Vulnerabilites related to Schneider Electric - StruxureWare Data Center Expert
var-201807-2218
Vulnerability from variot
Systems with microprocessors utilizing speculative execution and branch prediction may allow unauthorized disclosure of information to an attacker with local user access via a speculative buffer overflow and side-channel analysis. Intel Systems with microprocessors contain information disclosure vulnerabilities.Information may be obtained. Multiple CPU Hardware are prone to an information-disclosure vulnerability. Attackers can exploit this issue to obtain sensitive information that may aid in further attacks. ARM CPU is a CPU (central processing unit) product of the British ARM company. Intel CPU is a CPU (central processing unit) product of Intel Corporation of the United States. This vulnerability stems from configuration errors in network systems or products during operation. 7) - aarch64, noarch, ppc64le
Bug Fix(es):
-
Kernel panic on job cleanup, related to SyS_getdents64 (BZ#1702057)
-
Kernel modules generated incorrectly when system is localized to non-English language (BZ#1705285)
-
RHEL-Alt-7.6 - Fixup tlbie vs store ordering issue on POWER9 (BZ#1756270)
-
1713059 - CVE-2019-3846 kernel: Heap overflow in mwifiex_update_bss_desc_with_ie function in marvell/mwifiex/scan.c 1716992 - CVE-2019-10126 kernel: Heap overflow in mwifiex_uap_parse_tail_ies function in drivers/net/wireless/marvell/mwifiex/ie.c 1744130 - CVE-2019-14814 kernel: heap overflow in mwifiex_set_uap_rates() function of Marvell Wifi Driver leading to DoS 1744137 - CVE-2019-14815 kernel: heap-overflow in mwifiex_set_wmm_params() function of Marvell WiFi driver leading to DoS 1744149 - CVE-2019-14816 kernel: heap overflow in mwifiex_update_vs_ie() function of Marvell WiFi driver 1771909 - CVE-2019-17133 kernel: buffer overflow in cfg80211_mgd_wext_giwessid in net/wireless/wext-sme.c 1777825 - CVE-2019-18660 kernel: (powerpc) incomplete Spectre-RSB mitigation leads to information exposure
-
7) - noarch, x86_64
-
Description:
The kernel-rt packages provide the Real Time Linux Kernel, which enables fine-tuning for systems with extremely high determinism requirements. (BZ#1594915)
Bug Fix(es):
-
ovl_create can return positive retval and crash the host (BZ#1696290)
-
THP: Race between MADV_DONTNEED and NUMA hinting node migration code (BZ#1698105)
-
RHEL7.6 - Kernel changes for count cache flush Spectre v2 mitigation (BZ#1708543)
-
Poor system performance from thundering herd of kworkers competing for mddev->flush_bio ownership (BZ#1712762)
-
[RHEL7.7] RAID1
write-behindcauses a kernel panic (BZ#1712999)
Enhancement(s):
-
[Intel 7.5 FEAT] i40evf - Update to latest upstream driver version (BZ#1722774)
-
[netdrv] i40e/i40evf: Fix use after free in Rx cleanup path [7.4.z] (BZ#1723831)
Users of kernel are advised to upgrade to these updated packages, which fix these bugs and add these enhancements. 6) - i386, x86_64
Bug Fix(es):
-
The Least recently used (LRU) operations are batched by caching pages in per-cpu page vectors to prevent contention of the heavily used lru_lock spinlock. The page vectors can hold even the compound pages. Previously, the page vectors were cleared only if they were full. Subsequently, the amount of memory held in page vectors, which is not reclaimable, was sometimes too high. Consequently the page reclamation started the Out of Memory (OOM) killing processes. With this update, the underlying source code has been fixed to clear LRU page vectors each time when a compound page is added to them. As a result, OOM killing processes due to high amounts of memory held in page vectors no longer occur. (BZ#1575819)
-
-----BEGIN PGP SIGNED MESSAGE----- Hash: SHA256
====================================================================
Red Hat Security Advisory
Synopsis: Important: kernel security and bug fix update Advisory ID: RHSA-2018:2384-01 Product: Red Hat Enterprise Linux Advisory URL: https://access.redhat.com/errata/RHSA-2018:2384 Issue date: 2018-08-14 CVE Names: CVE-2017-13215 CVE-2018-3620 CVE-2018-3646 CVE-2018-3693 CVE-2018-5390 CVE-2018-7566 CVE-2018-10675 ==================================================================== 1. Summary:
An update for kernel is now available for Red Hat Enterprise Linux 7.
Red Hat Product Security has rated this update as having a security impact of Important. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.
- Relevant releases/architectures:
Red Hat Enterprise Linux Client (v. 7) - noarch, x86_64 Red Hat Enterprise Linux Client Optional (v. 7) - x86_64 Red Hat Enterprise Linux ComputeNode (v. 7) - noarch, x86_64 Red Hat Enterprise Linux ComputeNode Optional (v. 7) - x86_64 Red Hat Enterprise Linux Server (v. 7) - noarch, ppc64, ppc64le, s390x, x86_64 Red Hat Enterprise Linux Server Optional (v. 7) - ppc64, ppc64le, x86_64 Red Hat Enterprise Linux Workstation (v. 7) - noarch, x86_64 Red Hat Enterprise Linux Workstation Optional (v. 7) - x86_64 Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7) - noarch, ppc64le, s390x Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server Optional (v. 7) - noarch, ppc64le
- Description:
The kernel packages contain the Linux kernel, the core of any Linux operating system.
Security Fix(es):
-
Modern operating systems implement virtualization of physical memory to efficiently use available system resources and provide inter-domain protection through access control and isolation. The L1TF issue was found in the way the x86 microprocessor designs have implemented speculative execution of instructions (a commonly used performance optimisation) in combination with handling of page-faults caused by terminated virtual to physical address resolving process. As a result, an unprivileged attacker could use this flaw to read privileged memory of the kernel or other processes and/or cross guest/host boundaries to read host memory by conducting targeted cache side-channel attacks. (CVE-2018-3620, CVE-2018-3646)
-
An industry-wide issue was found in the way many modern microprocessor designs have implemented speculative execution of instructions past bounds check. The flaw relies on the presence of a precisely-defined instruction sequence in the privileged code and the fact that memory writes occur to an address which depends on the untrusted value. Such writes cause an update into the microprocessor's data cache even for speculatively executed instructions that never actually commit (retire). As a result, an unprivileged attacker could use this flaw to influence speculative execution and/or read privileged memory by conducting targeted cache side-channel attacks. (CVE-2018-3693)
-
A flaw named SegmentSmack was found in the way the Linux kernel handled specially crafted TCP packets. A remote attacker could use this flaw to trigger time and calculation expensive calls to tcp_collapse_ofo_queue() and tcp_prune_ofo_queue() functions by sending specially modified packets within ongoing TCP sessions which could lead to a CPU saturation and hence a denial of service on the system. Maintaining the denial of service condition requires continuous two-way TCP sessions to a reachable open port, thus the attacks cannot be performed using spoofed IP addresses. (CVE-2018-5390)
-
kernel: crypto: privilege escalation in skcipher_recvmsg function (CVE-2017-13215)
-
kernel: mm: use-after-free in do_get_mempolicy function allows local DoS or other unspecified impact (CVE-2018-10675)
-
kernel: race condition in snd_seq_write() may lead to UAF or OOB access (CVE-2018-7566)
For more details about the security issue(s), including the impact, a CVSS score, and other related information, refer to the CVE page(s) listed in the References section.
Red Hat would like to thank Intel OSSIRT (Intel.com) for reporting CVE-2018-3620 and CVE-2018-3646; Vladimir Kiriansky (MIT) and Carl Waldspurger (Carl Waldspurger Consulting) for reporting CVE-2018-3693; and Juha-Matti Tilli (Aalto University, Department of Communications and Networking and Nokia Bell Labs) for reporting CVE-2018-5390.
Bug Fix(es):
These updated kernel packages include also numerous bug fixes. Space precludes documenting all of the bug fixes in this advisory. See the descriptions in the related Knowledge Article:
https://access.redhat.com/articles/3527791
- Solution:
For details on how to apply this update, which includes the changes described in this advisory, refer to:
https://access.redhat.com/articles/11258
The system must be rebooted for this update to take effect.
- Bugs fixed (https://bugzilla.redhat.com/):
1535173 - CVE-2017-13215 kernel: crypto: privilege escalation in skcipher_recvmsg function 1550142 - CVE-2018-7566 kernel: race condition in snd_seq_write() may lead to UAF or OOB-access 1575065 - CVE-2018-10675 kernel: mm: use-after-free in do_get_mempolicy function allows local DoS or other unspecified impact 1581650 - CVE-2018-3693 Kernel: speculative bounds check bypass store 1585005 - CVE-2018-3646 Kernel: hw: cpu: L1 terminal fault (L1TF) 1601704 - CVE-2018-5390 kernel: TCP segments with random offsets allow a remote denial of service (SegmentSmack)
- Package List:
Red Hat Enterprise Linux Client (v. 7):
Source: kernel-3.10.0-862.11.6.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm kernel-doc-3.10.0-862.11.6.el7.noarch.rpm
x86_64: kernel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-headers-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm perf-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux Client Optional (v. 7):
x86_64: kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux ComputeNode (v. 7):
Source: kernel-3.10.0-862.11.6.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm kernel-doc-3.10.0-862.11.6.el7.noarch.rpm
x86_64: kernel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-headers-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm perf-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux ComputeNode Optional (v. 7):
x86_64: kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux Server (v. 7):
Source: kernel-3.10.0-862.11.6.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm kernel-doc-3.10.0-862.11.6.el7.noarch.rpm
ppc64: kernel-3.10.0-862.11.6.el7.ppc64.rpm kernel-bootwrapper-3.10.0-862.11.6.el7.ppc64.rpm kernel-debug-3.10.0-862.11.6.el7.ppc64.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm kernel-debug-devel-3.10.0-862.11.6.el7.ppc64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm kernel-debuginfo-common-ppc64-3.10.0-862.11.6.el7.ppc64.rpm kernel-devel-3.10.0-862.11.6.el7.ppc64.rpm kernel-headers-3.10.0-862.11.6.el7.ppc64.rpm kernel-tools-3.10.0-862.11.6.el7.ppc64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm kernel-tools-libs-3.10.0-862.11.6.el7.ppc64.rpm perf-3.10.0-862.11.6.el7.ppc64.rpm perf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm python-perf-3.10.0-862.11.6.el7.ppc64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm
ppc64le: kernel-3.10.0-862.11.6.el7.ppc64le.rpm kernel-bootwrapper-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debug-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm kernel-devel-3.10.0-862.11.6.el7.ppc64le.rpm kernel-headers-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-libs-3.10.0-862.11.6.el7.ppc64le.rpm perf-3.10.0-862.11.6.el7.ppc64le.rpm perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm python-perf-3.10.0-862.11.6.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm
s390x: kernel-3.10.0-862.11.6.el7.s390x.rpm kernel-debug-3.10.0-862.11.6.el7.s390x.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.s390x.rpm kernel-debug-devel-3.10.0-862.11.6.el7.s390x.rpm kernel-debuginfo-3.10.0-862.11.6.el7.s390x.rpm kernel-debuginfo-common-s390x-3.10.0-862.11.6.el7.s390x.rpm kernel-devel-3.10.0-862.11.6.el7.s390x.rpm kernel-headers-3.10.0-862.11.6.el7.s390x.rpm kernel-kdump-3.10.0-862.11.6.el7.s390x.rpm kernel-kdump-debuginfo-3.10.0-862.11.6.el7.s390x.rpm kernel-kdump-devel-3.10.0-862.11.6.el7.s390x.rpm perf-3.10.0-862.11.6.el7.s390x.rpm perf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm python-perf-3.10.0-862.11.6.el7.s390x.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm
x86_64: kernel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-headers-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm perf-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7):
noarch: kernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm kernel-doc-3.10.0-862.11.6.el7.noarch.rpm
ppc64le: kernel-3.10.0-862.11.6.el7.ppc64le.rpm kernel-bootwrapper-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debug-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm kernel-devel-3.10.0-862.11.6.el7.ppc64le.rpm kernel-headers-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-libs-3.10.0-862.11.6.el7.ppc64le.rpm perf-3.10.0-862.11.6.el7.ppc64le.rpm perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm python-perf-3.10.0-862.11.6.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm
s390x: kernel-3.10.0-862.11.6.el7.s390x.rpm kernel-debug-3.10.0-862.11.6.el7.s390x.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.s390x.rpm kernel-debug-devel-3.10.0-862.11.6.el7.s390x.rpm kernel-debuginfo-3.10.0-862.11.6.el7.s390x.rpm kernel-debuginfo-common-s390x-3.10.0-862.11.6.el7.s390x.rpm kernel-devel-3.10.0-862.11.6.el7.s390x.rpm kernel-headers-3.10.0-862.11.6.el7.s390x.rpm kernel-kdump-3.10.0-862.11.6.el7.s390x.rpm kernel-kdump-debuginfo-3.10.0-862.11.6.el7.s390x.rpm kernel-kdump-devel-3.10.0-862.11.6.el7.s390x.rpm perf-3.10.0-862.11.6.el7.s390x.rpm perf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm python-perf-3.10.0-862.11.6.el7.s390x.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm
Red Hat Enterprise Linux Server Optional (v. 7):
ppc64: kernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm kernel-debuginfo-common-ppc64-3.10.0-862.11.6.el7.ppc64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.ppc64.rpm perf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm
ppc64le: kernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debug-devel-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.ppc64le.rpm perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm
x86_64: kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server Optional (v. 7):
noarch: kernel-doc-3.10.0-862.11.6.el7.noarch.rpm
ppc64le: kernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debug-devel-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.ppc64le.rpm perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm
Red Hat Enterprise Linux Workstation (v. 7):
Source: kernel-3.10.0-862.11.6.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm kernel-doc-3.10.0-862.11.6.el7.noarch.rpm
x86_64: kernel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-headers-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm perf-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux Workstation Optional (v. 7):
x86_64: kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/
- References:
https://access.redhat.com/security/cve/CVE-2017-13215 https://access.redhat.com/security/cve/CVE-2018-3620 https://access.redhat.com/security/cve/CVE-2018-3646 https://access.redhat.com/security/cve/CVE-2018-3693 https://access.redhat.com/security/cve/CVE-2018-5390 https://access.redhat.com/security/cve/CVE-2018-7566 https://access.redhat.com/security/cve/CVE-2018-10675 https://access.redhat.com/security/updates/classification/#important https://access.redhat.com/security/vulnerabilities/L1TF https://access.redhat.com/articles/3527791
- Contact:
The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/
Copyright 2018 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1
iQIVAwUBW3MjONzjgjWX9erEAQioYA/9Ge//K50oCrGaDEMuI2PHYLcztiZt9meh C578LP6sC/HT17VAbV8C+Tvy9QBCU80t4mGU4GOPu8Q5HzZQv45n0NtdRTGCC+yb A1bFcf0vhXIALNsuDEZN9g5SwUBapxkRoh43R+E7ITCQWp0XIPaSjYgGNqpTTuD/ lxRCzc10HhxW+pUY+ERFcK6c0poc14FtSqM3GqZe10FhkykdIlmngFjkthjzefXO dUkYDy53G+iAdTrVFI03h3Wt+UBMmNwKtu8ydqtAxZ0zDZIP5ijASOtM4mlf77ec VsNn7OWythkpTcpa+Sh5+dk6DK+lU2vziVsEocYNpzB+T/aHC9n/+I8ibfp3B4DC k4lYqZJQDFR2jVABjkOVS9dWFlOYKFmU2JBwsqdRvt3rgVFXEH3n5OQydHGFskmP NFwDbRAFlwo3zjd9KuiQzdFTOensc35+eSHykY8nxY2hGMH5gGccShFL4C7N2mtx s8JnzA/Zj00VHMg8qIHGfQ7RSd/xyEJ5vn87WZcTshTNli6x1/0VnzpTKG85Ga+K S2EJDXFP9LqCT98TL1RDJmCTtfDjU3I/gbgu5xFaofQZfV48qAUomUQ2E+MhQAOX eBr/OvlfFP8HEwVEJBDtXKxxs1LgmjTSqOtfP8AvS5zI9/Y6o56i0d7Ng1CcaGKP lZgWJhC3Yik=i4St -----END PGP SIGNATURE-----
-- RHSA-announce mailing list RHSA-announce@redhat.com https://www.redhat.com/mailman/listinfo/rhsa-announce
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201807-2218",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "core i7",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "970"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "960"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "n3000"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "n4100"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "4360t"
},
{
"model": "atom x3",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "c3445"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "330e"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "965"
},
{
"model": "xeon e5 2650l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4610_v4"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "720qm"
},
{
"model": "xeon e3 1240l v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon phi",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7235"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4627_v4"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4660_v3"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "550"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6585r"
},
{
"model": "pentium n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3710"
},
{
"model": "xeon e5 2430l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4210m"
},
{
"model": "xeon e3 1240 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core m",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5y10c"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5550"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6154"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8860_v3"
},
{
"model": "enterprise linux",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "740qm"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3736g"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4350t"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e6510"
},
{
"model": "xeon e3 1225 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom x3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3235rk"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3775"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3340m"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4720hq"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4000m"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2405s"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8100"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4860_v2"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3850"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2435m"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4770"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3380m"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1545m_v5"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4360"
},
{
"model": "xeon e5 2637",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2518"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3317u"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4700ec"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4160t"
},
{
"model": "celeron j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j3160"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "460m"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4807"
},
{
"model": "cortex-a",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "15"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3480"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3745"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3580"
},
{
"model": "core m3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7y32"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5677"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8870_v3"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4570s"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8700k"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4330m"
},
{
"model": "xeon e3 1278l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4830"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4160"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8880l_v2"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x6550"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5750hq"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8160"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4570r"
},
{
"model": "xeon e3 1265l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8350u"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2760qm"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6134m"
},
{
"model": "xeon e5 2430 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "650"
},
{
"model": "atom x3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3295rk"
},
{
"model": "xeon e3 1280 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4109t"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4667_v3"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8860_v4"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4130"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5550u"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "w3690"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8891_v2"
},
{
"model": "xeon e5 2603 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "enterprise linux server eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.6"
},
{
"model": "cortex-a",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "57"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6260u"
},
{
"model": "xeon e5 2620 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1281 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2660"
},
{
"model": "xeon e5 2450l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "enterprise linux server",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.0"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8893_v2"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2699_v3"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4820"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3735d"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2340ue"
},
{
"model": "xeon e5 2630 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8867l"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5618"
},
{
"model": "core m3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7y30"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4130t"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5775c"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8180"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "760"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5700eq"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4330t"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4460"
},
{
"model": "xeon e3 1225 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2650l_v4"
},
{
"model": "xeon e5 2420",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5675c"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2690_v2"
},
{
"model": "enterprise linux desktop",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "xeon e5 2648l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5557u"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4850_v3"
},
{
"model": "celeron j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j3455"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5520"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3517u"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2629m"
},
{
"model": "pentium n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3700"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6138f"
},
{
"model": "xeon e5 2438l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5257u"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5502"
},
{
"model": "xeon bronze 3106",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2480"
},
{
"model": "xeon e5 2470 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6600t"
},
{
"model": "xeon e5 2407 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2450 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2675qm"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n2940"
},
{
"model": "xeon e5 2609 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "cortex-a",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "76"
},
{
"model": "cortex-r",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "7"
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.4"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8350k"
},
{
"model": "celeron j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j1850"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3220"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2358"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4460t"
},
{
"model": "xeon phi",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7285"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4310u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4460s"
},
{
"model": "pentium j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j2900"
},
{
"model": "xeon e5 2609 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2550"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4650_v3"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4210u"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3808"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3350"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5200u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4260u"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5506"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2690_v3"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6126f"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "560"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5675r"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3612qm"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4750hq"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1515m_v5"
},
{
"model": "xeon e3 1245",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4640"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3610qm"
},
{
"model": "xeon e5 2418l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2643 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2600s"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4722hq"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5500u"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8650u"
},
{
"model": "atom x3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3205rk"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2120"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4600m"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2660_v2"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4620"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1535m_v5"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4340m"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5560"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2540m"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5650"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5600u"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2687w_v2"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "430um"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3720qm"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2820qm"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2310e"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3210"
},
{
"model": "core m7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6y75"
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4114"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3785"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7820eq"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5120t"
},
{
"model": "atom e",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e3827"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2102"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4170t"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3610me"
},
{
"model": "celeron j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j1800"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2330e"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3010"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "470um"
},
{
"model": "xeon e5 1428l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "640m"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2670_v3"
},
{
"model": "xeon e5 2430",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8870_v2"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4890_v2"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5649"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "330um"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "610e"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4370t"
},
{
"model": "xeon e5 2428l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2640 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2667"
},
{
"model": "communications eagle application processor",
"scope": "eq",
"trust": 1.0,
"vendor": "oracle",
"version": "16.1.0"
},
{
"model": "xeon e5 2618l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4770s"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2300"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "530"
},
{
"model": "celeron j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j3060"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "660lm"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5690"
},
{
"model": "xeon e5 2643 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4830_v4"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4850"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4603_v2"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "870"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2390t"
},
{
"model": "celeron j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j4105"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2515e"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "560m"
},
{
"model": "pentium n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3530"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4880_v2"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8176f"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1565l_v5"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4648_v3"
},
{
"model": "cortex-r",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "8"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4600u"
},
{
"model": "xeon e5 1660 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2467m"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4850hq"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5680"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8857_v2"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8837"
},
{
"model": "xeon e5 2620",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4800mq"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n2830"
},
{
"model": "xeon e3 1505l v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l3406"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4628l_v4"
},
{
"model": "xeon e5 2618l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5120"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4603"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x3480"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2665"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2687w_v4"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8880_v2"
},
{
"model": "xeon e3 1220",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "540"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6500t"
},
{
"model": "xeon e5 2630 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4670"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4350"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "870s"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2550k"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3689y"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5700hq"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3538"
},
{
"model": "xeon e3 1265l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5672"
},
{
"model": "xeon e5 1650",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7820hk"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4650_v2"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3570"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3350p"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x3440"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3560"
},
{
"model": "xeon e5 1680 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2850"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3437u"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8890_v2"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7500u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4300y"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x3460"
},
{
"model": "celeron j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j3355"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6157u"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5667"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8160f"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8891_v4"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4624l_v2"
},
{
"model": "xeon e5 1650 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6140m"
},
{
"model": "xeon e3 1268l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4650_v4"
},
{
"model": "struxureware data center expert",
"scope": "eq",
"trust": 1.0,
"vendor": "schneider electric",
"version": "7.6.0"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4550u"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2520"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4200u"
},
{
"model": "xeon e5 2608l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2803"
},
{
"model": "xeon e5 2643 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5518"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4607_v2"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "980x"
},
{
"model": "xeon e5 1620 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2538"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3308"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4340"
},
{
"model": "core m",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5y51"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "640um"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4250u"
},
{
"model": "xeon e5 2637 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2630l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3770"
},
{
"model": "xeon phi",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7250"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4770r"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4607"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3955"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2357m"
},
{
"model": "xeon e3 1270 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7820hq"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3530"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3330"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2460"
},
{
"model": "xeon e3 1220 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1230 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2630l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8158"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6006u"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4158u"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3217ue"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4820_v2"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2750"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1585l_v5"
},
{
"model": "xeon e5 2408l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4116t"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3758"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3360m"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4112e"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e7530"
},
{
"model": "xeon e5 1650 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2348m"
},
{
"model": "xeon e3 1275 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "pentium j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j2850"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2680_v2"
},
{
"model": "xeon e3 1240 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4655_v4"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2120t"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2667_v2"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3229y"
},
{
"model": "atom e",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e3845"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2308"
},
{
"model": "xeon e3 1280 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4702ec"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4650"
},
{
"model": "xeon e5 2637 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "620ue"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4627_v2"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2667_v4"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "430m"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2820"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5503"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6200u"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "380m"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4510u"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5640"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4870_v2"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4690"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6126"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4200m"
},
{
"model": "core m",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5y71"
},
{
"model": "xeon e5 2630l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5122"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2370m"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3427u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5575r"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4558u"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3250t"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4710mq"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8168"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2630qm"
},
{
"model": "xeon e3 1241 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8160m"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4422e"
},
{
"model": "xeon e3 1230l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1260l v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4310m"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2312m"
},
{
