
{
"name": "CVE-2026-23123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23123"
},
{
"name": "CVE-2026-23142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23142"
},
{
"name": "CVE-2026-23148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23148"
},
{
"name": "CVE-2026-23159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23159"
},
{
"name": "CVE-2026-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23160"
},
{
"name": "CVE-2026-23168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23168"
},
{
"name": "CVE-2026-23256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23256"
},
{
"name": "CVE-2026-23257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23257"
},
{
"name": "CVE-2026-23258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23258"
},
{
"name": "CVE-2026-31499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31499"
},
{
"name": "CVE-2026-43088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43088"
},
{
"name": "CVE-2026-43109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43109"
},
{
"name": "CVE-2026-43490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43490"
},
{
"name": "CVE-2026-31635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31635"
},
{
"name": "CVE-2026-43494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43494"
},
{
"name": "CVE-2026-43503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43503"
},
{
"name": "CVE-2026-46174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46174"
},
{
"name": "CVE-2026-43110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43110"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-43334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43334"
},
{
"name": "CVE-2026-43437",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43437"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-31613",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31613"
},
{
"name": "CVE-2026-43329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43329"
},
{
"name": "CVE-2026-46243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46243"
},
{
"name": "CVE-2026-46028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46028"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-43060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43060"
},
{
"name": "CVE-2026-43061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43061"
},
{
"name": "CVE-2026-43062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43062"
},
{
"name": "CVE-2026-43066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43066"
},
{
"name": "CVE-2026-43068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43068"
},
{
"name": "CVE-2026-43069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43069"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-43327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43327"
},
{
"name": "CVE-2026-43328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43328"
},
{
"name": "CVE-2026-43336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43336"
},
{
"name": "CVE-2026-43339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43339"
},
{
"name": "CVE-2026-43340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43340"
},
{
"name": "CVE-2026-43342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43342"
},
{
"name": "CVE-2026-43343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43343"
},
{
"name": "CVE-2026-43355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43355"
},
{
"name": "CVE-2026-43357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43357"
},
{
"name": "CVE-2026-43363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43363"
},
{
"name": "CVE-2026-43370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43370"
},
{
"name": "CVE-2026-43373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43373"
},
{
"name": "CVE-2026-43381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43381"
},
{
"name": "CVE-2026-43382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43382"
},
{
"name": "CVE-2026-43383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43383"
},
{
"name": "CVE-2026-43386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43386"
},
{
"name": "CVE-2026-43387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43387"
},
{
"name": "CVE-2026-43407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43407"
},
{
"name": "CVE-2026-43411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43411"
},
{
"name": "CVE-2026-43420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43420"
},
{
"name": "CVE-2026-43424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43424"
},
{
"name": "CVE-2026-43425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43425"
},
{
"name": "CVE-2026-43426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43426"
},
{
"name": "CVE-2026-43427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43427"
},
{
"name": "CVE-2026-43428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43428"
},
{
"name": "CVE-2026-43429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43429"
},
{
"name": "CVE-2026-43430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43430"
},
{
"name": "CVE-2026-43432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43432"
},
{
"name": "CVE-2026-43439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43439"
},
{
"name": "CVE-2026-43445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43445"
},
{
"name": "CVE-2026-43449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43449"
},
{
"name": "CVE-2026-43450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43450"
},
{
"name": "CVE-2026-43451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43451"
},
{
"name": "CVE-2026-43452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43452"
},
{
"name": "CVE-2026-43453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43453"
},
{
"name": "CVE-2026-43458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43458"
},
{
"name": "CVE-2026-43459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43459"
},
{
"name": "CVE-2026-43466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43466"
},
{
"name": "CVE-2026-43472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43472"
},
{
"name": "CVE-2026-43475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43475"
},
{
"name": "CVE-2026-43480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43480"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-45899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45899"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-45914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45914"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-45920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45920"
},
{
"name": "CVE-2026-45923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45923"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-45956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45956"
},
{
"name": "CVE-2026-45958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45958"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-45981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45981"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-45985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45985"
},
{
"name": "CVE-2026-23418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23418"
},
{
"name": "CVE-2026-31579",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31579"
},
{
"name": "CVE-2026-43044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43044"
},
{
"name": "CVE-2026-43082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43082"
},
{
"name": "CVE-2026-43120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43120"
},
{
"name": "CVE-2026-43153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43153"
},
{
"name": "CVE-2026-43214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43214"
},
{
"name": "CVE-2026-43265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43265"
},
{
"name": "CVE-2026-43330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43330"
},
{
"name": "CVE-2026-43365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43365"
},
{
"name": "CVE-2026-43366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43366"
},
{
"name": "CVE-2026-43419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43419"
},
{
"name": "CVE-2026-43441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43441"
},
{
"name": "CVE-2026-45834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45834"
},
{
"name": "CVE-2026-45835",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45835"
},
{
"name": "CVE-2026-45836",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45836"
},
{
"name": "CVE-2026-45838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45838"
},
{
"name": "CVE-2026-45839",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45839"
},
{
"name": "CVE-2026-45840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45840"
},
{
"name": "CVE-2026-45841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45841"
},
{
"name": "CVE-2026-45842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45842"
},
{
"name": "CVE-2026-45843",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45843"
},
{
"name": "CVE-2026-45844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45844"
},
{
"name": "CVE-2026-45845",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45845"
},
{
"name": "CVE-2026-45846",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45846"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-45988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45988"
},
{
"name": "CVE-2026-45989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45989"
},
{
"name": "CVE-2026-45991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45991"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2026-45996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45996"
},
{
"name": "CVE-2026-45997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45997"
},
{
"name": "CVE-2026-45999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45999"
},
{
"name": "CVE-2026-46002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46002"
},
{
"name": "CVE-2026-46003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46003"
},
{
"name": "CVE-2026-46004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46004"
},
{
"name": "CVE-2026-46005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46005"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-46011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46011"
},
{
"name": "CVE-2026-46012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46012"
},
{
"name": "CVE-2026-46015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46015"
},
{
"name": "CVE-2026-46016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46016"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-46021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46021"
},
{
"name": "CVE-2026-46022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46022"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-46026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46026"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-46031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46031"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-46038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46038"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-46043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46043"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2026-46047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46047"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2026-46052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46052"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2026-46056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46056"
},
{
"name": "CVE-2026-46058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46058"
},
{
"name": "CVE-2026-46062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46062"
},
{
"name": "CVE-2026-46063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46063"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-46065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46065"
},
{
"name": "CVE-2026-46068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46068"
},
{
"name": "CVE-2026-46069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46069"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-46072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46072"
},
{
"name": "CVE-2026-46075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46075"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-46078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46078"
},
{
"name": "CVE-2026-46079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46079"
},
{
"name": "CVE-2026-46080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46080"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-46083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46083"
},
{
"name": "CVE-2026-46084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46084"
},
{
"name": "CVE-2026-46085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46085"
},
{
"name": "CVE-2026-46086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46086"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-46089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46089"
},
{
"name": "CVE-2026-46091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46091"
},
{
"name": "CVE-2026-46094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46094"
},
{
"name": "CVE-2026-46098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46098"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-46103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46103"
},
{
"name": "CVE-2026-46106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46106"
},
{
"name": "CVE-2026-46107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46107"
},
{
"name": "CVE-2026-46108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46108"
},
{
"name": "CVE-2026-46109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46109"
},
{
"name": "CVE-2026-46110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46110"
},
{
"name": "CVE-2026-46111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46111"
},
{
"name": "CVE-2026-46112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46112"
},
{
"name": "CVE-2026-46113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46113"
},
{
"name": "CVE-2026-46114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46114"
},
{
"name": "CVE-2026-46115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46115"
},
{
"name": "CVE-2026-46116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46116"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46120"
},
{
"name": "CVE-2026-46122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46122"
},
{
"name": "CVE-2026-46123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46123"
},
{
"name": "CVE-2026-46124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46124"
},
{
"name": "CVE-2026-46125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46125"
},
{
"name": "CVE-2026-46127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46127"
},
{
"name": "CVE-2026-46128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46128"
},
{
"name": "CVE-2026-46129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46129"
},
{
"name": "CVE-2026-46131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46131"
},
{
"name": "CVE-2026-46132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46132"
},
{
"name": "CVE-2026-46133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46133"
},
{
"name": "CVE-2026-46136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46136"
},
{
"name": "CVE-2026-46137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46137"
},
{
"name": "CVE-2026-46138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46138"
},
{
"name": "CVE-2026-46142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46142"
},
{
"name": "CVE-2026-46144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46144"
},
{
"name": "CVE-2026-46145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46145"
},
{
"name": "CVE-2026-46146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46146"
},
{
"name": "CVE-2026-46149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46149"
},
{
"name": "CVE-2026-46150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46150"
},
{
"name": "CVE-2026-46151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46151"
},
{
"name": "CVE-2026-46152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46152"
},
{
"name": "CVE-2026-46155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46155"
},
{
"name": "CVE-2026-46156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46156"
},
{
"name": "CVE-2026-46159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46159"
},
{
"name": "CVE-2026-46160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46160"
},
{
"name": "CVE-2026-46161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46161"
},
{
"name": "CVE-2026-46163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46163"
},
{
"name": "CVE-2026-46164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46164"
},
{
"name": "CVE-2026-46165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46165"
},
{
"name": "CVE-2026-46167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46167"
},
{
"name": "CVE-2026-46168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46168"
},
{
"name": "CVE-2026-46172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46172"
},
{
"name": "CVE-2026-46173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46173"
},
{
"name": "CVE-2026-46176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46176"
},
{
"name": "CVE-2026-46177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46177"
},
{
"name": "CVE-2026-46178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46178"
},
{
"name": "CVE-2026-46180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46180"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-46186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46186"
},
{
"name": "CVE-2026-46187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46187"
},
{
"name": "CVE-2026-46189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46189"
},
{
"name": "CVE-2026-46190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46190"
},
{
"name": "CVE-2026-46191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46191"
},
{
"name": "CVE-2026-46193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46193"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-46196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46196"
},
{
"name": "CVE-2026-46197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46197"
},
{
"name": "CVE-2026-46198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46198"
},
{
"name": "CVE-2026-46199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46199"
},
{
"name": "CVE-2026-46204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46204"
},
{
"name": "CVE-2026-46205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46205"
},
{
"name": "CVE-2026-46206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46206"
},
{
"name": "CVE-2026-46208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46208"
},
{
"name": "CVE-2026-46209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46209"
},
{
"name": "CVE-2026-46212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46212"
},
{
"name": "CVE-2026-46214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46214"
},
{
"name": "CVE-2026-46218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46218"
},
{
"name": "CVE-2026-46219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46219"
},
{
"name": "CVE-2026-46220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46220"
},
{
"name": "CVE-2026-46225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46225"
},
{
"name": "CVE-2026-46226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46226"
},
{
"name": "CVE-2026-46227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46227"
},
{
"name": "CVE-2026-46229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46229"
},
{
"name": "CVE-2026-46230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46230"
},
{
"name": "CVE-2026-46231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46231"
},
{
"name": "CVE-2026-46233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46233"
},
{
"name": "CVE-2026-46234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46234"
},
{
"name": "CVE-2026-46236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46236"
},
{
"name": "CVE-2026-46238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46238"
},
{
"name": "CVE-2026-46273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46273"
},
{
"name": "CVE-2026-31729",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31729"
},
{
"name": "CVE-2026-43012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43012"
},
{
"name": "CVE-2026-43112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43112"
},
{
"name": "CVE-2026-43252",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43252"
},
{
"name": "CVE-2026-43333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43333"
},
{
"name": "CVE-2026-43338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43338"
},
{
"name": "CVE-2026-43341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43341"
},
{
"name": "CVE-2026-43359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43359"
},
{
"name": "CVE-2026-43360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43360"
},
{
"name": "CVE-2026-43361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43361"
},
{
"name": "CVE-2026-43362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43362"
},
{
"name": "CVE-2026-43414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43414"
},
{
"name": "CVE-2026-43499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43499"
},
{
"name": "CVE-2026-43501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43501"
},
{
"name": "CVE-2026-45910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45910"
},
{
"name": "CVE-2026-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43056"
},
{
"name": "CVE-2026-43125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43125"
},
{
"name": "CVE-2026-46054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46054"
},
{
"name": "CVE-2026-46181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46181"
},
{
"name": "CVE-2026-31772",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31772"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-46117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46117"
},
{
"name": "CVE-2026-46135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46135"
},
{
"name": "CVE-2026-46166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46166"
},
{
"name": "CVE-2026-31717",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31717"
},
{
"name": "CVE-2026-43245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43245"
},
{
"name": "CVE-2026-46158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46158"
},
{
"name": "CVE-2026-46170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46170"
},
{
"name": "CVE-2026-46203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46203"
},
{
"name": "CVE-2026-46216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46216"
},
{
"name": "CVE-2026-46244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46244"
},
{
"name": "CVE-2026-46315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46315"
},
{
"name": "CVE-2026-46320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46320"
},
{
"name": "CVE-2026-46321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46321"
},
{
"name": "CVE-2026-46322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46322"
},
{
"name": "CVE-2026-52911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52911"
},
{
"name": "CVE-2026-31703",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31703"
},
{
"name": "CVE-2026-31767",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31767"
},
{
"name": "CVE-2026-43052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43052"
},
{
"name": "CVE-2026-43059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43059"
},
{
"name": "CVE-2026-43065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43065"
},
{
"name": "CVE-2026-43150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43150"
},
{
"name": "CVE-2026-43197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43197"
},
{
"name": "CVE-2026-43249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43249"
},
{
"name": "CVE-2026-43332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43332"
},
{
"name": "CVE-2026-43406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43406"
},
{
"name": "CVE-2026-43413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43413"
},
{
"name": "CVE-2026-43455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43455"
},
{
"name": "CVE-2026-43483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43483"
},
{
"name": "CVE-2026-45878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45878"
},
{
"name": "CVE-2026-45886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45886"
},
{
"name": "CVE-2026-45898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45898"
},
{
"name": "CVE-2026-45942",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45942"
},
{
"name": "CVE-2026-46090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46090"
},
{
"name": "CVE-2026-46157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46157"
},
{
"name": "CVE-2026-46169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46169"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-46316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46316"
},
{
"name": "CVE-2026-46317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46317"
},
{
"name": "CVE-2026-46274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46274"
},
{
"name": "CVE-2026-46280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46280"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-46287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46287"
},
{
"name": "CVE-2026-46289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46289"
},
{
"name": "CVE-2026-46291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46291"
},
{
"name": "CVE-2026-46292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46292"
},
{
"name": "CVE-2026-46293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46293"
},
{
"name": "CVE-2026-46296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46296"
},
{
"name": "CVE-2026-46299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46299"
},
{
"name": "CVE-2026-46301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46301"
},
{
"name": "CVE-2026-46303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46303"
},
{
"name": "CVE-2026-46304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46304"
},
{
"name": "CVE-2026-46306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46306"
},
{
"name": "CVE-2026-46307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46307"
},
{
"name": "CVE-2026-46312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46312"
},
{
"name": "CVE-2026-46319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46319"
},
{
"name": "CVE-2026-46275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46275"
},
{
"name": "CVE-2026-52912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52912"
},
{
"name": "CVE-2026-52913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52913"
},
{
"name": "CVE-2026-52915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52915"
},
{
"name": "CVE-2026-52916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52916"
},
{
"name": "CVE-2026-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52919"
},
{
"name": "CVE-2026-52921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52921"
},
{
"name": "CVE-2026-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52922"
},
{
"name": "CVE-2026-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52923"
},
{
"name": "CVE-2026-52926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52926"
},
{
"name": "CVE-2026-52927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52927"
},
{
"name": "CVE-2026-52931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52931"
},
{
"name": "CVE-2026-52934",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52934"
},
{
"name": "CVE-2026-52941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52941"
},
{
"name": "CVE-2026-52943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52943"
},
{
"name": "CVE-2026-53080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53080"
},
{
"name": "CVE-2026-43074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43074"
},
{
"name": "CVE-2026-52918",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52918"
},
{
"name": "CVE-2026-52944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52944"
},
{
"name": "CVE-2025-71272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71272"
},
{
"name": "CVE-2025-71273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71273"
},
{
"name": "CVE-2025-71286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71286"
},
{
"name": "CVE-2025-71291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71291"
},
{
"name": "CVE-2025-71295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71295"
},
{
"name": "CVE-2025-71297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71297"
},
{
"name": "CVE-2025-71305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71305"
},
{
"name": "CVE-2026-31574",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31574"
},
{
"name": "CVE-2026-31592",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31592"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-31706",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31706"
},
{
"name": "CVE-2026-31707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31707"
},
{
"name": "CVE-2026-31710",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31710"
},
{
"name": "CVE-2026-31712",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31712"
},
{
"name": "CVE-2026-31713",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31713"
},
{
"name": "CVE-2026-31714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31714"
},
{
"name": "CVE-2026-31716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31716"
},
{
"name": "CVE-2026-31718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31718"
},
{
"name": "CVE-2026-31719",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31719"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-43071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43071"
},
{
"name": "CVE-2026-43072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43072"
},
{
"name": "CVE-2026-43073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43073"
},
{
"name": "CVE-2026-43083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43083"
},
{
"name": "CVE-2026-43114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43114"
},
{
"name": "CVE-2026-43117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43117"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-43128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43128"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-43137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43137"
},
{
"name": "CVE-2026-43143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43143"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-43148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43148"
},
{
"name": "CVE-2026-43157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43157"
},
{
"name": "CVE-2026-43167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43167"
},
{
"name": "CVE-2026-43169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43169"
},
{
"name": "CVE-2026-43170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43170"
},
{
"name": "CVE-2026-43173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43173"
},
{
"name": "CVE-2026-43175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43175"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2026-43186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43186"
},
{
"name": "CVE-2026-43189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43189"
},
{
"name": "CVE-2026-43199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43199"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-43212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43212"
},
{
"name": "CVE-2026-43215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43215"
},
{
"name": "CVE-2026-43221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43221"
},
{
"name": "CVE-2026-43222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43222"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2026-43238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43238"