"model": "xeon e3 1225",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4655_v3"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "660"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l7555"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4200y"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4790s"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7700"
},
{
"model": "xeon e3 1271 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3635qm"
},
{
"model": "xeon e3 1260l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6167u"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4830_v3"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4330te"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6134"
},
{
"model": "xeon e3 1245 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7567u"
},
{
"model": "xeon e5 1650 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2760"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3450"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3115c"
},
{
"model": "xeon e3 1245 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1275 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1230",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5670"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2738"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "940xm"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x3430"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6100te"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "660ue"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "975"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4620_v2"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2695_v2"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5675"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2450m"
},
{
"model": "xeon e3 1240 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2658"
},
{
"model": "xeon e5 2623 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3615qm"
},
{
"model": "xeon e3 1285 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n4000"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3470s"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x3470"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4712hq"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4760hq"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "990x"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4200h"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8700"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8600k"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6146"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6142f"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4960hq"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2687w_v3"
},
{
"model": "xeon e5 2628l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7600u"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2698_v3"
},
{
"model": "xeon e5 2630 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3450s"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5950hq"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4360u"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3590"
},
{
"model": "xeon e5 1428l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8890_v3"
},
{
"model": "xeon e5 2448l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6300u"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "ec5549"
},
{
"model": "xeon e5 2428l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3745d"
},
{
"model": "enterprise linux desktop",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.0"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l7545"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5850eq"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5508"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2350"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2560"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2758"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3120me"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7560u"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2860"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "ec5509"
},
{
"model": "xeon e5 2637 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "750s"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2697_v3"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3540m"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7y75"
},
{
"model": "xeon e3 1285l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3958"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6102e"
},
{
"model": "communications eagle application processor",
"scope": "eq",
"trust": 1.0,
"vendor": "oracle",
"version": "16.2.0"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4302y"
},
{
"model": "xeon e5 2418l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom e",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e3805"
},
{
"model": "atom e",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e3825"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3770d"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2558"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3337u"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3508"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2850_v2"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8153"
},
{
"model": "xeon e5 2603 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5118"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n2910"
},
{
"model": "atom x3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3405"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6100e"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2657m"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5250u"
},
{
"model": "xeon e3 1286l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 1660 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8170"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5115"
},
{
"model": "xeon e3 12201 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1280",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4590t"
},
{
"model": "xeon e5 2640 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2643",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2620 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4690t"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2500k"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.6"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "880"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4170"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3820qm"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8893_v4"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2520m"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4830_v2"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4650u"
},
{
"model": "xeon e3 1285 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5640"
},
{
"model": "celeron j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j4005"
},
{
"model": "atom e",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e3826"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2367m"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2658_v4"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3740qm"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n2808"
},
{
"model": "xeon e3 1225 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5647"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6148f"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4980hq"
},
{
"model": "pentium j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j3710"
},
{
"model": "xeon e3 1240l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "cortex-a",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "73"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4402ec"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2715qe"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4020y"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3460"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2130"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "w3670"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2670"
},
{
"model": "cortex-a",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "17"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2695_v3"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5850hq"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4809_v2"
},
{
"model": "xeon e5 2430l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2718"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6500"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2610ue"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "390m"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2667_v3"
},
{
"model": "xeon e5 2448l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4025u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4570t"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4690s"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3570s"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6360u"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7920hq"
},
{
"model": "xeon e5 2407",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "330m"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4820_v3"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6100"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4870hq"
},
{
"model": "xeon e3 1275",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4640_v2"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8867_v3"
},
{
"model": "xeon e3 1270 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "930"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6400"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2655le"
},
{
"model": "xeon e3 1268l v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n2807"
},
{
"model": "xeon e3 1501m v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4620_v3"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3470"
},
{
"model": "core m",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5y31"
},
{
"model": "xeon e5 2618l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2670_v2"
},
{
"model": "cortex-a",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "9"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8550u"
},
{
"model": "xeon e3 1220 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2603 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4150t"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5506"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4150"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6130f"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6300hq"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "920xm"
},
{
"model": "xeon e3 1245 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3630qm"
},
{
"model": "xeon e5 2450l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4670k"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n2840"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4860"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x7542"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3770t"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "620m"
},
{
"model": "xeon e3 1225 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8160t"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5350u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2410m"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6400t"
},
{
"model": "xeon e5 1620 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4112"
},
{
"model": "atom x3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3130"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3339y"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2620m"
},
{
"model": "xeon e3 1276 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1558l_v5"
},
{
"model": "xeon e3 1505m v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4108"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2516"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "950"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2960xm"
},
{
"model": "xeon e5 2650l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6130"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "840qm"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2699r_v4"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2400s"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4500u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4400e"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6152"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6300t"
},
{
"model": "atom e",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e3815"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2698_v4"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n2920"
},
{
"model": "xeon e5 1620",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6685r"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7700k"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "520um"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3770s"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n2815"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3570k"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4610"
},
{
"model": "m12-2",
"scope": "lt",
"trust": 1.0,
"vendor": "fujitsu",
"version": "xcp3090"
},
{
"model": "xeon phi",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7230f"
},
{
"model": "xeon e3 1220l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1230 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "cortex-a",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "8"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3225"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2660_v3"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2310"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "875k"
},
{
"model": "xeon e3 1235l v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "680"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5350h"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1578l_v5"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3840qm"
},
{
"model": "xeon e3 1226 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1535m_v6"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4308u"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2920xm"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3338"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3240"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4712mq"
},
{
"model": "xeon e5 1428l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4670s"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3230m"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2720qm"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3227u"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3740d"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5530"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6600"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2687w"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2697_v4"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4790"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n2930"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4702mq"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "ec5539"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4570"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8870_v4"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5157u"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8164"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2658a_v3"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2690"
},
{
"model": "xeon e5 2648l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2603",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2380p"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "lc5528"
},
{
"model": "xeon e3 1275 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4700mq"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4640_v3"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5606"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4005u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "560um"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "640lm"
},
{
"model": "xeon e5 2628l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6138t"
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4116"
},
{
"model": "core m5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6y57"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "820qm"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x3450"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2600k"
},
{
"model": "xeon e3 1285 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2310m"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2730"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4669_v4"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6100u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5300u"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l3426"
},
{
"model": "xeon e3 12201",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2660_v4"
},
{
"model": "xeon e5 2418l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3475s"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2680_v3"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4340te"
},
{
"model": "core m",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5y10"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2860qm"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2637m"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3750"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3120m"
},
{
"model": "celeron j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j1750"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "580m"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5540"
},
{
"model": "xeon e5 1630 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6136"
},
{
"model": "xeon e5 2450",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4690k"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2699a_v4"
},
{
"model": "xeon e5 2403",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2500"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4785t"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4770t"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2375m"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2500s"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4590s"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6100t"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4860hq"
},
{
"model": "xeon e3 1270 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom x3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3200rk"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4770te"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1585_v5"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3735g"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3217u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "670"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6128"
},
{
"model": "xeon e5 2403 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6440eq"
},
{
"model": "xeon phi",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7290"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3610qe"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2700k"
},
{
"model": "atom x3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3230rk"
},
{
"model": "xeon e3 1501l v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2440",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e7540"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4610_v2"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3160"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4210y"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2649m"
},
{
"model": "enterprise linux workstation",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "pentium j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j4205"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2580"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6142"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3735e"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6402p"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3550"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2600"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8830"
},
{
"model": "xeon phi",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7295"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5660"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4950hq"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "540um"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "660um"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3558"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "520m"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e7520"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "860"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8880_v4"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4402e"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3950"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2617m"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2697a_v4"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2870_v2"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4870"
},
{
"model": "xeon e3 1245 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3667u"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2658_v3"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n2806"
},
{
"model": "xeon e5 1630 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.4"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5775r"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3736f"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x7550"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2557m"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4667_v4"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4570te"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "620le"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4440s"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4578u"
},
{
"model": "xeon e5 2470",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "m12-2s",
"scope": "lt",
"trust": 1.0,
"vendor": "fujitsu",
"version": "xcp3090"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4809_v3"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6144"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3050"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2316"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "350m"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4640_v4"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4030u"
},
{
"model": "xeon e5 2648l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5645"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4300m"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4430"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6148"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2683_v3"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "w5590"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4910mq"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4440"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6287u"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4100u"
},
{
"model": "xeon e3 1220 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e-1105c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8893_v3"
},
{
"model": "cortex-a",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "75"
},
{
"model": "xeon e3 1258l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6130t"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4202y"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4620_v4"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6100h"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4669_v3"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4700eq"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4100m"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2320"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3740"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8250u"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4110e"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4100e"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3858"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4370"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4610m"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2508"
},
{
"model": "xeon e3 1235",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2650l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1125c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4650l"
},
{
"model": "xeon e3 1270 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3520m"
},
{
"model": "xeon e5 2640 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7660u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4410e"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5638"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1575m_v5"
},
{
"model": "xeon e3 1220 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8890_v4"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "750"
},
{
"model": "xeon e5 2609 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "cortex-a",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "12"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3060"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2670qm"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8860"
},
{
"model": "communications lsms",
"scope": "lte",
"trust": 1.0,
"vendor": "oracle",
"version": "13.3"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "370m"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n2810"
},
{
"model": "celeron j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j1900"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "540m"
},
{
"model": "enterprise linux server",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2430m"
},
{
"model": "xeon e5 1620 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2630l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3550s"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "940"
},
{
"model": "xeon phi",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7210f"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6132"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5630"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6126t"
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4110"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2890_v2"
},
{
"model": "xeon e5 1660 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "pentium n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n4200"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2699_v4"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5607"
},
{
"model": "xeon e3 1240 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3570"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4012y"
},
{
"model": "core m",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5y70"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8891_v3"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4771"
},
{
"model": "enterprise linux eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.4"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "520e"
},
{
"model": "pentium n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3520"
},
{
"model": "xeon e5 2420 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e6540"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "lc5518"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8850_v2"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5650u"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8176m"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "620um"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5620"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "980"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5530"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "480m"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3775d"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "620lm"
},
{
"model": "xeon e3 1246 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1265l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2100"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3330s"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4278u"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3130m"
},
{
"model": "xeon phi",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7230"
},
{
"model": "xeon e3 1275l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2650 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2640m"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3340"
},
{
"model": "communications lsms",
"scope": "gte",
"trust": 1.0,
"vendor": "oracle",
"version": "13.1"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5119t"
},
{
"model": "enterprise linux server eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.5"
},
{
"model": "xeon e5 2623 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4809_v4"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2125"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n2805"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4657l_v2"
},
{
"model": "core m3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6y30"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3517ue"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5570"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5520"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2690_v4"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3320m"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4770hq"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3245"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2420"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2510e"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3632qm"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4710hq"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6150"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8880l_v3"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8850"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3687u"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5015u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6267u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4300u"
},
{
"model": "xeon e3 1275 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1285l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8867_v4"
},
{
"model": "xeon e3 1280 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "860s"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4765t"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3830"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4670t"
},
{
"model": "xeon e5 1660",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2428l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3240t"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3340s"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "w3680"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7700t"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5287u"
},
{
"model": "xeon e5 2630",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8880_v3"
},
{
"model": "xeon phi",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7290f"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2635qm"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2530"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4670r"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4850_v4"
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.6"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6300"
},
{
"model": "xeon e3 1230 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2650 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4770k"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2695_v4"
},
{
"model": "xeon e5 2440 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5603"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4790t"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "655k"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2680_v4"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4850_v2"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2450p"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4102e"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1505m_v6"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3615qe"
},
{
"model": "m12-1",
"scope": "lt",
"trust": 1.0,
"vendor": "fujitsu",
"version": "xcp3090"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4810mq"
},
{
"model": "xeon phi",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7250f"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8400"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5609"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4030y"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4210h"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3708"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6442eq"
},
{
"model": "xeon e3 1290 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2648l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 1680 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2650",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1125c v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8170m"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4820_v4"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3210m"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3439y"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2365m"
},
{
"model": "xeon e3 1231 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8156"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6098p"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4790k"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5504"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6138"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3110m"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4288u"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8176"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3612qe"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4900mq"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5630"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2537m"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2830"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3250"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3555le"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4350u"
},
{
"model": "xeon e3 1505l v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5020u"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4590"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3220t"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "661"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2677m"
},
{
"model": "xeon e5 2628l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7700hq"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8870"
},
{
"model": "pentium n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3510"
},
{
"model": "cortex-a",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "72"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c2338"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8894_v4"
},
{
"model": "xeon e3 1230 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4258u"
},
{
"model": "xeon e5 2609",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2650 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2870"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5507"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6600k"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4330"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n2820"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2100t"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2680"
},
{
"model": "xeon e5 2640",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4010y"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4610y"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2330m"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5010u"
},
{
"model": "solidfire element os management node",
"scope": "eq",
"trust": 1.0,
"vendor": "netapp",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4010u"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4617"
},
{
"model": "xeon e3 1280 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1270",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2377m"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2115c"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3470t"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2710qe"
},
{
"model": "pentium n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3540"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2400"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "920"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4700hq"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4610_v3"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "w5580"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4120u"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2350m"
},
{
"model": "xeon e3 1105c v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6140"
},
{
"model": "xeon phi",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7210"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4220y"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6500te"
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4114t"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3770k"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x7560"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4110m"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6350hq"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4430s"
},
{
"model": "xeon e3 1286 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3450"
},
{
"model": "xeon bronze 3104",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1290",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2658_v2"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4660_v4"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2880_v2"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2697_v2"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4627_v3"
},
{
"model": "enterprise linux workstation",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.0"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6320"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5005u"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "680um"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3795"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "450m"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2500t"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4702hq"
},
{
"model": "core m",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5y10a"
},
{
"model": "xeon",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5687"
},
{
"model": "xeon e3 1240",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2683_v4"
},
{