},
{
"name": "CVE-2026-43239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43239"
},
{
"name": "CVE-2026-43244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43244"
},
{
"name": "CVE-2026-43248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43248"
},
{
"name": "CVE-2026-43250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43250"
},
{
"name": "CVE-2026-43253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43253"
},
{
"name": "CVE-2026-43256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43256"
},
{
"name": "CVE-2026-43258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43258"
},
{
"name": "CVE-2026-43262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43262"
},
{
"name": "CVE-2026-43271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43271"
},
{
"name": "CVE-2026-43275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43275"
},
{
"name": "CVE-2026-43278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43278"
},
{
"name": "CVE-2026-43288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43288"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2026-43297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43297"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-43304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43304"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-43315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43315"
},
{
"name": "CVE-2026-43317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43317"
},
{
"name": "CVE-2026-43318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43318"
},
{
"name": "CVE-2026-43319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43319"
},
{
"name": "CVE-2026-43348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43348"
},
{
"name": "CVE-2026-43349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43349"
},
{
"name": "CVE-2026-43350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43350"
},
{
"name": "CVE-2026-43376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43376"
},
{
"name": "CVE-2026-43378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43378"
},
{
"name": "CVE-2026-43384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43384"
},
{
"name": "CVE-2026-43402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43402"
},
{
"name": "CVE-2026-43491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43491"
},
{
"name": "CVE-2026-43493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43493"
},
{
"name": "CVE-2026-45847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45847"
},
{
"name": "CVE-2026-45849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45849"
},
{
"name": "CVE-2026-45851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45851"
},
{
"name": "CVE-2026-45859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45859"
},
{
"name": "CVE-2026-45861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45861"
},
{
"name": "CVE-2026-45864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45864"
},
{
"name": "CVE-2026-45865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45865"
},
{
"name": "CVE-2026-45872",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45872"
},
{
"name": "CVE-2026-45877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45877"
},
{
"name": "CVE-2026-45880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45880"
},
{
"name": "CVE-2026-45881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45881"
},
{
"name": "CVE-2026-45882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45882"
},
{
"name": "CVE-2026-45884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45884"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-45893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45893"
},
{
"name": "CVE-2026-45895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45895"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-45905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45905"
},
{
"name": "CVE-2026-45913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45913"
},
{
"name": "CVE-2026-45917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45917"
},
{
"name": "CVE-2026-45921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45921"
},
{
"name": "CVE-2026-45928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45928"
},
{
"name": "CVE-2026-45935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45935"
},
{
"name": "CVE-2026-45938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45938"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-45947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45947"
},
{
"name": "CVE-2026-45957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45957"
},
{
"name": "CVE-2026-45962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45962"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-45972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45972"
},
{
"name": "CVE-2026-45973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45973"
},
{
"name": "CVE-2026-45976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45976"
},
{
"name": "CVE-2026-45982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45982"
},
{
"name": "CVE-2026-45990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45990"
},
{
"name": "CVE-2026-45995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45995"
},
{
"name": "CVE-2026-46001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46001"
},
{
"name": "CVE-2026-46007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46007"
},
{
"name": "CVE-2026-46008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46008"
},
{
"name": "CVE-2026-46010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46010"
},
{
"name": "CVE-2026-46013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46013"
},
{
"name": "CVE-2026-46014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46014"
},
{
"name": "CVE-2026-46020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46020"
},
{
"name": "CVE-2026-46025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46025"
},
{
"name": "CVE-2026-46029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46029"
},
{
"name": "CVE-2026-46030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46030"
},
{
"name": "CVE-2026-46032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46032"
},
{
"name": "CVE-2026-46034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46034"
},
{
"name": "CVE-2026-46035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46035"
},
{
"name": "CVE-2026-46036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46036"
},
{
"name": "CVE-2026-46039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46039"
},
{
"name": "CVE-2026-46041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46041"
},
{
"name": "CVE-2026-46042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46042"
},
{
"name": "CVE-2026-46044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46044"
},
{
"name": "CVE-2026-46045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46045"
},
{
"name": "CVE-2026-46057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46057"
},
{
"name": "CVE-2026-46059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46059"
},
{
"name": "CVE-2026-46060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46060"
},
{
"name": "CVE-2026-46061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46061"
},
{
"name": "CVE-2026-46066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46066"
},
{
"name": "CVE-2026-46067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46067"
},
{
"name": "CVE-2026-46071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46071"
},
{
"name": "CVE-2026-46073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46073"
},
{
"name": "CVE-2026-46074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46074"
},
{
"name": "CVE-2026-46076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46076"
},
{
"name": "CVE-2026-46081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46081"
},
{
"name": "CVE-2026-46087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46087"
},
{
"name": "CVE-2026-46092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46092"
},
{
"name": "CVE-2026-46093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46093"
},
{
"name": "CVE-2026-46095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46095"
},
{
"name": "CVE-2026-46096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46096"
},
{
"name": "CVE-2026-46097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46097"
},
{
"name": "CVE-2026-46100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46100"
},
{
"name": "CVE-2026-46246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46246"
},
{
"name": "CVE-2026-46247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46247"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-46250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46250"
},
{
"name": "CVE-2026-46251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46251"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-46254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46254"
},
{
"name": "CVE-2026-46255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46255"
},
{
"name": "CVE-2026-46260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46260"
},
{
"name": "CVE-2026-46261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46261"
},
{
"name": "CVE-2026-46265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46265"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-46276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46276"
},
{
"name": "CVE-2026-46277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46277"
},
{
"name": "CVE-2026-46278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46278"
},
{
"name": "CVE-2026-46279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46279"
},
{
"name": "CVE-2026-46281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46281"
},
{
"name": "CVE-2026-46282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46282"
},
{
"name": "CVE-2026-46283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46283"
},
{
"name": "CVE-2026-46284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46284"
},
{
"name": "CVE-2026-46286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46286"
},
{
"name": "CVE-2026-46288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46288"
},
{
"name": "CVE-2026-46290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46290"
},
{
"name": "CVE-2026-46325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46325"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2026-46332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46332"
},
{
"name": "CVE-2026-52904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52904"
},
{
"name": "CVE-2026-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52905"
},
{
"name": "CVE-2026-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52906"
},
{
"name": "CVE-2026-52907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52907"
},
{
"name": "CVE-2026-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52933"
},
{
"name": "CVE-2026-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53174"
},
{
"name": "CVE-2026-43036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43036"
},
{
"name": "CVE-2026-43049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43049"
},
{
"name": "CVE-2026-43119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43119"
},
{
"name": "CVE-2026-43345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43345"
},
{
"name": "CVE-2026-43405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43405"
},
{
"name": "CVE-2026-43469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43469"
},
{
"name": "CVE-2026-46162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46162"
},
{
"name": "CVE-2026-52928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52928"
},
{
"name": "CVE-2026-46242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46242"
},
{
"name": "CVE-2026-52975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52975"
},
{
"name": "CVE-2026-53070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53070"
},
{
"name": "CVE-2026-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53101"
},
{
"name": "CVE-2026-31630",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31630"
},
{
"name": "CVE-2026-43064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43064"
},
{
"name": "CVE-2026-43075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43075"
},
{
"name": "CVE-2026-43076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43076"
},
{
"name": "CVE-2026-43079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43079"
},
{
"name": "CVE-2026-43080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43080"
},
{
"name": "CVE-2026-43085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43085"
},
{
"name": "CVE-2026-43089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43089"
},
{
"name": "CVE-2026-43093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43093"
},
{
"name": "CVE-2026-43094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43094"
},
{
"name": "CVE-2026-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43098"
},
{
"name": "CVE-2026-43099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43099"
},
{
"name": "CVE-2026-43103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43103"
},
{
"name": "CVE-2026-43104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43104"
},
{
"name": "CVE-2026-43105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43105"
},
{
"name": "CVE-2026-43111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43111"
},
{
"name": "CVE-2026-43113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43113"
},
{
"name": "CVE-2026-43421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43421"
},
{
"name": "CVE-2026-43492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43492"
},
{
"name": "CVE-2026-43495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43495"
},
{
"name": "CVE-2026-43496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43496"
},
{
"name": "CVE-2026-43497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43497"
},
{
"name": "CVE-2026-43502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43502"
},
{
"name": "CVE-2026-46143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46143"
},
{
"name": "CVE-2026-46179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46179"
},
{
"name": "CVE-2026-46184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46184"
},
{
"name": "CVE-2026-46235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46235"
},
{
"name": "CVE-2026-46294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46294"
},
{
"name": "CVE-2026-46314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46314"
},
{
"name": "CVE-2026-52914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52914"
},
{
"name": "CVE-2026-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52920"
},
{
"name": "CVE-2026-52925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52925"
},
{
"name": "CVE-2026-52954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52954"
},
{
"name": "CVE-2026-52955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52955"
},
{
"name": "CVE-2026-52957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52957"
},
{
"name": "CVE-2026-52958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52958"
},
{
"name": "CVE-2026-52962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52962"
},
{
"name": "CVE-2026-52963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52963"
},
{
"name": "CVE-2026-52967",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52967"
},
{
"name": "CVE-2026-52968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52968"
},
{
"name": "CVE-2026-52969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52969"
},
{
"name": "CVE-2026-52970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52970"
},
{
"name": "CVE-2026-52974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52974"
},
{
"name": "CVE-2026-52977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52977"
},
{
"name": "CVE-2026-52981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52981"
},
{
"name": "CVE-2026-52982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52982"
},
{
"name": "CVE-2026-52984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52984"
},
{
"name": "CVE-2026-52985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52985"
},
{
"name": "CVE-2026-52986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52986"
},
{
"name": "CVE-2026-52989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52989"
},
{
"name": "CVE-2026-52992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52992"
},
{
"name": "CVE-2026-52993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52993"
},
{
"name": "CVE-2026-52995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52995"
},
{
"name": "CVE-2026-52998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52998"
},
{
"name": "CVE-2026-52999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52999"
},
{
"name": "CVE-2026-53001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53001"
},
{
"name": "CVE-2026-53002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53002"
},
{
"name": "CVE-2026-53003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53003"
},
{
"name": "CVE-2026-53004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53004"
},
{
"name": "CVE-2026-43081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43081"
},
{
"name": "CVE-2026-43086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43086"
},
{
"name": "CVE-2026-43107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43107"
},
{
"name": "CVE-2026-43456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43456"
},
{
"name": "CVE-2026-53053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53053"
},
{
"name": "CVE-2026-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53122"
},
{
"name": "CVE-2026-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53281"
},
{
"name": "CVE-2026-53006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53006"
},
{
"name": "CVE-2026-53011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53011"
},
{
"name": "CVE-2026-53012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53012"
},
{
"name": "CVE-2026-53016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53016"
},
{
"name": "CVE-2026-53021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53021"
},
{
"name": "CVE-2026-53022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53022"
},
{
"name": "CVE-2026-53023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53023"
},
{
"name": "CVE-2026-53033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53033"
},
{
"name": "CVE-2026-53034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53034"
},
{
"name": "CVE-2026-53035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53035"
},
{
"name": "CVE-2026-53036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53036"
},
{
"name": "CVE-2026-53037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53037"
},
{
"name": "CVE-2026-53039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53039"
},
{
"name": "CVE-2026-53040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53040"
},
{
"name": "CVE-2026-53041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53041"
},
{
"name": "CVE-2026-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53043"
},
{
"name": "CVE-2026-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53045"
},
{
"name": "CVE-2026-53046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53046"
},
{
"name": "CVE-2026-53047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53047"
},
{
"name": "CVE-2026-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53048"
},
{
"name": "CVE-2026-53049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53049"
},
{
"name": "CVE-2026-53050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53050"
},
{
"name": "CVE-2026-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53052"
},
{
"name": "CVE-2026-53056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53056"
},
{
"name": "CVE-2026-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53059"
},
{
"name": "CVE-2026-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53060"
},
{
"name": "CVE-2026-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53061"
},
{
"name": "CVE-2026-53062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53062"
},
{
"name": "CVE-2026-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53063"
},
{
"name": "CVE-2026-53064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53064"
},
{
"name": "CVE-2026-53065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53065"
},
{
"name": "CVE-2026-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53066"
},
{
"name": "CVE-2026-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53068"
},
{
"name": "CVE-2026-53069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53069"
},
{
"name": "CVE-2026-53071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53071"
},
{
"name": "CVE-2026-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53072"
},
{
"name": "CVE-2026-53073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53073"
},
{
"name": "CVE-2026-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53074"
},
{
"name": "CVE-2026-53075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53075"
},
{
"name": "CVE-2026-53077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53077"
},
{
"name": "CVE-2026-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53082"
},
{
"name": "CVE-2026-53086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53086"
},
{
"name": "CVE-2026-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53088"
},
{
"name": "CVE-2026-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53093"
},
{
"name": "CVE-2026-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53096"
},
{
"name": "CVE-2026-53111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53111"
},
{
"name": "CVE-2026-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53112"
},
{
"name": "CVE-2026-53128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53128"
},
{
"name": "CVE-2026-53130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53130"
},
{
"name": "CVE-2026-53279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53279"
},
{
"name": "CVE-2026-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53287"
},
{
"name": "CVE-2026-53289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53289"
},
{
"name": "CVE-2026-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53291"
},
{
"name": "CVE-2026-53294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53294"
},
{
"name": "CVE-2026-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53295"
},
{
"name": "CVE-2026-53296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53296"
},
{
"name": "CVE-2026-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53303"
},
{
"name": "CVE-2026-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53304"
},
{
"name": "CVE-2026-53306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53306"
},
{
"name": "CVE-2026-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53309"
},
{
"name": "CVE-2026-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53314"
},
{
"name": "CVE-2026-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53320"
},
{
"name": "CVE-2026-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53354"
},
{
"name": "CVE-2026-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53357"
},
{
"name": "CVE-2026-43281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43281"
},
{
"name": "CVE-2026-52936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52936"
},
{
"name": "CVE-2026-53013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53013"
},
{
"name": "CVE-2026-53032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53032"
},
{
"name": "CVE-2026-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53058"
},
{
"name": "CVE-2026-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53076"
},
{
"name": "CVE-2026-53094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53094"
},
{
"name": "CVE-2026-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53110"
},
{
"name": "CVE-2026-53126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53126"
},
{
"name": "CVE-2026-53293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53293"
},
{
"name": "CVE-2026-43185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43185"
},
{
"name": "CVE-2026-64208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64208"
},
{
"name": "CVE-2026-64209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64209"
},
{
"name": "CVE-2026-64210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64210"
},
{
"name": "CVE-2026-64211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64211"
},
{
"name": "CVE-2026-64212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64212"
},
{
"name": "CVE-2026-64213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64213"
},
{
"name": "CVE-2026-64214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64214"
},
{
"name": "CVE-2026-64215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64215"
},
{
"name": "CVE-2026-64216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64216"
},
{
"name": "CVE-2026-64217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64217"
},
{
"name": "CVE-2026-64218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64218"
},
{
"name": "CVE-2026-64219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64219"
},
{
"name": "CVE-2026-64220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64220"
},
{
"name": "CVE-2026-64221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64221"
},
{
"name": "CVE-2026-64222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64222"
},
{
"name": "CVE-2026-64223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64223"
},
{
"name": "CVE-2026-64224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64224"
},
{
"name": "CVE-2026-64225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64225"
},
{
"name": "CVE-2026-64226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64226"
},
{
"name": "CVE-2026-64227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64227"
},
{
"name": "CVE-2026-64228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64228"
},
{
"name": "CVE-2026-64229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64229"
},
{
"name": "CVE-2026-64230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64230"
},
{
"name": "CVE-2026-64231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64231"
},
{
"name": "CVE-2026-64232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64232"
},
{
"name": "CVE-2026-64233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64233"
},
{
"name": "CVE-2026-64234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64234"
},
{
"name": "CVE-2026-64235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64235"
},
{
"name": "CVE-2026-64236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64236"
},
{
"name": "CVE-2026-64237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64237"
},
{
"name": "CVE-2026-64238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64238"
},
{
"name": "CVE-2026-64239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64239"
},
{
"name": "CVE-2026-64240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64240"
},
{
"name": "CVE-2026-64241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64241"
},
{
"name": "CVE-2026-64242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64242"
},
{
"name": "CVE-2026-64243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64243"
},
{
"name": "CVE-2026-64515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64515"
},
{
"name": "CVE-2026-64516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64516"
},
{
"name": "CVE-2026-64517",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64517"
},
{
"name": "CVE-2026-64518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64518"
},
{
"name": "CVE-2025-71187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71187"
},
{
"name": "CVE-2025-71201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71201"
},
{
"name": "CVE-2025-71287",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71287"
},
{
"name": "CVE-2025-71288",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71288"
},
{
"name": "CVE-2026-22987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22987"
},
{
"name": "CVE-2026-23007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23007"
},
{
"name": "CVE-2026-23008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23008"
},
{
"name": "CVE-2026-23009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23009"
},
{
"name": "CVE-2026-23012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23012"
},
{
"name": "CVE-2026-23014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23014"
},
{
"name": "CVE-2026-23015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23015"
},
{
"name": "CVE-2026-23018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23018"
},
{
"name": "CVE-2026-23022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23022"
},
{
"name": "CVE-2026-23024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23024"
},
{
"name": "CVE-2026-23034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23034"
},
{
"name": "CVE-2026-23036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23036"
},
{
"name": "CVE-2026-23042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23042"
},
{
"name": "CVE-2026-23044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23044"
},
{
"name": "CVE-2026-23045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23045"
},
{
"name": "CVE-2026-23046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23046"
},
{
"name": "CVE-2026-23051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23051"
},
{
"name": "CVE-2026-23052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23052"
},
{
"name": "CVE-2026-23067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23067"
},
{
"name": "CVE-2026-23077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23077"
},
{
"name": "CVE-2026-23079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23079"
},
{
"name": "CVE-2026-23081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23081"
},
{
"name": "CVE-2026-23092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23092"
},
{
"name": "CVE-2026-23106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23106"
},
{
"name": "CVE-2026-23109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23109"
},
{
"name": "CVE-2026-23114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23114"
},
{
"name": "CVE-2026-23115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23115"
},
{
"name": "CVE-2026-23122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23122"
},
{
"name": "CVE-2026-23130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23130"
},
{
"name": "CVE-2026-23143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23143"
},
{
"name": "CVE-2026-23147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23147"
},
{
"name": "CVE-2026-23158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23158"
},
{
"name": "CVE-2026-23161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23161"
},
{
"name": "CVE-2026-23162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23162"
},
{
"name": "CVE-2026-23165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23165"
},
{
"name": "CVE-2026-31413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31413"
},
{
"name": "CVE-2026-31722",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31722"
},
{
"name": "CVE-2026-31723",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31723"
},
{
"name": "CVE-2026-31724",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31724"
},
{
"name": "CVE-2026-31725",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31725"
},
{
"name": "CVE-2026-31730",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31730"
},
{
"name": "CVE-2026-31731",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31731"
},
{
"name": "CVE-2026-31740",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31740"
},
{
"name": "CVE-2026-31741",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31741"
},
{
"name": "CVE-2026-43007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43007"
},
{
"name": "CVE-2026-43016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43016"
},
{
"name": "CVE-2026-43019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43019"
},
{
"name": "CVE-2026-43084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43084"
},
{
"name": "CVE-2026-43091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43091"
},
{
"name": "CVE-2026-43092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43092"
},
{
"name": "CVE-2026-43129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43129"
},
{
"name": "CVE-2026-43162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43162"
},
{
"name": "CVE-2026-43324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43324"
},
{
"name": "CVE-2026-43368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43368"
},
{
"name": "CVE-2026-43371",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43371"
},
{
"name": "CVE-2026-43372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43372"
},
{
"name": "CVE-2026-43377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43377"
},
{
"name": "CVE-2026-43380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43380"
},
{
"name": "CVE-2026-43395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43395"
},
{
"name": "CVE-2026-43397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43397"
},
{
"name": "CVE-2026-43408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43408"
},
{
"name": "CVE-2026-43409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43409"
},
{
"name": "CVE-2026-43412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43412"
},
{
"name": "CVE-2026-43415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43415"
},
{
"name": "CVE-2026-43436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43436"
},
{
"name": "CVE-2026-43448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43448"
},
{
"name": "CVE-2026-43457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43457"
},
{
"name": "CVE-2026-43467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43467"
},
{
"name": "CVE-2026-43468",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43468"
},
{
"name": "CVE-2026-43471",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43471"
},
{
"name": "CVE-2026-43473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43473"
},
{
"name": "CVE-2026-43476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43476"
},
{
"name": "CVE-2026-43484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43484"
},
{
"name": "CVE-2026-43488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43488"
},
{
"name": "CVE-2026-43498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43498"
},
{
"name": "CVE-2026-45837",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45837"
},
{
"name": "CVE-2026-45855",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45855"
},
{
"name": "CVE-2026-45858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45858"
},
{
"name": "CVE-2026-45911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45911"
},
{
"name": "CVE-2026-45924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45924"
},
{
"name": "CVE-2026-45943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45943"
},
{
"name": "CVE-2026-46104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46104"
},
{
"name": "CVE-2026-46105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46105"
},
{
"name": "CVE-2026-46118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46118"
},
{
"name": "CVE-2026-46121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46121"
},
{
"name": "CVE-2026-46126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46126"
},
{
"name": "CVE-2026-46130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46130"
},
{
"name": "CVE-2026-46134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46134"
},
{
"name": "CVE-2026-46139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46139"
},
{
"name": "CVE-2026-46140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46140"
},
{
"name": "CVE-2026-46141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46141"
},
{
"name": "CVE-2026-46147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46147"
},
{
"name": "CVE-2026-46148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46148"
},
{
"name": "CVE-2026-46153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46153"
},
{
"name": "CVE-2026-46154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46154"
},
{
"name": "CVE-2026-46171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46171"
},
{
"name": "CVE-2026-46175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46175"
},
{
"name": "CVE-2026-46182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46182"
},
{
"name": "CVE-2026-46183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46183"
},
{
"name": "CVE-2026-46188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46188"
},
{
"name": "CVE-2026-46192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46192"
},
{
"name": "CVE-2026-46194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46194"
},
{
"name": "CVE-2026-46200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46200"
},
{
"name": "CVE-2026-46201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46201"
},
{
"name": "CVE-2026-46202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46202"
},
{
"name": "CVE-2026-46207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46207"
},
{
"name": "CVE-2026-46210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46210"
},
{
"name": "CVE-2026-46211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46211"
},
{
"name": "CVE-2026-46213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46213"
},
{
"name": "CVE-2026-46215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46215"
},
{
"name": "CVE-2026-46221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46221"
},
{
"name": "CVE-2026-46222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46222"
},
{
"name": "CVE-2026-46223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46223"
},
{
"name": "CVE-2026-46224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46224"
},
{
"name": "CVE-2026-46228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46228"
},
{
"name": "CVE-2026-46232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46232"
},
{
"name": "CVE-2026-46239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46239"
},
{
"name": "CVE-2026-46240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46240"
},
{
"name": "CVE-2026-46241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46241"
},
{
"name": "CVE-2026-46295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46295"
},
{
"name": "CVE-2026-46297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46297"
},
{
"name": "CVE-2026-46298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46298"
},
{
"name": "CVE-2026-46302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46302"
},
{
"name": "CVE-2026-46305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46305"
},
{
"name": "CVE-2026-46308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46308"
},
{
"name": "CVE-2026-46309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46309"
},
{
"name": "CVE-2026-46310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46310"
},
{
"name": "CVE-2026-46311",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46311"
},
{
"name": "CVE-2026-46313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46313"
},
{
"name": "CVE-2026-46318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46318"
},
{
"name": "CVE-2026-46324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46324"
},
{
"name": "CVE-2026-52932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52932"
},
{
"name": "CVE-2026-52937",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52937"
},
{
"name": "CVE-2026-52949",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52949"
},
{
"name": "CVE-2026-52950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52950"
},
{
"name": "CVE-2026-52951",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52951"
},
{
"name": "CVE-2026-52952",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52952"
},
{
"name": "CVE-2026-52953",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52953"
},
{
"name": "CVE-2026-52956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52956"
},
{
"name": "CVE-2026-52959",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52959"
},
{
"name": "CVE-2026-52960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52960"
},
{
"name": "CVE-2026-52961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52961"
},
{
"name": "CVE-2026-52964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52964"
},
{
"name": "CVE-2026-52965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52965"
},
{
"name": "CVE-2026-52971",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52971"
},
{
"name": "CVE-2026-52973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52973"
},
{
"name": "CVE-2026-52976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52976"
},
{
"name": "CVE-2026-52978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52978"
},
{
"name": "CVE-2026-52979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52979"
},
{
"name": "CVE-2026-52980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52980"
},
{
"name": "CVE-2026-52983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52983"
},
{
"name": "CVE-2026-52987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52987"
},
{
"name": "CVE-2026-52988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52988"
},
{
"name": "CVE-2026-52990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52990"
},
{
"name": "CVE-2026-52991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52991"
},
{
"name": "CVE-2026-52994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52994"
},
{
"name": "CVE-2026-52996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52996"
},
{
"name": "CVE-2026-52997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52997"
},
{
"name": "CVE-2026-53000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53000"
},
{
"name": "CVE-2026-53005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53005"
},
{
"name": "CVE-2026-53007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53007"
},
{
"name": "CVE-2026-53008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53008"
},
{
"name": "CVE-2026-53009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53009"
},
{
"name": "CVE-2026-53010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53010"
},
{
"name": "CVE-2026-53014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53014"
},
{
"name": "CVE-2026-53015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53015"
},
{
"name": "CVE-2026-53017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53017"
},
{
"name": "CVE-2026-53018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53018"
},
{
"name": "CVE-2026-53019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53019"
},
{
"name": "CVE-2026-53020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53020"
},
{
"name": "CVE-2026-53024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53024"
},
{
"name": "CVE-2026-53025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53025"
},
{
"name": "CVE-2026-53026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53026"
},
{
"name": "CVE-2026-53027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53027"
},
{
"name": "CVE-2026-53028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53028"
},
{
"name": "CVE-2026-53029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53029"
},
{
"name": "CVE-2026-53030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53030"
},
{
"name": "CVE-2026-53031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53031"
},
{
"name": "CVE-2026-53038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53038"
},
{
"name": "CVE-2026-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53042"
},
{
"name": "CVE-2026-53044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53044"
},
{
"name": "CVE-2026-53051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53051"
},
{
"name": "CVE-2026-53054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53054"
},
{
"name": "CVE-2026-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53055"
},
{
"name": "CVE-2026-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53057"
},
{
"name": "CVE-2026-53067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53067"
},
{
"name": "CVE-2026-53078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53078"
},
{
"name": "CVE-2026-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53079"
},
{
"name": "CVE-2026-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53081"
},
{
"name": "CVE-2026-53083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53083"
},
{
"name": "CVE-2026-53084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53084"
},
{
"name": "CVE-2026-53085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53085"
},
{
"name": "CVE-2026-53087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53087"
},
{
"name": "CVE-2026-53089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53089"
},
{
"name": "CVE-2026-53090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53090"
},
{
"name": "CVE-2026-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53091"
},
{
"name": "CVE-2026-53092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53092"
},
{
"name": "CVE-2026-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53095"
},
{
"name": "CVE-2026-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53097"
},
{
"name": "CVE-2026-53098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53098"
},
{
"name": "CVE-2026-53099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53099"
},
{
"name": "CVE-2026-53100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53100"
},
{
"name": "CVE-2026-53102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53102"
},
{
"name": "CVE-2026-53103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53103"
},
{
"name": "CVE-2026-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53104"
},
{
"name": "CVE-2026-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53105"
},
{
"name": "CVE-2026-53106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53106"
},
{
"name": "CVE-2026-53107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53107"
},
{
"name": "CVE-2026-53108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53108"
},
{
"name": "CVE-2026-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53109"
},
{
"name": "CVE-2026-53113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53113"
},
{
"name": "CVE-2026-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53114"
},
{
"name": "CVE-2026-53115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53115"
},
{
"name": "CVE-2026-53116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53116"
},
{
"name": "CVE-2026-53117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53117"
},
{
"name": "CVE-2026-53118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53118"
},
{
"name": "CVE-2026-53119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53119"
},
{
"name": "CVE-2026-53120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53120"
},
{
"name": "CVE-2026-53121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53121"
},
{
"name": "CVE-2026-53123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53123"
},
{
"name": "CVE-2026-53124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53124"
},
{
"name": "CVE-2026-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53125"
},
{
"name": "CVE-2026-53127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53127"
},
{
"name": "CVE-2026-53129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53129"
},
{
"name": "CVE-2026-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53277"
},
{
"name": "CVE-2026-53278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53278"
},
{
"name": "CVE-2026-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53280"
},
{
"name": "CVE-2026-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53282"
},
{
"name": "CVE-2026-53283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53283"
},
{
"name": "CVE-2026-53284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53284"
},
{
"name": "CVE-2026-53285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53285"
},
{
"name": "CVE-2026-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53286"
},
{
"name": "CVE-2026-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53288"
},
{
"name": "CVE-2026-53290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53290"
},
{
"name": "CVE-2026-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53292"
},
{
"name": "CVE-2026-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53297"
},
{
"name": "CVE-2026-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53298"
},
{
"name": "CVE-2026-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53299"
},
{
"name": "CVE-2026-53300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53300"
},
{
"name": "CVE-2026-53301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53301"
},
{
"name": "CVE-2026-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53302"
},
{
"name": "CVE-2026-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53305"
},
{
"name": "CVE-2026-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53307"
},
{
"name": "CVE-2026-53308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53308"
},
{
"name": "CVE-2026-53310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53310"
},
{
"name": "CVE-2026-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53311"
},
{
"name": "CVE-2026-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53312"
},
{
"name": "CVE-2026-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53313"
},
{
"name": "CVE-2026-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53315"
},
{
"name": "CVE-2026-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53316"
},
{
"name": "CVE-2026-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53317"
},
{
"name": "CVE-2026-53318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53318"
},
{
"name": "CVE-2026-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53319"
},
{
"name": "CVE-2026-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53321"
},
{
"name": "CVE-2026-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53322"
},
{
"name": "CVE-2026-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53323"
},
{
"name": "CVE-2026-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53324"
},
{
"name": "CVE-2026-53358",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53358"
},
{
"name": "CVE-2026-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53360"
},
{
"name": "CVE-2026-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53364"
},
{
"name": "CVE-2026-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53365"
},
{
"name": "CVE-2026-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53367"
},
{
"name": "CVE-2026-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53368"
},
{
"name": "CVE-2026-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53369"
},
{
"name": "CVE-2026-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53370"
},
{
"name": "CVE-2026-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53371"
},
{
"name": "CVE-2026-53372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53372"
},
{
"name": "CVE-2026-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53373"
},
{
"name": "CVE-2026-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53374"
},
{
"name": "CVE-2026-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53375"
},
{
"name": "CVE-2026-53376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53376"
},
{
"name": "CVE-2026-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53377"
},
{
"name": "CVE-2026-53378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53378"
},
{
"name": "CVE-2026-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53379"
},
{
"name": "CVE-2026-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53380"
},
{
"name": "CVE-2026-63837",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63837"
},
{
"name": "CVE-2026-63838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63838"
},
{
"name": "CVE-2026-63839",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63839"
},
{
"name": "CVE-2026-63840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63840"
},
{
"name": "CVE-2026-63841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63841"
},
{
"name": "CVE-2026-63842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63842"
},
{
"name": "CVE-2026-63843",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63843"
},
{
"name": "CVE-2026-63844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63844"
},
{
"name": "CVE-2026-63845",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63845"
},
{
"name": "CVE-2026-63846",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63846"
},
{
"name": "CVE-2026-63847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63847"
},
{
"name": "CVE-2026-63848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63848"
},
{
"name": "CVE-2026-63849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63849"
},
{
"name": "CVE-2026-63850",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63850"
},
{
"name": "CVE-2026-63851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63851"
},
{
"name": "CVE-2026-63852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63852"
},
{
"name": "CVE-2026-63853",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63853"
},
{
"name": "CVE-2026-63854",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63854"
},
{
"name": "CVE-2026-63855",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63855"
},
{
"name": "CVE-2026-63856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63856"
},
{
"name": "CVE-2026-63857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63857"
},
{
"name": "CVE-2026-63858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63858"
},
{
"name": "CVE-2026-63859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63859"
},
{
"name": "CVE-2026-63860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63860"
},
{
"name": "CVE-2026-63861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63861"
},
{
"name": "CVE-2026-63862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63862"
},
{
"name": "CVE-2026-63863",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63863"
},
{
"name": "CVE-2026-63864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63864"
},
{
"name": "CVE-2026-63865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63865"
},
{
"name": "CVE-2026-63866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63866"
},
{
"name": "CVE-2026-63875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63875"
},
{
"name": "CVE-2026-63876",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63876"
},
{
"name": "CVE-2026-63877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63877"
},
{
"name": "CVE-2026-63878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63878"
},
{
"name": "CVE-2026-63879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63879"
},
{
"name": "CVE-2026-63880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63880"
},
{
"name": "CVE-2026-63881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63881"
},
{
"name": "CVE-2026-63882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63882"
},
{
"name": "CVE-2026-63883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63883"
},
{
"name": "CVE-2026-63884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63884"
},
{
"name": "CVE-2026-63886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63886"
},
{
"name": "CVE-2026-63887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63887"
},
{
"name": "CVE-2026-63888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63888"
},
{
"name": "CVE-2026-63889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63889"
},
{
"name": "CVE-2026-63890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63890"
},
{
"name": "CVE-2026-63891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63891"
},
{
"name": "CVE-2026-63892",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63892"
},
{
"name": "CVE-2026-63893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63893"
},
{
"name": "CVE-2026-63894",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63894"
},
{
"name": "CVE-2026-63895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63895"
},
{
"name": "CVE-2026-63896",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63896"
},
{
"name": "CVE-2026-63897",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63897"
},
{
"name": "CVE-2026-63898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63898"
},
{
"name": "CVE-2026-63899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63899"
},
{
"name": "CVE-2026-63900",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63900"
},
{
"name": "CVE-2026-63901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63901"
},
{
"name": "CVE-2026-63902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63902"
},
{
"name": "CVE-2026-63903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63903"
},
{
"name": "CVE-2026-63904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63904"
},
{
"name": "CVE-2026-63905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63905"
},
{
"name": "CVE-2026-63906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63906"
},
{
"name": "CVE-2026-63907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63907"
},
{
"name": "CVE-2026-63908",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63908"
},
{
"name": "CVE-2026-63909",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63909"
},
{
"name": "CVE-2026-63910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63910"
},
{
"name": "CVE-2026-63911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63911"
},
{
"name": "CVE-2026-63912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63912"
},
{
"name": "CVE-2026-63913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63913"
},
{
"name": "CVE-2026-63914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63914"
},
{
"name": "CVE-2026-63915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63915"
},
{
"name": "CVE-2026-63916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63916"
},
{
"name": "CVE-2026-63917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63917"
},
{
"name": "CVE-2026-63918",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63918"
},
{
"name": "CVE-2026-63919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63919"
},
{
"name": "CVE-2026-63920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63920"
},
{
"name": "CVE-2026-63921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63921"
},
{
"name": "CVE-2026-63922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63922"
},
{
"name": "CVE-2026-63923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63923"
},
{
"name": "CVE-2026-63924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63924"
},
{
"name": "CVE-2026-63925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63925"
},
{
"name": "CVE-2026-63926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63926"
},
{
"name": "CVE-2026-63927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63927"
},
{
"name": "CVE-2026-63928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63928"
},
{
"name": "CVE-2026-63929",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63929"
},
{
"name": "CVE-2026-63930",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63930"
},
{
"name": "CVE-2026-63931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63931"
},
{
"name": "CVE-2026-63932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63932"
},
{
"name": "CVE-2026-63933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63933"
},
{
"name": "CVE-2026-63934",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63934"
},
{
"name": "CVE-2026-63935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63935"
},
{
"name": "CVE-2026-63936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63936"
},
{
"name": "CVE-2026-63937",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63937"
},
{
"name": "CVE-2026-63938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63938"
},
{
"name": "CVE-2026-63939",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63939"
},
{
"name": "CVE-2026-63940",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63940"
},
{
"name": "CVE-2026-63941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63941"
},
{
"name": "CVE-2026-63942",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63942"
},
{
"name": "CVE-2026-63943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63943"
},
{
"name": "CVE-2026-63944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63944"
},
{
"name": "CVE-2026-63945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63945"
},
{
"name": "CVE-2026-63946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63946"
},
{
"name": "CVE-2026-63947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63947"
},
{
"name": "CVE-2026-63948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63948"
},
{
"name": "CVE-2026-63949",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63949"
},
{
"name": "CVE-2026-63950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63950"
},
{
"name": "CVE-2026-63951",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63951"
},
{
"name": "CVE-2026-63952",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63952"
},
{
"name": "CVE-2026-63953",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63953"
},
{
"name": "CVE-2026-63954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63954"
},
{
"name": "CVE-2026-63955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63955"
},
{
"name": "CVE-2026-63956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63956"
},
{
"name": "CVE-2026-63957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63957"
},
{
"name": "CVE-2026-63958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63958"
},
{
"name": "CVE-2026-63959",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63959"
},
{
"name": "CVE-2026-63960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63960"
},
{
"name": "CVE-2026-63961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63961"
},
{
"name": "CVE-2026-63962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63962"
},
{
"name": "CVE-2026-63963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63963"
},
{
"name": "CVE-2026-63964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63964"
},
{
"name": "CVE-2026-63965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63965"
},
{
"name": "CVE-2026-63966",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63966"
},
{
"name": "CVE-2026-63967",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63967"
},
{
"name": "CVE-2026-63968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63968"
},
{
"name": "CVE-2026-63969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63969"
},
{
"name": "CVE-2026-63970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63970"
},
{
"name": "CVE-2026-63971",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63971"
},
{
"name": "CVE-2026-63972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63972"
},
{
"name": "CVE-2026-63973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63973"
},
{
"name": "CVE-2026-63974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63974"
},
{
"name": "CVE-2026-63975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63975"
},
{
"name": "CVE-2026-63976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63976"
},
{
"name": "CVE-2026-63977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63977"
},
{
"name": "CVE-2026-63978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63978"
},
{
"name": "CVE-2026-63979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63979"
},
{
"name": "CVE-2026-63980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63980"
},
{
"name": "CVE-2026-63981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63981"
},
{
"name": "CVE-2026-63982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63982"
},
{
"name": "CVE-2026-63983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63983"
},
{
"name": "CVE-2026-63984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63984"
},
{
"name": "CVE-2026-63985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63985"
},
{
"name": "CVE-2026-63986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63986"
},
{
"name": "CVE-2026-63987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63987"
},
{
"name": "CVE-2026-63988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63988"
},
{
"name": "CVE-2026-63989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63989"
},
{
"name": "CVE-2026-63990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63990"
},
{
"name": "CVE-2026-63991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63991"
},
{
"name": "CVE-2026-63992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63992"
},
{
"name": "CVE-2026-63993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63993"
},
{
"name": "CVE-2026-63994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63994"
},
{
"name": "CVE-2026-63995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63995"
},
{
"name": "CVE-2026-63996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63996"
},
{
"name": "CVE-2026-63997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63997"
},
{
"name": "CVE-2026-63998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63998"