"model": "xeon e5 2620 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core m5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6y54"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3570t"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2328m"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6142m"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "380um"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2105"
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3150"
},
{
"model": "xeon e5 2608l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3770"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3735f"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "6440hq"
},
{
"model": "atom x3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3265rk"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3537u"
},
{
"model": "atom c",
"scope": null,
"trust": 0.8,
"vendor": "intel",
"version": null
},
{
"model": "atom e",
"scope": null,
"trust": 0.8,
"vendor": "intel",
"version": null
},
{
"model": "atom x3",
"scope": null,
"trust": 0.8,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": null,
"trust": 0.8,
"vendor": "intel",
"version": null
},
{
"model": "celeron j",
"scope": null,
"trust": 0.8,
"vendor": "intel",
"version": null
},
{
"model": "celeron n",
"scope": null,
"trust": 0.8,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "1231_v3"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "1220l_v2"
},
{
"model": "linux enterprise server sp3",
"scope": "eq",
"trust": 0.3,
"vendor": "suse",
"version": "12"
},
{
"model": "linux enterprise server sp4",
"scope": "eq",
"trust": 0.3,
"vendor": "suse",
"version": "11"
},
{
"model": "virtualization host",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "4"
},
{
"model": "enterprise linux workstation",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "7"
},
{
"model": "enterprise linux workstation",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "6"
},
{
"model": "enterprise linux server update services for sap solutions",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "-7.6"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "-7.6"
},
{
"model": "enterprise linux server extended update support",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "-7.6"
},
{
"model": "enterprise linux server extended update support",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "-7.5"
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "-7.6"
},
{
"model": "enterprise linux server update services for sap solutions",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "-7."
},
{
"model": "enterprise linux server",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "7"
},
{
"model": "enterprise linux server",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "6"
},
{
"model": "enterprise linux for scientific computing",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "7"
},
{
"model": "enterprise linux for scientific computing",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "6"
},
{
"model": "enterprise linux for real time",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "7"
},
{
"model": "enterprise linux for power little endian extended update supp",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "-7.6"
},
{
"model": "enterprise linux for power little endian extended update supp",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "-7.5"
},
{
"model": "enterprise linux for power little endian",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "7"
},
{
"model": "enterprise linux for power big endian extended update support",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "-7.6"
},
{
"model": "enterprise linux for power big endian extended update support",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "-7.5"
},
{
"model": "enterprise linux for power big endian",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "7"
},
{
"model": "enterprise linux for power big endian",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "6"
},
{
"model": "enterprise linux for power",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "97"
},
{
"model": "enterprise linux for ibm z systems extended update support",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "-7.6"
},
{
"model": "enterprise linux for ibm z systems extended update support",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "-7.5"
},
{
"model": "enterprise linux for ibm z systems",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "7"
},
{
"model": "enterprise linux for ibm z systems",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "6"
},
{
"model": "enterprise linux for ibm system z",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "7"
},
{
"model": "enterprise linux for arm",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "647"
},
{
"model": "enterprise linux eus compute node",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "7.6"
},
{
"model": "enterprise linux eus compute node",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "7.5"
},
{
"model": "enterprise linux desktop",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "7"
},
{
"model": "enterprise linux desktop",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "6"
},
{
"model": "communications eagle application processor",
"scope": "eq",
"trust": 0.3,
"vendor": "oracle",
"version": "16.2"
},
{
"model": "communications eagle application processor",
"scope": "eq",
"trust": 0.3,
"vendor": "oracle",
"version": "16.1"
},
{
"model": "solidfire element os management node",
"scope": "eq",
"trust": 0.3,
"vendor": "netapp",
"version": "0"
},
{
"model": "xeon w processor",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "xeon scalable processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "xeon processor e7 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "v40"
},
{
"model": "xeon processor e7 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "v30"
},
{
"model": "xeon processor e7 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "v20"
},
{
"model": "xeon processor e7 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "xeon processor e5 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "v40"
},
{
"model": "xeon processor e5 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "v30"
},
{
"model": "xeon processor e5 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "v20"
},
{
"model": "xeon processor e5 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "xeon processor e3 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "v60"
},
{
"model": "xeon processor e3 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "v50"
},
{
"model": "xeon processor e3 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "v40"
},
{
"model": "xeon processor e3 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "v30"
},
{
"model": "xeon processor e3 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "v20"
},
{
"model": "xeon processor e3 family",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "xeon e processor",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "pentium silver processor series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "pentium processor n series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "pentium processor j series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "legacy xeon processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "core x-series processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "celeron processor n series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "celeron processor j series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "celeron processor g series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "celeron processor series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "30000"
},
{
"model": "celeron processor series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "20000"
},
{
"model": "celeron processor series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "10000"
},
{
"model": "atom processor z series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "atom processor series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "x0"
},
{
"model": "atom processor s series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "atom processor n series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "atom processor e series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "atom processor d series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "atom processor c series",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "9th generation core i9 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "9th generation core i7 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "9th generation core i5 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "8th generation core m processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "8th generation core i9 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "8th generation core i7 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "8th generation core i5 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "8th generation core i3 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "7th generation core m processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "7th generation core i7 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "7th generation core i5 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "7th generation core i3 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "6th generation core m processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "6th generation core i7 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "6th generation core i5 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "6th generation core i3 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "5th generation core m processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "5th generation core i7 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "5th generation core i5 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "5th generation core i3 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "4th generation core i7 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "4th generation core i5 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "4th generation core i3 processors",
"scope": "eq",
"trust": 0.3,
"vendor": "intel",
"version": "0"
},
{
"model": "security identity governance and intelligence",
"scope": "eq",
"trust": 0.3,
"vendor": "ibm",
"version": "5.2.4"
},
{
"model": "security identity governance and intelligence",
"scope": "eq",
"trust": 0.3,
"vendor": "ibm",
"version": "5.2.3"
},
{
"model": "security identity governance and intelligence",
"scope": "eq",
"trust": 0.3,
"vendor": "ibm",
"version": "5.2.2"
},
{
"model": "security identity governance and intelligence",
"scope": "eq",
"trust": 0.3,
"vendor": "ibm",
"version": "5.2.1"
},
{
"model": "security identity governance and intelligence",
"scope": "eq",
"trust": 0.3,
"vendor": "ibm",
"version": "5.2.4.1"
},
{
"model": "security identity governance and intelligence",
"scope": "eq",
"trust": 0.3,
"vendor": "ibm",
"version": "5.2.3.2"
},
{
"model": "security identity governance and intelligence",
"scope": "eq",
"trust": 0.3,
"vendor": "ibm",
"version": "5.2.3.1"
},
{
"model": "security identity governance and intelligence",
"scope": "eq",
"trust": 0.3,
"vendor": "ibm",
"version": "5.2.2.1"
},
{
"model": "security identity governance and intelligence",
"scope": "eq",
"trust": 0.3,
"vendor": "ibm",
"version": "5.2"
},
{
"model": "qradar siem patch",
"scope": "eq",
"trust": 0.3,
"vendor": "ibm",
"version": "7.3.16"
},
{
"model": "qradar siem",
"scope": "eq",
"trust": 0.3,
"vendor": "ibm",
"version": "7.3"
},
{
"model": "cortex a57",
"scope": "eq",
"trust": 0.3,
"vendor": "arm",
"version": "0"
},
{
"model": "pro",
"scope": "eq",
"trust": 0.3,
"vendor": "amd",
"version": "0"
}
],
"sources": [
{
"db": "BID",
"id": "108004"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005796"
},
{
"db": "CNNVD",
"id": "CNNVD-201807-884"
},
{
"db": "NVD",
"id": "CVE-2018-3693"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/h:intel:atom_c",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/h:intel:atom_e",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/h:intel:atom_x3",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/h:intel:atom_z",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/h:intel:celeron_j",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/h:intel:celeron_n",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2018-005796"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Red Hat",
"sources": [
{
"db": "PACKETSTORM",
"id": "156020"
},
{
"db": "PACKETSTORM",
"id": "148907"
},
{
"db": "PACKETSTORM",
"id": "153815"
},
{
"db": "PACKETSTORM",
"id": "148898"
},
{
"db": "PACKETSTORM",
"id": "148899"
},
{
"db": "CNNVD",
"id": "CNNVD-201807-884"
}
],
"trust": 1.1
},
"cve": "CVE-2018-3693",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "MEDIUM",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 4.7,
"confidentialityImpact": "COMPLETE",
"exploitabilityScore": 3.4,
"id": "CVE-2018-3693",
"impactScore": 6.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 1.9,
"vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N",
"version": "2.0"
},
{
"accessComplexity": "MEDIUM",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "VULHUB",
"availabilityImpact": "NONE",
"baseScore": 4.7,
"confidentialityImpact": "COMPLETE",
"exploitabilityScore": 3.4,
"id": "VHN-133724",
"impactScore": 6.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 0.1,
"vectorString": "AV:L/AC:M/AU:N/C:C/I:N/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "HIGH",
"attackVector": "LOCAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 5.6,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 1.1,
"id": "CVE-2018-3693",
"impactScore": 4.0,
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "CHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N",
"version": "3.1"
},
{
"attackComplexity": "High",
"attackVector": "Local",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 5.6,
"baseSeverity": "Medium",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "CVE-2018-3693",
"impactScore": null,
"integrityImpact": "None",
"privilegesRequired": "Low",
"scope": "Changed",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2018-3693",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "CVE-2018-3693",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNNVD",
"id": "CNNVD-201807-884",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "VULHUB",
"id": "VHN-133724",
"trust": 0.1,
"value": "MEDIUM"
},
{
"author": "VULMON",
"id": "CVE-2018-3693",
"trust": 0.1,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "VULHUB",
"id": "VHN-133724"
},
{
"db": "VULMON",
"id": "CVE-2018-3693"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005796"
},
{
"db": "CNNVD",
"id": "CNNVD-201807-884"
},
{
"db": "NVD",
"id": "CVE-2018-3693"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Systems with microprocessors utilizing speculative execution and branch prediction may allow unauthorized disclosure of information to an attacker with local user access via a speculative buffer overflow and side-channel analysis. Intel Systems with microprocessors contain information disclosure vulnerabilities.Information may be obtained. Multiple CPU Hardware are prone to an information-disclosure vulnerability. \nAttackers can exploit this issue to obtain sensitive information that may aid in further attacks. ARM CPU is a CPU (central processing unit) product of the British ARM company. Intel CPU is a CPU (central processing unit) product of Intel Corporation of the United States. This vulnerability stems from configuration errors in network systems or products during operation. 7) - aarch64, noarch, ppc64le\n\n3. \n\nBug Fix(es):\n\n* Kernel panic on job cleanup, related to SyS_getdents64 (BZ#1702057)\n\n* Kernel modules generated incorrectly when system is localized to\nnon-English language (BZ#1705285)\n\n* RHEL-Alt-7.6 - Fixup tlbie vs store ordering issue on POWER9 (BZ#1756270)\n\n4. \n1713059 - CVE-2019-3846 kernel: Heap overflow in mwifiex_update_bss_desc_with_ie function in marvell/mwifiex/scan.c\n1716992 - CVE-2019-10126 kernel: Heap overflow in mwifiex_uap_parse_tail_ies function in drivers/net/wireless/marvell/mwifiex/ie.c\n1744130 - CVE-2019-14814 kernel: heap overflow in mwifiex_set_uap_rates() function of Marvell Wifi Driver leading to DoS\n1744137 - CVE-2019-14815 kernel: heap-overflow in mwifiex_set_wmm_params() function of Marvell WiFi driver leading to DoS\n1744149 - CVE-2019-14816 kernel: heap overflow in mwifiex_update_vs_ie() function of Marvell WiFi driver\n1771909 - CVE-2019-17133 kernel: buffer overflow in cfg80211_mgd_wext_giwessid in net/wireless/wext-sme.c\n1777825 - CVE-2019-18660 kernel: (powerpc) incomplete Spectre-RSB mitigation leads to information exposure\n\n6. 7) - noarch, x86_64\n\n3. Description:\n\nThe kernel-rt packages provide the Real Time Linux Kernel, which enables\nfine-tuning for systems with extremely high determinism requirements. \n(BZ#1594915)\n\n4. \n\nBug Fix(es):\n\n* ovl_create can return positive retval and crash the host (BZ#1696290)\n\n* THP: Race between MADV_DONTNEED and NUMA hinting node migration code\n(BZ#1698105)\n\n* RHEL7.6 - Kernel changes for count cache flush Spectre v2 mitigation\n(BZ#1708543)\n\n* Poor system performance from thundering herd of kworkers competing for\nmddev-\u003eflush_bio ownership (BZ#1712762)\n\n* [RHEL7.7] RAID1 `write-behind` causes a kernel panic (BZ#1712999)\n\nEnhancement(s):\n\n* [Intel 7.5 FEAT] i40evf - Update to latest upstream driver version\n(BZ#1722774)\n\n* [netdrv] i40e/i40evf: Fix use after free in Rx cleanup path [7.4.z]\n(BZ#1723831)\n\nUsers of kernel are advised to upgrade to these updated packages, which fix\nthese bugs and add these enhancements. 6) - i386, x86_64\n\n3. \n\nBug Fix(es):\n\n* The Least recently used (LRU) operations are batched by caching pages in\nper-cpu page vectors to prevent contention of the heavily used lru_lock\nspinlock. The page vectors can hold even the compound pages. Previously,\nthe page vectors were cleared only if they were full. Subsequently, the\namount of memory held in page vectors, which is not reclaimable, was\nsometimes too high. Consequently the page reclamation started the Out of\nMemory (OOM) killing processes. With this update, the underlying source\ncode has been fixed to clear LRU page vectors each time when a compound\npage is added to them. As a result, OOM killing processes due to high\namounts of memory held in page vectors no longer occur. (BZ#1575819)\n\n4. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA256\n\n==================================================================== \nRed Hat Security Advisory\n\nSynopsis: Important: kernel security and bug fix update\nAdvisory ID: RHSA-2018:2384-01\nProduct: Red Hat Enterprise Linux\nAdvisory URL: https://access.redhat.com/errata/RHSA-2018:2384\nIssue date: 2018-08-14\nCVE Names: CVE-2017-13215 CVE-2018-3620 CVE-2018-3646\n CVE-2018-3693 CVE-2018-5390 CVE-2018-7566\n CVE-2018-10675\n====================================================================\n1. Summary:\n\nAn update for kernel is now available for Red Hat Enterprise Linux 7. \n\nRed Hat Product Security has rated this update as having a security impact\nof Important. A Common Vulnerability Scoring System (CVSS) base score,\nwhich gives a detailed severity rating, is available for each vulnerability\nfrom the CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat Enterprise Linux Client (v. 7) - noarch, x86_64\nRed Hat Enterprise Linux Client Optional (v. 7) - x86_64\nRed Hat Enterprise Linux ComputeNode (v. 7) - noarch, x86_64\nRed Hat Enterprise Linux ComputeNode Optional (v. 7) - x86_64\nRed Hat Enterprise Linux Server (v. 7) - noarch, ppc64, ppc64le, s390x, x86_64\nRed Hat Enterprise Linux Server Optional (v. 7) - ppc64, ppc64le, x86_64\nRed Hat Enterprise Linux Workstation (v. 7) - noarch, x86_64\nRed Hat Enterprise Linux Workstation Optional (v. 7) - x86_64\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7) - noarch, ppc64le, s390x\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server Optional (v. 7) - noarch, ppc64le\n\n3. Description:\n\nThe kernel packages contain the Linux kernel, the core of any Linux\noperating system. \n\nSecurity Fix(es):\n\n* Modern operating systems implement virtualization of physical memory to\nefficiently use available system resources and provide inter-domain\nprotection through access control and isolation. The L1TF issue was found\nin the way the x86 microprocessor designs have implemented speculative\nexecution of instructions (a commonly used performance optimisation) in\ncombination with handling of page-faults caused by terminated virtual to\nphysical address resolving process. As a result, an unprivileged attacker\ncould use this flaw to read privileged memory of the kernel or other\nprocesses and/or cross guest/host boundaries to read host memory by\nconducting targeted cache side-channel attacks. (CVE-2018-3620,\nCVE-2018-3646)\n\n* An industry-wide issue was found in the way many modern microprocessor\ndesigns have implemented speculative execution of instructions past bounds\ncheck. The flaw relies on the presence of a precisely-defined instruction\nsequence in the privileged code and the fact that memory writes occur to an\naddress which depends on the untrusted value. Such writes cause an update\ninto the microprocessor\u0027s data cache even for speculatively executed\ninstructions that never actually commit (retire). As a result, an\nunprivileged attacker could use this flaw to influence speculative\nexecution and/or read privileged memory by conducting targeted cache\nside-channel attacks. (CVE-2018-3693)\n\n* A flaw named SegmentSmack was found in the way the Linux kernel handled\nspecially crafted TCP packets. A remote attacker could use this flaw to\ntrigger time and calculation expensive calls to tcp_collapse_ofo_queue()\nand tcp_prune_ofo_queue() functions by sending specially modified packets\nwithin ongoing TCP sessions which could lead to a CPU saturation and hence\na denial of service on the system. Maintaining the denial of service\ncondition requires continuous two-way TCP sessions to a reachable open\nport, thus the attacks cannot be performed using spoofed IP addresses. \n(CVE-2018-5390)\n\n* kernel: crypto: privilege escalation in skcipher_recvmsg function\n(CVE-2017-13215)\n\n* kernel: mm: use-after-free in do_get_mempolicy function allows local DoS\nor other unspecified impact (CVE-2018-10675)\n\n* kernel: race condition in snd_seq_write() may lead to UAF or OOB access\n(CVE-2018-7566)\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, and other related information, refer to the CVE page(s) listed in\nthe References section. \n\nRed Hat would like to thank Intel OSSIRT (Intel.com) for reporting\nCVE-2018-3620 and CVE-2018-3646; Vladimir Kiriansky (MIT) and Carl\nWaldspurger (Carl Waldspurger Consulting) for reporting CVE-2018-3693; and\nJuha-Matti Tilli (Aalto University, Department of Communications and\nNetworking and Nokia Bell Labs) for reporting CVE-2018-5390. \n\nBug Fix(es):\n\nThese updated kernel packages include also numerous bug fixes. Space\nprecludes documenting all of the bug fixes in this advisory. See the\ndescriptions in the related Knowledge Article:\n\nhttps://access.redhat.com/articles/3527791\n\n4. Solution:\n\nFor details on how to apply this update, which includes the changes\ndescribed in this advisory, refer to:\n\nhttps://access.redhat.com/articles/11258\n\nThe system must be rebooted for this update to take effect. \n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1535173 - CVE-2017-13215 kernel: crypto: privilege escalation in skcipher_recvmsg function\n1550142 - CVE-2018-7566 kernel: race condition in snd_seq_write() may lead to UAF or OOB-access\n1575065 - CVE-2018-10675 kernel: mm: use-after-free in do_get_mempolicy function allows local DoS or other unspecified impact\n1581650 - CVE-2018-3693 Kernel: speculative bounds check bypass store\n1585005 - CVE-2018-3646 Kernel: hw: cpu: L1 terminal fault (L1TF)\n1601704 - CVE-2018-5390 kernel: TCP segments with random offsets allow a remote denial of service (SegmentSmack)\n\n6. Package List:\n\nRed Hat Enterprise Linux Client (v. 7):\n\nSource:\nkernel-3.10.0-862.11.6.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-862.11.6.el7.noarch.rpm\n\nx86_64:\nkernel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-headers-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm\nperf-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Client Optional (v. 7):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode (v. 7):\n\nSource:\nkernel-3.10.0-862.11.6.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-862.11.6.el7.noarch.rpm\n\nx86_64:\nkernel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-headers-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm\nperf-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode Optional (v. 7):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server (v. 7):\n\nSource:\nkernel-3.10.0-862.11.6.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-862.11.6.el7.noarch.rpm\n\nppc64:\nkernel-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-bootwrapper-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debug-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debuginfo-common-ppc64-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-devel-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-headers-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-tools-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.ppc64.rpm\nperf-3.10.0-862.11.6.el7.ppc64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\npython-perf-3.10.0-862.11.6.el7.ppc64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\n\nppc64le:\nkernel-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-bootwrapper-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debug-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-devel-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-headers-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.ppc64le.rpm\nperf-3.10.0-862.11.6.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\npython-perf-3.10.0-862.11.6.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\n\ns390x:\nkernel-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debug-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debuginfo-common-s390x-3.10.0-862.11.6.el7.s390x.rpm\nkernel-devel-3.10.0-862.11.6.el7.s390x.rpm\nkernel-headers-3.10.0-862.11.6.el7.s390x.rpm\nkernel-kdump-3.10.0-862.11.6.el7.s390x.rpm\nkernel-kdump-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\nkernel-kdump-devel-3.10.0-862.11.6.el7.s390x.rpm\nperf-3.10.0-862.11.6.el7.s390x.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\npython-perf-3.10.0-862.11.6.el7.s390x.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\n\nx86_64:\nkernel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-headers-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm\nperf-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7):\n\nnoarch:\nkernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-862.11.6.el7.noarch.rpm\n\nppc64le:\nkernel-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-bootwrapper-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debug-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-devel-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-headers-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.ppc64le.rpm\nperf-3.10.0-862.11.6.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\npython-perf-3.10.0-862.11.6.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\n\ns390x:\nkernel-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debug-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debuginfo-common-s390x-3.10.0-862.11.6.el7.s390x.rpm\nkernel-devel-3.10.0-862.11.6.el7.s390x.rpm\nkernel-headers-3.10.0-862.11.6.el7.s390x.rpm\nkernel-kdump-3.10.0-862.11.6.el7.s390x.rpm\nkernel-kdump-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\nkernel-kdump-devel-3.10.0-862.11.6.el7.s390x.rpm\nperf-3.10.0-862.11.6.el7.s390x.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\npython-perf-3.10.0-862.11.6.el7.s390x.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\n\nRed Hat Enterprise Linux Server Optional (v. 7):\n\nppc64:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debuginfo-common-ppc64-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.ppc64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\n\nppc64le:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server Optional (v. 7):\n\nnoarch:\nkernel-doc-3.10.0-862.11.6.el7.noarch.rpm\n\nppc64le:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\n\nRed Hat Enterprise Linux Workstation (v. 7):\n\nSource:\nkernel-3.10.0-862.11.6.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-862.11.6.el7.noarch.rpm\n\nx86_64:\nkernel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-headers-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm\nperf-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Workstation Optional (v. 7):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security. Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. References:\n\nhttps://access.redhat.com/security/cve/CVE-2017-13215\nhttps://access.redhat.com/security/cve/CVE-2018-3620\nhttps://access.redhat.com/security/cve/CVE-2018-3646\nhttps://access.redhat.com/security/cve/CVE-2018-3693\nhttps://access.redhat.com/security/cve/CVE-2018-5390\nhttps://access.redhat.com/security/cve/CVE-2018-7566\nhttps://access.redhat.com/security/cve/CVE-2018-10675\nhttps://access.redhat.com/security/updates/classification/#important\nhttps://access.redhat.com/security/vulnerabilities/L1TF\nhttps://access.redhat.com/articles/3527791\n\n8. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2018 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niQIVAwUBW3MjONzjgjWX9erEAQioYA/9Ge//K50oCrGaDEMuI2PHYLcztiZt9meh\nC578LP6sC/HT17VAbV8C+Tvy9QBCU80t4mGU4GOPu8Q5HzZQv45n0NtdRTGCC+yb\nA1bFcf0vhXIALNsuDEZN9g5SwUBapxkRoh43R+E7ITCQWp0XIPaSjYgGNqpTTuD/\nlxRCzc10HhxW+pUY+ERFcK6c0poc14FtSqM3GqZe10FhkykdIlmngFjkthjzefXO\ndUkYDy53G+iAdTrVFI03h3Wt+UBMmNwKtu8ydqtAxZ0zDZIP5ijASOtM4mlf77ec\nVsNn7OWythkpTcpa+Sh5+dk6DK+lU2vziVsEocYNpzB+T/aHC9n/+I8ibfp3B4DC\nk4lYqZJQDFR2jVABjkOVS9dWFlOYKFmU2JBwsqdRvt3rgVFXEH3n5OQydHGFskmP\nNFwDbRAFlwo3zjd9KuiQzdFTOensc35+eSHykY8nxY2hGMH5gGccShFL4C7N2mtx\ns8JnzA/Zj00VHMg8qIHGfQ7RSd/xyEJ5vn87WZcTshTNli6x1/0VnzpTKG85Ga+K\nS2EJDXFP9LqCT98TL1RDJmCTtfDjU3I/gbgu5xFaofQZfV48qAUomUQ2E+MhQAOX\neBr/OvlfFP8HEwVEJBDtXKxxs1LgmjTSqOtfP8AvS5zI9/Y6o56i0d7Ng1CcaGKP\nlZgWJhC3Yik=i4St\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://www.redhat.com/mailman/listinfo/rhsa-announce\n",
"sources": [
{
"db": "NVD",
"id": "CVE-2018-3693"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005796"
},
{
"db": "BID",
"id": "108004"
},
{
"db": "VULHUB",
"id": "VHN-133724"
},
{
"db": "VULMON",
"id": "CVE-2018-3693"
},
{
"db": "PACKETSTORM",
"id": "156020"
},
{
"db": "PACKETSTORM",
"id": "148907"
},
{
"db": "PACKETSTORM",
"id": "153815"
},
{
"db": "PACKETSTORM",
"id": "148898"
},
{
"db": "PACKETSTORM",
"id": "148899"
}
],
"trust": 2.52
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2018-3693",
"trust": 3.4
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005796",
"trust": 0.8
},
{
"db": "CNNVD",
"id": "CNNVD-201807-884",
"trust": 0.7
},
{
"db": "PACKETSTORM",
"id": "156020",
"trust": 0.7
},
{
"db": "PACKETSTORM",
"id": "153815",
"trust": 0.7
},
{
"db": "AUSCERT",
"id": "ESB-2019.2861",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2020.0226",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.3234.2",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.0544",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.1899",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.1926",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.0726",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.3234.3",
"trust": 0.6
},
{
"db": "BID",
"id": "108004",
"trust": 0.3
},
{
"db": "VULHUB",
"id": "VHN-133724",
"trust": 0.1
},
{
"db": "VULMON",
"id": "CVE-2018-3693",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148907",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148898",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148899",
"trust": 0.1
}
],
"sources": [
{
"db": "VULHUB",
"id": "VHN-133724"
},
{
"db": "VULMON",
"id": "CVE-2018-3693"
},
{
"db": "BID",
"id": "108004"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005796"
},
{
"db": "PACKETSTORM",
"id": "156020"
},
{
"db": "PACKETSTORM",
"id": "148907"
},
{
"db": "PACKETSTORM",
"id": "153815"
},
{
"db": "PACKETSTORM",
"id": "148898"
},
{
"db": "PACKETSTORM",
"id": "148899"
},
{
"db": "CNNVD",
"id": "CNNVD-201807-884"
},
{
"db": "NVD",
"id": "CVE-2018-3693"
}
]
},
"id": "VAR-201807-2218",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "VULHUB",
"id": "VHN-133724"
}
],
"trust": 0.8213039427272727
},
"last_update_date": "2024-11-23T20:59:25.282000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "INTEL-OSS-10002",
"trust": 0.8,
"url": "https://01.org/security/advisories/intel-oss-10002"
},
{
"title": "Red Hat: Important: kernel security, bug fix, and enhancement update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20191946 - Security Advisory"
},
{
"title": "Red Hat: Important: kernel-rt security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20182395 - Security Advisory"
},
{
"title": "Red Hat: Important: kernel security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20182384 - Security Advisory"
},
{
"title": "Red Hat: CVE-2018-3693",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_cve_database\u0026qid=CVE-2018-3693"
},
{
"title": "Red Hat: Important: kernel security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20182390 - Security Advisory"
},
{
"title": "Red Hat: Important: kernel-alt security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20200174 - Security Advisory"
},
{
"title": "Amazon Linux AMI: ALAS-2018-1038",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux_ami\u0026qid=ALAS-2018-1038"
},
{
"title": "Amazon Linux 2: ALAS2-2018-1038",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux2\u0026qid=ALAS2-2018-1038"
},
{
"title": "IBM: IBM Security Bulletin: IBM Security Guardium is affected by Red Hat kernel vulnerabilities",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=75b9d198a73a91d81765c8b428423224"
},
{
"title": "Oracle Linux Bulletins: Oracle Linux Bulletin - July 2018",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=oracle_linux_bulletins\u0026qid=204a1aa9ebf7b5f47151e8b011269862"
},
{
"title": "Fortinet Security Advisories: Meltdown and Spectre class vulnerabilities",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=fortinet_security_advisories\u0026qid=FG-IR-18-002"
},
{
"title": "IBM: IBM Security Bulletin: IBM has announced a release for IBM Security Identity Governance and Intelligence in response to multiple security vulnerabilities",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=55ea315dfb69fce8383762ac64250315"
},
{
"title": "Spectre and Meltdown Guidance",
"trust": 0.1,
"url": "https://github.com/danswinus/HWFW "
},
{
"title": "Transient Execution Attack Pot",
"trust": 0.1,
"url": "https://github.com/github-3rr0r/TEApot "
},
{
"title": "Transient Execution Attack Pot",
"trust": 0.1,
"url": "https://github.com/Mashiro1995/TEApot "
},
{
"title": "Hardware attacks / State of the art",
"trust": 0.1,
"url": "https://github.com/codexlynx/hardware-attacks-state-of-the-art "
},
{
"title": "Awesome CVE PoC",
"trust": 0.1,
"url": "https://github.com/lnick2023/nicenice "
},
{
"title": "Awesome CVE PoC",
"trust": 0.1,
"url": "https://github.com/xbl3/awesome-cve-poc_qazbnm456 "
},
{
"title": "Awesome CVE PoC",
"trust": 0.1,
"url": "https://github.com/qazbnm456/awesome-cve-poc "
},
{
"title": "Securelist",
"trust": 0.1,
"url": "https://securelist.com/kaspersky-security-bulletin-2018-top-security-stories/89118/"
}
],
"sources": [
{
"db": "VULMON",
"id": "CVE-2018-3693"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005796"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "NVD-CWE-noinfo",
"trust": 1.0
},
{
"problemtype": "CWE-200",
"trust": 0.9
}
],
"sources": [
{
"db": "VULHUB",
"id": "VHN-133724"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005796"
},
{
"db": "NVD",
"id": "CVE-2018-3693"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.6,
"url": "https://access.redhat.com/errata/rhsa-2019:1946"
},
{
"trust": 2.5,
"url": "https://access.redhat.com/errata/rhsa-2020:0174"
},
{
"trust": 2.4,
"url": "https://www.oracle.com/security-alerts/cpuoct2020.html"
},
{
"trust": 2.2,
"url": "https://access.redhat.com/errata/rhsa-2018:2384"
},
{
"trust": 2.2,
"url": "https://access.redhat.com/errata/rhsa-2018:2390"
},
{
"trust": 2.2,
"url": "https://access.redhat.com/errata/rhsa-2018:2395"
},
{
"trust": 2.1,
"url": "https://security.netapp.com/advisory/ntap-20180823-0001/"
},
{
"trust": 1.8,
"url": "https://cdrdv2.intel.com/v1/dl/getcontent/685359"
},
{
"trust": 1.8,
"url": "https://help.ecostruxureit.com/display/public/uadce725/security+fixes+in+struxureware+data+center+expert+v7.6.0"
},
{
"trust": 1.8,
"url": "https://www.oracle.com/security-alerts/cpujul2020.html"
},
{
"trust": 1.8,
"url": "https://www.oracle.com/technetwork/security-advisory/cpuapr2019-5072813.html"
},
{
"trust": 1.3,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-3693"
},
{
"trust": 0.9,
"url": "https://www.suse.com/support/kb/doc/?id=7023075"
},
{
"trust": 0.9,
"url": "https://01.org/security/advisories/intel-oss-10002"
},
{
"trust": 0.8,
"url": "https://access.redhat.com/security/cve/cve-2018-3693"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-3693"
},
{
"trust": 0.6,
"url": "https://thehackernews.com/2018/07/intel-spectre-vulnerability.html"
},
{
"trust": 0.6,
"url": "https://support.f5.com/csp/article/k54252492"
},
{
"trust": 0.6,
"url": "https://fortiguard.com/psirt/fg-ir-18-002"
},
{
"trust": 0.6,
"url": "http://www.ibm.com/support/docview.wss?uid=ibm10872142"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/75922"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.3234.2/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.3234.3/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/76682"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2020.0226/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.2861/"
},
{
"trust": 0.6,
"url": "https://packetstormsecurity.com/files/153815/red-hat-security-advisory-2019-1946-01.html"
},
{
"trust": 0.6,
"url": "https://packetstormsecurity.com/files/156020/red-hat-security-advisory-2020-0174-01.html"
},
{
"trust": 0.6,
"url": "http://www.ibm.com/support/docview.wss?uid=ibm10872470"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.1926/"
},
{
"trust": 0.6,
"url": "https://www-01.ibm.com/support/docview.wss?uid=ibm10872142"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.1899/"
},
{
"trust": 0.5,
"url": "https://access.redhat.com/security/updates/classification/#important"
},
{
"trust": 0.5,
"url": "https://access.redhat.com/articles/11258"
},
{
"trust": 0.5,
"url": "https://access.redhat.com/security/team/contact/"
},
{
"trust": 0.5,
"url": "https://www.redhat.com/mailman/listinfo/rhsa-announce"
},
{
"trust": 0.5,
"url": "https://bugzilla.redhat.com/):"
},
{
"trust": 0.5,
"url": "https://access.redhat.com/security/team/key/"
},
{
"trust": 0.3,
"url": "http://www.amd.com/en-gb"
},
{
"trust": 0.3,
"url": "https://www.arm.com/"
},
{
"trust": 0.3,
"url": "http://www.intel.com/content/www/us/en/homepage.html"
},
{
"trust": 0.3,
"url": "https://www.intel.in/content/www/in/en/support/articles/000029382/processors.html"
},
{
"trust": 0.3,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=1581650"
},
{
"trust": 0.3,
"url": "https://www.ibm.com/blogs/psirt/ibm-security-bulletin-ibm-has-announced-a-release-for-ibm-security-identity-governance-and-intelligence-in-response-to-multiple-security-vulnerabilities-2/"
},
{
"trust": 0.3,
"url": "https://www-01.ibm.com/support/docview.wss?uid=ibm10742755"
},
{
"trust": 0.3,
"url": "https://people.csail.mit.edu/vlk/spectre11.pdf"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/vulnerabilities/l1tf"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-7566"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-3620"
},
{
"trust": 0.3,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-7566"
},
{
"trust": 0.3,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-3620"
},
{
"trust": 0.3,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-3646"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-3646"
},
{
"trust": 0.2,
"url": "https://access.redhat.com/solutions/3523601"
},
{
"trust": 0.2,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-13215"
},
{
"trust": 0.2,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-5390"
},
{
"trust": 0.2,
"url": "https://access.redhat.com/security/cve/cve-2017-13215"
},
{
"trust": 0.2,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-10675"
},
{
"trust": 0.2,
"url": "https://access.redhat.com/security/cve/cve-2018-5390"
},
{
"trust": 0.2,
"url": "https://access.redhat.com/security/cve/cve-2018-10675"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/.html"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov"
},
{
"trust": 0.1,
"url": "https://github.com/github-3rr0r/teapot"
},
{
"trust": 0.1,
"url": "https://tools.cisco.com/security/center/viewalert.x?alertid=58431"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-14815"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-14815"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-18660"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-18559"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-3846"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-17133"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-3846"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8912"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-14816"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-11487"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-11487"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-10126"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-18559"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-8912"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-18660"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-14814"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-14816"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-17133"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-14814"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-10126"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-15129"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-12154"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-14633"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-12154"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-14633"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-15274"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-15129"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-15274"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-15265"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-15265"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-1000004"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-0861"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-0861"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-10901"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1000004"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-10901"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/articles/3527791"
}
],
"sources": [
{
"db": "VULHUB",
"id": "VHN-133724"
},
{
"db": "VULMON",
"id": "CVE-2018-3693"
},
{
"db": "BID",
"id": "108004"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005796"
},
{
"db": "PACKETSTORM",
"id": "156020"
},
{
"db": "PACKETSTORM",
"id": "148907"
},
{
"db": "PACKETSTORM",
"id": "153815"
},
{
"db": "PACKETSTORM",
"id": "148898"
},
{
"db": "PACKETSTORM",
"id": "148899"
},
{
"db": "CNNVD",
"id": "CNNVD-201807-884"
},
{
"db": "NVD",
"id": "CVE-2018-3693"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "VULHUB",
"id": "VHN-133724"
},
{
"db": "VULMON",
"id": "CVE-2018-3693"
},
{
"db": "BID",
"id": "108004"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005796"
},
{
"db": "PACKETSTORM",
"id": "156020"
},
{
"db": "PACKETSTORM",
"id": "148907"
},
{
"db": "PACKETSTORM",
"id": "153815"
},
{
"db": "PACKETSTORM",
"id": "148898"
},
{
"db": "PACKETSTORM",
"id": "148899"
},
{
"db": "CNNVD",
"id": "CNNVD-201807-884"
},
{
"db": "NVD",
"id": "CVE-2018-3693"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2018-07-10T00:00:00",
"db": "VULHUB",
"id": "VHN-133724"
},
{
"date": "2018-07-10T00:00:00",
"db": "VULMON",
"id": "CVE-2018-3693"
},
{
"date": "2018-07-10T00:00:00",
"db": "BID",
"id": "108004"
},
{
"date": "2018-07-30T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2018-005796"
},
{
"date": "2020-01-21T19:10:15",
"db": "PACKETSTORM",
"id": "156020"
},
{
"date": "2018-08-15T04:40:44",
"db": "PACKETSTORM",
"id": "148907"
},
{
"date": "2019-07-30T18:19:52",
"db": "PACKETSTORM",
"id": "153815"
},
{
"date": "2018-08-15T04:37:29",
"db": "PACKETSTORM",
"id": "148898"
},
{
"date": "2018-08-15T04:37:37",
"db": "PACKETSTORM",
"id": "148899"
},
{
"date": "2018-07-11T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201807-884"
},
{
"date": "2018-07-10T21:29:01.340000",
"db": "NVD",
"id": "CVE-2018-3693"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2021-11-19T00:00:00",
"db": "VULHUB",
"id": "VHN-133724"
},
{
"date": "2022-04-18T00:00:00",
"db": "VULMON",
"id": "CVE-2018-3693"
},
{
"date": "2018-07-10T00:00:00",
"db": "BID",
"id": "108004"
},
{
"date": "2018-07-30T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2018-005796"
},
{
"date": "2021-11-23T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201807-884"
},
{
"date": "2024-11-21T04:05:53.970000",
"db": "NVD",
"id": "CVE-2018-3693"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "local",
"sources": [
{
"db": "BID",
"id": "108004"
},
{
"db": "CNNVD",
"id": "CNNVD-201807-884"
}
],
"trust": 0.9
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Intel Information disclosure vulnerability in systems with microprocessors",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2018-005796"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "information disclosure",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201807-884"
}
],
"trust": 0.6
}
}
var-202109-1928
Vulnerability from variot
This vulnerability allows remote attackers to execute arbitrary code on affected installations of Schneider Electric Struxureware Data Center Expert. Authentication is required to exploit this vulnerability.The specific flaw exists within the handling of firmware updates. The issue results from the lack of proper validation of a user-supplied path prior to using it in file operations. An attacker can leverage this vulnerability to execute code in the context of root
Show details on source website{
"affected_products": {
"_id": null,
"data": [
{
"_id": null,
"model": "struxureware data center expert",
"scope": null,
"trust": 0.7,
"vendor": "schneider electric",
"version": null
}
],
"sources": [
{
"db": "ZDI",
"id": "ZDI-21-1071"
}
]
},
"credits": {
"_id": null,
"data": "David Yesland",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-990"
},
{
"db": "ZDI",
"id": "ZDI-21-1071"
}
],
"trust": 1.3
},
"cve": "CVE-2021-22794",
"cvss": {
"_id": null,
"data": [
{
"cvssV2": [],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"author": "ZDI",
"availabilityImpact": "HIGH",
"baseScore": 8.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 2.8,
"id": "CVE-2021-22794",
"impactScore": 5.9,
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"trust": 0.7,
"userInteraction": "NONE",
"vectorString": "AV:N/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "ZDI",
"id": "CVE-2021-22794",
"trust": 0.7,
"value": "HIGH"
},
{
"author": "CNNVD",
"id": "CNNVD-202109-990",
"trust": 0.6,
"value": "HIGH"
}
]
}
],
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-990"
},
{
"db": "ZDI",
"id": "ZDI-21-1071"
}
]
},
"description": {
"_id": null,
"data": "This vulnerability allows remote attackers to execute arbitrary code on affected installations of Schneider Electric Struxureware Data Center Expert. Authentication is required to exploit this vulnerability.The specific flaw exists within the handling of firmware updates. The issue results from the lack of proper validation of a user-supplied path prior to using it in file operations. An attacker can leverage this vulnerability to execute code in the context of root",
"sources": [
{
"db": "ZDI",
"id": "ZDI-21-1071"
},
{
"db": "VULMON",
"id": "CVE-2021-22794"
}
],
"trust": 0.72
},
"external_ids": {
"_id": null,
"data": [
{
"db": "NVD",
"id": "CVE-2021-22794",
"trust": 1.4
},
{
"db": "ZDI",
"id": "ZDI-21-1071",
"trust": 1.4
},
{
"db": "ZDI_CAN",
"id": "ZDI-CAN-13077",
"trust": 0.7
},
{
"db": "MCAFEE",
"id": "SB20210",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2021.3095",
"trust": 0.6
},
{
"db": "ICS CERT",
"id": "ICSA-21-257-03",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202109-990",
"trust": 0.6
},
{
"db": "VULMON",
"id": "CVE-2021-22794",
"trust": 0.1
}
],
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-990"
},
{
"db": "VULMON",
"id": "CVE-2021-22794"
},
{
"db": "ZDI",
"id": "ZDI-21-1071"
}
]
},
"id": "VAR-202109-1928",
"iot": {
"_id": null,
"data": true,
"sources": [
{
"db": "VARIoT devices database",
"id": null
}
],
"trust": 0.1196509
},
"last_update_date": "2021-12-18T15:40:54.484000Z",
"patch": {
"_id": null,
"data": [
{
"title": "Schneider Electric has issued an update to correct this vulnerability.",
"trust": 0.7,
"url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-257-03"
},
{
"title": "Schneider Electric Struxureware Data Center Expert Repair measures for path traversal vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqbyid.tag?id=162792"
}
],
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-990"
},
{
"db": "ZDI",
"id": "ZDI-21-1071"
}
]
},
"references": {
"_id": null,
"data": [
{
"trust": 1.3,
"url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-257-03"
},
{
"trust": 0.7,
"url": "https://www.zerodayinitiative.com/advisories/zdi-21-1071/"
},
{
"trust": 0.6,
"url": "https://www.cybersecurity-help.cz/vdb/sb2021091511"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2021.3095"
}
],
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-990"
},
{
"db": "VULMON",
"id": "CVE-2021-22794"
},
{
"db": "ZDI",
"id": "ZDI-21-1071"
}
]
},
"sources": {
"_id": null,
"data": [
{
"db": "CNNVD",
"id": "CNNVD-202109-990",
"ident": null
},
{
"db": "VULMON",
"id": "CVE-2021-22794",
"ident": null
},
{
"db": "ZDI",
"id": "ZDI-21-1071",
"ident": null
}
]
},
"sources_release_date": {
"_id": null,
"data": [
{
"date": "2021-09-14T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202109-990",
"ident": null
},
{
"date": null,
"db": "VULMON",
"id": "CVE-2021-22794",
"ident": null
},
{
"date": "2021-09-15T00:00:00",
"db": "ZDI",
"id": "ZDI-21-1071",
"ident": null
}
]
},
"sources_update_date": {
"_id": null,
"data": [
{
"date": "2021-09-16T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202109-990",
"ident": null
},
{
"date": null,
"db": "VULMON",
"id": "CVE-2021-22794",
"ident": null
},
{
"date": "2021-09-15T00:00:00",
"db": "ZDI",
"id": "ZDI-21-1071",
"ident": null
}
]
},
"threat_type": {
"_id": null,
"data": "remote",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-990"
}
],
"trust": 0.6
},
"title": {
"_id": null,
"data": "Schneider Electric Struxureware Data Center Expert Directory Traversal Remote Code Execution Vulnerability",
"sources": [
{
"db": "ZDI",
"id": "ZDI-21-1071"
}
],
"trust": 0.7
},
"type": {
"_id": null,
"data": "path traversal",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-990"
}
],
"trust": 0.6
}
}
var-202109-1929
Vulnerability from variot
This vulnerability allows remote attackers to execute arbitrary code on affected installations of Schneider Electric Struxureware Data Center Expert. Authentication is required to exploit this vulnerability.The specific flaw exists within the testRepository method. The issue results from the lack of proper validation of a user-supplied string before using it to execute a system call. An attacker can leverage this vulnerability to execute code in the context of root
Show details on source website{
"affected_products": {
"_id": null,
"data": [
{
"_id": null,
"model": "struxureware data center expert",
"scope": null,
"trust": 0.7,
"vendor": "schneider electric",
"version": null
}
],
"sources": [
{
"db": "ZDI",
"id": "ZDI-21-1072"
}
]
},
"credits": {
"_id": null,
"data": "David Yesland",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-989"
},
{
"db": "ZDI",
"id": "ZDI-21-1072"
}
],
"trust": 1.3
},
"cve": "CVE-2021-22795",
"cvss": {
"_id": null,
"data": [
{
"cvssV2": [],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"author": "ZDI",
"availabilityImpact": "HIGH",
"baseScore": 8.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 2.8,
"id": "CVE-2021-22795",
"impactScore": 5.9,
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"trust": 0.7,
"userInteraction": "NONE",
"vectorString": "AV:N/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "ZDI",
"id": "CVE-2021-22795",
"trust": 0.7,
"value": "HIGH"
},
{
"author": "CNNVD",
"id": "CNNVD-202109-989",
"trust": 0.6,
"value": "HIGH"
}
]
}
],
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-989"
},
{
"db": "ZDI",
"id": "ZDI-21-1072"
}
]
},
"description": {
"_id": null,
"data": "This vulnerability allows remote attackers to execute arbitrary code on affected installations of Schneider Electric Struxureware Data Center Expert. Authentication is required to exploit this vulnerability.The specific flaw exists within the testRepository method. The issue results from the lack of proper validation of a user-supplied string before using it to execute a system call. An attacker can leverage this vulnerability to execute code in the context of root",
"sources": [
{
"db": "ZDI",
"id": "ZDI-21-1072"
},
{
"db": "VULMON",
"id": "CVE-2021-22795"
}
],
"trust": 0.72
},
"external_ids": {
"_id": null,
"data": [
{
"db": "NVD",
"id": "CVE-2021-22795",
"trust": 1.4
},
{
"db": "ZDI",
"id": "ZDI-21-1072",
"trust": 1.4
},
{
"db": "ZDI_CAN",
"id": "ZDI-CAN-13553",
"trust": 0.7
},
{
"db": "MCAFEE",
"id": "SB20210",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2021.3095",
"trust": 0.6
},
{
"db": "ICS CERT",
"id": "ICSA-21-257-03",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202109-989",
"trust": 0.6
},
{
"db": "VULMON",
"id": "CVE-2021-22795",
"trust": 0.1
}
],
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-989"
},
{
"db": "VULMON",
"id": "CVE-2021-22795"
},
{
"db": "ZDI",
"id": "ZDI-21-1072"
}
]
},
"id": "VAR-202109-1929",
"iot": {
"_id": null,
"data": true,
"sources": [
{
"db": "VARIoT devices database",
"id": null
}
],
"trust": 0.1196509
},
"last_update_date": "2021-12-18T15:40:54.171000Z",
"patch": {
"_id": null,
"data": [
{
"title": "Schneider Electric has issued an update to correct this vulnerability.",
"trust": 0.7,
"url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-257-03"
},
{
"title": "Schneider Electric Struxureware Data Center Expert Fixes for operating system command injection vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqbyid.tag?id=162791"
}
],
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-989"
},
{
"db": "ZDI",
"id": "ZDI-21-1072"
}
]
},
"references": {
"_id": null,
"data": [
{
"trust": 1.3,
"url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-257-03"
},
{
"trust": 0.7,
"url": "https://www.zerodayinitiative.com/advisories/zdi-21-1072/"
},
{
"trust": 0.6,
"url": "https://www.cybersecurity-help.cz/vdb/sb2021091511"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2021.3095"
}
],
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-989"
},
{
"db": "VULMON",
"id": "CVE-2021-22795"
},
{
"db": "ZDI",
"id": "ZDI-21-1072"
}
]
},
"sources": {
"_id": null,
"data": [
{
"db": "CNNVD",
"id": "CNNVD-202109-989",
"ident": null
},
{
"db": "VULMON",
"id": "CVE-2021-22795",
"ident": null
},
{
"db": "ZDI",
"id": "ZDI-21-1072",
"ident": null
}
]
},
"sources_release_date": {
"_id": null,
"data": [
{
"date": "2021-09-14T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202109-989",
"ident": null
},
{
"date": null,
"db": "VULMON",
"id": "CVE-2021-22795",
"ident": null
},
{
"date": "2021-09-15T00:00:00",
"db": "ZDI",
"id": "ZDI-21-1072",
"ident": null
}
]
},
"sources_update_date": {
"_id": null,
"data": [
{
"date": "2021-09-16T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202109-989",
"ident": null
},
{
"date": null,
"db": "VULMON",
"id": "CVE-2021-22795",
"ident": null
},
{
"date": "2021-09-15T00:00:00",
"db": "ZDI",
"id": "ZDI-21-1072",
"ident": null
}
]
},
"threat_type": {
"_id": null,
"data": "remote",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-989"
}
],
"trust": 0.6
},
"title": {
"_id": null,
"data": "Schneider Electric Struxureware Data Center Expert Command Injection Remote Code Execution Vulnerability",
"sources": [
{
"db": "ZDI",
"id": "ZDI-21-1072"
}
],
"trust": 0.7
},
"type": {
"_id": null,
"data": "operating system commend injection",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202109-989"
}
],
"trust": 0.6
}
}
var-201805-0963
Vulnerability from variot
Systems with microprocessors utilizing speculative execution and speculative execution of memory reads before the addresses of all prior memory writes are known may allow unauthorized disclosure of information to an attacker with local user access via a side-channel analysis, aka Speculative Store Bypass (SSB), Variant 4. CPU hardware utilizing speculative execution may be vulnerable to cache timing side-channel analysis. Two vulnerabilities are identified, known as "Variant 3a" and "Variant 4". CPUhardware is firmware that runs in the central processor for managing and controlling the CPU. Multiple CPUHardware information disclosure vulnerabilities. The vulnerability is caused by a race condition in the CPU cache processing. Local attackers can exploit vulnerabilities to obtain sensitive information through side channel analysis. AMD, ARM, and Intel CPUs are all CPU (central processing unit) products from different manufacturers. AMD, ARM, and Intel CPUs have security vulnerabilities. 7) - aarch64, noarch, ppc64le
-
(CVE-2018-3639, aarch64)
-
A flaw named SegmentSmack was found in the way the Linux kernel handled specially crafted TCP packets. A remote attacker could use this flaw to trigger time and calculation expensive calls to tcp_collapse_ofo_queue() and tcp_prune_ofo_queue() functions by sending specially modified packets within ongoing TCP sessions which could lead to a CPU saturation and hence a denial of service on the system. Maintaining the denial of service condition requires continuous two-way TCP sessions to a reachable open port, thus the attacks cannot be performed using spoofed IP addresses. (CVE-2018-5390)
-
A flaw named FragmentSmack was found in the way the Linux kernel handled reassembly of fragmented IPv4 and IPv6 packets. A remote attacker could use this flaw to trigger time and calculation expensive fragment reassembly algorithm by sending specially crafted packets which could lead to a CPU saturation and hence a denial of service on the system. (CVE-2018-5391)
Space precludes documenting all of the security fixes in this advisory. See the descriptions of the remaining security fixes in the related Knowledge Article:
https://access.redhat.com/articles/3658021
For more details about the security issue(s), including the impact, a CVSS score, and other related information, refer to the CVE page(s) listed in the References section. 1623067 - CVE-2018-9363 kernel: Buffer overflow in hidp_process_report 1629636 - CVE-2018-14641 kernel: a bug in ip_frag_reasm() can cause a crash in ip_do_fragment()
-
(CVE-2018-3639, PowerPC)
-
kernel: net/packet: overflow in check for priv area size (CVE-2017-7308)
-
kernel: AIO interface didn't use rw_verify_area() for checking mandatory locking on files and size of access (CVE-2012-6701)
-
kernel: AIO write triggers integer overflow in some protocols (CVE-2015-8830)
-
kernel: Null pointer dereference via keyctl (CVE-2016-8650)
-
kernel: ping socket / AF_LLC connect() sin_family race (CVE-2017-2671)
-
kernel: Race condition between multiple sys_perf_event_open() calls (CVE-2017-6001)
-
kernel: Incorrect error handling in the set_mempolicy and mbind compat syscalls in mm/mempolicy.c (CVE-2017-7616)
-
kernel: mm subsystem does not properly enforce the CONFIG_STRICT_DEVMEM protection mechanism (CVE-2017-7889)
-
kernel: Double free in the inet_csk_clone_lock function in net/ipv4/inet_connection_sock.c (CVE-2017-8890)
-
kernel: net: sctp_v6_create_accept_sk function mishandles inheritance (CVE-2017-9075)
-
kernel: net: IPv6 DCCP implementation mishandles inheritance (CVE-2017-9076)
-
kernel: net: tcp_v6_syn_recv_sock function mishandles inheritance (CVE-2017-9077)
-
kernel: memory leak when merging buffers in SCSI IO vectors (CVE-2017-12190)
-
kernel: vfs: BUG in truncate_inode_pages_range() and fuse client (CVE-2017-15121)
-
kernel: Race condition in drivers/md/dm.c:dm_get_from_kobject() allows local users to cause a denial of service (CVE-2017-18203)
-
kernel: a null pointer dereference in net/dccp/output.c:dccp_write_xmit() leads to a system crash (CVE-2018-1130)
-
kernel: Missing length check of payload in net/sctp/sm_make_chunk.c:_sctp_make_chunk() function allows denial of service (CVE-2018-5803)
For more details about the security issue(s), including the impact, a CVSS score, and other related information, refer to the CVE page(s) listed in the References section. Bugs fixed (https://bugzilla.redhat.com/):
869942 - Kernel crashes on reading an ACL containing 190 ACEs over NFSv4 1314275 - CVE-2015-8830 kernel: AIO write triggers integer overflow in some protocols 1314288 - CVE-2012-6701 kernel: AIO interface didn't use rw_verify_area() for checking mandatory locking on files and size of access 1395187 - CVE-2016-8650 kernel: Null pointer dereference via keyctl 1422825 - CVE-2017-6001 kernel: Race condition between multiple sys_perf_event_open() calls 1436649 - CVE-2017-2671 kernel: ping socket / AF_LLC connect() sin_family race 1437404 - CVE-2017-7308 kernel: net/packet: overflow in check for priv area size 1441088 - CVE-2017-7616 kernel: Incorrect error handling in the set_mempolicy and mbind compat syscalls in mm/mempolicy.c 1444493 - CVE-2017-7889 kernel: mm subsystem does not properly enforce the CONFIG_STRICT_DEVMEM protection mechanism 1448170 - RHEL6.9: sunrpc reconnect logic now may trigger a SYN storm when a TCP connection drops and a burst of RPC commands hit the transport 1450972 - CVE-2017-8890 kernel: Double free in the inet_csk_clone_lock function in net/ipv4/inet_connection_sock.c 1452688 - CVE-2017-9076 kernel: net: IPv6 DCCP implementation mishandles inheritance 1452691 - CVE-2017-9075 kernel: net: sctp_v6_create_accept_sk function mishandles inheritance 1452744 - CVE-2017-9077 kernel: net: tcp_v6_syn_recv_sock function mishandles inheritance 1495089 - CVE-2017-12190 kernel: memory leak when merging buffers in SCSI IO vectors 1497152 - systool causes panic on 2.6.32-696.6.3.el6.x86_64 using be2iscsi 1520893 - CVE-2017-15121 kernel: vfs: BUG in truncate_inode_pages_range() and fuse client 1550811 - CVE-2017-18203 kernel: Race condition in drivers/md/dm.c:dm_get_from_kobject() allows local users to cause a denial of service 1551051 - CVE-2018-5803 kernel: Missing length check of payload in net/sctp/sm_make_chunk.c:_sctp_make_chunk() function allows denial of service 1560494 - i686: Using invpcid_flush_all_nonglobals() can cause user-space panic on .i686 1566890 - CVE-2018-3639 hw: cpu: speculative store bypass 1576419 - CVE-2018-1130 kernel: a null pointer dereference in net/dccp/output.c:dccp_write_xmit() leads to a system crash
-
7) - aarch64, noarch, ppc64le, s390x
-
Description:
The java-1.8.0-openjdk packages provide the OpenJDK 8 Java Runtime Environment and the OpenJDK 8 Java Software Development Kit. (CVE-2018-3639)
Note: This is the OpenJDK side of the CVE-2018-3639 mitigation.
The following packages have been upgraded to a later upstream version: rhevm-setup-plugins (3.6.7). Description:
KVM (Kernel-based Virtual Machine) is a full virtualization solution for Linux on a variety of architectures. The qemu-kvm-rhev packages provide the user-space component for running virtual machines that use KVM in environments managed by Red Hat products.
Bug Fix(es):
-
Previously, using device passthrough for a SCSI-2 device failed and returned an "Illegal Request" error. With this update, the QEMU emulator checks the SCSI version of the device when performing passthrough. (BZ#1571370)
-
Under certain circumstances, resuming a paused guest generated redundant "VIR_DOMAIN_PAUSED_UNKNOWN" error messages in the libvirt log. This update corrects the event sending order when resuming guests, which prevents the errors being logged. (BZ#1588001)
-
Once all virtual machines have shut down, start them again for this update to take effect. -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA256
====================================================================
Red Hat Security Advisory
Synopsis: Important: kernel security and bug fix update Advisory ID: RHSA-2018:2161-01 Product: Red Hat Enterprise Linux Advisory URL: https://access.redhat.com/errata/RHSA-2018:2161 Issue date: 2018-07-10 CVE Names: CVE-2018-3639 ==================================================================== 1. Summary:
An update for kernel is now available for Red Hat Enterprise Linux 7.3 Extended Update Support.
Red Hat Product Security has rated this update as having a security impact of Important. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.
- Relevant releases/architectures:
Red Hat Enterprise Linux ComputeNode EUS (v. 7.3) - noarch, x86_64 Red Hat Enterprise Linux ComputeNode Optional EUS (v. 7.3) - x86_64 Red Hat Enterprise Linux Server EUS (v. 7.3) - noarch, ppc64, ppc64le, s390x, x86_64 Red Hat Enterprise Linux Server Optional EUS (v. 7.3) - ppc64, ppc64le, x86_64
- Description:
The kernel packages contain the Linux kernel, the core of any Linux operating system.
Security Fix(es):
- An industry-wide issue was found in the way many modern microprocessor designs have implemented speculative execution of Load & Store instructions (a commonly used performance optimization). It relies on the presence of a precisely-defined instruction sequence in the privileged code as well as the fact that memory read from address to which a recent memory write has occurred may see an older value and subsequently cause an update into the microprocessor's data cache even for speculatively executed instructions that never actually commit (retire). As a result, an unprivileged attacker could use this flaw to read privileged memory by conducting targeted cache side-channel attacks. (CVE-2018-3639, x86 AMD)
Red Hat would like to thank Ken Johnson (Microsoft Security Response Center) and Jann Horn (Google Project Zero) for reporting this issue.
Bug Fix(es):
-
When a Nonvolatile Memory Express (NVMe) namespace was created, changed, or deleted, an occasional deadlock occurred. With this update, namespace scanning and removal does not hold a mutual exclusion (mutex) program object. As a result, a deadlock no longer occurs in the described scenario. (BZ#1566886)
-
Previously, a live migration of a virtual machine from one host with updated firmware to another host without updated firmware resulted in incorrect kernel settings for Meltdown mitigations, which could leave the kernel vulnerable to Meltdown. With this fix, the firmware on the new physical host is re-scanned for updates after a live migration. As a result, the kernel uses the correct mitigation in the described scenario. (BZ#1570507)
-
Previously, microcode updates on 32 and 64-bit AMD and Intel architectures were not synchronized. As a consequence, it was not possible to apply the microcode updates. This fix adds the synchronization to the microcode updates so that processors of the stated architectures receive updates at the same time. As a result, microcode updates are now synchronized. (BZ#1578044)
-
When switching from the indirect branch speculation (IBRS) feature to the retpolines feature, the IBRS state of some CPUs was sometimes not handled correctly. Consequently, some CPUs were left with the IBRS Model-Specific Register (MSR) bit set to 1, which could lead to performance issues. With this update, the underlying source code has been fixed to clear the IBRS MSR bits correctly, thus fixing the bug. (BZ#1586146)
Users of kernel are advised to upgrade to these updated packages, which fix these bugs.
The system must be rebooted for this update to take effect.
- Solution:
For details on how to apply this update, which includes the changes described in this advisory, refer to:
https://access.redhat.com/articles/11258
- Bugs fixed (https://bugzilla.redhat.com/):
1566890 - CVE-2018-3639 hw: cpu: speculative store bypass
- Package List:
Red Hat Enterprise Linux ComputeNode EUS (v. 7.3):
Source: kernel-3.10.0-514.53.1.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-514.53.1.el7.noarch.rpm kernel-doc-3.10.0-514.53.1.el7.noarch.rpm
x86_64: kernel-3.10.0-514.53.1.el7.x86_64.rpm kernel-debug-3.10.0-514.53.1.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debug-devel-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm kernel-devel-3.10.0-514.53.1.el7.x86_64.rpm kernel-headers-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-libs-3.10.0-514.53.1.el7.x86_64.rpm perf-3.10.0-514.53.1.el7.x86_64.rpm perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm python-perf-3.10.0-514.53.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm
Red Hat Enterprise Linux ComputeNode Optional EUS (v. 7.3):
x86_64: kernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-514.53.1.el7.x86_64.rpm perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm
Red Hat Enterprise Linux Server EUS (v. 7.3):
Source: kernel-3.10.0-514.53.1.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-514.53.1.el7.noarch.rpm kernel-doc-3.10.0-514.53.1.el7.noarch.rpm
ppc64: kernel-3.10.0-514.53.1.el7.ppc64.rpm kernel-bootwrapper-3.10.0-514.53.1.el7.ppc64.rpm kernel-debug-3.10.0-514.53.1.el7.ppc64.rpm kernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm kernel-debug-devel-3.10.0-514.53.1.el7.ppc64.rpm kernel-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm kernel-debuginfo-common-ppc64-3.10.0-514.53.1.el7.ppc64.rpm kernel-devel-3.10.0-514.53.1.el7.ppc64.rpm kernel-headers-3.10.0-514.53.1.el7.ppc64.rpm kernel-tools-3.10.0-514.53.1.el7.ppc64.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm kernel-tools-libs-3.10.0-514.53.1.el7.ppc64.rpm perf-3.10.0-514.53.1.el7.ppc64.rpm perf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm python-perf-3.10.0-514.53.1.el7.ppc64.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm
ppc64le: kernel-3.10.0-514.53.1.el7.ppc64le.rpm kernel-bootwrapper-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debug-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-514.53.1.el7.ppc64le.rpm kernel-devel-3.10.0-514.53.1.el7.ppc64le.rpm kernel-headers-3.10.0-514.53.1.el7.ppc64le.rpm kernel-tools-3.10.0-514.53.1.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm kernel-tools-libs-3.10.0-514.53.1.el7.ppc64le.rpm perf-3.10.0-514.53.1.el7.ppc64le.rpm perf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm python-perf-3.10.0-514.53.1.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm
s390x: kernel-3.10.0-514.53.1.el7.s390x.rpm kernel-debug-3.10.0-514.53.1.el7.s390x.rpm kernel-debug-debuginfo-3.10.0-514.53.1.el7.s390x.rpm kernel-debug-devel-3.10.0-514.53.1.el7.s390x.rpm kernel-debuginfo-3.10.0-514.53.1.el7.s390x.rpm kernel-debuginfo-common-s390x-3.10.0-514.53.1.el7.s390x.rpm kernel-devel-3.10.0-514.53.1.el7.s390x.rpm kernel-headers-3.10.0-514.53.1.el7.s390x.rpm kernel-kdump-3.10.0-514.53.1.el7.s390x.rpm kernel-kdump-debuginfo-3.10.0-514.53.1.el7.s390x.rpm kernel-kdump-devel-3.10.0-514.53.1.el7.s390x.rpm perf-3.10.0-514.53.1.el7.s390x.rpm perf-debuginfo-3.10.0-514.53.1.el7.s390x.rpm python-perf-3.10.0-514.53.1.el7.s390x.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.s390x.rpm
x86_64: kernel-3.10.0-514.53.1.el7.x86_64.rpm kernel-debug-3.10.0-514.53.1.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debug-devel-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm kernel-devel-3.10.0-514.53.1.el7.x86_64.rpm kernel-headers-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-libs-3.10.0-514.53.1.el7.x86_64.rpm perf-3.10.0-514.53.1.el7.x86_64.rpm perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm python-perf-3.10.0-514.53.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm
Red Hat Enterprise Linux Server Optional EUS (v. 7.3):
ppc64: kernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm kernel-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm kernel-debuginfo-common-ppc64-3.10.0-514.53.1.el7.ppc64.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm kernel-tools-libs-devel-3.10.0-514.53.1.el7.ppc64.rpm perf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm
ppc64le: kernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debug-devel-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-514.53.1.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm kernel-tools-libs-devel-3.10.0-514.53.1.el7.ppc64le.rpm perf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm
x86_64: kernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-514.53.1.el7.x86_64.rpm perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm
These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/
- References:
https://access.redhat.com/security/cve/CVE-2018-3639 https://access.redhat.com/security/updates/classification/#important
- Contact:
The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/
Copyright 2018 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1
iQIVAwUBW0Tt1NzjgjWX9erEAQjWjRAAqEnkLg83IXcDh/QVNDhAoM5gAh+OkfHJ LiuDz6CIHgDiv9K3BiG/dLNgL5caK11pxryqk/9kmtgoy6ClyqcrA2FNRIJMwugr PXTjAXNxekyn6gTX0I+8hSOulCZtkCRXmlUu79apvVT/eqQM6PfqjK02OjEL9uc8 59jO7ZoWcv7GVJhu+06QoHaWAqGHBOYL9ufCVAXZH6dY3aS2dPM4UUcZpVxsP8X/ HqXR/ciyXNPSQoGcR/waf/iZgx1pDIV6JXmdl/qlJXthohwa1ZwxD2qqEV3cM9uO XzXXVu9SD2D8cU4jClzIZ+XfM9J9dNl8j2YbZHaUs5IADNwqAIjPTb5leNhe6jqv omnbgOwkJ0mEOLeWBSpQhGxoq4rk4eUJLai1kcpw8MRa6RzOzTs+GHOxTpDfL681 S7F8GjN6J4l0gbW+fOkley3gdMi/74cZcWA6jX/GcjJrtzhlFhRsUDZqd8Eb+F/g quqdBLQ9Vc81FRlMoCATOhuqHM1/eJUcySbY3r1A6bU9oUQShN+prvIV4z5/ag6o WIPN2ImSDaSBACJoCSEby8e2jXs689JLHgPPS0QVvuMQK7wdYGu8/7W++L7+5/It IkS2XQFetG9urfkgM/OMVzeybOiGVsai+JAJOTxFnTWPeyIFF5MJ2E31Q11Amdlp YF80GD/Rvjo=ltf/ -----END PGP SIGNATURE-----
-- RHSA-announce mailing list RHSA-announce@redhat.com https://www.redhat.com/mailman/listinfo/rhsa-announce . Relevant releases/architectures:
RHV-M 4.3 - noarch
- It includes the configuration of the Red Hat Support plugin, copying downstream-only artifacts to the ISO domain, and links to the knowledgebase and other support material. There are three primary variants of the issue which differ in the way the speculative execution can be exploited. Variant CVE-2017-5754 relies on the fact that, on impacted microprocessors, during speculative execution of instruction permission faults, exception generation triggered by a faulting access is suppressed until the retirement of the whole instruction block. Note: CVE-2017-5754 affects Intel x86-64 microprocessors. AMD x86-64 microprocessors are not affected by this issue. (CVE-2017-5754)
Bug Fix(es):
-
[CVE-2017-5754] Variant3: POWER {qemu-kvm-rhev} Add machine type variants (BZ#1559948)
-
add POWER 9 to the 4.2 cluster level (BZ#1574494)
-
6.6) - x86_64
-
Description:
The libvirt library contains a C API for managing and interacting with the virtualization capabilities of Linux and other operating systems. In addition, libvirt provides tools for remote management of virtualized systems
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201805-0963",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "atom c",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "c3808"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "c3508"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "c3538"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "c3558"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "c3708"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "c3750"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "c3758"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "c2308"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "c3308"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.6,
"vendor": "intel",
"version": "c3338"
},
{
"model": "xeon e5 2650l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4610_v4"
},
{
"model": "xeon e3 1240l v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4627_v4"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4660_v3"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.6"
},
{
"model": "xeon e5 2430l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1240 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8860_v3"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3736g"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8893_v3"
},
{
"model": "xeon e3 1225 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4860_v2"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "45nm"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3775"
},
{
"model": "windows 10",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "1809"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86130t"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3850"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86126t"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1545m_v5"
},
{
"model": "xeon e5 2637",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4807"
},
{
"model": "cortex-a",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "15"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3480"
},
{
"model": "simatic ipc827d",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "19.02.11"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3745"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3580"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x3480"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8870_v3"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5504"
},
{
"model": "xeon e3 1278l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4830"