},
{
"name": "CVE-2026-63999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63999"
},
{
"name": "CVE-2026-64000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64000"
},
{
"name": "CVE-2026-64001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64001"
},
{
"name": "CVE-2026-64002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64002"
},
{
"name": "CVE-2026-64003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64003"
},
{
"name": "CVE-2026-64004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64004"
},
{
"name": "CVE-2026-64005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64005"
},
{
"name": "CVE-2026-64006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64006"
},
{
"name": "CVE-2026-64007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64007"
},
{
"name": "CVE-2026-64008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64008"
},
{
"name": "CVE-2026-64009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64009"
},
{
"name": "CVE-2026-64010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64010"
},
{
"name": "CVE-2026-64011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64011"
},
{
"name": "CVE-2026-64012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64012"
},
{
"name": "CVE-2026-64013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64013"
},
{
"name": "CVE-2026-64014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64014"
},
{
"name": "CVE-2026-64015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64015"
},
{
"name": "CVE-2026-64017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64017"
},
{
"name": "CVE-2026-64018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64018"
},
{
"name": "CVE-2026-64019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64019"
},
{
"name": "CVE-2026-64020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64020"
},
{
"name": "CVE-2026-64021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64021"
},
{
"name": "CVE-2026-64022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64022"
},
{
"name": "CVE-2026-64023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64023"
},
{
"name": "CVE-2026-64024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64024"
},
{
"name": "CVE-2026-64025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64025"
},
{
"name": "CVE-2026-64026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64026"
},
{
"name": "CVE-2026-64027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64027"
},
{
"name": "CVE-2026-64029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64029"
},
{
"name": "CVE-2026-64030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64030"
},
{
"name": "CVE-2026-64031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64031"
},
{
"name": "CVE-2026-64032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64032"
},
{
"name": "CVE-2026-64033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64033"
},
{
"name": "CVE-2026-64034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64034"
},
{
"name": "CVE-2026-64035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64035"
},
{
"name": "CVE-2026-64036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64036"
},
{
"name": "CVE-2026-64037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64037"
},
{
"name": "CVE-2026-64038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64038"
},
{
"name": "CVE-2026-64039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64039"
},
{
"name": "CVE-2026-64040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64040"
},
{
"name": "CVE-2026-64041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64041"
},
{
"name": "CVE-2026-64042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64042"
},
{
"name": "CVE-2026-64043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64043"
},
{
"name": "CVE-2026-64044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64044"
},
{
"name": "CVE-2026-64045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64045"
},
{
"name": "CVE-2026-64046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64046"
},
{
"name": "CVE-2026-64047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64047"
},
{
"name": "CVE-2026-64048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64048"
},
{
"name": "CVE-2026-64049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64049"
},
{
"name": "CVE-2026-64050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64050"
},
{
"name": "CVE-2026-64051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64051"
},
{
"name": "CVE-2026-64052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64052"
},
{
"name": "CVE-2026-64053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64053"
},
{
"name": "CVE-2026-64054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64054"
},
{
"name": "CVE-2026-64055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64055"
},
{
"name": "CVE-2026-64056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64056"
},
{
"name": "CVE-2026-64057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64057"
},
{
"name": "CVE-2026-64058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64058"
},
{
"name": "CVE-2026-64059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64059"
},
{
"name": "CVE-2026-64060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64060"
},
{
"name": "CVE-2026-64061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64061"
},
{
"name": "CVE-2026-64062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64062"
},
{
"name": "CVE-2026-64063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64063"
},
{
"name": "CVE-2026-64064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64064"
},
{
"name": "CVE-2026-64065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64065"
},
{
"name": "CVE-2026-64066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64066"
},
{
"name": "CVE-2026-64067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64067"
},
{
"name": "CVE-2026-64068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64068"
},
{
"name": "CVE-2026-64069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64069"
},
{
"name": "CVE-2026-64070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64070"
},
{
"name": "CVE-2026-64071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64071"
},
{
"name": "CVE-2026-64072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64072"
},
{
"name": "CVE-2026-64073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64073"
},
{
"name": "CVE-2026-64074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64074"
},
{
"name": "CVE-2026-64075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64075"
},
{
"name": "CVE-2026-64076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64076"
},
{
"name": "CVE-2026-64077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64077"
},
{
"name": "CVE-2026-64078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64078"
},
{
"name": "CVE-2026-64079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64079"
},
{
"name": "CVE-2026-64080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64080"
},
{
"name": "CVE-2026-64081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64081"
},
{
"name": "CVE-2026-64082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64082"
},
{
"name": "CVE-2026-64083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64083"
},
{
"name": "CVE-2026-64084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64084"
},
{
"name": "CVE-2026-64085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64085"
},
{
"name": "CVE-2026-64086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64086"
},
{
"name": "CVE-2026-64087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64087"
},
{
"name": "CVE-2026-64088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64088"
},
{
"name": "CVE-2026-64089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64089"
},
{
"name": "CVE-2026-64090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64090"
},
{
"name": "CVE-2026-64091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64091"
},
{
"name": "CVE-2026-64093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64093"
},
{
"name": "CVE-2026-64094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64094"
},
{
"name": "CVE-2026-64095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64095"
},
{
"name": "CVE-2026-64096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64096"
},
{
"name": "CVE-2026-64097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64097"
},
{
"name": "CVE-2026-64098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64098"
},
{
"name": "CVE-2026-64099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64099"
},
{
"name": "CVE-2026-64100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64100"
},
{
"name": "CVE-2026-64101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64101"
},
{
"name": "CVE-2026-64102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64102"
},
{
"name": "CVE-2026-64103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64103"
},
{
"name": "CVE-2026-64104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64104"
},
{
"name": "CVE-2026-64105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64105"
},
{
"name": "CVE-2026-64106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64106"
},
{
"name": "CVE-2026-64107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64107"
},
{
"name": "CVE-2026-64108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64108"
},
{
"name": "CVE-2026-64109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64109"
},
{
"name": "CVE-2026-64110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64110"
},
{
"name": "CVE-2026-64111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64111"
},
{
"name": "CVE-2026-64112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64112"
},
{
"name": "CVE-2026-64113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64113"
},
{
"name": "CVE-2026-64114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64114"
},
{
"name": "CVE-2026-64115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64115"
},
{
"name": "CVE-2026-64116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64116"
},
{
"name": "CVE-2026-64117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64117"
},
{
"name": "CVE-2026-64118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64118"
},
{
"name": "CVE-2026-64119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64119"
},
{
"name": "CVE-2026-64120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64120"
},
{
"name": "CVE-2026-64121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64121"
},
{
"name": "CVE-2026-64122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64122"
},
{
"name": "CVE-2026-64123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64123"
},
{
"name": "CVE-2026-64124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64124"
},
{
"name": "CVE-2026-64125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64125"
},
{
"name": "CVE-2026-64126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64126"
},
{
"name": "CVE-2026-64127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64127"
},
{
"name": "CVE-2026-64128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64128"
},
{
"name": "CVE-2026-64129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64129"
},
{
"name": "CVE-2026-64130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64130"
},
{
"name": "CVE-2026-64131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64131"
},
{
"name": "CVE-2026-64132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64132"
},
{
"name": "CVE-2026-64133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64133"
},
{
"name": "CVE-2026-64134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64134"
},
{
"name": "CVE-2026-64135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64135"
},
{
"name": "CVE-2026-64136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64136"
},
{
"name": "CVE-2026-64137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64137"
},
{
"name": "CVE-2026-64138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64138"
},
{
"name": "CVE-2026-64139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64139"
},
{
"name": "CVE-2026-64140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64140"
},
{
"name": "CVE-2026-64141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64141"
},
{
"name": "CVE-2026-64142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64142"
},
{
"name": "CVE-2026-64143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64143"
},
{
"name": "CVE-2026-64144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64144"
},
{
"name": "CVE-2026-64145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64145"
},
{
"name": "CVE-2026-64146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64146"
},
{
"name": "CVE-2026-64147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64147"
},
{
"name": "CVE-2026-64148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64148"
},
{
"name": "CVE-2026-64149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64149"
},
{
"name": "CVE-2026-64150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64150"
},
{
"name": "CVE-2026-64151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64151"
},
{
"name": "CVE-2026-64152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64152"
},
{
"name": "CVE-2026-64153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64153"
},
{
"name": "CVE-2026-64154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64154"
},
{
"name": "CVE-2026-64155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64155"
},
{
"name": "CVE-2026-64156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64156"
},
{
"name": "CVE-2026-64157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64157"
},
{
"name": "CVE-2026-64158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64158"
},
{
"name": "CVE-2026-64159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64159"
},
{
"name": "CVE-2026-64160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64160"
},
{
"name": "CVE-2026-64161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64161"
},
{
"name": "CVE-2026-64162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64162"
},
{
"name": "CVE-2026-64163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64163"
},
{
"name": "CVE-2026-64164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64164"
},
{
"name": "CVE-2026-64165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64165"
},
{
"name": "CVE-2026-64166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64166"
},
{
"name": "CVE-2026-64167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64167"
},
{
"name": "CVE-2026-64168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64168"
},
{
"name": "CVE-2026-64169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64169"
},
{
"name": "CVE-2026-64170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64170"
},
{
"name": "CVE-2026-64171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64171"
},
{
"name": "CVE-2026-64172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64172"
},
{
"name": "CVE-2026-64173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64173"
},
{
"name": "CVE-2026-64174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64174"
},
{
"name": "CVE-2026-64175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64175"
},
{
"name": "CVE-2026-64176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64176"
},
{
"name": "CVE-2026-64177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64177"
},
{
"name": "CVE-2026-64178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64178"
},
{
"name": "CVE-2026-64179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64179"
},
{
"name": "CVE-2026-64180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64180"
},
{
"name": "CVE-2026-64181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64181"
},
{
"name": "CVE-2026-64182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64182"
},
{
"name": "CVE-2026-64183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64183"
},
{
"name": "CVE-2026-64184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64184"
},
{
"name": "CVE-2026-64185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64185"
},
{
"name": "CVE-2026-64186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64186"
},
{
"name": "CVE-2026-64519",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64519"
},
{
"name": "CVE-2026-64520",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64520"
},
{
"name": "CVE-2026-64521",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64521"
},
{
"name": "CVE-2026-64522",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64522"
},
{
"name": "CVE-2026-64523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64523"
},
{
"name": "CVE-2026-64524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64524"
},
{
"name": "CVE-2026-64525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64525"
},
{
"name": "CVE-2026-64526",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64526"
},
{
"name": "CVE-2026-64527",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64527"
},
{
"name": "CVE-2026-64528",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64528"
}
],
"initial_release_date": "2026-07-31T00:00:00",
"last_revision_date": "2026-07-31T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0954",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-07-31T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-07-29",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8622-1",
"url": "https://ubuntu.com/security/notices/USN-8622-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8620-1",
"url": "https://ubuntu.com/security/notices/USN-8620-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8604-1",
"url": "https://ubuntu.com/security/notices/USN-8604-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8615-1",
"url": "https://ubuntu.com/security/notices/USN-8615-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8574-3",
"url": "https://ubuntu.com/security/notices/USN-8574-3"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8619-1",
"url": "https://ubuntu.com/security/notices/USN-8619-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8595-2",
"url": "https://ubuntu.com/security/notices/USN-8595-2"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8570-2",
"url": "https://ubuntu.com/security/notices/USN-8570-2"
},
{
"published_at": "2026-07-29",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8623-1",
"url": "https://ubuntu.com/security/notices/USN-8623-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8575-3",
"url": "https://ubuntu.com/security/notices/USN-8575-3"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8608-1",
"url": "https://ubuntu.com/security/notices/USN-8608-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8547-2",
"url": "https://ubuntu.com/security/notices/USN-8547-2"
},
{
"published_at": "2026-07-29",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8615-2",
"url": "https://ubuntu.com/security/notices/USN-8615-2"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8618-1",
"url": "https://ubuntu.com/security/notices/USN-8618-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8617-1",
"url": "https://ubuntu.com/security/notices/USN-8617-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8609-1",
"url": "https://ubuntu.com/security/notices/USN-8609-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8607-1",
"url": "https://ubuntu.com/security/notices/USN-8607-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8595-3",
"url": "https://ubuntu.com/security/notices/USN-8595-3"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8605-1",
"url": "https://ubuntu.com/security/notices/USN-8605-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8616-1",
"url": "https://ubuntu.com/security/notices/USN-8616-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8603-1",
"url": "https://ubuntu.com/security/notices/USN-8603-1"
},
{
"published_at": "2026-07-29",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8620-2",
"url": "https://ubuntu.com/security/notices/USN-8620-2"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8610-1",
"url": "https://ubuntu.com/security/notices/USN-8610-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8606-1",
"url": "https://ubuntu.com/security/notices/USN-8606-1"
}
]
}
FKIE_CVE-2026-43153
Vulnerability from fkie_nvd - Published: 2026-05-06 12:16 - Updated: 2026-06-17 10:49| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/2fbc8421d1db102c0e5458607e042a23a03648b1 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/3a65ea768b8094e4699e72f9ab420eb9e0f3f568 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/457121c01f609b9934addbb04d5c1ef638c71c61 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/530082df991903f3330354e99e0cb7b05debfa86 | Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/xfs/libxfs/xfs_attr.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "2fbc8421d1db102c0e5458607e042a23a03648b1",
"status": "affected",
"version": "07120f1abdff80f3d1351f733661abe28d609535",
"versionType": "git"
},
{
"lessThan": "457121c01f609b9934addbb04d5c1ef638c71c61",
"status": "affected",
"version": "07120f1abdff80f3d1351f733661abe28d609535",
"versionType": "git"
},
{
"lessThan": "530082df991903f3330354e99e0cb7b05debfa86",
"status": "affected",
"version": "07120f1abdff80f3d1351f733661abe28d609535",
"versionType": "git"
},
{
"lessThan": "3a65ea768b8094e4699e72f9ab420eb9e0f3f568",
"status": "affected",
"version": "07120f1abdff80f3d1351f733661abe28d609535",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/xfs/libxfs/xfs_attr.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.9"
},
{
"lessThan": "5.9",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.75",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.16",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.19.*",
"status": "unaffected",
"version": "6.19.6",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.0",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "F0FB6DE3-7F78-4DBC-83E3-1ACA0F4DC0E4",
"versionEndExcluding": "6.12.75",
"versionStartIncluding": "5.9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B4B8CDA9-BADF-4CF5-8B3B-702DE8EEA40B",
"versionEndExcluding": "6.18.16",
"versionStartIncluding": "6.13",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "373EEEDA-FAA1-4FB4-B6ED-DB4DD99DBE67",
"versionEndExcluding": "6.19.6",
"versionStartIncluding": "6.19",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nxfs: remove xfs_attr_leaf_hasname\n\nThe calling convention of xfs_attr_leaf_hasname() is problematic, because\nit returns a NULL buffer when xfs_attr3_leaf_read fails, a valid buffer\nwhen xfs_attr3_leaf_lookup_int returns -ENOATTR or -EEXIST, and a\nnon-NULL buffer pointer for an already released buffer when\nxfs_attr3_leaf_lookup_int fails with other error values.\n\nFix this by simply open coding xfs_attr_leaf_hasname in the callers, so\nthat the buffer release code is done by each caller of\nxfs_attr3_leaf_read."
}
],
"id": "CVE-2026-43153",
"lastModified": "2026-06-17T10:49:02.063",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
}
]
},
"published": "2026-05-06T12:16:33.073",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2fbc8421d1db102c0e5458607e042a23a03648b1"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3a65ea768b8094e4699e72f9ab420eb9e0f3f568"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/457121c01f609b9934addbb04d5c1ef638c71c61"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/530082df991903f3330354e99e0cb7b05debfa86"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-Other"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-J9JF-6FW4-2V2V
Vulnerability from github – Published: 2026-05-06 12:30 – Updated: 2026-05-08 15:31In the Linux kernel, the following vulnerability has been resolved:
xfs: remove xfs_attr_leaf_hasname
The calling convention of xfs_attr_leaf_hasname() is problematic, because it returns a NULL buffer when xfs_attr3_leaf_read fails, a valid buffer when xfs_attr3_leaf_lookup_int returns -ENOATTR or -EEXIST, and a non-NULL buffer pointer for an already released buffer when xfs_attr3_leaf_lookup_int fails with other error values.
Fix this by simply open coding xfs_attr_leaf_hasname in the callers, so that the buffer release code is done by each caller of xfs_attr3_leaf_read.
{
"affected": [],
"aliases": [
"CVE-2026-43153"
],
"database_specific": {
"cwe_ids": [],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2026-05-06T12:16:33Z",
"severity": "HIGH"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nxfs: remove xfs_attr_leaf_hasname\n\nThe calling convention of xfs_attr_leaf_hasname() is problematic, because\nit returns a NULL buffer when xfs_attr3_leaf_read fails, a valid buffer\nwhen xfs_attr3_leaf_lookup_int returns -ENOATTR or -EEXIST, and a\nnon-NULL buffer pointer for an already released buffer when\nxfs_attr3_leaf_lookup_int fails with other error values.\n\nFix this by simply open coding xfs_attr_leaf_hasname in the callers, so\nthat the buffer release code is done by each caller of\nxfs_attr3_leaf_read.",
"id": "GHSA-j9jf-6fw4-2v2v",
"modified": "2026-05-08T15:31:16Z",
"published": "2026-05-06T12:30:30Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43153"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/2fbc8421d1db102c0e5458607e042a23a03648b1"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/3a65ea768b8094e4699e72f9ab420eb9e0f3f568"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/457121c01f609b9934addbb04d5c1ef638c71c61"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/530082df991903f3330354e99e0cb7b05debfa86"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
]
}
MSRC_CVE-2026-43153
Vulnerability from csaf_microsoft - Published: 2026-05-07 01:07 - Updated: 2026-09-24 01:45OESA-2026-2871 (CVE-2026-31414)
Vulnerability from osv_openeuler – Published: 2026-07-06 11:11 – Updated: 2026-08-06 11:11 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_conntrack_expect: use expect->helper
Use expect->helper in ctnetlink and /proc to dump the helper name. Using nfct_help() without holding a reference to the master conntrack is unsafe.
Use exp->master->helper in ctnetlink path if userspace does not provide an explicit helper when creating an expectation to retain the existing behaviour. The ctnetlink expectation path holds the reference on the master conntrack and nf_conntrack_expect lock and the nfnetlink glue path refers to the master ct that is attached to the skb.(CVE-2026-31414)
In the Linux kernel, the following vulnerability has been resolved:
xfs: avoid dereferencing log items after push callbacks
After xfsaild_push_item() calls iop_push(), the log item may have been freed if the AIL lock was dropped during the push. Background inode reclaim or the dquot shrinker can free the log item while the AIL lock is not held, and the tracepoints in the switch statement dereference the log item after iop_push() returns.
Fix this by capturing the log item type, flags, and LSN before calling xfsaild_push_item(), and introducing a new xfs_ail_push_class trace event class that takes these pre-captured values and the ailp pointer instead of the log item pointer.(CVE-2026-31453)
In the Linux kernel, the following vulnerability has been resolved:
xfs: stop reclaim before pushing AIL during unmount
The unmount sequence in xfs_unmount_flush_inodes() pushed the AIL while background reclaim and inodegc are still running. This is broken independently of any use-after-free issues - background reclaim and inodegc should not be running while the AIL is being pushed during unmount, as inodegc can dirty and insert inodes into the AIL during the flush, and background reclaim can race to abort and free dirty inodes.
Reorder xfs_unmount_flush_inodes() to stop inodegc and cancel background reclaim before pushing the AIL. Stop inodegc before cancelling m_reclaim_work because the inodegc worker can re-queue m_reclaim_work via xfs_inodegc_set_reclaimable.(CVE-2026-31455)
In the Linux kernel, the following vulnerability has been resolved:
fs/smb/client: fix out-of-bounds read in cifs_sanitize_prepath
When cifs_sanitize_prepath is called with an empty string or a string containing only delimiters (e.g., "/"), the current logic attempts to check *(cursor2 - 1) before cursor2 has advanced. This results in an out-of-bounds read.
This patch adds an early exit check after stripping prepended delimiters. If no path content remains, the function returns NULL.
The bug was identified via manual audit and verified using a standalone test case compiled with AddressSanitizer, which triggered a SEGV on affected inputs.(CVE-2026-43112)
In the Linux kernel, the following vulnerability has been resolved:
xfs: remove xfs_attr_leaf_hasname
The calling convention of xfs_attr_leaf_hasname() is problematic, because it returns a NULL buffer when xfs_attr3_leaf_read fails, a valid buffer when xfs_attr3_leaf_lookup_int returns -ENOATTR or -EEXIST, and a non-NULL buffer pointer for an already released buffer when xfs_attr3_leaf_lookup_int fails with other error values.
Fix this by simply open coding xfs_attr_leaf_hasname in the callers, so that the buffer release code is done by each caller of xfs_attr3_leaf_read.(CVE-2026-43153)
In the Linux kernel, the following vulnerability has been resolved:
xfs: fix freemap adjustments when adding xattrs to leaf blocks
xfs/592 and xfs/794 both trip this assertion in the leaf block freemap adjustment code after ~20 minutes of running on my test VMs:
ASSERT(ichdr->firstused >= ichdr->count * sizeof(xfs_attr_leaf_entry_t) + xfs_attr3_leaf_hdr_size(leaf));
Upon enabling quite a lot more debugging code, I narrowed this down to fsstress trying to set a local extended attribute with namelen=3 and valuelen=71. This results in an entry size of 80 bytes.
At the start of xfs_attr3_leaf_add_work, the freemap looks like this:
i 0 base 448 size 0 rhs 448 count 46 i 1 base 388 size 132 rhs 448 count 46 i 2 base 2120 size 4 rhs 448 count 46 firstused = 520
where "rhs" is the first byte past the end of the leaf entry array. This is inconsistent -- the entries array ends at byte 448, but freemap[1] says there's free space starting at byte 388!
By the end of the function, the freemap is in worse shape:
i 0 base 456 size 0 rhs 456 count 47 i 1 base 388 size 52 rhs 456 count 47 i 2 base 2120 size 4 rhs 456 count 47 firstused = 440
Important note: 388 is not aligned with the entries array element size of 8 bytes.
Based on the incorrect freemap, the name area starts at byte 440, which is below the end of the entries array! That's why the assertion triggers and the filesystem shuts down.
How did we end up here? First, recall from the previous patch that the freemap array in an xattr leaf block is not intended to be a comprehensive map of all free space in the leaf block. In other words, it's perfectly legal to have a leaf block with:
- 376 bytes in use by the entries array
- freemap[0] has [base = 376, size = 8]
- freemap[1] has [base = 388, size = 1500]
- the space between 376 and 388 is free, but the freemap stopped tracking that some time ago
If we add one xattr, the entries array grows to 384 bytes, and freemap[0] becomes [base = 384, size = 0]. So far, so good. But if we add a second xattr, the entries array grows to 392 bytes, and freemap[0] gets pushed up to [base = 392, size = 0]. This is bad, because freemap[1] hasn't been updated, and now the entries array and the free space claim the same space.
The fix here is to adjust all freemap entries so that none of them collide with the entries array. Note that this fix relies on commit 2a2b5932db6758 ("xfs: fix attr leaf header freemap.size underflow") and the previous patch that resets zero length freemap entries to have base = 0.(CVE-2026-43158)
In the Linux kernel, the following vulnerability has been resolved:
smb: client: require a full NFS mode SID before reading mode bits
parse_dacl() treats an ACE SID matching sid_unix_NFS_mode as an NFS mode SID and reads sid.sub_auth[2] to recover the mode bits.
That assumes the ACE carries three subauthorities, but compare_sids() only compares min(a, b) subauthorities. A malicious server can return an ACE with num_subauth = 2 and sub_auth[] = {88, 3}, which still matches sid_unix_NFS_mode and then drives the sub_auth[2] read four bytes past the end of the ACE.
Require num_subauth >= 3 before treating the ACE as an NFS mode SID. This keeps the fix local to the special-SID mode path without changing compare_sids() semantics for the rest of cifsacl.(CVE-2026-43350)
In the Linux kernel, the following vulnerability has been resolved:
xfs: fix undersized l_iclog_roundoff values
If the superblock doesn't list a log stripe unit, we set the incore log roundoff value to 512. This leads to corrupt logs and unmountable filesystems in generic/617 on a disk with 4k physical sectors...