},
{
"model": "simatic ipc427e",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "21.01.09"
},
{
"model": "windows 7",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8880l_v2"
},
{
"model": "jetson tx2",
"scope": "lt",
"trust": 1.0,
"vendor": "nvidia",
"version": "r28.3"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8160"
},
{
"model": "xeon e3 1265l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2430 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1280 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4109t"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4667_v3"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8860_v4"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8891_v2"
},
{
"model": "xeon e5 2603 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "cortex-a",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "57"
},
{
"model": "xeon e5 2620 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5507"
},
{
"model": "xeon e3 1281 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2660"
},
{
"model": "xeon e5 2450l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "enterprise linux server",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.0"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8893_v2"
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "17.10"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2699_v3"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4820"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3735d"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8867l"
},
{
"model": "xeon e5 2630 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "windows server 2012",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": null
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8180"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2650l_v4"
},
{
"model": "xeon e3 1225 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2420",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2690_v2"
},
{
"model": "enterprise linux desktop",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "xeon e5 2648l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4850_v3"
},
{
"model": "celeron j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j3455"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "w5580"
},
{
"model": "mivoice border gateway",
"scope": "eq",
"trust": 1.0,
"vendor": "mitel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86134m"
},
{
"model": "surface",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": null
},
{
"model": "mivoic mx-one",
"scope": "eq",
"trust": 1.0,
"vendor": "mitel",
"version": null
},
{
"model": "xeon e5 2438l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2480"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86144"
},
{
"model": "xeon e5 2470 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom x5-e3930",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "simatic ipc547e",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "r1.30.0"
},
{
"model": "windows server 2016",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "1803"
},
{
"model": "xeon e5 2407 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2450 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2609 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.4"
},
{
"model": "windows server 2008",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "sp2"
},
{
"model": "xeon e5 2609 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4650_v3"
},
{
"model": "simatic ipc647c",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "15.01.14"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2690_v3"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5508_"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1515m_v5"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86126"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86132"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4640"
},
{
"model": "xeon e3 1245",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2418l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2643 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86142m"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4620"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2660_v2"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1535m_v5"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2687w_v2"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "85120"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "3600"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86134"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "85120t"
},
{
"model": "pentium silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n5000"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3785"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5550"
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4114"
},
{
"model": "atom e",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e3827"
},
{
"model": "simatic ipc827c",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "15.02.15"
},
{
"model": "xeon e5 1428l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2670_v3"
},
{
"model": "xeon e5 2430",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8870_v2"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4890_v2"
},
{
"model": "xeon e5 2428l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2640 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2667"
},
{
"model": "xeon e5 2618l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2643 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4850"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4603_v2"
},
{
"model": "celeron j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j4105"
},
{
"model": "simatic ipc427d",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "17.0x.14"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.7"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4880_v2"
},
{
"model": "itc1500 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "3.1"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8176f"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1565l_v5"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4648_v3"
},
{
"model": "xeon e5 1660 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "ruggedcom ape",
"scope": "eq",
"trust": 1.0,
"vendor": "siemens",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8857_v2"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8837"
},
{
"model": "xeon e5 2620",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1505l v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4628l_v4"
},
{
"model": "xeon e5 2618l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "85115"
},
{
"model": "solaris",
"scope": "eq",
"trust": 1.0,
"vendor": "oracle",
"version": "11"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4603"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2665"
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "32nm"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2687w_v4"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8880_v2"
},
{
"model": "xeon e5 2630 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4830_v4"
},
{
"model": "xeon e3 1265l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 1650",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4650_v2"
},
{
"model": "pentium silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j5005"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3570"
},
{
"model": "xeon e5 1680 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3560"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2850"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.2"
},
{
"model": "sonicosv",
"scope": "eq",
"trust": 1.0,
"vendor": "sonicwall",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8890_v2"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5520"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8160f"
},
{
"model": "email security",
"scope": "eq",
"trust": 1.0,
"vendor": "sonicwall",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8891_v4"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4624l_v2"
},
{
"model": "xeon e5 1650 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1268l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4650_v4"
},
{
"model": "openstack",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "9"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2520"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "85119t"
},
{
"model": "xeon e5 2608l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "itc2200",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "3.1"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2803"
},
{
"model": "xeon e5 2643 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4607_v2"
},
{
"model": "xeon e5 1620 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "secure mobile access",
"scope": "eq",
"trust": 1.0,
"vendor": "sonicwall",
"version": null
},
{
"model": "xeon e5 2637 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2630l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3770"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4607"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3955"
},
{
"model": "xeon e3 1270 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3530"
},
{
"model": "xeon e5 2630l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2460"
},
{
"model": "xeon e3 1220 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1230 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86146"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5506"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8158"
},
{
"model": "simatic ipc677d",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "19.02.11"
},
{
"model": "cloud global management system",
"scope": "eq",
"trust": 1.0,
"vendor": "sonicwall",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4820_v2"
},
{
"model": "core i7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "32nm"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1585l_v5"
},
{
"model": "xeon e5 2408l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4116t"
},
{
"model": "enterprise linux eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.7"
},
{
"model": "xeon e5 1650 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "surface pro with lte advanced",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "1807"
},
{
"model": "windows server 2016",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": null
},
{
"model": "simatic ipc477e",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "21.01.09"
},
{
"model": "xeon e3 1275 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2680_v2"
},
{
"model": "xeon e3 1240 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4655_v4"
},
{
"model": "simatic ipc847c",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "15.01.14"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5560"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2667_v2"
},
{
"model": "enterprise linux eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.5"
},
{
"model": "atom e",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e3845"
},
{
"model": "xeon e3 1280 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "18.04"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4650"
},
{
"model": "xeon e5 2637 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4627_v2"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2667_v4"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2820"
},
{
"model": "mivoice business",
"scope": "eq",
"trust": 1.0,
"vendor": "mitel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4870_v2"
},
{
"model": "xeon e5 2630l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8168"
},
{
"model": "xeon e3 1241 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86142"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8160m"
},
{
"model": "xeon e3 1230l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1260l v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "virtualization manager",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "4.3"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4655_v3"
},
{
"model": "xeon e3 1225",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "windows 10",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "1709"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4830_v3"
},
{
"model": "xeon e3 1271 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1260l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "itc2200 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "3.1"
},
{
"model": "xeon e3 1245 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5506"
},
{
"model": "xeon e5 1650 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2760"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l3406"
},
{
"model": "xeon e3 1245 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1275 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1230",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "jetson tx1",
"scope": "lt",
"trust": 1.0,
"vendor": "nvidia",
"version": "r28.3"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l3403"
},
{
"model": "xeon e5 2623 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2650",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4620_v2"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2695_v2"
},
{
"model": "xeon e3 1240 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2658"
},
{
"model": "xeon e3 1285 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x3440"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2687w_v3"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x3460"
},
{
"model": "xeon e5 2628l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2698_v3"
},
{
"model": "xeon e5 2630 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86128"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86148f"
},
{
"model": "local service management system",
"scope": "gte",
"trust": 1.0,
"vendor": "oracle",
"version": "13.0"
},
{
"model": "pentium",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n4000"
},
{
"model": "core m",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "45nm"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3590"
},
{
"model": "xeon e5 1428l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "micloud management portal",
"scope": "eq",
"trust": 1.0,
"vendor": "mitel",
"version": "*"
},
{
"model": "surface pro",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "1796"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8890_v3"
},
{
"model": "xeon e5 2448l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2428l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3745d"
},
{
"model": "enterprise linux desktop",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.0"
},
{
"model": "struxureware data center expert",
"scope": "lt",
"trust": 1.0,
"vendor": "schneider electric",
"version": "7.6.0"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2560"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2860"
},
{
"model": "xeon e5 2637 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2697_v3"
},
{
"model": "xeon e3 1285l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3958"
},
{
"model": "simatic ipc547g",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "r1.23.0"
},
{
"model": "xeon e5 2418l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom e",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e3805"
},
{
"model": "atom e",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e3825"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3770d"
},
{
"model": "windows 10",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "1607"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2850_v2"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8153"
},
{
"model": "xeon e5 2603 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.6"
},
{
"model": "micollab",
"scope": "eq",
"trust": 1.0,
"vendor": "mitel",
"version": null
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8170"
},
{
"model": "xeon e3 1286l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 1660 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "pentium",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n4100"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5115"
},
{
"model": "xeon e3 12201 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1280",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2640 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2643",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2620 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "windows server 2008",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "r2"
},
{
"model": "virtualization",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "4.0"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.6"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8893_v4"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5503"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4830_v2"
},
{
"model": "xeon e3 1285 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "celeron j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j4005"
},
{
"model": "atom e",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e3826"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2658_v4"
},
{
"model": "xeon e3 1225 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "windows 10",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "1703"
},
{
"model": "xeon e3 1240l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3460"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2670"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2695_v3"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4809_v2"
},
{
"model": "atom x7-e3950",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2430l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2667_v3"
},
{
"model": "openstack",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "12"
},
{
"model": "xeon e5 2448l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2407",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4820_v3"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4640_v2"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x3430"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8867_v3"
},
{
"model": "xeon e3 1270 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1268l v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86138f"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4620_v3"
},
{
"model": "xeon e3 1501m v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2618l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2670_v2"
},
{
"model": "xeon e3 1220 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x3470"
},
{
"model": "xeon e5 2603 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "simatic ipc477e pro",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "21.01.09"
},
{
"model": "xeon e3 1245 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2450l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4860"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8160t"
},
{
"model": "xeon e3 1225 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 1620 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4112"
},
{
"model": "xeon e3 1276 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1558l_v5"
},
{
"model": "xeon e3 1505m v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4108"
},
{
"model": "enterprise linux eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.6"
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "12.04"
},
{
"model": "web application firewall",
"scope": "eq",
"trust": 1.0,
"vendor": "sonicwall",
"version": null
},
{
"model": "xeon e5 2650l",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2699r_v4"
},
{
"model": "atom e",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e3815"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2698_v4"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5518_"
},
{
"model": "xeon e5 1620",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "w5590"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.3"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4610"
},
{
"model": "xeon e3 1220l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1230 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2660_v3"
},
{
"model": "xeon e3 1235l v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1578l_v5"
},
{
"model": "xeon e3 1226 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1535m_v6"
},
{
"model": "xeon e5 1428l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.4"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3740d"
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "45nm"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2687w"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2697_v4"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "125c_"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86142f"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86154"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8870_v4"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8164"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2658a_v3"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2690"
},
{
"model": "xeon e5 2648l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2603",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1275 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4640_v3"
},
{
"model": "sinema remote connect",
"scope": "eq",
"trust": 1.0,
"vendor": "siemens",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86140"
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.7"
},
{
"model": "xeon e5 2628l v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4116"
},
{
"model": "xeon e3 1285 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4669_v4"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86138"
},
{
"model": "openstack",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8"
},
{
"model": "xeon e3 12201",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2660_v4"
},
{
"model": "xeon e5 2418l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "simatic field pg m5",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "22.01.06"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2680_v3"
},
{
"model": "simatic ipc677c",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "15.02.15"
},
{
"model": "surface pro",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "3"
},
{
"model": "xeon e5 1630 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "core i5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "45nm"
},
{
"model": "xeon e5 2450",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86136"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2699a_v4"
},
{
"model": "xeon e5 2403",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "openstack",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "13"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e6550"
},
{
"model": "enterprise linux eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.3"
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.2"
},
{
"model": "windows server 2016",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "1709"
},
{
"model": "xeon e3 1270 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "linux",
"scope": "eq",
"trust": 1.0,
"vendor": "debian",
"version": "8.0"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1585_v5"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3735g"
},
{
"model": "xeon e5 2403 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1501l v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2440",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "enterprise linux workstation",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4610_v2"
},
{
"model": "pentium j",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "j4205"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2580"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3735e"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8830"
},
{
"model": "surface book",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1220_"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8880_v4"
},
{
"model": "surface studio",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": null
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3950"
},
{
"model": "linux",
"scope": "eq",
"trust": 1.0,
"vendor": "debian",
"version": "9.0"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2697a_v4"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2870_v2"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4870"
},
{
"model": "simatic ipc847d",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "19.01.14"
},
{
"model": "xeon e3 1245 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2658_v3"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "7500"
},
{
"model": "xeon e5 1630 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.4"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3736f"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4667_v4"
},
{
"model": "itc1900 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "3.1"
},
{
"model": "xeon e5 2470",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "openstack",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "10"
},
{
"model": "surface pro",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "4"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4809_v3"
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "14.04"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4640_v4"
},
{
"model": "xeon e5 2648l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "sinumerik pcu 50.5",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "15.02.15"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2683_v3"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5530"
},
{
"model": "xeon e3 1220 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e-1105c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "sinumerik 840 d sl",
"scope": "eq",
"trust": 1.0,
"vendor": "siemens",
"version": null
},
{
"model": "xeon e3 1258l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4620_v4"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4669_v3"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3740"
},
{
"model": "simatic itp1000",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "23.01.04"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3858"
},
{
"model": "xeon e3 1235",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2650l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4650l"
},
{
"model": "xeon e3 1270 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "simotion p320-4e",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "17.0x.14"
},
{
"model": "xeon e5 2640 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1575m_v5"
},
{
"model": "xeon e3 1220 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8890_v4"
},
{
"model": "xeon e5 2609 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x3450"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8860"
},
{
"model": "simatic ipc477c",
"scope": "eq",
"trust": 1.0,
"vendor": "siemens",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l3426"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86152"
},
{
"model": "enterprise linux server",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "5.9"
},
{
"model": "xeon e5 1620 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2630l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1275_"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5540"
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4110"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2890_v2"
},
{
"model": "xeon e5 1660 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2699_v4"
},
{
"model": "open integration gateway",
"scope": "eq",
"trust": 1.0,
"vendor": "mitel",
"version": null
},
{
"model": "xeon e3 1240 v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "simatic ipc477d",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "17.0x.14"
},
{
"model": "simatic et 200 sp",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "2.6"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8891_v3"
},
{
"model": "enterprise linux eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.4"
},
{
"model": "xeon e5 2420 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86130"
},
{
"model": "windows 10",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "1803"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8850_v2"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8176m"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86140m"
},
{
"model": "xeon e3 1265l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3775d"
},
{
"model": "xeon e3 1246 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "virtualization manager",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "4.2"
},
{
"model": "local service management system",
"scope": "lte",
"trust": 1.0,
"vendor": "oracle",
"version": "13.3"
},
{
"model": "xeon e3 1275l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2650 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86148"
},
{
"model": "xeon e5 2623 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4809_v4"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4657l_v2"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2690_v4"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z2420"
},
{
"model": "openstack",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8880l_v3"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8850"
},
{
"model": "xeon e3 1275 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom x5-e3940",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1285l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8867_v4"
},
{
"model": "xeon e3 1280 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86138t"
},
{
"model": "simatic ipc427c",
"scope": "eq",
"trust": 1.0,
"vendor": "siemens",
"version": null
},
{
"model": "core i3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "32nm"
},
{
"model": "simatic ipc347e",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "1.5"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e6510"
},
{
"model": "atom c",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "c3830"
},
{
"model": "xeon e5 1660",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2428l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "sinumerik tcu 30.3",
"scope": "eq",
"trust": 1.0,
"vendor": "siemens",
"version": null
},
{
"model": "mivoice connect",
"scope": "eq",
"trust": 1.0,
"vendor": "mitel",
"version": null
},
{
"model": "windows 8.1",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": null
},
{
"model": "xeon e5 2630",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "simatic ipc627d",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "19.02.11"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8880_v3"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4850_v4"
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "16.04"
},
{
"model": "windows server 2012",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "r2"
},
{
"model": "xeon e3 1230 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2650 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "simatic s7-1500",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "2.6"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2695_v4"
},
{
"model": "xeon e5 2440 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4850_v2"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2680_v4"
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.5"
},
{
"model": "mivoice 5000",
"scope": "eq",
"trust": 1.0,
"vendor": "mitel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "1505m_v6"
},
{
"model": "itc1500",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "3.1"
},
{
"model": "xeon e5 2648l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "85122"
},
{
"model": "xeon e3 1290 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 1680 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1125c v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8170m"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4820_v4"
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8156"
},
{
"model": "xeon e3 1231 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon platinum",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8176"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2830"
},
{
"model": "xeon e3 1505l v6",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2628l v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8870"
},
{
"model": "cortex-a",
"scope": "eq",
"trust": 1.0,
"vendor": "arm",
"version": "72"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "8894_v4"
},
{
"model": "xeon e3 1230 v5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2609",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2650 v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2870"
},
{
"model": "simatic ipc3000 smart",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "1.5"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2680"
},
{
"model": "xeon e5 2640",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5502"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4617"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e6540"
},
{
"model": "simatic ipc647d",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "19.01.14"
},
{
"model": "xeon e3 1280 v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1270",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "pentium",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n4200"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "e5530"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4610_v3"
},
{
"model": "xeon e3 1105c v2",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon silver",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4114t"
},
{
"model": "simatic field pg m4",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "18.01.09"
},
{
"model": "itc1900",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "3.1"
},
{
"model": "simatic ipc627c",
"scope": "lt",
"trust": 1.0,
"vendor": "siemens",
"version": "15.02.15"
},
{
"model": "core m",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "32nm"
},
{
"model": "global management system",
"scope": "eq",
"trust": 1.0,
"vendor": "sonicwall",
"version": null
},
{
"model": "xeon e3 1286 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e3 1290",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "celeron n",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "n3450"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2658_v2"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4660_v4"
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.3"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "x5570"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86150"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "l5520"
},
{
"model": "mrg realtime",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "2.0"
},
{
"model": "xeon e7",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2880_v2"
},
{
"model": "windows 10",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": null
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2697_v2"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "4627_v3"
},
{
"model": "enterprise linux workstation",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.0"
},
{
"model": "xeon e3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "5600"
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3795"
},
{
"model": "enterprise linux eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.7"
},
{
"model": "xeon e5",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "2683_v4"
},
{
"model": "xeon e3 1240",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "xeon e5 2620 v3",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "surface book",
"scope": "eq",
"trust": 1.0,
"vendor": "microsoft",
"version": "2"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86130f"
},
{
"model": "xeon e5 2608l v4",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": null
},
{
"model": "atom z",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "z3735f"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "86126f"
},
{
"model": "xeon gold",
"scope": "eq",
"trust": 1.0,
"vendor": "intel",
"version": "85118"
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "amd",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "arm",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "apple",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "cisco",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "dell",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "dell emc",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "fortinet",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "hp",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "hitachi",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "ibm",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "intel",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "microsoft",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "qualcomm incorporated",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "red hat",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "suse linux",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "synology",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "ubuntu",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "vmware",
"version": null
},
{
"model": "cortex a57",
"scope": null,
"trust": 0.6,
"vendor": "arm",
"version": null
},
{
"model": "5th generation core processors",
"scope": null,
"trust": 0.6,
"vendor": "intel",
"version": null
},
{
"model": "cortex a72",
"scope": null,
"trust": 0.6,
"vendor": "arm",
"version": null
},
{
"model": "6th generation core processors",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "5th generation core processors",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "4th generation core processors",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "3rd generation core processors",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "2nd generation core processors",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "8th generation core processors",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "7th generation core processors",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "atom processor a series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "atom processor c series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "atom processor e series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "atom processor t series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "atom processor series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "x0"
},
{
"model": "atom processor z series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "core x-series processor family for intel platforms",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "x990"
},
{
"model": "celeron processor j series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "celeron processor n series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "core m processor family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "core x-series processor family for intel platforms",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "x2990"
},
{
"model": "pentium processor n series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "pentium processor silver series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "xeon processor series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "34000"
},
{
"model": "xeon processor series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "36000"
},
{
"model": "xeon processor series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "55000"
},
{
"model": "xeon processor series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "56000"
},
{
"model": "xeon processor series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "75000"
},
{
"model": "xeon processor series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "65000"
},
{
"model": "pentium processor j series",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "xeon processor e3 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "xeon processor e3 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "v20"
},
{
"model": "xeon processor e3 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "v3"
},
{
"model": "xeon processor e3 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "v40"
},
{
"model": "xeon processor e3 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "v50"
},
{
"model": "xeon processor e3 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "v60"
},
{
"model": "xeon processor e5 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "xeon processor e5 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "v20"
},
{
"model": "xeon processor e5 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "v3"
},
{
"model": "xeon processor e5 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "v40"
},
{
"model": "xeon processor e7 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "0"
},
{
"model": "xeon processor e7 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "v20"
},
{
"model": "xeon processor e7 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "v3"
},
{
"model": "xeon processor e7 family",
"scope": "eq",
"trust": 0.6,
"vendor": "intel",
"version": "v40"
}
],
"sources": [
{
"db": "CERT/CC",
"id": "VU#180049"
},
{
"db": "CNVD",
"id": "CNVD-2018-13391"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-749"
},
{
"db": "NVD",
"id": "CVE-2018-3639"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Red Hat",
"sources": [
{
"db": "PACKETSTORM",
"id": "147778"
},
{
"db": "PACKETSTORM",
"id": "150070"
},
{
"db": "PACKETSTORM",
"id": "148244"
},
{
"db": "PACKETSTORM",
"id": "151288"
},
{
"db": "PACKETSTORM",
"id": "150075"
},
{
"db": "PACKETSTORM",
"id": "147738"
},
{
"db": "PACKETSTORM",
"id": "147758"
},
{
"db": "PACKETSTORM",
"id": "148330"
},
{
"db": "PACKETSTORM",
"id": "148484"
},
{
"db": "PACKETSTORM",
"id": "152767"
},
{
"db": "PACKETSTORM",
"id": "150077"
},
{
"db": "PACKETSTORM",
"id": "147748"
}
],
"trust": 1.2
},
"cve": "CVE-2018-3639",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CVE-2018-3639",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 1.0,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:N/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 4.9,
"confidentialityImpact": "COMPLETE",
"exploitabilityScore": 3.9,
"id": "CNVD-2018-13391",
"impactScore": 6.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:C/I:N/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "VULHUB",
"availabilityImpact": "NONE",
"baseScore": 4.9,
"confidentialityImpact": "COMPLETE",
"exploitabilityScore": 3.9,
"id": "VHN-133670",
"impactScore": 6.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 0.1,
"vectorString": "AV:L/AC:L/AU:N/C:C/I:N/A:N",
"version": "2.0"
},
{
"accessComplexity": "MEDIUM",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "VULHUB",
"availabilityImpact": "NONE",
"baseScore": 4.7,
"confidentialityImpact": "COMPLETE",
"exploitabilityScore": 3.4,
"id": "VHN-133671",
"impactScore": 6.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 0.1,
"vectorString": "AV:L/AC:M/AU:N/C:C/I:N/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 1.8,
"id": "CVE-2018-3639",
"impactScore": 3.6,
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:N",
"version": "3.1"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2018-3639",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "CNVD",
"id": "CNVD-2018-13391",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "CNNVD",
"id": "CNNVD-201805-749",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "VULHUB",
"id": "VHN-133670",
"trust": 0.1,
"value": "MEDIUM"
},
{
"author": "VULHUB",
"id": "VHN-133671",
"trust": 0.1,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2018-13391"
},
{
"db": "VULHUB",
"id": "VHN-133670"
},
{
"db": "VULHUB",
"id": "VHN-133671"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-749"
},
{
"db": "NVD",
"id": "CVE-2018-3639"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Systems with microprocessors utilizing speculative execution and speculative execution of memory reads before the addresses of all prior memory writes are known may allow unauthorized disclosure of information to an attacker with local user access via a side-channel analysis, aka Speculative Store Bypass (SSB), Variant 4. CPU hardware utilizing speculative execution may be vulnerable to cache timing side-channel analysis. Two vulnerabilities are identified, known as \"Variant 3a\" and \"Variant 4\". CPUhardware is firmware that runs in the central processor for managing and controlling the CPU. Multiple CPUHardware information disclosure vulnerabilities. The vulnerability is caused by a race condition in the CPU cache processing. Local attackers can exploit vulnerabilities to obtain sensitive information through side channel analysis. AMD, ARM, and Intel CPUs are all CPU (central processing unit) products from different manufacturers. AMD, ARM, and Intel CPUs have security vulnerabilities. 7) - aarch64, noarch, ppc64le\n\n3. (CVE-2018-3639, aarch64)\n\n* A flaw named SegmentSmack was found in the way the Linux kernel handled\nspecially crafted TCP packets. A remote attacker could use this flaw to\ntrigger time and calculation expensive calls to tcp_collapse_ofo_queue()\nand tcp_prune_ofo_queue() functions by sending specially modified packets\nwithin ongoing TCP sessions which could lead to a CPU saturation and hence\na denial of service on the system. Maintaining the denial of service\ncondition requires continuous two-way TCP sessions to a reachable open\nport, thus the attacks cannot be performed using spoofed IP addresses. \n(CVE-2018-5390)\n\n* A flaw named FragmentSmack was found in the way the Linux kernel handled\nreassembly of fragmented IPv4 and IPv6 packets. A remote attacker could use\nthis flaw to trigger time and calculation expensive fragment reassembly\nalgorithm by sending specially crafted packets which could lead to a CPU\nsaturation and hence a denial of service on the system. (CVE-2018-5391)\n\nSpace precludes documenting all of the security fixes in this advisory. See\nthe descriptions of the remaining security fixes in the related Knowledge\nArticle:\n\nhttps://access.redhat.com/articles/3658021\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, and other related information, refer to the CVE page(s) listed in\nthe References section. \n1623067 - CVE-2018-9363 kernel: Buffer overflow in hidp_process_report\n1629636 - CVE-2018-14641 kernel: a bug in ip_frag_reasm() can cause a crash in ip_do_fragment()\n\n6. (CVE-2018-3639, PowerPC)\n\n* kernel: net/packet: overflow in check for priv area size (CVE-2017-7308)\n\n* kernel: AIO interface didn\u0027t use rw_verify_area() for checking mandatory\nlocking on files and size of access (CVE-2012-6701)\n\n* kernel: AIO write triggers integer overflow in some protocols\n(CVE-2015-8830)\n\n* kernel: Null pointer dereference via keyctl (CVE-2016-8650)\n\n* kernel: ping socket / AF_LLC connect() sin_family race (CVE-2017-2671)\n\n* kernel: Race condition between multiple sys_perf_event_open() calls\n(CVE-2017-6001)\n\n* kernel: Incorrect error handling in the set_mempolicy and mbind compat\nsyscalls in mm/mempolicy.c (CVE-2017-7616)\n\n* kernel: mm subsystem does not properly enforce the CONFIG_STRICT_DEVMEM\nprotection mechanism (CVE-2017-7889)\n\n* kernel: Double free in the inet_csk_clone_lock function in\nnet/ipv4/inet_connection_sock.c (CVE-2017-8890)\n\n* kernel: net: sctp_v6_create_accept_sk function mishandles inheritance\n(CVE-2017-9075)\n\n* kernel: net: IPv6 DCCP implementation mishandles inheritance\n(CVE-2017-9076)\n\n* kernel: net: tcp_v6_syn_recv_sock function mishandles inheritance\n(CVE-2017-9077)\n\n* kernel: memory leak when merging buffers in SCSI IO vectors\n(CVE-2017-12190)\n\n* kernel: vfs: BUG in truncate_inode_pages_range() and fuse client\n(CVE-2017-15121)\n\n* kernel: Race condition in drivers/md/dm.c:dm_get_from_kobject() allows\nlocal users to cause a denial of service (CVE-2017-18203)\n\n* kernel: a null pointer dereference in net/dccp/output.c:dccp_write_xmit()\nleads to a system crash (CVE-2018-1130)\n\n* kernel: Missing length check of payload in\nnet/sctp/sm_make_chunk.c:_sctp_make_chunk() function allows denial of\nservice (CVE-2018-5803)\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, and other related information, refer to the CVE page(s) listed in\nthe References section. Bugs fixed (https://bugzilla.redhat.com/):\n\n869942 - Kernel crashes on reading an ACL containing 190 ACEs over NFSv4\n1314275 - CVE-2015-8830 kernel: AIO write triggers integer overflow in some protocols\n1314288 - CVE-2012-6701 kernel: AIO interface didn\u0027t use rw_verify_area() for checking mandatory locking on files and size of access\n1395187 - CVE-2016-8650 kernel: Null pointer dereference via keyctl\n1422825 - CVE-2017-6001 kernel: Race condition between multiple sys_perf_event_open() calls\n1436649 - CVE-2017-2671 kernel: ping socket / AF_LLC connect() sin_family race\n1437404 - CVE-2017-7308 kernel: net/packet: overflow in check for priv area size\n1441088 - CVE-2017-7616 kernel: Incorrect error handling in the set_mempolicy and mbind compat syscalls in mm/mempolicy.c\n1444493 - CVE-2017-7889 kernel: mm subsystem does not properly enforce the CONFIG_STRICT_DEVMEM protection mechanism\n1448170 - RHEL6.9: sunrpc reconnect logic now may trigger a SYN storm when a TCP connection drops and a burst of RPC commands hit the transport\n1450972 - CVE-2017-8890 kernel: Double free in the inet_csk_clone_lock function in net/ipv4/inet_connection_sock.c\n1452688 - CVE-2017-9076 kernel: net: IPv6 DCCP implementation mishandles inheritance\n1452691 - CVE-2017-9075 kernel: net: sctp_v6_create_accept_sk function mishandles inheritance\n1452744 - CVE-2017-9077 kernel: net: tcp_v6_syn_recv_sock function mishandles inheritance\n1495089 - CVE-2017-12190 kernel: memory leak when merging buffers in SCSI IO vectors\n1497152 - systool causes panic on 2.6.32-696.6.3.el6.x86_64 using be2iscsi\n1520893 - CVE-2017-15121 kernel: vfs: BUG in truncate_inode_pages_range() and fuse client\n1550811 - CVE-2017-18203 kernel: Race condition in drivers/md/dm.c:dm_get_from_kobject() allows local users to cause a denial of service\n1551051 - CVE-2018-5803 kernel: Missing length check of payload in net/sctp/sm_make_chunk.c:_sctp_make_chunk() function allows denial of service\n1560494 - i686: Using invpcid_flush_all_nonglobals() can cause user-space panic on .i686\n1566890 - CVE-2018-3639 hw: cpu: speculative store bypass\n1576419 - CVE-2018-1130 kernel: a null pointer dereference in net/dccp/output.c:dccp_write_xmit() leads to a system crash\n\n6. 7) - aarch64, noarch, ppc64le, s390x\n\n3. Description:\n\nThe java-1.8.0-openjdk packages provide the OpenJDK 8 Java Runtime\nEnvironment and the OpenJDK 8 Java Software Development Kit. (CVE-2018-3639)\n\nNote: This is the OpenJDK side of the CVE-2018-3639 mitigation. \n\nThe following packages have been upgraded to a later upstream version:\nrhevm-setup-plugins (3.6.7). Description:\n\nKVM (Kernel-based Virtual Machine) is a full virtualization solution for\nLinux on a variety of architectures. The qemu-kvm-rhev packages provide the\nuser-space component for running virtual machines that use KVM in\nenvironments managed by Red Hat products. \n\nBug Fix(es):\n\n* Previously, using device passthrough for a SCSI-2 device failed and\nreturned an \"Illegal Request\" error. With this update, the QEMU emulator\nchecks the SCSI version of the device when performing passthrough. (BZ#1571370)\n \n* Under certain circumstances, resuming a paused guest generated redundant\n\"VIR_DOMAIN_PAUSED_UNKNOWN\" error messages in the libvirt log. This update\ncorrects the event sending order when resuming guests, which prevents the\nerrors being logged. (BZ#1588001)\n\n4. Once\nall virtual machines have shut down, start them again for this update to\ntake effect. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA256\n\n==================================================================== \nRed Hat Security Advisory\n\nSynopsis: Important: kernel security and bug fix update\nAdvisory ID: RHSA-2018:2161-01\nProduct: Red Hat Enterprise Linux\nAdvisory URL: https://access.redhat.com/errata/RHSA-2018:2161\nIssue date: 2018-07-10\nCVE Names: CVE-2018-3639\n====================================================================\n1. Summary:\n\nAn update for kernel is now available for Red Hat Enterprise Linux 7.3\nExtended Update Support. \n\nRed Hat Product Security has rated this update as having a security impact\nof Important. A Common Vulnerability Scoring System (CVSS) base score,\nwhich gives a detailed severity rating, is available for each vulnerability\nfrom the CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat Enterprise Linux ComputeNode EUS (v. 7.3) - noarch, x86_64\nRed Hat Enterprise Linux ComputeNode Optional EUS (v. 7.3) - x86_64\nRed Hat Enterprise Linux Server EUS (v. 7.3) - noarch, ppc64, ppc64le, s390x, x86_64\nRed Hat Enterprise Linux Server Optional EUS (v. 7.3) - ppc64, ppc64le, x86_64\n\n3. Description:\n\nThe kernel packages contain the Linux kernel, the core of any Linux\noperating system. \n\nSecurity Fix(es):\n\n* An industry-wide issue was found in the way many modern microprocessor\ndesigns have implemented speculative execution of Load \u0026 Store instructions\n(a commonly used performance optimization). It relies on the presence of a\nprecisely-defined instruction sequence in the privileged code as well as\nthe fact that memory read from address to which a recent memory write has\noccurred may see an older value and subsequently cause an update into the\nmicroprocessor\u0027s data cache even for speculatively executed instructions\nthat never actually commit (retire). As a result, an unprivileged attacker\ncould use this flaw to read privileged memory by conducting targeted cache\nside-channel attacks. (CVE-2018-3639, x86 AMD)\n\nRed Hat would like to thank Ken Johnson (Microsoft Security Response\nCenter) and Jann Horn (Google Project Zero) for reporting this issue. \n\nBug Fix(es):\n\n* When a Nonvolatile Memory Express (NVMe) namespace was created, changed,\nor deleted, an occasional deadlock occurred. With this update, namespace\nscanning and removal does not hold a mutual exclusion (mutex) program\nobject. As a result, a deadlock no longer occurs in the described scenario. \n(BZ#1566886)\n\n* Previously, a live migration of a virtual machine from one host with\nupdated firmware to another host without updated firmware resulted in\nincorrect kernel settings for Meltdown mitigations, which could leave the\nkernel vulnerable to Meltdown. With this fix, the firmware on the new\nphysical host is re-scanned for updates after a live migration. As a\nresult, the kernel uses the correct mitigation in the described scenario. \n(BZ#1570507)\n\n* Previously, microcode updates on 32 and 64-bit AMD and Intel\narchitectures were not synchronized. As a consequence, it was not possible\nto apply the microcode updates. This fix adds the synchronization to the\nmicrocode updates so that processors of the stated architectures receive\nupdates at the same time. As a result, microcode updates are now\nsynchronized. (BZ#1578044)\n\n* When switching from the indirect branch speculation (IBRS) feature to the\nretpolines feature, the IBRS state of some CPUs was sometimes not handled\ncorrectly. Consequently, some CPUs were left with the IBRS Model-Specific\nRegister (MSR) bit set to 1, which could lead to performance issues. With\nthis update, the underlying source code has been fixed to clear the IBRS\nMSR bits correctly, thus fixing the bug. (BZ#1586146)\n\nUsers of kernel are advised to upgrade to these updated packages, which fix\nthese bugs. \n\nThe system must be rebooted for this update to take effect. \n\n4. Solution:\n\nFor details on how to apply this update, which includes the changes\ndescribed in this advisory, refer to:\n\nhttps://access.redhat.com/articles/11258\n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1566890 - CVE-2018-3639 hw: cpu: speculative store bypass\n\n6. Package List:\n\nRed Hat Enterprise Linux ComputeNode EUS (v. 7.3):\n\nSource:\nkernel-3.10.0-514.53.1.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-514.53.1.el7.noarch.rpm\nkernel-doc-3.10.0-514.53.1.el7.noarch.rpm\n\nx86_64:\nkernel-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debug-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-devel-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-headers-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-514.53.1.el7.x86_64.rpm\nperf-3.10.0-514.53.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\npython-perf-3.10.0-514.53.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode Optional EUS (v. 7.3):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-514.53.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server EUS (v. 7.3):\n\nSource:\nkernel-3.10.0-514.53.1.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-514.53.1.el7.noarch.rpm\nkernel-doc-3.10.0-514.53.1.el7.noarch.rpm\n\nppc64:\nkernel-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-bootwrapper-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debug-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debug-devel-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debuginfo-common-ppc64-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-devel-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-headers-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-tools-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-tools-libs-3.10.0-514.53.1.el7.ppc64.rpm\nperf-3.10.0-514.53.1.el7.ppc64.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\npython-perf-3.10.0-514.53.1.el7.ppc64.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\n\nppc64le:\nkernel-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-bootwrapper-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debug-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-devel-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-headers-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-tools-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-tools-libs-3.10.0-514.53.1.el7.ppc64le.rpm\nperf-3.10.0-514.53.1.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\npython-perf-3.10.0-514.53.1.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\n\ns390x:\nkernel-3.10.0-514.53.1.el7.s390x.rpm\nkernel-debug-3.10.0-514.53.1.el7.s390x.rpm\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.s390x.rpm\nkernel-debug-devel-3.10.0-514.53.1.el7.s390x.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.s390x.rpm\nkernel-debuginfo-common-s390x-3.10.0-514.53.1.el7.s390x.rpm\nkernel-devel-3.10.0-514.53.1.el7.s390x.rpm\nkernel-headers-3.10.0-514.53.1.el7.s390x.rpm\nkernel-kdump-3.10.0-514.53.1.el7.s390x.rpm\nkernel-kdump-debuginfo-3.10.0-514.53.1.el7.s390x.rpm\nkernel-kdump-devel-3.10.0-514.53.1.el7.s390x.rpm\nperf-3.10.0-514.53.1.el7.s390x.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.s390x.rpm\npython-perf-3.10.0-514.53.1.el7.s390x.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.s390x.rpm\n\nx86_64:\nkernel-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debug-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-devel-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-headers-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-514.53.1.el7.x86_64.rpm\nperf-3.10.0-514.53.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\npython-perf-3.10.0-514.53.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional EUS (v. 7.3):\n\nppc64:\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debuginfo-common-ppc64-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-tools-libs-devel-3.10.0-514.53.1.el7.ppc64.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\n\nppc64le:\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debug-devel-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-tools-libs-devel-3.10.0-514.53.1.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-514.53.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security. Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. References:\n\nhttps://access.redhat.com/security/cve/CVE-2018-3639\nhttps://access.redhat.com/security/updates/classification/#important\n\n8. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2018 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niQIVAwUBW0Tt1NzjgjWX9erEAQjWjRAAqEnkLg83IXcDh/QVNDhAoM5gAh+OkfHJ\nLiuDz6CIHgDiv9K3BiG/dLNgL5caK11pxryqk/9kmtgoy6ClyqcrA2FNRIJMwugr\nPXTjAXNxekyn6gTX0I+8hSOulCZtkCRXmlUu79apvVT/eqQM6PfqjK02OjEL9uc8\n59jO7ZoWcv7GVJhu+06QoHaWAqGHBOYL9ufCVAXZH6dY3aS2dPM4UUcZpVxsP8X/\nHqXR/ciyXNPSQoGcR/waf/iZgx1pDIV6JXmdl/qlJXthohwa1ZwxD2qqEV3cM9uO\nXzXXVu9SD2D8cU4jClzIZ+XfM9J9dNl8j2YbZHaUs5IADNwqAIjPTb5leNhe6jqv\nomnbgOwkJ0mEOLeWBSpQhGxoq4rk4eUJLai1kcpw8MRa6RzOzTs+GHOxTpDfL681\nS7F8GjN6J4l0gbW+fOkley3gdMi/74cZcWA6jX/GcjJrtzhlFhRsUDZqd8Eb+F/g\nquqdBLQ9Vc81FRlMoCATOhuqHM1/eJUcySbY3r1A6bU9oUQShN+prvIV4z5/ag6o\nWIPN2ImSDaSBACJoCSEby8e2jXs689JLHgPPS0QVvuMQK7wdYGu8/7W++L7+5/It\nIkS2XQFetG9urfkgM/OMVzeybOiGVsai+JAJOTxFnTWPeyIFF5MJ2E31Q11Amdlp\nYF80GD/Rvjo=ltf/\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://www.redhat.com/mailman/listinfo/rhsa-announce\n. Relevant releases/architectures:\n\nRHV-M 4.3 - noarch\n\n3. \nIt includes the configuration of the Red Hat Support plugin, copying\ndownstream-only artifacts to the ISO domain, and links to the knowledgebase\nand other support material. There are three primary variants of the\nissue which differ in the way the speculative execution can be exploited. \nVariant CVE-2017-5754 relies on the fact that, on impacted microprocessors,\nduring speculative execution of instruction permission faults, exception\ngeneration triggered by a faulting access is suppressed until the\nretirement of the whole instruction block. Note: CVE-2017-5754 affects Intel\nx86-64 microprocessors. AMD x86-64 microprocessors are not affected by this\nissue. (CVE-2017-5754)\n\nBug Fix(es):\n\n* [CVE-2017-5754] Variant3: POWER {qemu-kvm-rhev} Add machine type variants\n(BZ#1559948)\n\n* add POWER 9 to the 4.2 cluster level (BZ#1574494)\n\n4. 6.6) - x86_64\n\n3. Description:\n\nThe libvirt library contains a C API for managing and interacting with the\nvirtualization capabilities of Linux and other operating systems. In\naddition, libvirt provides tools for remote management of virtualized\nsystems",
"sources": [
{
"db": "NVD",
"id": "CVE-2018-3639"
},
{
"db": "CERT/CC",
"id": "VU#180049"
},
{
"db": "CNVD",
"id": "CNVD-2018-13391"
},
{
"db": "VULHUB",
"id": "VHN-133670"
},
{
"db": "VULHUB",
"id": "VHN-133671"
},
{
"db": "PACKETSTORM",
"id": "147778"
},
{
"db": "PACKETSTORM",
"id": "150070"
},
{
"db": "PACKETSTORM",
"id": "148244"
},
{
"db": "PACKETSTORM",
"id": "151288"
},
{
"db": "PACKETSTORM",
"id": "147738"
},
{
"db": "PACKETSTORM",
"id": "147758"
},
{
"db": "PACKETSTORM",
"id": "148330"
},
{
"db": "PACKETSTORM",
"id": "148484"
},
{
"db": "PACKETSTORM",
"id": "152767"
},
{
"db": "PACKETSTORM",
"id": "150077"
},
{
"db": "PACKETSTORM",
"id": "147748"
},
{
"db": "PACKETSTORM",
"id": "150075"
}
],
"trust": 3.42
},
"exploit_availability": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/exploit_availability#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"reference": "https://www.scap.org.cn/vuln/vhn-133670",
"trust": 0.1,
"type": "unknown"
}
],
"sources": [
{
"db": "VULHUB",
"id": "VHN-133670"
}
]
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2018-3639",
"trust": 3.6
},
{
"db": "USCERT",
"id": "TA18-141A",
"trust": 2.6
},
{
"db": "CERT/CC",
"id": "VU#180049",
"trust": 2.6
},
{
"db": "SECTRACK",
"id": "1040949",
"trust": 2.4
},
{
"db": "BID",
"id": "104232",
"trust": 2.3
},
{
"db": "LENOVO",
"id": "LEN-22133",
"trust": 1.8
},
{
"db": "SIEMENS",
"id": "SSA-268644",
"trust": 1.8
},
{
"db": "SIEMENS",
"id": "SSA-608355",
"trust": 1.8
},
{
"db": "SECTRACK",
"id": "1042004",
"trust": 1.8
},
{
"db": "OPENWALL",
"id": "OSS-SECURITY/2020/06/10/5",
"trust": 1.7
},
{
"db": "OPENWALL",
"id": "OSS-SECURITY/2020/06/10/1",
"trust": 1.7
},
{
"db": "OPENWALL",
"id": "OSS-SECURITY/2020/06/10/2",
"trust": 1.7
},
{
"db": "EXPLOIT-DB",
"id": "44695",
"trust": 1.7
},
{
"db": "SIEMENS",
"id": "SSA-505225",
"trust": 1.7
},
{
"db": "CERT/CC",
"id": "VU#584653",
"trust": 0.8
},
{
"db": "PACKETSTORM",
"id": "152767",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2018-13391",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2020.2340",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2021.3058",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2020.2798",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2020.3052",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.0077.2",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.1025.2",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.4343",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.0854",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2021.4156",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.0726",
"trust": 0.6
},
{
"db": "LENOVO",
"id": "LEN-30550",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-201805-749",
"trust": 0.6
},
{
"db": "PACKETSTORM",
"id": "148484",
"trust": 0.2
},
{
"db": "PACKETSTORM",
"id": "147748",
"trust": 0.2
},
{
"db": "PACKETSTORM",
"id": "148330",
"trust": 0.2
},
{
"db": "PACKETSTORM",
"id": "150077",
"trust": 0.2
},
{
"db": "PACKETSTORM",
"id": "147738",
"trust": 0.2
},
{
"db": "PACKETSTORM",
"id": "147778",
"trust": 0.2
},
{
"db": "PACKETSTORM",
"id": "147758",
"trust": 0.2
},
{
"db": "PACKETSTORM",
"id": "150075",
"trust": 0.2
},
{
"db": "PACKETSTORM",
"id": "151288",
"trust": 0.2
},
{
"db": "PACKETSTORM",
"id": "148581",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148151",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147743",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148318",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148731",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148817",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "150097",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147932",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "150076",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147839",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147749",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148324",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147769",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147746",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147765",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147762",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147770",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147754",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147756",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147931",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148323",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147751",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147747",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147764",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147755",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147873",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "150073",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148699",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147763",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148656",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147744",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147779",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147734",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147750",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148370",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147767",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147719",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "150090",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147737",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147742",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147796",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147720",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "149127",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "149390",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148614",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148818",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147752",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "150096",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147745",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147753",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148751",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147780",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148842",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147733",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147866",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147740",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147757",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147741",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "150079",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "150078",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148853",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147735",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147766",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148695",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147938",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147933",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147721",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147760",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148975",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "150095",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "150074",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147736",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147761",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148317",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147904",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147759",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147930",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148507",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147739",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147851",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147934",
"trust": 0.1
},
{
"db": "VULHUB",
"id": "VHN-133670",
"trust": 0.1
},
{
"db": "BID",
"id": "104228",
"trust": 0.1
},
{
"db": "CNNVD",
"id": "CNNVD-201805-748",
"trust": 0.1
},
{
"db": "VULHUB",
"id": "VHN-133671",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "150070",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "148244",
"trust": 0.1
}
],
"sources": [
{
"db": "CERT/CC",
"id": "VU#180049"
},
{
"db": "CNVD",
"id": "CNVD-2018-13391"
},
{
"db": "VULHUB",
"id": "VHN-133670"
},
{
"db": "VULHUB",
"id": "VHN-133671"
},
{
"db": "PACKETSTORM",
"id": "147778"
},
{
"db": "PACKETSTORM",
"id": "150070"
},
{
"db": "PACKETSTORM",
"id": "148244"
},
{
"db": "PACKETSTORM",
"id": "151288"
},
{
"db": "PACKETSTORM",
"id": "150075"
},
{
"db": "PACKETSTORM",
"id": "147738"
},
{
"db": "PACKETSTORM",
"id": "147758"
},
{
"db": "PACKETSTORM",
"id": "148330"
},
{
"db": "PACKETSTORM",
"id": "148484"
},
{
"db": "PACKETSTORM",
"id": "152767"
},
{
"db": "PACKETSTORM",
"id": "150077"
},
{
"db": "PACKETSTORM",
"id": "147748"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-749"
},
{
"db": "NVD",
"id": "CVE-2018-3639"
}
]
},
"id": "VAR-201805-0963",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2018-13391"
},
{
"db": "VULHUB",
"id": "VHN-133670"
},
{
"db": "VULHUB",
"id": "VHN-133671"
}
],
"trust": 1.4987851138095238
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"Network device"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2018-13391"
}
]
},
"last_update_date": "2024-11-29T22:19:19.544000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "Patches for multiple CPUHardware information disclosure vulnerabilities",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/134555"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2018-13391"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-203",
"trust": 1.2
},
{
"problemtype": "CWE-200",
"trust": 0.2
}
],
"sources": [
{
"db": "VULHUB",
"id": "VHN-133670"
},
{
"db": "VULHUB",
"id": "VHN-133671"
},
{
"db": "NVD",
"id": "CVE-2018-3639"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 3.4,
"url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html"
},
{
"trust": 2.6,
"url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability"
},
{
"trust": 2.6,
"url": "https://www.us-cert.gov/ncas/alerts/ta18-141a"
},
{
"trust": 2.6,
"url": "https://tools.cisco.com/security/center/content/ciscosecurityadvisory/cisco-sa-20180521-cpusidechannel"
},
{
"trust": 2.5,
"url": "https://bugs.chromium.org/p/project-zero/issues/detail?id=1528"
},
{
"trust": 2.3,
"url": "http://www.securityfocus.com/bid/104232"
},
{
"trust": 2.3,
"url": "https://www.oracle.com/security-alerts/cpujul2020.html"
},
{
"trust": 2.3,
"url": "https://lists.debian.org/debian-lts-announce/2019/03/msg00017.html"
},
{
"trust": 2.3,
"url": "https://lists.debian.org/debian-lts-announce/2019/03/msg00034.html"
},
{
"trust": 1.8,
"url": "https://www.kb.cert.org/vuls/id/180049"
},
{
"trust": 1.8,
"url": "http://support.lenovo.com/us/en/solutions/len-22133"
},
{
"trust": 1.8,
"url": "http://www.fujitsu.com/global/support/products/software/security/products-f/cve-2018-3639e.html"
},
{
"trust": 1.8,
"url": "https://cert-portal.siemens.com/productcert/pdf/ssa-268644.pdf"
},
{
"trust": 1.8,
"url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf"
},
{
"trust": 1.8,
"url": "https://security.netapp.com/advisory/ntap-20180521-0001/"
},
{
"trust": 1.8,
"url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0006"
},
{
"trust": 1.8,
"url": "https://www.synology.com/support/security/synology_sa_18_23"
},
{
"trust": 1.8,
"url": "https://www.debian.org/security/2018/dsa-4273"
},
{
"trust": 1.8,
"url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00038.html"
},
{
"trust": 1.8,
"url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00017.html"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1649"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1653"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1655"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1689"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1854"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2018:2060"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2018:2161"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2018:2948"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2018:3398"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2018:3400"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2019:0148"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2019:1046"
},
{
"trust": 1.8,
"url": "http://www.securitytracker.com/id/1040949"
},
{
"trust": 1.8,
"url": "http://www.securitytracker.com/id/1042004"
},
{
"trust": 1.8,
"url": "https://usn.ubuntu.com/3756-1/"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/security/vulnerabilities/ssbd"
},
{
"trust": 1.7,
"url": "https://seclists.org/bugtraq/2019/jun/36"
},
{
"trust": 1.7,
"url": "http://xenbits.xen.org/xsa/advisory-263.html"
},
{
"trust": 1.7,
"url": "https://cert-portal.siemens.com/productcert/pdf/ssa-505225.pdf"
},
{
"trust": 1.7,
"url": "https://help.ecostruxureit.com/display/public/uadce725/security+fixes+in+struxureware+data+center+expert+v7.6.0"
},
{
"trust": 1.7,
"url": "https://nvidia.custhelp.com/app/answers/detail/a_id/4787"
},
{
"trust": 1.7,
"url": "https://portal.msrc.microsoft.com/en-us/security-guidance/advisory/adv180012"
},
{
"trust": 1.7,
"url": "https://psirt.global.sonicwall.com/vuln-detail/snwlid-2018-0004"
},
{
"trust": 1.7,
"url": "https://support.citrix.com/article/ctx235225"
},
{
"trust": 1.7,
"url": "https://support.oracle.com/knowledge/sun%20microsystems/2481872_1.html"
},
{
"trust": 1.7,
"url": "https://www.oracle.com/technetwork/security-advisory/cpujan2019-5072801.html"
},
{
"trust": 1.7,
"url": "https://www.debian.org/security/2018/dsa-4210"
},
{
"trust": 1.7,
"url": "https://www.exploit-db.com/exploits/44695/"
},
{
"trust": 1.7,
"url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00020.html"
},
{
"trust": 1.7,
"url": "https://lists.debian.org/debian-lts-announce/2019/04/msg00004.html"
},
{
"trust": 1.7,
"url": "http://www.openwall.com/lists/oss-security/2020/06/10/2"
},
{
"trust": 1.7,
"url": "http://www.openwall.com/lists/oss-security/2020/06/10/5"
},
{
"trust": 1.7,