XFS (sda1): Mounting V5 Filesystem ff3121ca-26e6-4b77-b742-aaff9a449e1c XFS (sda1): Torn write (CRC failure) detected at log block 0x318e. Truncating head block from 0x3197. XFS (sda1): failed to locate log tail XFS (sda1): log mount/recovery failed: error -74 XFS (sda1): log mount failed XFS (sda1): Mounting V5 Filesystem ff3121ca-26e6-4b77-b742-aaff9a449e1c XFS (sda1): Ending clean mount
...on the current xfsprogs for-next which has a broken mkfs. xfs_info shows this...
meta-data=/dev/sda1 isize=512 agcount=4, agsize=644992 blks = sectsz=4096 attr=2, projid32bit=1 = crc=1 finobt=1, sparse=1, rmapbt=1 = reflink=1 bigtime=1 inobtcount=1 nrext64=1 = exchange=1 metadir=1 data = bsize=4096 blocks=2579968, imaxpct=25 = sunit=0 swidth=0 blks naming =version 2 bsize=4096 ascii-ci=0, ftype=1, parent=1 log =internal log bsize=4096 blocks=16384, version=2 = sectsz=4096 sunit=0 blks, lazy-count=1 realtime =none extsz=4096 blocks=0, rtextents=0 = rgcount=0 rgsize=268435456 extents = zoned=0 start=0 reserved=0
...observe that the log section has sectsz=4096 sunit=0, which means that the roundoff factor is 512, not 4096 as you'd expect. We should fix mkfs not to generate broken filesystems, but anyone can fuzz the ondisk superblock so we should be more cautious. I think the inadequate logic predates commit a6a65fef5ef8d0, but that's clearly going to require a different backport.(CVE-2026-43365)
In the Linux kernel, the following vulnerability has been resolved:
nvmet-tcp: fix race between ICReq handling and queue teardown
nvmet_tcp_handle_icreq() updates queue->state after sending an Initialization Connection Response (ICResp), but it does so without serializing against target-side queue teardown.
If an NVMe/TCP host sends an Initialization Connection Request (ICReq) and immediately closes the connection, target-side teardown may start in softirq context before io_work drains the already buffered ICReq. In that case, nvmet_tcp_schedule_release_queue() sets queue->state to NVMET_TCP_Q_DISCONNECTING and drops the queue reference under state_lock.
If io_work later processes that ICReq, nvmet_tcp_handle_icreq() can still overwrite the state back to NVMET_TCP_Q_LIVE. That defeats the DISCONNECTING-state guard in nvmet_tcp_schedule_release_queue() and allows a later socket state change to re-enter teardown and issue a second kref_put() on an already released queue.
The ICResp send failure path has the same problem. If teardown has already moved the queue to DISCONNECTING, a send error can still overwrite the state with NVMET_TCP_Q_FAILED, again reopening the window for a second teardown path to drop the queue reference.
Fix this by serializing both post-send state transitions with state_lock and bailing out if teardown has already started.
Use -ESHUTDOWN as an internal sentinel for that bail-out path rather than propagating it as a transport error like -ECONNRESET. Keep nvmet_tcp_socket_error() setting rcv_state to NVMET_TCP_RECV_ERR before honoring that sentinel so receive-side parsing stays quiesced until the existing release path completes.(CVE-2026-46135)
In the Linux kernel, the following vulnerability has been resolved:
scsi: target: configfs: Bound snprintf() return in tg_pt_gp_members_show()
target_tg_pt_gp_members_show() formats LUN paths with snprintf() into a 256-byte stack buffer, then will memcpy() cur_len bytes from that buffer. snprintf() returns the length the output would have had, which can exceed the buffer size when the fabric WWN is long because iSCSI IQN names can be up to 223 bytes. The check at the memcpy() site only guards the destination page write, not the source read, so memcpy() will read past the stack buffer and copy adjacent stack contents to the sysfs reader, which when CONFIG_FORTIFY_SOURCE is enabled, fortify_panic() will be triggered.
Commit 27e06650a5ea ("scsi: target: target_core_configfs: Add length check to avoid buffer overflow") added the same bound to the target_lu_gp_members_show() but the tg_pt_gp variant was missed so resolve that here.(CVE-2026-46149)
In the Linux kernel, the following vulnerability has been resolved:
sctp: revalidate list cursor after sctp_sendmsg_to_asoc() in SCTP_SENDALL
The SCTP_SENDALL path in sctp_sendmsg() iterates ep->asocs with list_for_each_entry_safe(), which caches the next entry in @tmp before the loop body runs. The body calls sctp_sendmsg_to_asoc(), which may drop the socket lock inside sctp_wait_for_sndbuf().
While the lock is dropped, another thread can SCTP_SOCKOPT_PEELOFF the association cached in @tmp, migrating it to a new endpoint via sctp_sock_migrate() (list_del_init() + list_add_tail() to newep->asocs), and optionally close the new socket which frees the association via kfree_rcu(). The cached @tmp can also be freed by a network ABORT for that association, processed in softirq while the lock is dropped.
sctp_wait_for_sndbuf() revalidates @asoc (the current entry) on re-lock via the "sk != asoc->base.sk" and "asoc->base.dead" checks, but nothing revalidates @tmp. After a successful return, the iterator advances to the stale @tmp, yielding either a use-after-free (if the peeled socket was closed) or a list-walk onto the new endpoint's list head (type confusion of &newep->asocs as a struct sctp_association *).
Both are reachable from CapEff=0; the type-confusion path gives controlled indirect call via the outqueue.sched->init_sid pointer.
Fix by re-deriving @tmp from @asoc after sctp_sendmsg_to_asoc() returns. @asoc is known to still be on ep->asocs at that point: the only callers that list_del an association from ep->asocs are sctp_association_free() (which sets asoc->base.dead) and sctp_assoc_migrate() (which changes asoc->base.sk), and sctp_wait_for_sndbuf() checks both under the lock before any successful return; a tripped check propagates as err < 0 and the loop bails before the re-derive.
The SCTP_ABORT path in sctp_sendmsg_check_sflags() returns 0 and the loop hits 'continue' before sctp_sendmsg_to_asoc() is ever called, so the @tmp cached by list_for_each_entry_safe() still covers the lock-held free that ba59fb027307 ("sctp: walk the list of asoc safely") was added for.(CVE-2026-46227)
In the Linux kernel, the following vulnerability has been resolved:
fs/fcntl: fix SOFTIRQ-unsafe lock order in fasync signaling
A SOFTIRQ-safe to SOFTIRQ-unsafe lock order deadlock can occur in send_sigio() and send_sigurg() when a process group receives a signal.
When FASYNC is configured for a process group (PIDTYPE_PGID), both functions use read_lock(&tasklist_lock) to traverse the task list. However, they are frequently called from softirq context: - send_sigio() via input_inject_event -> kill_fasync - send_sigurg() via tcp_check_urg -> sk_send_sigurg (NET_RX_SOFTIRQ)
The deadlock is caused by the rwlock writer fairness mechanism: 1. CPU 0 (process context) holds read_lock(&tasklist_lock) in do_wait(). 2. CPU 1 (process context) attempts write_lock(&tasklist_lock) in fork() or exit() and spins, which blocks all new readers. 3. CPU 0 is interrupted by a softirq (e.g., TCP URG packet reception). 4. The softirq calls send_sigurg() and attempts to acquire read_lock(&tasklist_lock), deadlocking because CPU 1 is waiting.
Since PID hashing and do_each_pid_task() traversals are already RCU-protected, the read_lock on tasklist_lock is no longer strictly required for safe traversal. Fix this by replacing tasklist_lock with rcu_read_lock(), aligning the process group signaling path with the single-PID path. This also mitigates a potential remote denial of service vector via TCP URG packets.
Lockdep splat:
WARNING: SOFTIRQ-safe -> SOFTIRQ-unsafe lock order detected [...] Chain exists of: &dev->event_lock --> &f_owner->lock --> tasklist_lock
Possible interrupt unsafe locking scenario: CPU0 CPU1 ---- ---- lock(tasklist_lock); local_irq_disable(); lock(&dev->event_lock); lock(&f_owner->lock); <Interrupt> lock(&dev->event_lock);
*** DEADLOCK ***(CVE-2026-52946)
In the Linux kernel, the following vulnerability has been resolved:
HID: usbhid: fix deadlock in hid_post_reset()
You can build a USB device that includes a HID component and a storage or UAS component. The components can be reset only together. That means that hid_pre_reset() and hid_post_reset() are in the block IO error handling. Hence no memory allocation used in them may do block IO because the IO can deadlock on the mutex held while resetting a device and calling the interface drivers. Use GFP_NOIO for all allocations in them.(CVE-2026-53037)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: l2cap: Add missing chan lock in l2cap_ecred_reconf_rsp
l2cap_ecred_reconf_rsp() calls l2cap_chan_del() without holding l2cap_chan_lock(). Every other l2cap_chan_del() caller in the file acquires the lock first. A remote BLE device can send a crafted L2CAP ECRED reconfiguration response to corrupt the channel list while another thread is iterating it.
Add l2cap_chan_hold() and l2cap_chan_lock() before l2cap_chan_del(), and l2cap_chan_unlock() and l2cap_chan_put() after, matching the pattern used in l2cap_ecred_conn_rsp() and l2cap_conn_del().(CVE-2026-53071)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"bpftool-debuginfo-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"kernel-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"kernel-debuginfo-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"kernel-debugsource-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"kernel-devel-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"kernel-headers-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"kernel-source-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"kernel-tools-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"kernel-tools-devel-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"perf-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"perf-debuginfo-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"python3-perf-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-321.0.0.223.oe2203sp4.aarch64.rpm"
],
"src": [
"kernel-5.10.0-321.0.0.223.oe2203sp4.src.rpm"
],
"x86_64": [
"bpftool-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"bpftool-debuginfo-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"kernel-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"kernel-debuginfo-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"kernel-debugsource-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"kernel-devel-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"kernel-headers-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"kernel-source-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"kernel-tools-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"kernel-tools-devel-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"perf-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"perf-debuginfo-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"python3-perf-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-321.0.0.223.oe2203sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-321.0.0.223.oe2203sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: nf_conntrack_expect: use expect-\u0026gt;helper\n\nUse expect-\u0026gt;helper in ctnetlink and /proc to dump the helper name.\nUsing nfct_help() without holding a reference to the master conntrack\nis unsafe.\n\nUse exp-\u0026gt;master-\u0026gt;helper in ctnetlink path if userspace does not provide\nan explicit helper when creating an expectation to retain the existing\nbehaviour. The ctnetlink expectation path holds the reference on the\nmaster conntrack and nf_conntrack_expect lock and the nfnetlink glue\npath refers to the master ct that is attached to the skb.(CVE-2026-31414)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfs: avoid dereferencing log items after push callbacks\n\nAfter xfsaild_push_item() calls iop_push(), the log item may have been\nfreed if the AIL lock was dropped during the push. Background inode\nreclaim or the dquot shrinker can free the log item while the AIL lock\nis not held, and the tracepoints in the switch statement dereference\nthe log item after iop_push() returns.\n\nFix this by capturing the log item type, flags, and LSN before calling\nxfsaild_push_item(), and introducing a new xfs_ail_push_class trace\nevent class that takes these pre-captured values and the ailp pointer\ninstead of the log item pointer.(CVE-2026-31453)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfs: stop reclaim before pushing AIL during unmount\n\nThe unmount sequence in xfs_unmount_flush_inodes() pushed the AIL while\nbackground reclaim and inodegc are still running. This is broken\nindependently of any use-after-free issues - background reclaim and\ninodegc should not be running while the AIL is being pushed during\nunmount, as inodegc can dirty and insert inodes into the AIL during the\nflush, and background reclaim can race to abort and free dirty inodes.\n\nReorder xfs_unmount_flush_inodes() to stop inodegc and cancel background\nreclaim before pushing the AIL. Stop inodegc before cancelling\nm_reclaim_work because the inodegc worker can re-queue m_reclaim_work\nvia xfs_inodegc_set_reclaimable.(CVE-2026-31455)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfs/smb/client: fix out-of-bounds read in cifs_sanitize_prepath\n\nWhen cifs_sanitize_prepath is called with an empty string or a string\ncontaining only delimiters (e.g., \u0026quot;/\u0026quot;), the current logic attempts to\ncheck *(cursor2 - 1) before cursor2 has advanced. This results in an\nout-of-bounds read.\n\nThis patch adds an early exit check after stripping prepended\ndelimiters. If no path content remains, the function returns NULL.\n\nThe bug was identified via manual audit and verified using a\nstandalone test case compiled with AddressSanitizer, which\ntriggered a SEGV on affected inputs.(CVE-2026-43112)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfs: remove xfs_attr_leaf_hasname\n\nThe calling convention of xfs_attr_leaf_hasname() is problematic, because\nit returns a NULL buffer when xfs_attr3_leaf_read fails, a valid buffer\nwhen xfs_attr3_leaf_lookup_int returns -ENOATTR or -EEXIST, and a\nnon-NULL buffer pointer for an already released buffer when\nxfs_attr3_leaf_lookup_int fails with other error values.\n\nFix this by simply open coding xfs_attr_leaf_hasname in the callers, so\nthat the buffer release code is done by each caller of\nxfs_attr3_leaf_read.(CVE-2026-43153)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfs: fix freemap adjustments when adding xattrs to leaf blocks\n\nxfs/592 and xfs/794 both trip this assertion in the leaf block freemap\nadjustment code after ~20 minutes of running on my test VMs:\n\n ASSERT(ichdr-\u0026gt;firstused \u0026gt;= ichdr-\u0026gt;count * sizeof(xfs_attr_leaf_entry_t)\n\t\t\t\t\t+ xfs_attr3_leaf_hdr_size(leaf));\n\nUpon enabling quite a lot more debugging code, I narrowed this down to\nfsstress trying to set a local extended attribute with namelen=3 and\nvaluelen=71. This results in an entry size of 80 bytes.\n\nAt the start of xfs_attr3_leaf_add_work, the freemap looks like this:\n\ni 0 base 448 size 0 rhs 448 count 46\ni 1 base 388 size 132 rhs 448 count 46\ni 2 base 2120 size 4 rhs 448 count 46\nfirstused = 520\n\nwhere \u0026quot;rhs\u0026quot; is the first byte past the end of the leaf entry array.\nThis is inconsistent -- the entries array ends at byte 448, but\nfreemap[1] says there\u0026apos;s free space starting at byte 388!\n\nBy the end of the function, the freemap is in worse shape:\n\ni 0 base 456 size 0 rhs 456 count 47\ni 1 base 388 size 52 rhs 456 count 47\ni 2 base 2120 size 4 rhs 456 count 47\nfirstused = 440\n\nImportant note: 388 is not aligned with the entries array element size\nof 8 bytes.\n\nBased on the incorrect freemap, the name area starts at byte 440, which\nis below the end of the entries array! That\u0026apos;s why the assertion\ntriggers and the filesystem shuts down.\n\nHow did we end up here? First, recall from the previous patch that the\nfreemap array in an xattr leaf block is not intended to be a\ncomprehensive map of all free space in the leaf block. In other words,\nit\u0026apos;s perfectly legal to have a leaf block with:\n\n * 376 bytes in use by the entries array\n * freemap[0] has [base = 376, size = 8]\n * freemap[1] has [base = 388, size = 1500]\n * the space between 376 and 388 is free, but the freemap stopped\n tracking that some time ago\n\nIf we add one xattr, the entries array grows to 384 bytes, and\nfreemap[0] becomes [base = 384, size = 0]. So far, so good. But if we\nadd a second xattr, the entries array grows to 392 bytes, and freemap[0]\ngets pushed up to [base = 392, size = 0]. This is bad, because\nfreemap[1] hasn\u0026apos;t been updated, and now the entries array and the free\nspace claim the same space.\n\nThe fix here is to adjust all freemap entries so that none of them\ncollide with the entries array. Note that this fix relies on commit\n2a2b5932db6758 (\u0026quot;xfs: fix attr leaf header freemap.size underflow\u0026quot;) and\nthe previous patch that resets zero length freemap entries to have\nbase = 0.(CVE-2026-43158)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsmb: client: require a full NFS mode SID before reading mode bits\n\nparse_dacl() treats an ACE SID matching sid_unix_NFS_mode as an NFS\nmode SID and reads sid.sub_auth[2] to recover the mode bits.\n\nThat assumes the ACE carries three subauthorities, but compare_sids()\nonly compares min(a, b) subauthorities. A malicious server can return\nan ACE with num_subauth = 2 and sub_auth[] = {88, 3}, which still\nmatches sid_unix_NFS_mode and then drives the sub_auth[2] read four\nbytes past the end of the ACE.\n\nRequire num_subauth \u0026gt;= 3 before treating the ACE as an NFS mode SID.\nThis keeps the fix local to the special-SID mode path without changing\ncompare_sids() semantics for the rest of cifsacl.(CVE-2026-43350)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfs: fix undersized l_iclog_roundoff values\n\nIf the superblock doesn\u0026apos;t list a log stripe unit, we set the incore log\nroundoff value to 512. This leads to corrupt logs and unmountable\nfilesystems in generic/617 on a disk with 4k physical sectors...\n\nXFS (sda1): Mounting V5 Filesystem ff3121ca-26e6-4b77-b742-aaff9a449e1c\nXFS (sda1): Torn write (CRC failure) detected at log block 0x318e. Truncating head block from 0x3197.\nXFS (sda1): failed to locate log tail\nXFS (sda1): log mount/recovery failed: error -74\nXFS (sda1): log mount failed\nXFS (sda1): Mounting V5 Filesystem ff3121ca-26e6-4b77-b742-aaff9a449e1c\nXFS (sda1): Ending clean mount\n\n...on the current xfsprogs for-next which has a broken mkfs. xfs_info\nshows this...\n\nmeta-data=/dev/sda1 isize=512 agcount=4, agsize=644992 blks\n = sectsz=4096 attr=2, projid32bit=1\n = crc=1 finobt=1, sparse=1, rmapbt=1\n = reflink=1 bigtime=1 inobtcount=1 nrext64=1\n = exchange=1 metadir=1\ndata = bsize=4096 blocks=2579968, imaxpct=25\n = sunit=0 swidth=0 blks\nnaming =version 2 bsize=4096 ascii-ci=0, ftype=1, parent=1\nlog =internal log bsize=4096 blocks=16384, version=2\n = sectsz=4096 sunit=0 blks, lazy-count=1\nrealtime =none extsz=4096 blocks=0, rtextents=0\n = rgcount=0 rgsize=268435456 extents\n = zoned=0 start=0 reserved=0\n\n...observe that the log section has sectsz=4096 sunit=0, which means\nthat the roundoff factor is 512, not 4096 as you\u0026apos;d expect. We should\nfix mkfs not to generate broken filesystems, but anyone can fuzz the\nondisk superblock so we should be more cautious. I think the inadequate\nlogic predates commit a6a65fef5ef8d0, but that\u0026apos;s clearly going to\nrequire a different backport.(CVE-2026-43365)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnvmet-tcp: fix race between ICReq handling and queue teardown\n\nnvmet_tcp_handle_icreq() updates queue-\u0026gt;state after sending an\nInitialization Connection Response (ICResp), but it does so without\nserializing against target-side queue teardown.\n\nIf an NVMe/TCP host sends an Initialization Connection Request\n(ICReq) and immediately closes the connection, target-side teardown\nmay start in softirq context before io_work drains the already\nbuffered ICReq. In that case, nvmet_tcp_schedule_release_queue()\nsets queue-\u0026gt;state to NVMET_TCP_Q_DISCONNECTING and drops the queue\nreference under state_lock.\n\nIf io_work later processes that ICReq, nvmet_tcp_handle_icreq() can\nstill overwrite the state back to NVMET_TCP_Q_LIVE. That defeats the\nDISCONNECTING-state guard in nvmet_tcp_schedule_release_queue() and\nallows a later socket state change to re-enter teardown and issue a\nsecond kref_put() on an already released queue.\n\nThe ICResp send failure path has the same problem. If teardown has\nalready moved the queue to DISCONNECTING, a send error can still\noverwrite the state with NVMET_TCP_Q_FAILED, again reopening the\nwindow for a second teardown path to drop the queue reference.\n\nFix this by serializing both post-send state transitions with\nstate_lock and bailing out if teardown has already started.\n\nUse -ESHUTDOWN as an internal sentinel for that bail-out path rather\nthan propagating it as a transport error like -ECONNRESET. Keep\nnvmet_tcp_socket_error() setting rcv_state to NVMET_TCP_RECV_ERR before\nhonoring that sentinel so receive-side parsing stays quiesced until the\nexisting release path completes.