"url": "http://www.openwall.com/lists/oss-security/2020/06/10/1"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1629"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1630"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1632"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1633"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1635"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1636"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1637"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1638"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1639"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1640"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1641"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1642"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1643"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1644"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1645"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1646"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1647"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1648"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1650"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1651"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1652"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1654"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1656"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1657"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1658"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1659"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1660"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1661"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1662"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1663"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1664"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1665"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1666"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1667"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1668"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1669"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1674"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1675"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1676"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1686"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1688"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1690"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1696"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1710"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1711"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1737"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1738"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1826"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1965"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1967"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1997"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2001"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2003"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2006"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2162"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2164"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2171"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2172"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2216"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2228"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2246"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2250"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2258"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2289"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2309"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2328"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2363"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2364"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2387"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2394"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2396"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:3396"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:3397"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:3399"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:3401"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:3402"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:3407"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:3423"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:3424"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:3425"
},
{
"trust": 1.7,
"url": "http://lists.opensuse.org/opensuse-security-announce/2019-05/msg00058.html"
},
{
"trust": 1.7,
"url": "http://lists.opensuse.org/opensuse-security-announce/2019-05/msg00059.html"
},
{
"trust": 1.7,
"url": "http://lists.opensuse.org/opensuse-security-announce/2020-09/msg00007.html"
},
{
"trust": 1.7,
"url": "https://usn.ubuntu.com/3651-1/"
},
{
"trust": 1.7,
"url": "https://usn.ubuntu.com/3652-1/"
},
{
"trust": 1.7,
"url": "https://usn.ubuntu.com/3653-1/"
},
{
"trust": 1.7,
"url": "https://usn.ubuntu.com/3653-2/"
},
{
"trust": 1.7,
"url": "https://usn.ubuntu.com/3654-1/"
},
{
"trust": 1.7,
"url": "https://usn.ubuntu.com/3654-2/"
},
{
"trust": 1.7,
"url": "https://usn.ubuntu.com/3655-1/"
},
{
"trust": 1.7,
"url": "https://usn.ubuntu.com/3655-2/"
},
{
"trust": 1.7,
"url": "https://usn.ubuntu.com/3679-1/"
},
{
"trust": 1.7,
"url": "https://usn.ubuntu.com/3680-1/"
},
{
"trust": 1.7,
"url": "https://usn.ubuntu.com/3777-3/"
},
{
"trust": 1.6,
"url": "https://support.apple.com//ht208394"
},
{
"trust": 1.6,
"url": "http://www.dell.com/support/speculative-store-bypass"
},
{
"trust": 1.6,
"url": "https://support.hpe.com/hpsc/doc/public/display?doclocale=en_us\u0026docid=emr_na-hpesbhf03850en_us"
},
{
"trust": 1.2,
"url": "https://www.redhat.com/mailman/listinfo/rhsa-announce"
},
{
"trust": 1.2,
"url": "https://access.redhat.com/security/cve/cve-2018-3639"
},
{
"trust": 1.2,
"url": "https://bugzilla.redhat.com/):"
},
{
"trust": 1.2,
"url": "https://access.redhat.com/security/team/key/"
},
{
"trust": 1.2,
"url": "https://access.redhat.com/security/team/contact/"
},
{
"trust": 1.2,
"url": "https://access.redhat.com/security/updates/classification/#important"
},
{
"trust": 1.1,
"url": "https://access.redhat.com/articles/11258"
},
{
"trust": 1.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-3639"
},
{
"trust": 0.8,
"url": "https://vuls.cert.org/confluence/display/wiki/vulnerabilities+associated+with+cpu+speculative+execution"
},
{
"trust": 0.8,
"url": "https://developer.amd.com/wp-content/resources/124441_amd64_speculativestorebypassdisable_whitepaper_final.pdf"
},
{
"trust": 0.8,
"url": "https://www.kb.cert.org/vuls/id/584653"
},
{
"trust": 0.8,
"url": "http://cwe.mitre.org/data/definitions/208.html"
},
{
"trust": 0.8,
"url": "https://software.intel.com/sites/default/files/managed/c5/63/336996-speculative-execution-side-channel-mitigations.pdf"
},
{
"trust": 0.8,
"url": "https://software.intel.com/sites/default/files/managed/b9/f9/336983-intel-analysis-of-speculative-execution-side-channels-white-paper.pdf"
},
{
"trust": 0.8,
"url": "https://fortiguard.com/psirt/fg-ir-18-002"
},
{
"trust": 0.8,
"url": "https://support.hp.com/us-en/document/c06001626"
},
{
"trust": 0.8,
"url": "http://www.hitachi.com/hirt/publications/hirt-pub18001/"
},
{
"trust": 0.8,
"url": "https://www.ibm.com/blogs/psirt/potential-impact-processors-power-family/"
},
{
"trust": 0.8,
"url": "https://docs.microsoft.com/en-us/cpp/security/developer-guidance-speculative-execution"
},
{
"trust": 0.8,
"url": "https://www.suse.com/support/kb/doc/?id=7022937"
},
{
"trust": 0.8,
"url": "https://www.synology.com/en-global/support/security/synology_sa_18_23"
},
{
"trust": 0.8,
"url": "https://wiki.ubuntu.com/securityteam/knowledgebase/variant4"
},
{
"trust": 0.8,
"url": "https://kb.vmware.com/s/article/54951"
},
{
"trust": 0.8,
"url": "https://aws.amazon.com/security/security-bulletins/aws-2018-015/"
},
{
"trust": 0.6,
"url": "https://securitytracker.com/id/1040949"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20190049-1/"
},
{
"trust": 0.6,
"url": "http://www.ibm.com/support/docview.wss"
},
{
"trust": 0.6,
"url": "https://security.business.xerox.com/wp-content/uploads/2019/11/cert_xrx19-029_ffpsv2_win10_securitybulletin_nov2019.pdf"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/77958"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/73854"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20180615-01-cpu-cn"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2020.2340/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/76682"
},
{
"trust": 0.6,
"url": "https://packetstormsecurity.com/files/152767/red-hat-security-advisory-2019-1046-01.html"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.4343/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2020.2798/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2020.3052/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2021.4156"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2021.3058"
},
{
"trust": 0.6,
"url": "http://www.ibm.com/support/docview.wss?uid=ibm10872470"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/77246"
},
{
"trust": 0.6,
"url": "https://support.lenovo.com/us/en/product_security/len-30550"
},
{
"trust": 0.6,
"url": "http://www.ibm.com/support/docview.wss?uid=ibm10879093"
},
{
"trust": 0.2,
"url": "https://support.hpe.com/hpsc/doc/public/display?doclocale=en_us\u0026amp;docid=emr_na-hpesbhf03850en_us"
},
{
"trust": 0.2,
"url": "https://access.redhat.com/security/cve/cve-2018-5803"
},
{
"trust": 0.1,
"url": "http://www.securityfocus.com/bid/104228"
},
{
"trust": 0.1,
"url": "https://portal.msrc.microsoft.com/en-us/security-guidance/advisory/adv180013"
},
{
"trust": 0.1,
"url": "https://psirt.global.sonicwall.com/vuln-detail/snwlid-2018-0005"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-7566"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-1120"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1000200"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-16648"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-10880"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-10882"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-10883"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-1065"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-10881"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-10322"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-14619"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/documentation/en-us/red_hat_enterprise_linux/7/html/7.6_release_notes/index"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-10877"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-10878"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-13405"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-10880"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-10882"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-18208"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-12232"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-17805"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1000026"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-1000200"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-17805"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-10877"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-10879"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-10883"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-1000204"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-10322"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-16648"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-10879"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1092"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-11506"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-5750"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/articles/3658021"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-18075"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-10881"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1095"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-13166"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1118"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-17806"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-5390"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-13166"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-1000026"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-8781"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-18208"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-9363"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-14641"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1065"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-1068"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-5344"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-1094"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-18344"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-10940"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1068"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-1092"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/articles/3553061"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-18344"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1094"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-7757"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-10940"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-5848"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-1118"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-5391"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-10878"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-1095"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1000204"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-18075"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-17806"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1120"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/documentation/en-us/red_hat_enterprise_linux/6/html/6.10_technical_notes/index.html"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-5803"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-2671"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2012-6701"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-7308"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-7889"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-2671"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-8890"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-7889"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1130"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-15121"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2015-8830"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/documentation/en-us/red_hat_enterprise_linux/6/html/6.10_release_notes/index.html"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-12190"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-9077"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-18203"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-6001"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2012-6701"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-9076"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-9076"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2015-8830"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-9075"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-7616"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-9075"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-6001"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-9077"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-15121"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-1130"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2017-8890"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2016-8650"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-7616"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-18203"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2016-8650"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-12190"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-7308"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/articles/2974891"
}
],
"sources": [
{
"db": "CERT/CC",
"id": "VU#180049"
},
{
"db": "CNVD",
"id": "CNVD-2018-13391"
},
{
"db": "VULHUB",
"id": "VHN-133670"
},
{
"db": "VULHUB",
"id": "VHN-133671"
},
{
"db": "PACKETSTORM",
"id": "147778"
},
{
"db": "PACKETSTORM",
"id": "150070"
},
{
"db": "PACKETSTORM",
"id": "148244"
},
{
"db": "PACKETSTORM",
"id": "151288"
},
{
"db": "PACKETSTORM",
"id": "150075"
},
{
"db": "PACKETSTORM",
"id": "147738"
},
{
"db": "PACKETSTORM",
"id": "147758"
},
{
"db": "PACKETSTORM",
"id": "148330"
},
{
"db": "PACKETSTORM",
"id": "148484"
},
{
"db": "PACKETSTORM",
"id": "152767"
},
{
"db": "PACKETSTORM",
"id": "150077"
},
{
"db": "PACKETSTORM",
"id": "147748"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-749"
},
{
"db": "NVD",
"id": "CVE-2018-3639"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CERT/CC",
"id": "VU#180049"
},
{
"db": "CNVD",
"id": "CNVD-2018-13391"
},
{
"db": "VULHUB",
"id": "VHN-133670"
},
{
"db": "VULHUB",
"id": "VHN-133671"
},
{
"db": "PACKETSTORM",
"id": "147778"
},
{
"db": "PACKETSTORM",
"id": "150070"
},
{
"db": "PACKETSTORM",
"id": "148244"
},
{
"db": "PACKETSTORM",
"id": "151288"
},
{
"db": "PACKETSTORM",
"id": "150075"
},
{
"db": "PACKETSTORM",
"id": "147738"
},
{
"db": "PACKETSTORM",
"id": "147758"
},
{
"db": "PACKETSTORM",
"id": "148330"
},
{
"db": "PACKETSTORM",
"id": "148484"
},
{
"db": "PACKETSTORM",
"id": "152767"
},
{
"db": "PACKETSTORM",
"id": "150077"
},
{
"db": "PACKETSTORM",
"id": "147748"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-749"
},
{
"db": "NVD",
"id": "CVE-2018-3639"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2018-05-21T00:00:00",
"db": "CERT/CC",
"id": "VU#180049"
},
{
"date": "2018-07-18T00:00:00",
"db": "CNVD",
"id": "CNVD-2018-13391"
},
{
"date": "2018-05-22T00:00:00",
"db": "VULHUB",
"id": "VHN-133670"
},
{
"date": "2018-05-22T00:00:00",
"db": "VULHUB",
"id": "VHN-133671"
},
{
"date": "2018-05-23T07:09:25",
"db": "PACKETSTORM",
"id": "147778"
},
{
"date": "2018-10-31T01:11:59",
"db": "PACKETSTORM",
"id": "150070"
},
{
"date": "2018-06-19T22:22:22",
"db": "PACKETSTORM",
"id": "148244"
},
{
"date": "2019-01-23T21:29:07",
"db": "PACKETSTORM",
"id": "151288"
},
{
"date": "2018-10-31T01:13:27",
"db": "PACKETSTORM",
"id": "150075"
},
{
"date": "2018-05-23T06:55:26",
"db": "PACKETSTORM",
"id": "147738"
},
{
"date": "2018-05-23T07:01:56",
"db": "PACKETSTORM",
"id": "147758"
},
{
"date": "2018-06-27T13:56:46",
"db": "PACKETSTORM",
"id": "148330"
},
{
"date": "2018-07-11T02:45:29",
"db": "PACKETSTORM",
"id": "148484"
},
{
"date": "2019-05-08T17:46:11",
"db": "PACKETSTORM",
"id": "152767"
},
{
"date": "2018-10-31T01:13:43",
"db": "PACKETSTORM",
"id": "150077"
},
{
"date": "2018-05-23T06:59:09",
"db": "PACKETSTORM",
"id": "147748"
},
{
"date": "2018-05-23T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201805-749"
},
{
"date": "2018-05-22T12:29:00.250000",
"db": "NVD",
"id": "CVE-2018-3639"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2018-06-19T00:00:00",
"db": "CERT/CC",
"id": "VU#180049"
},
{
"date": "2018-07-18T00:00:00",
"db": "CNVD",
"id": "CNVD-2018-13391"
},
{
"date": "2020-09-02T00:00:00",
"db": "VULHUB",
"id": "VHN-133670"
},
{
"date": "2020-08-24T00:00:00",
"db": "VULHUB",
"id": "VHN-133671"
},
{
"date": "2021-12-08T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201805-749"
},
{
"date": "2024-11-21T04:05:48.867000",
"db": "NVD",
"id": "CVE-2018-3639"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201805-749"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "CPU hardware utilizing speculative execution may be vulnerable to cache side-channel attacks",
"sources": [
{
"db": "CERT/CC",
"id": "VU#180049"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "bypass",
"sources": [
{
"db": "PACKETSTORM",
"id": "147778"
},
{
"db": "PACKETSTORM",
"id": "151288"
},
{
"db": "PACKETSTORM",
"id": "150075"
},
{
"db": "PACKETSTORM",
"id": "147738"
},
{
"db": "PACKETSTORM",
"id": "147758"
},
{
"db": "PACKETSTORM",
"id": "148330"
},
{
"db": "PACKETSTORM",
"id": "148484"
},
{
"db": "PACKETSTORM",
"id": "150077"
},
{
"db": "PACKETSTORM",
"id": "147748"
}
],
"trust": 0.9
}
}
var-201811-0564
Vulnerability from variot
Data Center Expert, versions 7.5.0 and earlier, allows for the upload of a zip file from its user interface to the server. A carefully crafted, malicious file could be mistakenly uploaded by an authenticated user via this feature which could contain path traversal file names. As such, it could allow for the arbitrary upload of files contained with the zip onto the server file system outside of the intended directory. This is leveraging the more commonly known ZipSlip vulnerability within Java code. Data Center Expert Contains a path traversal vulnerability.Information is obtained, information is altered, and service operation is disrupted (DoS) There is a possibility of being put into a state. Schneider Electric StruxureWare Data Center Expert is a set of centralized data center infrastructure management software from Schneider Electric (France). The software collects and distributes critical alerts, surveillance videos, and critical information, and supports a unified view of the physical infrastructure environment from anywhere on the network.
Schneider Electric StruxureWare Data Center Expert has a security vulnerability
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201811-0564",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "struxureware data center expert",
"scope": "lte",
"trust": 1.8,
"vendor": "schneider electric",
"version": "7.5.0"
},
{
"model": "electric struxureware data center expert",
"scope": "lte",
"trust": 0.8,
"vendor": "schneider",
"version": "\u003c=7.5.0"
},
{
"model": "struxureware data center expert",
"scope": "eq",
"trust": 0.6,
"vendor": "schneider electric",
"version": "7.5.0"
}
],
"sources": [
{
"db": "IVD",
"id": "9b3ded0d-d6b9-422d-aaa4-f29109720cd5"
},
{
"db": "CNVD",
"id": "CNVD-2019-45194"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-012799"
},
{
"db": "CNNVD",
"id": "CNNVD-201812-006"
},
{
"db": "NVD",
"id": "CVE-2018-7807"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/a:schneider_electric:struxureware_data_center_expert",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2018-012799"
}
]
},
"cve": "CVE-2018-7807",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "NETWORK",
"authentication": "SINGLE",
"author": "nvd@nist.gov",
"availabilityImpact": "PARTIAL",
"baseScore": 6.5,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 8.0,
"id": "CVE-2018-7807",
"impactScore": 6.4,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 1.8,
"vectorString": "AV:N/AC:L/Au:S/C:P/I:P/A:P",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "NETWORK",
"authentication": "SINGLE",
"author": "CNVD",
"availabilityImpact": "PARTIAL",
"baseScore": 6.5,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 8.0,
"id": "CNVD-2019-45194",
"impactScore": 6.4,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 0.6,
"vectorString": "AV:N/AC:L/Au:S/C:P/I:P/A:P",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "NETWORK",
"authentication": "SINGLE",
"author": "IVD",
"availabilityImpact": "PARTIAL",
"baseScore": 6.5,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 8.0,
"id": "9b3ded0d-d6b9-422d-aaa4-f29109720cd5",
"impactScore": 6.4,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 0.2,
"vectorString": "AV:N/AC:L/Au:S/C:P/I:P/A:P",
"version": "2.9 [IVD]"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"author": "nvd@nist.gov",
"availabilityImpact": "HIGH",
"baseScore": 8.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 2.8,
"id": "CVE-2018-7807",
"impactScore": 5.9,
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"trust": 1.8,
"userInteraction": "NONE",
"vectorString": "CVSS:3.0/AV:N/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2018-7807",
"trust": 1.0,
"value": "HIGH"
},
{
"author": "NVD",
"id": "CVE-2018-7807",
"trust": 0.8,
"value": "High"
},
{
"author": "CNVD",
"id": "CNVD-2019-45194",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "CNNVD",
"id": "CNNVD-201812-006",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "IVD",
"id": "9b3ded0d-d6b9-422d-aaa4-f29109720cd5",
"trust": 0.2,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "IVD",
"id": "9b3ded0d-d6b9-422d-aaa4-f29109720cd5"
},
{
"db": "CNVD",
"id": "CNVD-2019-45194"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-012799"
},
{
"db": "CNNVD",
"id": "CNNVD-201812-006"
},
{
"db": "NVD",
"id": "CVE-2018-7807"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Data Center Expert, versions 7.5.0 and earlier, allows for the upload of a zip file from its user interface to the server. A carefully crafted, malicious file could be mistakenly uploaded by an authenticated user via this feature which could contain path traversal file names. As such, it could allow for the arbitrary upload of files contained with the zip onto the server file system outside of the intended directory. This is leveraging the more commonly known ZipSlip vulnerability within Java code. Data Center Expert Contains a path traversal vulnerability.Information is obtained, information is altered, and service operation is disrupted (DoS) There is a possibility of being put into a state. Schneider Electric StruxureWare Data Center Expert is a set of centralized data center infrastructure management software from Schneider Electric (France). The software collects and distributes critical alerts, surveillance videos, and critical information, and supports a unified view of the physical infrastructure environment from anywhere on the network. \n\nSchneider Electric StruxureWare Data Center Expert has a security vulnerability",
"sources": [
{
"db": "NVD",
"id": "CVE-2018-7807"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-012799"
},
{
"db": "CNVD",
"id": "CNVD-2019-45194"
},
{
"db": "IVD",
"id": "9b3ded0d-d6b9-422d-aaa4-f29109720cd5"
}
],
"trust": 2.34
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2018-7807",
"trust": 3.2
},
{
"db": "CNVD",
"id": "CNVD-2019-45194",
"trust": 0.8
},
{
"db": "CNNVD",
"id": "CNNVD-201812-006",
"trust": 0.8
},
{
"db": "JVNDB",
"id": "JVNDB-2018-012799",
"trust": 0.8
},
{
"db": "IVD",
"id": "9B3DED0D-D6B9-422D-AAA4-F29109720CD5",
"trust": 0.2
}
],
"sources": [
{
"db": "IVD",
"id": "9b3ded0d-d6b9-422d-aaa4-f29109720cd5"
},
{
"db": "CNVD",
"id": "CNVD-2019-45194"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-012799"
},
{
"db": "CNNVD",
"id": "CNNVD-201812-006"
},
{
"db": "NVD",
"id": "CVE-2018-7807"
}
]
},
"id": "VAR-201811-0564",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "IVD",
"id": "9b3ded0d-d6b9-422d-aaa4-f29109720cd5"
},
{
"db": "CNVD",
"id": "CNVD-2019-45194"
}
],
"trust": 1.8
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"ICS"
],
"sub_category": null,
"trust": 0.8
}
],
"sources": [
{
"db": "IVD",
"id": "9b3ded0d-d6b9-422d-aaa4-f29109720cd5"
},
{
"db": "CNVD",
"id": "CNVD-2019-45194"
}
]
},
"last_update_date": "2024-11-23T23:08:33.312000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "Security fixes in StruxureWare Data Center Expert v7.6.0",
"trust": 0.8,
"url": "https://help.ecostruxureit.com/display/public/UADCE725/Security+fixes+in+StruxureWare+Data+Center+Expert+v7.6.0"
},
{
"title": "Patch for Schneider Electric StruxureWare Data Center Expert has an unknown vulnerability",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/194047"
},
{
"title": "Schneider Electric StruxureWare Data Center Expert Security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=87342"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-45194"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-012799"
},
{
"db": "CNNVD",
"id": "CNNVD-201812-006"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-22",
"trust": 1.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2018-012799"
},
{
"db": "NVD",
"id": "CVE-2018-7807"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.2,
"url": "https://help.ecostruxureit.com/display/public/uadce725/security+fixes+in+struxureware+data+center+expert+v7.6.0"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-7807"
},
{
"trust": 0.8,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-7807"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-45194"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-012799"
},
{
"db": "CNNVD",
"id": "CNNVD-201812-006"
},
{
"db": "NVD",
"id": "CVE-2018-7807"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "IVD",
"id": "9b3ded0d-d6b9-422d-aaa4-f29109720cd5"
},
{
"db": "CNVD",
"id": "CNVD-2019-45194"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-012799"
},
{
"db": "CNNVD",
"id": "CNNVD-201812-006"
},
{
"db": "NVD",
"id": "CVE-2018-7807"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-12-13T00:00:00",
"db": "IVD",
"id": "9b3ded0d-d6b9-422d-aaa4-f29109720cd5"
},
{
"date": "2019-12-13T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-45194"
},
{
"date": "2019-02-07T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2018-012799"
},
{
"date": "2018-12-03T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201812-006"
},
{
"date": "2018-11-30T19:29:00.390000",
"db": "NVD",
"id": "CVE-2018-7807"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-12-13T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-45194"
},
{
"date": "2019-02-07T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2018-012799"
},
{
"date": "2018-12-03T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201812-006"
},
{
"date": "2024-11-21T04:12:46.247000",
"db": "NVD",
"id": "CVE-2018-7807"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "remote",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201812-006"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Data Center Expert Path traversal vulnerability",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2018-012799"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Path traversal",
"sources": [
{
"db": "IVD",
"id": "9b3ded0d-d6b9-422d-aaa4-f29109720cd5"
},
{
"db": "CNNVD",
"id": "CNNVD-201812-006"
}
],
"trust": 0.8
}
}
var-201704-1294
Vulnerability from variot
Schneider Electric StruxureWare Data Center Expert before 7.4.0 uses cleartext RAM storage for passwords, which might allow remote attackers to obtain sensitive information via unspecified vectors. Schneider Electric StruxureWare Data Center is a data center automation system of Schneider Electric (France). Successfully exploiting this issue may allow an attacker to obtain sensitive information that may aid in further attacks
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201704-1294",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "struxureware data center expert",
"scope": "lte",
"trust": 1.0,
"vendor": "schneider electric",
"version": "7.3.1"
},
{
"model": "struxureware data center expert",
"scope": "eq",
"trust": 0.9,
"vendor": "schneider electric",
"version": "7.3.1"
},
{
"model": "struxureware data center expert",
"scope": "lt",
"trust": 0.8,
"vendor": "schneider electric",
"version": "7.4.0"
},
{
"model": "electric struxureware data center",
"scope": "lt",
"trust": 0.6,
"vendor": "schneider",
"version": "7.4.0"
},
{
"model": "struxureware data center expert",
"scope": "eq",
"trust": 0.3,
"vendor": "schneider electric",
"version": "7.2.4"
},
{
"model": "struxureware data center expert",
"scope": "eq",
"trust": 0.3,
"vendor": "schneider electric",
"version": "7.3.1.114"
},
{
"model": "struxureware data center expert",
"scope": "ne",
"trust": 0.3,
"vendor": "schneider electric",
"version": "7.4"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2017-07260"
},
{
"db": "BID",
"id": "98399"
},
{
"db": "JVNDB",
"id": "JVNDB-2017-003699"
},
{
"db": "CNNVD",
"id": "CNNVD-201705-046"
},
{
"db": "NVD",
"id": "CVE-2017-8371"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/a:schneider_electric:struxureware_data_center_expert",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2017-003699"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Ilya Karpov of Positive Technologies.",
"sources": [
{
"db": "BID",
"id": "98399"
}
],
"trust": 0.3
},
"cve": "CVE-2017-8371",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "NETWORK",
"authentication": "SINGLE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 4.0,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 8.0,
"id": "CVE-2017-8371",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 1.9,
"vectorString": "AV:N/AC:L/Au:S/C:P/I:N/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "NETWORK",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 8.5,
"confidentialityImpact": "COMPLETE",
"exploitabilityScore": 10.0,
"id": "CNVD-2017-07260",
"impactScore": 7.8,
"integrityImpact": "PARTIAL",
"severity": "HIGH",
"trust": 0.6,
"vectorString": "AV:N/AC:L/Au:N/C:C/I:P/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 6.8,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 2.3,
"id": "CVE-2017-8371",
"impactScore": 4.0,
"integrityImpact": "NONE",
"privilegesRequired": "HIGH",
"scope": "CHANGED",
"trust": 1.8,
"userInteraction": "NONE",
"vectorString": "CVSS:3.0/AV:N/AC:L/PR:H/UI:N/S:C/C:H/I:N/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2017-8371",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "CVE-2017-8371",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2017-07260",
"trust": 0.6,
"value": "HIGH"
},
{
"author": "CNNVD",
"id": "CNNVD-201705-046",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "VULMON",
"id": "CVE-2017-8371",
"trust": 0.1,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2017-07260"
},
{
"db": "VULMON",
"id": "CVE-2017-8371"
},
{
"db": "JVNDB",
"id": "JVNDB-2017-003699"
},
{
"db": "CNNVD",
"id": "CNNVD-201705-046"
},
{
"db": "NVD",
"id": "CVE-2017-8371"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Schneider Electric StruxureWare Data Center Expert before 7.4.0 uses cleartext RAM storage for passwords, which might allow remote attackers to obtain sensitive information via unspecified vectors. Schneider Electric StruxureWare Data Center is a data center automation system of Schneider Electric (France). \nSuccessfully exploiting this issue may allow an attacker to obtain sensitive information that may aid in further attacks",
"sources": [
{
"db": "NVD",
"id": "CVE-2017-8371"
},
{
"db": "JVNDB",
"id": "JVNDB-2017-003699"
},
{
"db": "CNVD",
"id": "CNVD-2017-07260"
},
{
"db": "BID",
"id": "98399"
},
{
"db": "VULMON",
"id": "CVE-2017-8371"
}
],
"trust": 2.52
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2017-8371",
"trust": 3.4
},
{
"db": "SCHNEIDER",
"id": "SEVD-2016-343-01",
"trust": 2.0
},
{
"db": "JVNDB",
"id": "JVNDB-2017-003699",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2017-07260",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-201705-046",
"trust": 0.6
},
{
"db": "BID",
"id": "98399",
"trust": 0.4
},
{
"db": "VULMON",
"id": "CVE-2017-8371",
"trust": 0.1
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2017-07260"
},
{
"db": "VULMON",
"id": "CVE-2017-8371"
},
{
"db": "BID",
"id": "98399"
},
{
"db": "JVNDB",
"id": "JVNDB-2017-003699"
},
{
"db": "CNNVD",
"id": "CNNVD-201705-046"
},
{
"db": "NVD",
"id": "CVE-2017-8371"
}
]
},
"id": "VAR-201704-1294",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2017-07260"
}
],
"trust": 1.6
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"ICS"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2017-07260"
}
]
},
"last_update_date": "2024-11-23T21:54:07.551000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "SEVD-2016-343-01",
"trust": 0.8,
"url": "http://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2016-343-01"
},
{
"title": "Patch for Schneider Electric StruxureWare Data Center Information Disclosure Vulnerability",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/94149"
},
{
"title": "Schneider Electric StruxureWare Data Center Expert Security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=69752"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2017-07260"
},
{
"db": "JVNDB",
"id": "JVNDB-2017-003699"
},
{
"db": "CNNVD",
"id": "CNNVD-201705-046"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-522",
"trust": 1.0
},
{
"problemtype": "CWE-200",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2017-003699"
},
{
"db": "NVD",
"id": "CVE-2017-8371"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.3,
"url": "http://www.datacenterdynamics.com/content-tracks/security-risk/schneider-patches-critical-vulnerability-in-struxureware-dcim/97738.fullarticle"
},
{
"trust": 2.0,
"url": "http://download.schneider-electric.com/files?p_doc_ref=sevd-2016-343-01"
},
{
"trust": 0.8,
"url": "http://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-8371"
},
{
"trust": 0.8,
"url": "https://nvd.nist.gov/vuln/detail/cve-2017-8371"
},
{
"trust": 0.3,
"url": "http://www.schneider-electric.com/site/home/index.cfm/ww/?selectcountry=true"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/522.html"
},
{
"trust": 0.1,
"url": "https://www.securityfocus.com/bid/98399"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2017-07260"
},
{
"db": "VULMON",
"id": "CVE-2017-8371"
},
{
"db": "BID",
"id": "98399"
},
{
"db": "JVNDB",
"id": "JVNDB-2017-003699"
},
{
"db": "CNNVD",
"id": "CNNVD-201705-046"
},
{
"db": "NVD",
"id": "CVE-2017-8371"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2017-07260"
},
{
"db": "VULMON",
"id": "CVE-2017-8371"
},
{
"db": "BID",
"id": "98399"
},
{
"db": "JVNDB",
"id": "JVNDB-2017-003699"
},
{
"db": "CNNVD",
"id": "CNNVD-201705-046"
},
{
"db": "NVD",
"id": "CVE-2017-8371"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2017-05-22T00:00:00",
"db": "CNVD",
"id": "CNVD-2017-07260"
},
{
"date": "2017-04-30T00:00:00",
"db": "VULMON",
"id": "CVE-2017-8371"
},
{
"date": "2017-01-20T00:00:00",
"db": "BID",
"id": "98399"
},
{
"date": "2017-06-05T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2017-003699"
},
{
"date": "2017-04-30T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201705-046"
},
{
"date": "2017-04-30T20:59:00.167000",
"db": "NVD",
"id": "CVE-2017-8371"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2017-05-23T00:00:00",
"db": "CNVD",
"id": "CNVD-2017-07260"
},
{
"date": "2019-10-03T00:00:00",
"db": "VULMON",
"id": "CVE-2017-8371"
},
{
"date": "2017-05-23T16:25:00",
"db": "BID",
"id": "98399"
},
{
"date": "2017-06-05T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2017-003699"
},
{
"date": "2019-10-23T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201705-046"
},
{
"date": "2024-11-21T03:33:53.460000",
"db": "NVD",
"id": "CVE-2017-8371"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "remote",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201705-046"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Schneider Electric StruxureWare Data Center Expert Vulnerability in which important information is obtained",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2017-003699"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "information disclosure",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201705-046"
}
],
"trust": 0.6
}
}
var-201804-1619
Vulnerability from variot
Vulnerability in the Java SE component of Oracle Java SE (subcomponent: Install). Supported versions that are affected are Java SE: 8u162 and 10. Difficult to exploit vulnerability allows unauthenticated attacker with logon to the infrastructure where Java SE executes to compromise Java SE. Successful attacks require human interaction from a person other than the attacker and while the vulnerability is in Java SE, attacks may significantly impact additional products. Successful attacks of this vulnerability can result in takeover of Java SE. Note: Applies to installation process on client deployment of Java. CVSS 3.0 Base Score 7.7 (Confidentiality, Integrity and Availability impacts). CVSS Vector: (CVSS:3.0/AV:L/AC:H/PR:N/UI:R/S:C/C:H/I:H/A:H). Oracle Java SE Is Install There are vulnerabilities that affect confidentiality, integrity, and availability due to incomplete handling.Information is obtained by local users, information is altered, and service operation is interrupted. (DoS) An attack may be carried out. This issue affects the 'Install' component. - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Gentoo Linux Security Advisory GLSA 201903-14
https://security.gentoo.org/
Severity: Normal Title: Oracle JDK/JRE: Multiple vulnerabilities Date: March 14, 2019 Bugs: #653560, #661456, #676134 ID: 201903-14
Synopsis
Multiple vulnerabilities have been found in Oracleas JDK and JRE software suites.