(CVE-2026-46135)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: target: configfs: Bound snprintf() return in tg_pt_gp_members_show()\n\ntarget_tg_pt_gp_members_show() formats LUN paths with snprintf() into a\n256-byte stack buffer, then will memcpy() cur_len bytes from that\nbuffer. snprintf() returns the length the output would have had, which\ncan exceed the buffer size when the fabric WWN is long because iSCSI IQN\nnames can be up to 223 bytes. The check at the memcpy() site only\nguards the destination page write, not the source read, so memcpy() will\nread past the stack buffer and copy adjacent stack contents to the sysfs\nreader, which when CONFIG_FORTIFY_SOURCE is enabled, fortify_panic()\nwill be triggered.\n\nCommit 27e06650a5ea (\u0026quot;scsi: target: target_core_configfs: Add length\ncheck to avoid buffer overflow\u0026quot;) added the same bound to the\ntarget_lu_gp_members_show() but the tg_pt_gp variant was missed so\nresolve that here.(CVE-2026-46149)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: revalidate list cursor after sctp_sendmsg_to_asoc() in SCTP_SENDALL\n\nThe SCTP_SENDALL path in sctp_sendmsg() iterates ep-\u0026gt;asocs with\nlist_for_each_entry_safe(), which caches the next entry in @tmp before\nthe loop body runs. The body calls sctp_sendmsg_to_asoc(), which may\ndrop the socket lock inside sctp_wait_for_sndbuf().\n\nWhile the lock is dropped, another thread can SCTP_SOCKOPT_PEELOFF the\nassociation cached in @tmp, migrating it to a new endpoint via\nsctp_sock_migrate() (list_del_init() + list_add_tail() to\nnewep-\u0026gt;asocs), and optionally close the new socket which frees the\nassociation via kfree_rcu(). The cached @tmp can also be freed by a\nnetwork ABORT for that association, processed in softirq while the\nlock is dropped.\n\nsctp_wait_for_sndbuf() revalidates @asoc (the current entry) on re-lock\nvia the \u0026quot;sk != asoc-\u0026gt;base.sk\u0026quot; and \u0026quot;asoc-\u0026gt;base.dead\u0026quot; checks, but nothing\nrevalidates @tmp. After a successful return, the iterator advances to\nthe stale @tmp, yielding either a use-after-free (if the peeled socket\nwas closed) or a list-walk onto the new endpoint\u0026apos;s list head (type\nconfusion of \u0026amp;newep-\u0026gt;asocs as a struct sctp_association *).\n\nBoth are reachable from CapEff=0; the type-confusion path gives\ncontrolled indirect call via the outqueue.sched-\u0026gt;init_sid pointer.\n\nFix by re-deriving @tmp from @asoc after sctp_sendmsg_to_asoc()\nreturns. @asoc is known to still be on ep-\u0026gt;asocs at that point: the\nonly callers that list_del an association from ep-\u0026gt;asocs are\nsctp_association_free() (which sets asoc-\u0026gt;base.dead) and\nsctp_assoc_migrate() (which changes asoc-\u0026gt;base.sk), and\nsctp_wait_for_sndbuf() checks both under the lock before any\nsuccessful return; a tripped check propagates as err \u0026lt; 0 and the loop\nbails before the re-derive.\n\nThe SCTP_ABORT path in sctp_sendmsg_check_sflags() returns 0 and the\nloop hits \u0026apos;continue\u0026apos; before sctp_sendmsg_to_asoc() is ever called, so\nthe @tmp cached by list_for_each_entry_safe() still covers the\nlock-held free that ba59fb027307 (\u0026quot;sctp: walk the list of asoc\nsafely\u0026quot;) was added for.(CVE-2026-46227)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfs/fcntl: fix SOFTIRQ-unsafe lock order in fasync signaling\n\nA SOFTIRQ-safe to SOFTIRQ-unsafe lock order deadlock can occur in\nsend_sigio() and send_sigurg() when a process group receives a signal.\n\nWhen FASYNC is configured for a process group (PIDTYPE_PGID), both\nfunctions use read_lock(\u0026amp;tasklist_lock) to traverse the task list.\nHowever, they are frequently called from softirq context:\n- send_sigio() via input_inject_event -\u0026gt; kill_fasync\n- send_sigurg() via tcp_check_urg -\u0026gt; sk_send_sigurg (NET_RX_SOFTIRQ)\n\nThe deadlock is caused by the rwlock writer fairness mechanism:\n1. CPU 0 (process context) holds read_lock(\u0026amp;tasklist_lock) in do_wait().\n2. CPU 1 (process context) attempts write_lock(\u0026amp;tasklist_lock) in\n fork() or exit() and spins, which blocks all new readers.\n3. CPU 0 is interrupted by a softirq (e.g., TCP URG packet reception).\n4. The softirq calls send_sigurg() and attempts to acquire\n read_lock(\u0026amp;tasklist_lock), deadlocking because CPU 1 is waiting.\n\nSince PID hashing and do_each_pid_task() traversals are already\nRCU-protected, the read_lock on tasklist_lock is no longer strictly\nrequired for safe traversal. Fix this by replacing tasklist_lock with\nrcu_read_lock(), aligning the process group signaling path with the\nsingle-PID path. This also mitigates a potential remote denial of\nservice vector via TCP URG packets.\n\nLockdep splat:\n=====================================================\nWARNING: SOFTIRQ-safe -\u0026gt; SOFTIRQ-unsafe lock order detected\n[...]\nChain exists of:\n \u0026amp;dev-\u0026gt;event_lock --\u0026gt; \u0026amp;f_owner-\u0026gt;lock --\u0026gt; tasklist_lock\n\nPossible interrupt unsafe locking scenario:\n CPU0 CPU1\n ---- ----\n lock(tasklist_lock);\n local_irq_disable();\n lock(\u0026amp;dev-\u0026gt;event_lock);\n lock(\u0026amp;f_owner-\u0026gt;lock);\n \u0026lt;Interrupt\u0026gt;\n lock(\u0026amp;dev-\u0026gt;event_lock);\n\n*** DEADLOCK ***(CVE-2026-52946)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nHID: usbhid: fix deadlock in hid_post_reset()\n\nYou can build a USB device that includes a HID component\nand a storage or UAS component. The components can be reset\nonly together. That means that hid_pre_reset() and hid_post_reset()\nare in the block IO error handling. Hence no memory allocation\nused in them may do block IO because the IO can deadlock\non the mutex held while resetting a device and calling the\ninterface drivers.\nUse GFP_NOIO for all allocations in them.(CVE-2026-53037)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBluetooth: l2cap: Add missing chan lock in l2cap_ecred_reconf_rsp\n\nl2cap_ecred_reconf_rsp() calls l2cap_chan_del() without holding\nl2cap_chan_lock(). Every other l2cap_chan_del() caller in the file\nacquires the lock first. A remote BLE device can send a crafted\nL2CAP ECRED reconfiguration response to corrupt the channel list\nwhile another thread is iterating it.\n\nAdd l2cap_chan_hold() and l2cap_chan_lock() before l2cap_chan_del(),\nand l2cap_chan_unlock() and l2cap_chan_put() after, matching the\npattern used in l2cap_ecred_conn_rsp() and l2cap_conn_del().(CVE-2026-53071)",
"id": "OESA-2026-2871",
"modified": "2026-08-06T11:11:47Z",
"published": "2026-07-06T11:11:47Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2026-2871"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31414"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31453"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31455"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43112"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43153"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43158"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43350"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43365"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46135"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46149"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46227"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-52946"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53037"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53071"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2026-31414",
"CVE-2026-31453",
"CVE-2026-31455",
"CVE-2026-43112",
"CVE-2026-43153",
"CVE-2026-43158",
"CVE-2026-43350",
"CVE-2026-43365",
"CVE-2026-46135",
"CVE-2026-46149",
"CVE-2026-46227",
"CVE-2026-52946",
"CVE-2026-53037",
"CVE-2026-53071"
]
}
OESA-2026-3454 (CVE-2026-43153)
Vulnerability from osv_openeuler – Published: 2026-08-20 09:59 – Updated: 2026-08-20 09:59 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
xfs: remove xfs_attr_leaf_hasname
The calling convention of xfs_attr_leaf_hasname() is problematic, because it returns a NULL buffer when xfs_attr3_leaf_read fails, a valid buffer when xfs_attr3_leaf_lookup_int returns -ENOATTR or -EEXIST, and a non-NULL buffer pointer for an already released buffer when xfs_attr3_leaf_lookup_int fails with other error values.
Fix this by simply open coding xfs_attr_leaf_hasname in the callers, so that the buffer release code is done by each caller of xfs_attr3_leaf_read.(CVE-2026-43153)
In the Linux kernel, the following vulnerability has been resolved:
x86/kexec: Disable KCOV instrumentation after load_segments()
The load_segments() function changes segment registers, invalidating GS base (which KCOV relies on for per-cpu data). When CONFIG_KCOV is enabled, any subsequent instrumented C code call (e.g. native_gdt_invalidate()) begins crashing the kernel in an endless loop.
To reproduce the problem, it's sufficient to do kexec on a KCOV-instrumented kernel:
$ kexec -l /boot/otherKernel $ kexec -e
The real-world context for this problem is enabling crash dump collection in syzkaller. For this, the tool loads a panic kernel before fuzzing and then calls makedumpfile after the panic. This workflow requires both CONFIG_KEXEC and CONFIG_KCOV to be enabled simultaneously.
Adding safeguards directly to the KCOV fast-path (__sanitizer_cov_trace_pc()) is also undesirable as it would introduce an extra performance overhead.
Disabling instrumentation for the individual functions would be too fragile, so disable KCOV instrumentation for the entire machine_kexec_64.c and physaddr.c. If coverage-guided fuzzing ever needs these components in the future, other approaches should be considered.
The problem is not relevant for 32 bit kernels as CONFIG_KCOV is not supported there.
bp: Space out comment for better readability.
In the Linux kernel, the following vulnerability has been resolved:
apparmor: Fix & Optimize table creation from possibly unaligned memory
Source blob may come from userspace and might be unaligned. Try to optize the copying process by avoiding unaligned memory accesses.
- Added Fixes tag
- Added "Fix &" to description as this doesn't just optimize but fixes a potential unaligned memory access jj: remove duplicate word "convert" in comment trigger checkpatch warning
In the Linux kernel, the following vulnerability has been resolved:
nvmet-tcp: fix race between ICReq handling and queue teardown
nvmet_tcp_handle_icreq() updates queue->state after sending an Initialization Connection Response (ICResp), but it does so without serializing against target-side queue teardown.
If an NVMe/TCP host sends an Initialization Connection Request (ICReq) and immediately closes the connection, target-side teardown may start in softirq context before io_work drains the already buffered ICReq. In that case, nvmet_tcp_schedule_release_queue() sets queue->state to NVMET_TCP_Q_DISCONNECTING and drops the queue reference under state_lock.
If io_work later processes that ICReq, nvmet_tcp_handle_icreq() can still overwrite the state back to NVMET_TCP_Q_LIVE. That defeats the DISCONNECTING-state guard in nvmet_tcp_schedule_release_queue() and allows a later socket state change to re-enter teardown and issue a second kref_put() on an already released queue.
The ICResp send failure path has the same problem. If teardown has already moved the queue to DISCONNECTING, a send error can still overwrite the state with NVMET_TCP_Q_FAILED, again reopening the window for a second teardown path to drop the queue reference.
Fix this by serializing both post-send state transitions with state_lock and bailing out if teardown has already started.
Use -ESHUTDOWN as an internal sentinel for that bail-out path rather than propagating it as a transport error like -ECONNRESET. Keep nvmet_tcp_socket_error() setting rcv_state to NVMET_TCP_RECV_ERR before honoring that sentinel so receive-side parsing stays quiesced until the existing release path completes.(CVE-2026-46135)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_tables: use list_del_rcu for netlink hooks
nft_netdev_unregister_hooks and __nft_unregister_flowtable_net_hooks need to use list_del_rcu(), this list can be walked by concurrent dumpers.
Add a new helper and use it consistently.(CVE-2026-46324)
In the Linux kernel, the following vulnerability has been resolved:
RDMA: During rereg_mr ensure that REREG_ACCESS is compatible
If IB_MR_REREG_ACCESS changes from RO to RW then the umem has to be re-evaluated to ensure it is properly pinned as RW. Since the umem is hidden inside each driver's mr struct add a ib_umem_check_rereg() function that each driver has to call before processing IB_MR_REREG_ACCESS.
mlx4 has to retain its duplicate ib_access_writable check because it implements IB_MR_REREG_ACCESS | IB_MR_REREG_TRANS by changing both items in place sequentially while the MR is live, so it will continue to not support this combination.(CVE-2026-52908)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: serialize accept_q access
bt_sock_poll() walks the accept queue without synchronization, while child teardown can unlink the same socket and drop its last reference. The unsynchronized accept queue walk has existed since the initial Bluetooth import.
Protect accept_q with a dedicated lock for queue updates and polling. Also rework bt_accept_dequeue() to take temporary child references under the queue lock before dropping it and locking the child socket.(CVE-2026-52918)
In the Linux kernel, the following vulnerability has been resolved:
ipc: limit next_id allocation to the valid ID range
The checkpoint/restore sysctl path can request the next SysV IPC id through ids->next_id. ipc_idr_alloc() currently forwards that request to idr_alloc() with an open-ended upper bound.
If the valid tail of the SysV IPC id space is full, the allocation can spill beyond ipc_mni. The returned SysV IPC id still uses the normal index encoding, so later lookup and removal can target the wrong slot. This leaves the real IDR entry behind and breaks the IDR state for the object.
The bug is in ipc_idr_alloc() in the checkpoint/restore path.
-
ids->next_id is passed to:
idr_alloc(&ids->ipcs_idr, new, ipcid_to_idx(next_id), 0, ...)
-
The zero upper bound makes the allocation effectively open-ended. Once the valid SysV IPC tail is occupied, idr_alloc() can spill past ipc_mni and allocate an entry beyond the valid IPC id range.
-
The new object id is still encoded with the narrower SysV IPC index width:
new->id = (new->seq << ipcmni_seq_shift()) + idx
-
Later removal goes through ipc_rmid(), which uses:
ipcid_to_idx(ipcp->id)
That truncates the real IDR index. An object actually stored at a high index can then be removed as if it lived at a low in-range index.
-
For shared memory, shm_destroy() frees the current object anyway, but the real high IDR slot is left behind as a dangling pointer.
-
A subsequent walk of /proc/sysvipc/shm reaches the stale IDR entry and dereferences freed memory.
Prevent this by bounding the requested allocation to ipc_mni so the checkpoint/restore path fails once the valid range is exhausted.(CVE-2026-52923)
In the Linux kernel, the following vulnerability has been resolved:
ipc/shm: serialize orphan cleanup with shm_nattch updates
shm_destroy_orphaned() walks the shm idr under shm_ids(ns).rwsem, but that does not serialize all fields tested by shm_may_destroy(). In particular, shm_nattch is updated while holding shm_perm.lock, and attach paths can do that without holding the rwsem.
Do not decide that an orphaned segment is unused before taking the object lock. Move the shm_may_destroy() check under shm_perm.lock, matching the other destroy paths, and unlock the segment when it no longer qualifies for removal.(CVE-2026-52930)
In the Linux kernel, the following vulnerability has been resolved:
i2c: dev: prevent integer overflow in I2C_TIMEOUT ioctl
While fuzzing with Syzkaller, a persistent schedule_timeout: wrong
timeout value warning was observed, accompanied by SMBus controller
state machine corruption.
The I2C_TIMEOUT ioctl accepts a user-provided timeout in multiples of 10 ms. The user argument is checked against INT_MAX, but it is subsequently multiplied by 10 before being passed to msecs_to_jiffies().
A malicious user can pass a large value (e.g., 429496729) that passes
the arg > INT_MAX check but overflows when multiplied by 10. This
results in a truncated 32-bit unsigned value that bypasses the
internal (int)m < 0 check in msecs_to_jiffies().
The truncated value is then assigned to client->adapter->timeout
(a signed 32-bit int), which is reinterpreted as a negative number.
When passed to wait_for_completion_timeout(), this negative value
undergoes sign extension to a 64-bit unsigned long, triggering the
schedule_timeout warning and causing premature returns. This leaves
the SMBus state machine in an unrecoverable state, constituting a
local Denial of Service (DoS).
Fix this by bounding the user argument to INT_MAX / 10.
In the Linux kernel, the following vulnerability has been resolved:
iommu/vt-d: Fix oops due to out of scope access
Below oops triggers when kill QEMU process:
Oops: general protection fault, probably for non-canonical address 0x7fffffff844eaaa7: 0000 [#1] SMP NOPTI Call Trace: <TASK> do_raw_spin_lock+0xaa/0xc0 _raw_spin_lock_irqsave+0x21/0x40 domain_remove_dev_pasid+0x52/0x160 intel_nested_set_dev_pasid+0x1b9/0x1e0 __iommu_set_group_pasid+0x56/0x120 pci_dev_reset_iommu_done+0xe3/0x180 pcie_flr+0x65/0x160 __pci_reset_function_locked+0x5b/0x120 vfio_pci_core_close_device+0x63/0xe0 [vfio_pci_core] vfio_df_close+0x4f/0xa0 vfio_df_unbind_iommufd+0x2d/0x60 vfio_device_fops_release+0x3e/0x40 __fput+0xe5/0x2c0 task_work_run+0x58/0xa0 do_exit+0x2c8/0x600 do_group_exit+0x2f/0xa0 get_signal+0x863/0x8c0 arch_do_signal_or_restart+0x24/0x100 exit_to_user_mode_loop+0x87/0x380 do_syscall_64+0x2ff/0x11e0 entry_SYSCALL_64_after_hwframe+0x76/0x7e
The global static blocked domain is a dummy domain without corresponding dmar_domain structure, accessing beyond iommu_domain structure triggers oops easily. Fix it by return early in domain_remove_dev_pasid() like identity domain.(CVE-2026-52953)
In the Linux kernel, the following vulnerability has been resolved:
ceph: fix BUG_ON in __ceph_build_xattrs_blob() due to stale blob size
The generic/642 test-case can reproduce the kernel crash:
[40243.605254] ------------[ cut here ]------------ [40243.605956] kernel BUG at fs/ceph/xattr.c:918! [40243.607142] Oops: invalid opcode: 0000 [#1] SMP PTI [40243.608067] CPU: 7 UID: 0 PID: 498762 Comm: kworker/7:1 Not tainted 7.0.0-rc7+ #3 PREEMPT(full) [40243.609700] Hardware name: QEMU Ubuntu 25.10 PC v2 (i440FX + PIIX, + 10.1 machine, 1996), BIOS 1.16.3-debian-1.16.3-2 04/01/2014 [40243.611820] Workqueue: ceph-msgr ceph_con_workfn [40243.612715] RIP: 0010:__ceph_build_xattrs_blob+0x1b8/0x1e0 [40243.613731] Code: 0f 84 82 fe ff ff e9 cf 8e 56 ff 48 8d 65 e8 31 c0 5b 41 5c 41 5d 5d 31 d2 31 c9 31 f6 31 ff 45 31 c0 45 31 c9 c3 cc cc cc cc <0f> 0b 4c 8b 62 08 41 8b 85 24 07 00 00 49 83 c4 04 41 89 44 24 fc [40243.616888] RSP: 0018:ffffcc80c4d4b688 EFLAGS: 00010287 [40243.617773] RAX: 0000000000010026 RBX: 0000000000000001 RCX: 0000000000000000 [40243.618928] RDX: ffff8a773798dee0 RSI: 0000000000000000 RDI: 0000000000000000 [40243.620158] RBP: ffffcc80c4d4b6a0 R08: 0000000000000000 R09: 0000000000000000 [40243.621573] R10: 0000000000000000 R11: 0000000000000000 R12: ffff8a75f3b58000 [40243.622907] R13: ffff8a75f3b58000 R14: 0000000000000080 R15: 000000000000bffd [40243.624054] FS: 0000000000000000(0000) GS:ffff8a787d1b4000(0000) knlGS:0000000000000000 [40243.625331] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [40243.626269] CR2: 000072f390b623c0 CR3: 000000011c02a003 CR4: 0000000000372ef0 [40243.627408] Call Trace: [40243.627839] <TASK> [40243.628188] __prep_cap+0x3fd/0x4a0 [40243.628789] ? do_raw_spin_unlock+0x4e/0xe0 [40243.629474] ceph_check_caps+0x46a/0xc80 [40243.630094] ? __lock_acquire+0x4a2/0x2650 [40243.630773] ? find_held_lock+0x31/0x90 [40243.631347] ? handle_cap_grant+0x79f/0x1060 [40243.632068] ? lock_release+0xd9/0x300 [40243.632696] ? __mutex_unlock_slowpath+0x3e/0x340 [40243.633429] ? lock_release+0xd9/0x300 [40243.634052] handle_cap_grant+0xcf6/0x1060 [40243.634745] ceph_handle_caps+0x122b/0x2110 [40243.635415] mds_dispatch+0x5bd/0x2160 [40243.636034] ? ceph_con_process_message+0x65/0x190 [40243.636828] ? lock_release+0xd9/0x300 [40243.637431] ceph_con_process_message+0x7a/0x190 [40243.638184] ? kfree+0x311/0x4f0 [40243.638749] ? kfree+0x311/0x4f0 [40243.639268] process_message+0x16/0x1a0 [40243.639915] ? sg_free_table+0x39/0x90 [40243.640572] ceph_con_v2_try_read+0xf58/0x2120 [40243.641255] ? lock_acquire+0xc8/0x300 [40243.641863] ceph_con_workfn+0x151/0x820 [40243.642493] process_one_work+0x22f/0x630 [40243.643093] ? process_one_work+0x254/0x630 [40243.643770] worker_thread+0x1e2/0x400 [40243.644332] ? __pfx_worker_thread+0x10/0x10 [40243.645020] kthread+0x109/0x140 [40243.645560] ? __pfx_kthread+0x10/0x10 [40243.646125] ret_from_fork+0x3f8/0x480 [40243.646752] ? __pfx_kthread+0x10/0x10 [40243.647316] ? __pfx_kthread+0x10/0x10 [40243.647919] ret_from_fork_asm+0x1a/0x30 [40243.648556] </TASK> [40243.648902] Modules linked in: overlay hctr2 libpolyval chacha libchacha adiantum libnh libpoly1305 essiv intel_rapl_msr intel_rapl_common intel_uncore_frequency_common skx_edac_common nfit kvm_intel kvm irqbypass joydev ghash_clmulni_intel aesni_intel rapl input_leds mac_hid psmouse vga16fb serio_raw vgastate floppy i2c_piix4 pata_acpi bochs qemu_fw_cfg i2c_smbus sch_fq_codel rbd dm_crypt msr parport_pc ppdev lp parport efi_pstore [40243.654766] ---[ end trace 0000000000000000 ]---
Commit d93231a6bc8a ("ceph: prevent a client from exceeding the MDS maximum xattr size") moved the required_blob_size computation to before the __build_xattrs() call, introducing a race.
__build_xattrs() releases and reacquires i_ceph_lock during execution. In that window, handle_cap_grant() may update i_xattrs.blob with a newer MDS-provided blob and bump i_xattrs.version. When __bui ---truncated---(CVE-2026-52961)
In the Linux kernel, the following vulnerability has been resolved:
fsnotify: fix inode reference leak in fsnotify_recalc_mask()
fsnotify_recalc_mask() fails to handle the return value of __fsnotify_recalc_mask(), which may return an inode pointer that needs to be released via fsnotify_drop_object() when the connector's HAS_IREF flag transitions from set to cleared.
This manifests as a hung task with the following call trace:
INFO: task umount:1234 blocked for more than 120 seconds. Call Trace: __schedule schedule fsnotify_sb_delete generic_shutdown_super kill_anon_super cleanup_mnt task_work_run do_exit do_group_exit
The race window that triggers the iref leak:
Thread A (adding mark) Thread B (removing mark) ────────────────────── ──────────────────────── fsnotify_add_mark_locked(): fsnotify_add_mark_list(): spin_lock(conn->lock) add mark_B(evictable) to list spin_unlock(conn->lock) return
/* ---- gap: no lock held ---- */
fsnotify_detach_mark(mark_A):
spin_lock(mark_A->lock)
clear ATTACHED flag on mark_A
spin_unlock(mark_A->lock)
fsnotify_put_mark(mark_A)
fsnotify_recalc_mask():
spin_lock(conn->lock)
__fsnotify_recalc_mask():
/* mark_A skipped: ATTACHED cleared */
/* only mark_B(evictable) remains */
want_iref = false
has_iref = true /* not yet cleared */
-> HAS_IREF transitions true -> false
-> returns inode pointer
spin_unlock(conn->lock)
/* BUG: return value discarded!
* iput() and fsnotify_put_sb_watched_objects()
* are never called */
Fix this by deferring the transition true -> false of HAS_IREF flag from fsnotify_recalc_mask() (Thread A) to fsnotify_put_mark() (thread B).(CVE-2026-52990)
In the Linux kernel, the following vulnerability has been resolved:
erofs: unify lcn as u64 for 32-bit platforms
As sashiko reported [1], lcn was typed as unsigned long (or
unsigned int sometimes), which is only 32 bits wide on 32-bit
platforms, which causes (lcn << lclusterbits) to be truncated
at 4 GiB.
In order to consolidate the logic, just use u64 consistently
around the codebase.
[1] https://sashiko.dev/r/20260420034612.1899973-1-hsiangkao%40linux.alibaba.com(CVE-2026-53015)
In the Linux kernel, the following vulnerability has been resolved:
iommu/amd: Fix clone_alias() to use the original device's devid
Currently clone_alias() assumes first argument (pdev) is always the original device pointer. This function is called by pci_for_each_dma_alias() which based on topology decides to send original or alias device details in first argument.
This meant that the source devid used to look up and copy the DTE may be incorrect, leading to wrong or stale DTE entries being propagated to alias device.
Fix this by passing the original pdev as the opaque data argument to both the direct clone_alias() call and pci_for_each_dma_alias(). Inside clone_alias(), retrieve the original device from data and compute devid from it.(CVE-2026-53053)
In the Linux kernel, the following vulnerability has been resolved:
USB: serial: kl5kusb105: fix bulk-out buffer overflow
klsi_105_prepare_write_buffer() is called by the generic write path with the bulk-out buffer and its size (bulk_out_size, 64 bytes). It stores a two-byte length header at the start of the buffer and copies the payload from the write fifo starting at buf + KLSI_HDR_LEN, but passes the full buffer size as the number of bytes to copy:
count = kfifo_out_locked(&port->write_fifo, buf + KLSI_HDR_LEN, size, &port->lock);
When the fifo holds at least size bytes, size bytes are copied starting two bytes into the size-byte buffer, writing KLSI_HDR_LEN bytes past its end. Copy at most size - KLSI_HDR_LEN bytes instead, leaving room for the header as safe_serial already does.
Writing bulk_out_size or more bytes to the tty triggers a slab out-of-bounds write, observed with KASAN by emulating the device with dummy_hcd and raw-gadget:
BUG: KASAN: slab-out-of-bounds in kfifo_copy_out+0x83/0xc0 Write of size 64 at addr ffff888112c62202 by task python3 kfifo_copy_out klsi_105_prepare_write_buffer [kl5kusb105] usb_serial_generic_write_start [usbserial] Allocated by task 139: usb_serial_probe [usbserial] The buggy address is located 2 bytes inside of allocated 64-byte region
The out-of-bounds write no longer occurs with this change applied.(CVE-2026-53194)
In the Linux kernel, the following vulnerability has been resolved:
USB: serial: io_ti: fix heap overflow in get_manuf_info()
get_manuf_info() reads le16_to_cpu(rom_desc->Size) bytes from the device I2C EEPROM into a buffer allocated with kmalloc_obj(), which is sizeof(struct edge_ti_manuf_descriptor) = 10 bytes.
The Size field comes from the device and is only validated (in check_i2c_image()) to make sure the descriptor fits within TI_MAX_I2C_SIZE (16384 bytes), not against the destination buffer size. A malicious USB device can therefore set Size to any value up to 16377, causing a heap overflow of up to 16367 bytes when plugged into a host running this driver.
valid_csum() is called after read_rom() and also iterates buffer[0..Size-1], compounding the out-of-bounds access.
Fix by rejecting descriptors with unexpected length before calling read_rom().
johan: amend commit message; also check for short descriptors
In the Linux kernel, the following vulnerability has been resolved:
l2tp: pppol2tp: hold reference to session in pppol2tp_ioctl()
pppol2tp_ioctl() read sock->sk->sk_user_data directly without any locks or reference counting. If a controllable sleep was induced during copy_from_user() (e.g. via a userfaultfd page fault sleep), a concurrent socket close could trigger pppol2tp_session_close() asynchronously. This frees the l2tp_session structure via the l2tp_session_del_work workqueue. Upon resuming, the ioctl thread dereferences the stale session pointer, resulting in a Use-After-Free (UAF).
Fix this by securely fetching the session reference using the RCU-safe, refcounted helper pppol2tp_sock_to_session(sk) on entry. This locks the session's refcount across the sleep. We structured the function to exit via standard err breaks, guaranteeing that l2tp_session_put() is cleanly called on all return paths to drop the reference.
To preserve existing behavior we validate the session and its magic signature only for the specific L2TP commands that require it. This ensures that generic/unknown ioctls called on an unconnected socket still return -ENOIOCTLCMD and correctly fall back to generic handlers (e.g. in sock_do_ioctl()).(CVE-2026-53262)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Wrap DCN32 phantom-plane allocation in DC_RUN_WITH_PREEMPTION_ENABLED
[Why] dcn32_validate_bandwidth() wraps dcn32_internal_validate_bw() with DC_FP_START()/DC_FP_END(). In x86 non-RT, DC_FP_START takes fpregs_lock(), which disables local softirqs.
The DML1 path through dcn32_enable_phantom_plane() calls kvzalloc() to allocate ~335 KiB for dc_plane_state. This triggers the vmalloc path, which calls BUG_ON(in_interrupt()) because it's invoked within the FPU-enabled (softirq disabled) region, leading to a kernel crash.
[How] Wrap the dc_state_create_phantom_plane() call with the DC_RUN_WITH_PREEMPTION_ENABLED() macro to allow preemption during this memory allocation.
(cherry picked from commit 885ccbef7b94a8b38f69c4211c679021aa27ad11)(CVE-2026-53285)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Avoid NULL dereference in dc_dmub_srv error paths
In dc_dmub_srv_log_diagnostic_data() and dc_dmub_srv_enable_dpia_trace().
Both functions check:
if (!dc_dmub_srv || !dc_dmub_srv->dmub)
and then call DC_LOG_ERROR() inside that block.
DC_LOG_ERROR() uses dc_dmub_srv->ctx internally. So if dc_dmub_srv is NULL, the logging itself can dereference a NULL pointer and cause a crash.
Fix this by splitting the checks.
First check if dc_dmub_srv is NULL and return immediately. Then check dc_dmub_srv->dmub and log the error only when dc_dmub_srv is valid.
Fixes the below: ../display/dc/dc_dmub_srv.c:962 dc_dmub_srv_log_diagnostic_data() error: we previously assumed 'dc_dmub_srv' could be null (see line 961) ../display/dc/dc_dmub_srv.c:1167 dc_dmub_srv_enable_dpia_trace() error: we previously assumed 'dc_dmub_srv' could be null (see line 1166)(CVE-2026-53313)
In the Linux kernel, the following vulnerability has been resolved:
padata: Put CPU offline callback in ONLINE section to allow failure
syzbot reported the following warning:
DEAD callback error for CPU1
WARNING: kernel/cpu.c:1463 at _cpu_down+0x759/0x1020 kernel/cpu.c:1463, CPU#0: syz.0.1960/14614
at commit 4ae12d8bd9a8 ("Merge tag 'kbuild-fixes-7.0-2' of git://git.kernel.org/pub/scm/linux/kernel/git/kbuild/linux") which tglx traced to padata_cpu_dead() given it's the only sub-CPUHP_TEARDOWN_CPU callback that returns an error.
Failure isn't allowed in hotplug states before CPUHP_TEARDOWN_CPU so move the CPU offline callback to the ONLINE section where failure is possible.(CVE-2026-53314)
In the Linux kernel, the following vulnerability has been resolved:
drm/virtio: Fix driver removal with disabled KMS
DRM atomic and modesetting aren't initialized if virtio-gpu driver built with disabled KMS, leading to access of uninitialized data on driver removal/unbinding and crashing kernel. Fix it by skipping shutting down atomic core with unavailable KMS.(CVE-2026-53347)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"bpftool-debuginfo-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"kernel-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"kernel-debuginfo-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"kernel-debugsource-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"kernel-devel-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"kernel-headers-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"kernel-source-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"kernel-tools-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"kernel-tools-debuginfo-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"kernel-tools-devel-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"perf-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"perf-debuginfo-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"python3-perf-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm",
"python3-perf-debuginfo-6.6.0-145.1.22.159.oe2403sp1.aarch64.rpm"
],
"src": [
"kernel-6.6.0-145.1.22.159.oe2403sp1.src.rpm"
],
"x86_64": [
"bpftool-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"bpftool-debuginfo-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"kernel-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"kernel-debuginfo-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"kernel-debugsource-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"kernel-devel-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"kernel-headers-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"kernel-source-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"kernel-tools-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"kernel-tools-debuginfo-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"kernel-tools-devel-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"perf-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"perf-debuginfo-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"python3-perf-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm",
"python3-perf-debuginfo-6.6.0-145.1.22.159.oe2403sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:24.03-LTS-SP1",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-24.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "6.6.0-145.1.22.159.oe2403sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfs: remove xfs_attr_leaf_hasname\n\nThe calling convention of xfs_attr_leaf_hasname() is problematic, because\nit returns a NULL buffer when xfs_attr3_leaf_read fails, a valid buffer\nwhen xfs_attr3_leaf_lookup_int returns -ENOATTR or -EEXIST, and a\nnon-NULL buffer pointer for an already released buffer when\nxfs_attr3_leaf_lookup_int fails with other error values.\n\nFix this by simply open coding xfs_attr_leaf_hasname in the callers, so\nthat the buffer release code is done by each caller of\nxfs_attr3_leaf_read.(CVE-2026-43153)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nx86/kexec: Disable KCOV instrumentation after load_segments()\n\nThe load_segments() function changes segment registers, invalidating GS base\n(which KCOV relies on for per-cpu data). When CONFIG_KCOV is enabled, any\nsubsequent instrumented C code call (e.g. native_gdt_invalidate()) begins\ncrashing the kernel in an endless loop.\n\nTo reproduce the problem, it\u0026apos;s sufficient to do kexec on a KCOV-instrumented\nkernel:\n\n $ kexec -l /boot/otherKernel\n $ kexec -e\n\nThe real-world context for this problem is enabling crash dump collection in\nsyzkaller. For this, the tool loads a panic kernel before fuzzing and then\ncalls makedumpfile after the panic. This workflow requires both CONFIG_KEXEC\nand CONFIG_KCOV to be enabled simultaneously.\n\nAdding safeguards directly to the KCOV fast-path (__sanitizer_cov_trace_pc())\nis also undesirable as it would introduce an extra performance overhead.\n\nDisabling instrumentation for the individual functions would be too fragile,\nso disable KCOV instrumentation for the entire machine_kexec_64.c and\nphysaddr.c. If coverage-guided fuzzing ever needs these components in the\nfuture, other approaches should be considered.\n\nThe problem is not relevant for 32 bit kernels as CONFIG_KCOV is not supported\nthere.\n\n [ bp: Space out comment for better readability. ](CVE-2026-43331)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\napparmor: Fix \u0026amp; Optimize table creation from possibly unaligned memory\n\nSource blob may come from userspace and might be unaligned.\nTry to optize the copying process by avoiding unaligned memory accesses.\n\n- Added Fixes tag\n- Added \u0026quot;Fix \u0026amp;\u0026quot; to description as this doesn\u0026apos;t just optimize but fixes\n a potential unaligned memory access\n[jj: remove duplicate word \u0026quot;convert\u0026quot; in comment trigger checkpatch warning](CVE-2026-45893)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnvmet-tcp: fix race between ICReq handling and queue teardown\n\nnvmet_tcp_handle_icreq() updates queue-\u0026gt;state after sending an\nInitialization Connection Response (ICResp), but it does so without\nserializing against target-side queue teardown.\n\nIf an NVMe/TCP host sends an Initialization Connection Request\n(ICReq) and immediately closes the connection, target-side teardown\nmay start in softirq context before io_work drains the already\nbuffered ICReq. In that case, nvmet_tcp_schedule_release_queue()\nsets queue-\u0026gt;state to NVMET_TCP_Q_DISCONNECTING and drops the queue\nreference under state_lock.\n\nIf io_work later processes that ICReq, nvmet_tcp_handle_icreq() can\nstill overwrite the state back to NVMET_TCP_Q_LIVE. That defeats the\nDISCONNECTING-state guard in nvmet_tcp_schedule_release_queue() and\nallows a later socket state change to re-enter teardown and issue a\nsecond kref_put() on an already released queue.\n\nThe ICResp send failure path has the same problem. If teardown has\nalready moved the queue to DISCONNECTING, a send error can still\noverwrite the state with NVMET_TCP_Q_FAILED, again reopening the\nwindow for a second teardown path to drop the queue reference.\n\nFix this by serializing both post-send state transitions with\nstate_lock and bailing out if teardown has already started.\n\nUse -ESHUTDOWN as an internal sentinel for that bail-out path rather\nthan propagating it as a transport error like -ECONNRESET. Keep\nnvmet_tcp_socket_error() setting rcv_state to NVMET_TCP_RECV_ERR before\nhonoring that sentinel so receive-side parsing stays quiesced until the\nexisting release path completes.(CVE-2026-46135)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: nf_tables: use list_del_rcu for netlink hooks\n\nnft_netdev_unregister_hooks and __nft_unregister_flowtable_net_hooks need\nto use list_del_rcu(), this list can be walked by concurrent dumpers.\n\nAdd a new helper and use it consistently.(CVE-2026-46324)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA: During rereg_mr ensure that REREG_ACCESS is compatible\n\nIf IB_MR_REREG_ACCESS changes from RO to RW then the umem has to be\nre-evaluated to ensure it is properly pinned as RW. Since the umem is\nhidden inside each driver\u0026apos;s mr struct add a ib_umem_check_rereg() function\nthat each driver has to call before processing IB_MR_REREG_ACCESS.\n\nmlx4 has to retain its duplicate ib_access_writable check because it\nimplements IB_MR_REREG_ACCESS | IB_MR_REREG_TRANS by changing both items\nin place sequentially while the MR is live, so it will continue to not\nsupport this combination.(CVE-2026-52908)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBluetooth: serialize accept_q access\n\nbt_sock_poll() walks the accept queue without synchronization, while\nchild teardown can unlink the same socket and drop its last reference.\nThe unsynchronized accept queue walk has existed since the initial\nBluetooth import.\n\nProtect accept_q with a dedicated lock for queue updates and polling.\nAlso rework bt_accept_dequeue() to take temporary child references under\nthe queue lock before dropping it and locking the child socket.(CVE-2026-52918)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipc: limit next_id allocation to the valid ID range\n\nThe checkpoint/restore sysctl path can request the next SysV IPC id\nthrough ids-\u0026gt;next_id. ipc_idr_alloc() currently forwards that request to\nidr_alloc() with an open-ended upper bound.\n\nIf the valid tail of the SysV IPC id space is full, the allocation can\nspill beyond ipc_mni. The returned SysV IPC id still uses the normal\nindex encoding, so later lookup and removal can target the wrong slot. \nThis leaves the real IDR entry behind and breaks the IDR state for the\nobject.\n\nThe bug is in ipc_idr_alloc() in the checkpoint/restore path.\n\n1. ids-\u0026gt;next_id is passed to:\n\n idr_alloc(\u0026amp;ids-\u0026gt;ipcs_idr, new, ipcid_to_idx(next_id), 0, ...)\n\n2. The zero upper bound makes the allocation effectively open-ended.\n Once the valid SysV IPC tail is occupied, idr_alloc() can spill past\n ipc_mni and allocate an entry beyond the valid IPC id range.\n\n3. The new object id is still encoded with the narrower SysV IPC index\n width:\n\n new-\u0026gt;id = (new-\u0026gt;seq \u0026lt;\u0026lt; ipcmni_seq_shift()) + idx\n\n4. Later removal goes through ipc_rmid(), which uses:\n\n ipcid_to_idx(ipcp-\u0026gt;id)\n\n That truncates the real IDR index. An object actually stored at a\n high index can then be removed as if it lived at a low in-range\n index.\n\n5. For shared memory, shm_destroy() frees the current object anyway, but\n the real high IDR slot is left behind as a dangling pointer.\n\n6. A subsequent walk of /proc/sysvipc/shm reaches the stale IDR entry\n and dereferences freed memory.\n\nPrevent this by bounding the requested allocation to ipc_mni so the\ncheckpoint/restore path fails once the valid range is exhausted.(CVE-2026-52923)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipc/shm: serialize orphan cleanup with shm_nattch updates\n\nshm_destroy_orphaned() walks the shm idr under shm_ids(ns).rwsem, but that\ndoes not serialize all fields tested by shm_may_destroy(). In particular,\nshm_nattch is updated while holding shm_perm.lock, and attach paths can do\nthat without holding the rwsem.\n\nDo not decide that an orphaned segment is unused before taking the object\nlock. Move the shm_may_destroy() check under shm_perm.lock, matching the\nother destroy paths, and unlock the segment when it no longer qualifies\nfor removal.(CVE-2026-52930)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ni2c: dev: prevent integer overflow in I2C_TIMEOUT ioctl\n\nWhile fuzzing with Syzkaller, a persistent `schedule_timeout: wrong\ntimeout value` warning was observed, accompanied by SMBus controller\nstate machine corruption.\n\nThe I2C_TIMEOUT ioctl accepts a user-provided timeout in multiples of\n10 ms. The user argument is checked against INT_MAX, but it is\nsubsequently multiplied by 10 before being passed to msecs_to_jiffies().\n\nA malicious user can pass a large value (e.g., 429496729) that passes\nthe `arg \u0026gt; INT_MAX` check but overflows when multiplied by 10. This\nresults in a truncated 32-bit unsigned value that bypasses the\ninternal `(int)m \u0026lt; 0` check in `msecs_to_jiffies()`.\n\nThe truncated value is then assigned to `client-\u0026gt;adapter-\u0026gt;timeout`\n(a signed 32-bit int), which is reinterpreted as a negative number.\nWhen passed to wait_for_completion_timeout(), this negative value\nundergoes sign extension to a 64-bit unsigned long, triggering the\n`schedule_timeout` warning and causing premature returns. This leaves\nthe SMBus state machine in an unrecoverable state, constituting a\nlocal Denial of Service (DoS).\n\nFix this by bounding the user argument to `INT_MAX / 10`.\n\n[wsa: move the comment as well](CVE-2026-52948)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/vt-d: Fix oops due to out of scope access\n\nBelow oops triggers when kill QEMU process:\n\n Oops: general protection fault, probably for non-canonical address 0x7fffffff844eaaa7: 0000 [#1] SMP NOPTI\n Call Trace:\n \u0026lt;TASK\u0026gt;\n do_raw_spin_lock+0xaa/0xc0\n _raw_spin_lock_irqsave+0x21/0x40\n domain_remove_dev_pasid+0x52/0x160\n intel_nested_set_dev_pasid+0x1b9/0x1e0\n __iommu_set_group_pasid+0x56/0x120\n pci_dev_reset_iommu_done+0xe3/0x180\n pcie_flr+0x65/0x160\n __pci_reset_function_locked+0x5b/0x120\n vfio_pci_core_close_device+0x63/0xe0 [vfio_pci_core]\n vfio_df_close+0x4f/0xa0\n vfio_df_unbind_iommufd+0x2d/0x60\n vfio_device_fops_release+0x3e/0x40\n __fput+0xe5/0x2c0\n task_work_run+0x58/0xa0\n do_exit+0x2c8/0x600\n do_group_exit+0x2f/0xa0\n get_signal+0x863/0x8c0\n arch_do_signal_or_restart+0x24/0x100\n exit_to_user_mode_loop+0x87/0x380\n do_syscall_64+0x2ff/0x11e0\n entry_SYSCALL_64_after_hwframe+0x76/0x7e\n\nThe global static blocked domain is a dummy domain without corresponding\ndmar_domain structure, accessing beyond iommu_domain structure triggers\noops easily. Fix it by return early in domain_remove_dev_pasid() like\nidentity domain.(CVE-2026-52953)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nceph: fix BUG_ON in __ceph_build_xattrs_blob() due to stale blob size\n\nThe generic/642 test-case can reproduce the kernel crash:\n\n[40243.605254] ------------[ cut here ]------------\n[40243.605956] kernel BUG at fs/ceph/xattr.c:918!\n[40243.607142] Oops: invalid opcode: 0000 [#1] SMP PTI\n[40243.608067] CPU: 7 UID: 0 PID: 498762 Comm: kworker/7:1 Not tainted 7.0.0-rc7+ #3 PREEMPT(full)\n[40243.609700] Hardware name: QEMU Ubuntu 25.10 PC v2 (i440FX + PIIX, + 10.1 machine, 1996), BIOS 1.16.3-debian-1.16.3-2 04/01/2014\n[40243.611820] Workqueue: ceph-msgr ceph_con_workfn\n[40243.612715] RIP: 0010:__ceph_build_xattrs_blob+0x1b8/0x1e0\n[40243.613731] Code: 0f 84 82 fe ff ff e9 cf 8e 56 ff 48 8d 65 e8 31 c0 5b 41 5c 41 5d 5d 31 d2 31 c9 31 f6 31 ff 45 31 c0 45 31 c9 c3 cc cc cc cc \u0026lt;0f\u0026gt; 0b 4c 8b 62 08 41 8b 85 24 07 00 00 49 83 c4 04 41 89 44 24 fc\n[40243.616888] RSP: 0018:ffffcc80c4d4b688 EFLAGS: 00010287\n[40243.617773] RAX: 0000000000010026 RBX: 0000000000000001 RCX: 0000000000000000\n[40243.618928] RDX: ffff8a773798dee0 RSI: 0000000000000000 RDI: 0000000000000000\n[40243.620158] RBP: ffffcc80c4d4b6a0 R08: 0000000000000000 R09: 0000000000000000\n[40243.621573] R10: 0000000000000000 R11: 0000000000000000 R12: ffff8a75f3b58000\n[40243.622907] R13: ffff8a75f3b58000 R14: 0000000000000080 R15: 000000000000bffd\n[40243.624054] FS: 0000000000000000(0000) GS:ffff8a787d1b4000(0000) knlGS:0000000000000000\n[40243.625331] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[40243.626269] CR2: 000072f390b623c0 CR3: 000000011c02a003 CR4: 0000000000372ef0\n[40243.627408] Call Trace:\n[40243.627839] \u0026lt;TASK\u0026gt;\n[40243.628188] __prep_cap+0x3fd/0x4a0\n[40243.628789] ? do_raw_spin_unlock+0x4e/0xe0\n[40243.629474] ceph_check_caps+0x46a/0xc80\n[40243.630094] ? __lock_acquire+0x4a2/0x2650\n[40243.630773] ? find_held_lock+0x31/0x90\n[40243.631347] ? handle_cap_grant+0x79f/0x1060\n[40243.632068] ? lock_release+0xd9/0x300\n[40243.632696] ? __mutex_unlock_slowpath+0x3e/0x340\n[40243.633429] ? lock_release+0xd9/0x300\n[40243.634052] handle_cap_grant+0xcf6/0x1060\n[40243.634745] ceph_handle_caps+0x122b/0x2110\n[40243.635415] mds_dispatch+0x5bd/0x2160\n[40243.636034] ? ceph_con_process_message+0x65/0x190\n[40243.636828] ? lock_release+0xd9/0x300\n[40243.637431] ceph_con_process_message+0x7a/0x190\n[40243.638184] ? kfree+0x311/0x4f0\n[40243.638749] ? kfree+0x311/0x4f0\n[40243.639268] process_message+0x16/0x1a0\n[40243.639915] ? sg_free_table+0x39/0x90\n[40243.640572] ceph_con_v2_try_read+0xf58/0x2120\n[40243.641255] ? lock_acquire+0xc8/0x300\n[40243.641863] ceph_con_workfn+0x151/0x820\n[40243.642493] process_one_work+0x22f/0x630\n[40243.643093] ? process_one_work+0x254/0x630\n[40243.643770] worker_thread+0x1e2/0x400\n[40243.644332] ? __pfx_worker_thread+0x10/0x10\n[40243.645020] kthread+0x109/0x140\n[40243.645560] ? __pfx_kthread+0x10/0x10\n[40243.646125] ret_from_fork+0x3f8/0x480\n[40243.646752] ? __pfx_kthread+0x10/0x10\n[40243.647316] ? __pfx_kthread+0x10/0x10\n[40243.647919] ret_from_fork_asm+0x1a/0x30\n[40243.648556] \u0026lt;/TASK\u0026gt;\n[40243.648902] Modules linked in: overlay hctr2 libpolyval chacha libchacha adiantum libnh libpoly1305 essiv intel_rapl_msr intel_rapl_common intel_uncore_frequency_common skx_edac_common nfit kvm_intel kvm irqbypass joydev ghash_clmulni_intel aesni_intel rapl input_leds mac_hid psmouse vga16fb serio_raw vgastate floppy i2c_piix4 pata_acpi bochs qemu_fw_cfg i2c_smbus sch_fq_codel rbd dm_crypt msr parport_pc ppdev lp parport efi_pstore\n[40243.654766] ---[ end trace 0000000000000000 ]---\n\nCommit d93231a6bc8a (\u0026quot;ceph: prevent a client from exceeding the MDS\nmaximum xattr size\u0026quot;) moved the required_blob_size computation to before\nthe __build_xattrs() call, introducing a race.\n\n__build_xattrs() releases and reacquires i_ceph_lock during execution.\nIn that window, handle_cap_grant() may update i_xattrs.blob with a\nnewer MDS-provided blob and bump i_xattrs.version. When\n__bui\n---truncated---(CVE-2026-52961)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfsnotify: fix inode reference leak in fsnotify_recalc_mask()\n\nfsnotify_recalc_mask() fails to handle the return value of\n__fsnotify_recalc_mask(), which may return an inode pointer that needs\nto be released via fsnotify_drop_object() when the connector\u0026apos;s HAS_IREF\nflag transitions from set to cleared.\n\nThis manifests as a hung task with the following call trace:\n\n INFO: task umount:1234 blocked for more than 120 seconds.\n Call Trace:\n __schedule\n schedule\n fsnotify_sb_delete\n generic_shutdown_super\n kill_anon_super\n cleanup_mnt\n task_work_run\n do_exit\n do_group_exit\n\nThe race window that triggers the iref leak:\n\n Thread A (adding mark) Thread B (removing mark)\n \u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500 \u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\u2500\n fsnotify_add_mark_locked():\n fsnotify_add_mark_list():\n spin_lock(conn-\u0026gt;lock)\n add mark_B(evictable) to list\n spin_unlock(conn-\u0026gt;lock)\n return\n\n /* ---- gap: no lock held ---- */\n\n fsnotify_detach_mark(mark_A):\n spin_lock(mark_A-\u0026gt;lock)\n clear ATTACHED flag on mark_A\n spin_unlock(mark_A-\u0026gt;lock)\n fsnotify_put_mark(mark_A)\n\n fsnotify_recalc_mask():\n spin_lock(conn-\u0026gt;lock)\n __fsnotify_recalc_mask():\n /* mark_A skipped: ATTACHED cleared */\n /* only mark_B(evictable) remains */\n want_iref = false\n has_iref = true /* not yet cleared */\n -\u0026gt; HAS_IREF transitions true -\u0026gt; false\n -\u0026gt; returns inode pointer\n spin_unlock(conn-\u0026gt;lock)\n /* BUG: return value discarded!\n * iput() and fsnotify_put_sb_watched_objects()\n * are never called */\n\nFix this by deferring the transition true -\u0026gt; false of HAS_IREF flag from\nfsnotify_recalc_mask() (Thread A) to fsnotify_put_mark() (thread B).(CVE-2026-52990)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nerofs: unify lcn as u64 for 32-bit platforms\n\nAs sashiko reported [1], `lcn` was typed as `unsigned long` (or\n`unsigned int` sometimes), which is only 32 bits wide on 32-bit\nplatforms, which causes `(lcn \u0026lt;\u0026lt; lclusterbits)` to be truncated\nat 4 GiB.\n\nIn order to consolidate the logic, just use `u64` consistently\naround the codebase.\n\n[1] https://sashiko.dev/r/20260420034612.1899973-1-hsiangkao%40linux.alibaba.com(CVE-2026-53015)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/amd: Fix clone_alias() to use the original device\u0026apos;s devid\n\nCurrently clone_alias() assumes first argument (pdev) is always the\noriginal device pointer. This function is called by\npci_for_each_dma_alias() which based on topology decides to send\noriginal or alias device details in first argument.\n\nThis meant that the source devid used to look up and copy the DTE\nmay be incorrect, leading to wrong or stale DTE entries being\npropagated to alias device.\n\nFix this by passing the original pdev as the opaque data argument to\nboth the direct clone_alias() call and pci_for_each_dma_alias(). Inside\nclone_alias(), retrieve the original device from data and compute devid\nfrom it.(CVE-2026-53053)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nUSB: serial: kl5kusb105: fix bulk-out buffer overflow\n\nklsi_105_prepare_write_buffer() is called by the generic write path\nwith the bulk-out buffer and its size (bulk_out_size, 64 bytes). It\nstores a two-byte length header at the start of the buffer and copies\nthe payload from the write fifo starting at buf + KLSI_HDR_LEN, but\npasses the full buffer size as the number of bytes to copy:\n\n count = kfifo_out_locked(\u0026amp;port-\u0026gt;write_fifo, buf + KLSI_HDR_LEN,\n size, \u0026amp;port-\u0026gt;lock);\n\nWhen the fifo holds at least size bytes, size bytes are copied starting\ntwo bytes into the size-byte buffer, writing KLSI_HDR_LEN bytes past its\nend. Copy at most size - KLSI_HDR_LEN bytes instead, leaving room for\nthe header as safe_serial already does.\n\nWriting bulk_out_size or more bytes to the tty triggers a slab\nout-of-bounds write, observed with KASAN by emulating the device with\ndummy_hcd and raw-gadget:\n\n BUG: KASAN: slab-out-of-bounds in kfifo_copy_out+0x83/0xc0\n Write of size 64 at addr ffff888112c62202 by task python3\n kfifo_copy_out\n klsi_105_prepare_write_buffer [kl5kusb105]\n usb_serial_generic_write_start [usbserial]\n Allocated by task 139:\n usb_serial_probe [usbserial]\n The buggy address is located 2 bytes inside of allocated 64-byte region\n\nThe out-of-bounds write no longer occurs with this change applied.(CVE-2026-53194)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nUSB: serial: io_ti: fix heap overflow in get_manuf_info()\n\nget_manuf_info() reads le16_to_cpu(rom_desc-\u0026gt;Size) bytes from the\ndevice I2C EEPROM into a buffer allocated with kmalloc_obj(), which\nis sizeof(struct edge_ti_manuf_descriptor) = 10 bytes.\n\nThe Size field comes from the device and is only validated (in\ncheck_i2c_image()) to make sure the descriptor fits within\nTI_MAX_I2C_SIZE (16384 bytes), not against the destination buffer size.\nA malicious USB device can therefore set Size to any value up to 16377,\ncausing a heap overflow of up to 16367 bytes when plugged into a host\nrunning this driver.\n\nvalid_csum() is called after read_rom() and also iterates\nbuffer[0..Size-1], compounding the out-of-bounds access.\n\nFix by rejecting descriptors with unexpected length before calling\nread_rom().\n\n[ johan: amend commit message; also check for short descriptors ](CVE-2026-53196)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nl2tp: pppol2tp: hold reference to session in pppol2tp_ioctl()\n\npppol2tp_ioctl() read sock-\u0026gt;sk-\u0026gt;sk_user_data directly without any\nlocks or reference counting. If a controllable sleep was induced during\ncopy_from_user() (e.g. via a userfaultfd page fault sleep), a concurrent\nsocket close could trigger pppol2tp_session_close() asynchronously. This\nfrees the l2tp_session structure via the l2tp_session_del_work workqueue.\nUpon resuming, the ioctl thread dereferences the stale session pointer,\nresulting in a Use-After-Free (UAF).\n\nFix this by securely fetching the session reference using the RCU-safe,\nrefcounted helper pppol2tp_sock_to_session(sk) on entry. This locks the\nsession\u0026apos;s refcount across the sleep. We structured the function to exit\nvia standard err breaks, guaranteeing that l2tp_session_put() is cleanly\ncalled on all return paths to drop the reference.\n\nTo preserve existing behavior we validate the session and its magic\nsignature only for the specific L2TP commands that require it. This\nensures that generic/unknown ioctls called on an unconnected socket\nstill return -ENOIOCTLCMD and correctly fall back to generic handlers\n(e.g. in sock_do_ioctl()).(CVE-2026-53262)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndrm/amd/display: Wrap DCN32 phantom-plane allocation in DC_RUN_WITH_PREEMPTION_ENABLED\n\n[Why]\ndcn32_validate_bandwidth() wraps dcn32_internal_validate_bw() with\nDC_FP_START()/DC_FP_END(). In x86 non-RT, DC_FP_START takes fpregs_lock(),\nwhich disables local softirqs.\n\nThe DML1 path through dcn32_enable_phantom_plane() calls kvzalloc() to\nallocate ~335 KiB for dc_plane_state. This triggers the vmalloc path,\nwhich calls BUG_ON(in_interrupt()) because it\u0026apos;s invoked within the\nFPU-enabled (softirq disabled) region, leading to a kernel crash.\n\n[How]\nWrap the dc_state_create_phantom_plane() call with the\nDC_RUN_WITH_PREEMPTION_ENABLED() macro to allow preemption during\nthis memory allocation.\n\n(cherry picked from commit 885ccbef7b94a8b38f69c4211c679021aa27ad11)(CVE-2026-53285)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndrm/amd/display: Avoid NULL dereference in dc_dmub_srv error paths\n\nIn dc_dmub_srv_log_diagnostic_data() and\ndc_dmub_srv_enable_dpia_trace().\n\nBoth functions check:\n\n if (!dc_dmub_srv || !dc_dmub_srv-\u0026gt;dmub)\n\nand then call DC_LOG_ERROR() inside that block.\n\nDC_LOG_ERROR() uses dc_dmub_srv-\u0026gt;ctx internally. So if\ndc_dmub_srv is NULL, the logging itself can dereference a\nNULL pointer and cause a crash.\n\nFix this by splitting the checks.\n\nFirst check if dc_dmub_srv is NULL and return immediately.\nThen check dc_dmub_srv-\u0026gt;dmub and log the error only when\ndc_dmub_srv is valid.\n\nFixes the below:\n../display/dc/dc_dmub_srv.c:962 dc_dmub_srv_log_diagnostic_data() error: we previously assumed \u0026apos;dc_dmub_srv\u0026apos; could be null (see line 961)\n../display/dc/dc_dmub_srv.c:1167 dc_dmub_srv_enable_dpia_trace() error: we previously assumed \u0026apos;dc_dmub_srv\u0026apos; could be null (see line 1166)(CVE-2026-53313)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\npadata: Put CPU offline callback in ONLINE section to allow failure\n\nsyzbot reported the following warning:\n\n DEAD callback error for CPU1\n WARNING: kernel/cpu.c:1463 at _cpu_down+0x759/0x1020 kernel/cpu.c:1463, CPU#0: syz.0.1960/14614\n\nat commit 4ae12d8bd9a8 (\u0026quot;Merge tag \u0026apos;kbuild-fixes-7.0-2\u0026apos; of git://git.kernel.org/pub/scm/linux/kernel/git/kbuild/linux\u0026quot;)\nwhich tglx traced to padata_cpu_dead() given it\u0026apos;s the only\nsub-CPUHP_TEARDOWN_CPU callback that returns an error.\n\nFailure isn\u0026apos;t allowed in hotplug states before CPUHP_TEARDOWN_CPU\nso move the CPU offline callback to the ONLINE section where failure is\npossible.(CVE-2026-53314)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndrm/virtio: Fix driver removal with disabled KMS\n\nDRM atomic and modesetting aren\u0026apos;t initialized if virtio-gpu driver built\nwith disabled KMS, leading to access of uninitialized data on driver\nremoval/unbinding and crashing kernel. Fix it by skipping shutting down\natomic core with unavailable KMS.(CVE-2026-53347)",
"id": "OESA-2026-3454",
"modified": "2026-08-20T09:59:30Z",
"published": "2026-08-20T09:59:30Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2026-3454"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43153"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43331"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45893"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46135"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46324"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-52908"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-52918"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-52923"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-52930"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-52948"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-52953"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-52961"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-52990"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53015"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53053"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53194"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53196"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53262"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53285"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53313"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53314"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53347"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2026-43153",
"CVE-2026-43331",
"CVE-2026-45893",
"CVE-2026-46135",
"CVE-2026-46324",
"CVE-2026-52908",
"CVE-2026-52918",
"CVE-2026-52923",
"CVE-2026-52930",
"CVE-2026-52948",
"CVE-2026-52953",
"CVE-2026-52961",
"CVE-2026-52990",
"CVE-2026-53015",
"CVE-2026-53053",
"CVE-2026-53194",
"CVE-2026-53196",
"CVE-2026-53262",
"CVE-2026-53285",
"CVE-2026-53313",
"CVE-2026-53314",
"CVE-2026-53347"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.