Background
Java Platform, Standard Edition (Java SE) lets you develop and deploy Java applications on desktops and servers, as well as in todayas demanding embedded environments. Java offers the rich user interface, performance, versatility, portability, and security that todayas applications require.
Affected packages
-------------------------------------------------------------------
Package / Vulnerable / Unaffected
-------------------------------------------------------------------
1 dev-java/oracle-jdk-bin < 1.8.0.202 >= 1.8.0.202 2 dev-java/oracle-jre-bin < 1.8.0.202 >= 1.8.0.202 ------------------------------------------------------------------- 2 affected packages
Description
Multiple vulnerabilities have been discovered in Oracleas JDK and JRE software suites. Please review the CVE identifiers referenced below for details.
Impact
A remote attacker could possibly execute arbitrary code with the privileges of the process, gain access to information, or cause a Denial of Service condition.
Workaround
There is no known workaround at this time.
Resolution
All Oracle JDK bin users should upgrade to the latest version:
# emerge --sync # emerge --ask --oneshot -v ">=dev-java/oracle-jdk-bin-1.8.0.202"
All Oracle JRE bin users should upgrade to the latest version:
# emerge --sync # emerge --ask --oneshot -v ">=dev-java/oracle-jre-bin-1.8.0.202"
References
[ 1 ] CVE-2018-2790 https://nvd.nist.gov/vuln/detail/CVE-2018-2790 [ 2 ] CVE-2018-2794 https://nvd.nist.gov/vuln/detail/CVE-2018-2794 [ 3 ] CVE-2018-2795 https://nvd.nist.gov/vuln/detail/CVE-2018-2795 [ 4 ] CVE-2018-2796 https://nvd.nist.gov/vuln/detail/CVE-2018-2796 [ 5 ] CVE-2018-2797 https://nvd.nist.gov/vuln/detail/CVE-2018-2797 [ 6 ] CVE-2018-2798 https://nvd.nist.gov/vuln/detail/CVE-2018-2798 [ 7 ] CVE-2018-2799 https://nvd.nist.gov/vuln/detail/CVE-2018-2799 [ 8 ] CVE-2018-2800 https://nvd.nist.gov/vuln/detail/CVE-2018-2800 [ 9 ] CVE-2018-2811 https://nvd.nist.gov/vuln/detail/CVE-2018-2811 [ 10 ] CVE-2018-2814 https://nvd.nist.gov/vuln/detail/CVE-2018-2814 [ 11 ] CVE-2018-2815 https://nvd.nist.gov/vuln/detail/CVE-2018-2815 [ 12 ] CVE-2019-2422 https://nvd.nist.gov/vuln/detail/CVE-2019-2422 [ 13 ] CVE-2019-2426 https://nvd.nist.gov/vuln/detail/CVE-2019-2426
Availability
This GLSA and any updates to it are available for viewing at the Gentoo Security Website:
https://security.gentoo.org/glsa/201903-14
Concerns?
Security is a primary focus of Gentoo Linux and ensuring the confidentiality and security of our users' machines is of utmost importance to us. Any security concerns should be addressed to security@gentoo.org or alternatively, you may file a bug at https://bugs.gentoo.org.
License
Copyright 2019 Gentoo Foundation, Inc; referenced text belongs to its owner(s).
The contents of this document are licensed under the Creative Commons - Attribution / Share Alike license.
https://creativecommons.org/licenses/by-sa/2.5
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201804-1619",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "enterprise linux workstation",
"scope": "eq",
"trust": 1.6,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "enterprise linux workstation",
"scope": "eq",
"trust": 1.6,
"vendor": "redhat",
"version": "6.0"
},
{
"model": "enterprise linux server",
"scope": "eq",
"trust": 1.6,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "enterprise linux server",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.0"
},
{
"model": "jdk",
"scope": "eq",
"trust": 1.0,
"vendor": "oracle",
"version": "1.10.0"
},
{
"model": "jre",
"scope": "eq",
"trust": 1.0,
"vendor": "oracle",
"version": "1.10.0"
},
{
"model": "jdk",
"scope": "eq",
"trust": 1.0,
"vendor": "oracle",
"version": "1.8.0"
},
{
"model": "struxureware data center expert",
"scope": "lt",
"trust": 1.0,
"vendor": "schneider electric",
"version": "7.6.0"
},
{
"model": "jre",
"scope": "eq",
"trust": 1.0,
"vendor": "oracle",
"version": "1.8.0"
},
{
"model": "jre update",
"scope": "eq",
"trust": 0.9,
"vendor": "oracle",
"version": "1.8162"
},
{
"model": "jre",
"scope": "eq",
"trust": 0.9,
"vendor": "oracle",
"version": "10.0.1"
},
{
"model": "jdk update",
"scope": "eq",
"trust": 0.9,
"vendor": "oracle",
"version": "1.8162"
},
{
"model": "jdk",
"scope": "eq",
"trust": 0.9,
"vendor": "oracle",
"version": "10.0.1"
},
{
"model": "jdk",
"scope": "eq",
"trust": 0.8,
"vendor": "oracle",
"version": "10"
},
{
"model": "jdk",
"scope": "eq",
"trust": 0.8,
"vendor": "oracle",
"version": "8 update 162"
},
{
"model": "jre",
"scope": "eq",
"trust": 0.8,
"vendor": "oracle",
"version": "10"
},
{
"model": "jre",
"scope": "eq",
"trust": 0.8,
"vendor": "oracle",
"version": "8 update 162"
},
{
"model": "enterprise linux server",
"scope": null,
"trust": 0.8,
"vendor": "red hat",
"version": null
},
{
"model": "enterprise linux workstation",
"scope": null,
"trust": 0.8,
"vendor": "red hat",
"version": null
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-2811"
},
{
"db": "CNNVD",
"id": "CNNVD-201804-1210"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-002871"
},
{
"db": "BID",
"id": "103810"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:a:oracle:jre:1.10.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:a:oracle:jre:1.8.0:update_162:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:a:oracle:jdk:1.10.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:a:oracle:jdk:1.8.0:update162:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
}
],
"operator": "OR"
},
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_workstation:6.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_workstation:7.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_server:7.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_server:6.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
}
],
"operator": "OR"
},
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:a:schneider-electric:struxureware_data_center_expert:*:*:*:*:*:*:*:*",
"cpe_name": [],
"versionEndExcluding": "7.6.0",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-2811"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Gentoo",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201804-1210"
},
{
"db": "PACKETSTORM",
"id": "152088"
}
],
"trust": 0.7
},
"cve": "CVE-2018-2811",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/severity#"
},
"@id": "https://www.variotdbs.pl/ref/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"acInsufInfo": false,
"accessComplexity": "HIGH",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "NVD",
"availabilityImpact": "PARTIAL",
"baseScore": 3.7,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 1.9,
"id": "CVE-2018-2811",
"impactScore": 6.4,
"integrityImpact": "PARTIAL",
"obtainAllPrivilege": false,
"obtainOtherPrivilege": false,
"obtainUserPrivilege": false,
"severity": "LOW",
"trust": 1.8,
"userInteractionRequired": true,
"vectorString": "AV:L/AC:H/Au:N/C:P/I:P/A:P",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "HIGH",
"attackVector": "LOCAL",
"author": "NVD",
"availabilityImpact": "HIGH",
"baseScore": 7.7,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 1.0,
"id": "CVE-2018-2811",
"impactScore": 6.0,
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "CHANGED",
"trust": 1.8,
"userInteraction": "REQUIRED",
"vectorString": "CVSS:3.0/AV:L/AC:H/PR:N/UI:R/S:C/C:H/I:H/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "NVD",
"id": "CVE-2018-2811",
"trust": 1.8,
"value": "HIGH"
},
{
"author": "CNNVD",
"id": "CNNVD-201804-1210",
"trust": 0.6,
"value": "HIGH"
}
]
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-2811"
},
{
"db": "CNNVD",
"id": "CNNVD-201804-1210"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-002871"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Vulnerability in the Java SE component of Oracle Java SE (subcomponent: Install). Supported versions that are affected are Java SE: 8u162 and 10. Difficult to exploit vulnerability allows unauthenticated attacker with logon to the infrastructure where Java SE executes to compromise Java SE. Successful attacks require human interaction from a person other than the attacker and while the vulnerability is in Java SE, attacks may significantly impact additional products. Successful attacks of this vulnerability can result in takeover of Java SE. Note: Applies to installation process on client deployment of Java. CVSS 3.0 Base Score 7.7 (Confidentiality, Integrity and Availability impacts). CVSS Vector: (CVSS:3.0/AV:L/AC:H/PR:N/UI:R/S:C/C:H/I:H/A:H). Oracle Java SE Is Install There are vulnerabilities that affect confidentiality, integrity, and availability due to incomplete handling.Information is obtained by local users, information is altered, and service operation is interrupted. (DoS) An attack may be carried out. \nThis issue affects the \u0027Install\u0027 component. - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\nGentoo Linux Security Advisory GLSA 201903-14\n- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n https://security.gentoo.org/\n- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n\n Severity: Normal\n Title: Oracle JDK/JRE: Multiple vulnerabilities\n Date: March 14, 2019\n Bugs: #653560, #661456, #676134\n ID: 201903-14\n\n- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n\nSynopsis\n========\n\nMultiple vulnerabilities have been found in Oracleas JDK and JRE\nsoftware suites. \n\nBackground\n==========\n\nJava Platform, Standard Edition (Java SE) lets you develop and deploy\nJava applications on desktops and servers, as well as in todayas\ndemanding embedded environments. Java offers the rich user interface,\nperformance, versatility, portability, and security that todayas\napplications require. \n\nAffected packages\n=================\n\n -------------------------------------------------------------------\n Package / Vulnerable / Unaffected\n -------------------------------------------------------------------\n 1 dev-java/oracle-jdk-bin \u003c 1.8.0.202 \u003e= 1.8.0.202 \n 2 dev-java/oracle-jre-bin \u003c 1.8.0.202 \u003e= 1.8.0.202 \n -------------------------------------------------------------------\n 2 affected packages\n\nDescription\n===========\n\nMultiple vulnerabilities have been discovered in Oracleas JDK and JRE\nsoftware suites. Please review the CVE identifiers referenced below for\ndetails. \n\nImpact\n======\n\nA remote attacker could possibly execute arbitrary code with the\nprivileges of the process, gain access to information, or cause a\nDenial of Service condition. \n\nWorkaround\n==========\n\nThere is no known workaround at this time. \n\nResolution\n==========\n\nAll Oracle JDK bin users should upgrade to the latest version:\n\n # emerge --sync\n # emerge --ask --oneshot -v \"\u003e=dev-java/oracle-jdk-bin-1.8.0.202\"\n\nAll Oracle JRE bin users should upgrade to the latest version:\n\n # emerge --sync\n # emerge --ask --oneshot -v \"\u003e=dev-java/oracle-jre-bin-1.8.0.202\"\n\nReferences\n==========\n\n[ 1 ] CVE-2018-2790\n https://nvd.nist.gov/vuln/detail/CVE-2018-2790\n[ 2 ] CVE-2018-2794\n https://nvd.nist.gov/vuln/detail/CVE-2018-2794\n[ 3 ] CVE-2018-2795\n https://nvd.nist.gov/vuln/detail/CVE-2018-2795\n[ 4 ] CVE-2018-2796\n https://nvd.nist.gov/vuln/detail/CVE-2018-2796\n[ 5 ] CVE-2018-2797\n https://nvd.nist.gov/vuln/detail/CVE-2018-2797\n[ 6 ] CVE-2018-2798\n https://nvd.nist.gov/vuln/detail/CVE-2018-2798\n[ 7 ] CVE-2018-2799\n https://nvd.nist.gov/vuln/detail/CVE-2018-2799\n[ 8 ] CVE-2018-2800\n https://nvd.nist.gov/vuln/detail/CVE-2018-2800\n[ 9 ] CVE-2018-2811\n https://nvd.nist.gov/vuln/detail/CVE-2018-2811\n[ 10 ] CVE-2018-2814\n https://nvd.nist.gov/vuln/detail/CVE-2018-2814\n[ 11 ] CVE-2018-2815\n https://nvd.nist.gov/vuln/detail/CVE-2018-2815\n[ 12 ] CVE-2019-2422\n https://nvd.nist.gov/vuln/detail/CVE-2019-2422\n[ 13 ] CVE-2019-2426\n https://nvd.nist.gov/vuln/detail/CVE-2019-2426\n\nAvailability\n============\n\nThis GLSA and any updates to it are available for viewing at\nthe Gentoo Security Website:\n\n https://security.gentoo.org/glsa/201903-14\n\nConcerns?\n=========\n\nSecurity is a primary focus of Gentoo Linux and ensuring the\nconfidentiality and security of our users\u0027 machines is of utmost\nimportance to us. Any security concerns should be addressed to\nsecurity@gentoo.org or alternatively, you may file a bug at\nhttps://bugs.gentoo.org. \n\nLicense\n=======\n\nCopyright 2019 Gentoo Foundation, Inc; referenced text\nbelongs to its owner(s). \n\nThe contents of this document are licensed under the\nCreative Commons - Attribution / Share Alike license. \n\nhttps://creativecommons.org/licenses/by-sa/2.5\n",
"sources": [
{
"db": "NVD",
"id": "CVE-2018-2811"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-002871"
},
{
"db": "BID",
"id": "103810"
},
{
"db": "PACKETSTORM",
"id": "152088"
}
],
"trust": 1.98
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2018-2811",
"trust": 2.8
},
{
"db": "BID",
"id": "103810",
"trust": 1.9
},
{
"db": "SECTRACK",
"id": "1040697",
"trust": 1.6
},
{
"db": "JVNDB",
"id": "JVNDB-2018-002871",
"trust": 0.8
},
{
"db": "PACKETSTORM",
"id": "152088",
"trust": 0.7
},
{
"db": "CNNVD",
"id": "CNNVD-201804-1210",
"trust": 0.6
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-2811"
},
{
"db": "CNNVD",
"id": "CNNVD-201804-1210"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-002871"
},
{
"db": "BID",
"id": "103810"
},
{
"db": "PACKETSTORM",
"id": "152088"
}
]
},
"id": "VAR-201804-1619",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "VARIoT devices database",
"id": null
}
],
"trust": 0.1196509
},
"last_update_date": "2021-12-19T00:57:05.378000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "Oracle Critical Patch Update Advisory - April 2018",
"trust": 0.8,
"url": "http://www.oracle.com/technetwork/security-advisory/cpuapr2018-3678067.html"
},
{
"title": "Text Form of Oracle Critical Patch Update - April 2018 Risk Matrices",
"trust": 0.8,
"url": "http://www.oracle.com/technetwork/security-advisory/cpuapr2018verbose-3678108.html"
},
{
"title": "RHSA-2018:1204",
"trust": 0.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1204"
},
{
"title": "RHSA-2018:1202",
"trust": 0.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1202"
},
{
"title": "Oracle Corporation Java\u30d7\u30e9\u30b0\u30a4\u30f3\u306e\u8106\u5f31\u6027\u306b\u95a2\u3059\u308b\u304a\u77e5\u3089\u305b",
"trust": 0.8,
"url": "http://www.fmworld.net/biz/common/oracle/20180418.html"
},
{
"title": "Oracle Java SE Fixes for component security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqbyid.tag?id=79528"
}
],
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201804-1210"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-002871"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "NVD-CWE-noinfo",
"trust": 1.0
},
{
"problemtype": "CWE-284",
"trust": 0.8
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-2811"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-002871"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.2,
"url": "http://www.securityfocus.com/bid/103810"
},
{
"trust": 1.9,
"url": "http://www.oracle.com/technetwork/security-advisory/cpuapr2018-3678067.html"
},
{
"trust": 1.7,
"url": "https://security.gentoo.org/glsa/201903-14"
},
{
"trust": 1.6,
"url": "http://www.securitytracker.com/id/1040697"
},
{
"trust": 1.6,
"url": "https://security.netapp.com/advisory/ntap-20180419-0001/"
},
{
"trust": 1.6,
"url": "https://access.redhat.com/errata/rhsa-2018:1204"
},
{
"trust": 1.6,
"url": "https://access.redhat.com/errata/rhsa-2018:1202"
},
{
"trust": 1.6,
"url": "https://help.ecostruxureit.com/display/public/uadce725/security+fixes+in+struxureware+data+center+expert+v7.6.0"
},
{
"trust": 0.9,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-2811"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-2811"
},
{
"trust": 0.8,
"url": "https://www.ipa.go.jp/security/ciadr/vul/20180418-jre.html"
},
{
"trust": 0.8,
"url": "http://www.jpcert.or.jp/at/2018/at180018.html"
},
{
"trust": 0.6,
"url": "https://packetstormsecurity.com/files/152088/gentoo-linux-security-advisory-201903-14.html"
},
{
"trust": 0.3,
"url": "http://www.oracle.com/index.html"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-2798"
},
{
"trust": 0.1,
"url": "https://bugs.gentoo.org."
},
{
"trust": 0.1,
"url": "https://security.gentoo.org/"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-2796"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-2794"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-2795"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-2814"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-2790"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-2815"
},
{
"trust": 0.1,
"url": "https://creativecommons.org/licenses/by-sa/2.5"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-2797"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-2426"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-2800"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-2799"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-2422"
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-2811"
},
{
"db": "CNNVD",
"id": "CNNVD-201804-1210"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-002871"
},
{
"db": "BID",
"id": "103810"
},
{
"db": "PACKETSTORM",
"id": "152088"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2018-2811"
},
{
"db": "CNNVD",
"id": "CNNVD-201804-1210"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-002871"
},
{
"db": "BID",
"id": "103810"
},
{
"db": "PACKETSTORM",
"id": "152088"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2018-04-19T02:29:00",
"db": "NVD",
"id": "CVE-2018-2811"
},
{
"date": "2018-04-20T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201804-1210"
},
{
"date": "2018-05-07T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2018-002871"
},
{
"date": "2018-04-17T00:00:00",
"db": "BID",
"id": "103810"
},
{
"date": "2019-03-14T16:24:13",
"db": "PACKETSTORM",
"id": "152088"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-09-08T12:29:00",
"db": "NVD",
"id": "CVE-2018-2811"
},
{
"date": "2019-10-23T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201804-1210"
},
{
"date": "2018-05-07T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2018-002871"
},
{
"date": "2018-04-17T00:00:00",
"db": "BID",
"id": "103810"
},
{
"date": null,
"db": "PACKETSTORM",
"id": "152088"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201804-1210"
},
{
"db": "BID",
"id": "103810"
}
],
"trust": 0.9
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Oracle Java SE In Install Vulnerabilities",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2018-002871"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "access control error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201804-1210"
}
],
"trust": 0.6
}
}
var-201805-0872
Vulnerability from variot
procps-ng before version 3.3.15 is vulnerable to an incorrect integer size in proc/alloc.* leading to truncation/integer overflow issues. This flaw is related to CVE-2018-1124. procps-ng Contains an integer overflow vulnerability.Information is obtained, information is altered, and service operation is disrupted (DoS) There is a possibility of being put into a state. Procps-ng Procps is prone to the following security vulnerabilities: 1. A local security-bypass vulnerability 2. A local privilege-escalation vulnerability 3. A local denial-of-service vulnerability 4. Multiple local integer-overflow vulnerabilities 5. A stack-based buffer-overflow vulnerability Attackers can exploit these issues to execute arbitrary code in the context of the user running the affected application or perform unauthorized actions. Failed exploit attempts will likely cause a denial-of-service condition
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201805-0872",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "procps-ng",
"scope": "lt",
"trust": 1.8,
"vendor": "procps ng",
"version": "3.3.15"
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.6,
"vendor": "canonical",
"version": "16.04"
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.6,
"vendor": "canonical",
"version": "14.04"
},
{
"model": "enterprise linux workstation",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "18.04"
},
{
"model": "linux",
"scope": "eq",
"trust": 1.0,
"vendor": "debian",
"version": "7.0"
},
{
"model": "enterprise linux desktop",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "linux",
"scope": "eq",
"trust": 1.0,
"vendor": "debian",
"version": "8.0"
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.6"
},
{
"model": "enterprise linux server",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.5"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "6.6"
},
{
"model": "enterprise linux",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "struxureware data center expert",
"scope": "lt",
"trust": 1.0,
"vendor": "schneider electric",
"version": "7.6.0"
},
{
"model": "linux",
"scope": "eq",
"trust": 1.0,
"vendor": "debian",
"version": "9.0"
},
{
"model": "enterprise linux server",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "17.10"
},
{
"model": "ubuntu",
"scope": null,
"trust": 0.8,
"vendor": "canonical",
"version": null
},
{
"model": "gnu/linux",
"scope": null,
"trust": 0.8,
"vendor": "debian",
"version": null
},
{
"model": "enterprise linux",
"scope": null,
"trust": 0.8,
"vendor": "red hat",
"version": null
},
{
"model": "enterprise linux desktop",
"scope": null,
"trust": 0.8,
"vendor": "red hat",
"version": null
},
{
"model": "enterprise linux server",
"scope": null,
"trust": 0.8,
"vendor": "red hat",
"version": null
},
{
"model": "enterprise linux workstation",
"scope": null,
"trust": 0.8,
"vendor": "red hat",
"version": null
},
{
"model": "enterprise linux",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "7"
},
{
"model": "enterprise linux",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "6"
},
{
"model": "enterprise linux",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "5"
},
{
"model": "procps",
"scope": "eq",
"trust": 0.3,
"vendor": "procps ng",
"version": "0"
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1126"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-788"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005229"
},
{
"db": "BID",
"id": "104214"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:a:procps-ng_project:procps-ng:*:*:*:*:*:*:*:*",
"cpe_name": [],
"versionEndExcluding": "3.3.15",
"vulnerable": true
}
],
"operator": "OR"
},
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:o:canonical:ubuntu_linux:16.04:*:*:*:lts:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:canonical:ubuntu_linux:14.04:*:*:*:lts:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:canonical:ubuntu_linux:18.04:*:*:*:lts:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:canonical:ubuntu_linux:17.10:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
}
],
"operator": "OR"
},
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:o:debian:debian_linux:7.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:debian:debian_linux:9.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:debian:debian_linux:8.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
}
],
"operator": "OR"
},
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_desktop:7.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_server_aus:6.6:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_server_tus:6.6:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_server:7.5:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_workstation:7.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux:7.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_server:7.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
}
],
"operator": "OR"
},
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:a:schneider-electric:struxureware_data_center_expert:*:*:*:*:*:*:*:*",
"cpe_name": [],
"versionEndExcluding": "7.6.0",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1126"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Red Hat",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201805-788"
}
],
"trust": 0.6
},
"cve": "CVE-2018-1126",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/severity#"
},
"@id": "https://www.variotdbs.pl/ref/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"acInsufInfo": false,
"accessComplexity": "LOW",
"accessVector": "NETWORK",
"authentication": "NONE",
"author": "NVD",
"availabilityImpact": "PARTIAL",
"baseScore": 7.5,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 10.0,
"id": "CVE-2018-1126",
"impactScore": 6.4,
"integrityImpact": "PARTIAL",
"obtainAllPrivilege": false,
"obtainOtherPrivilege": false,
"obtainUserPrivilege": false,
"severity": "HIGH",
"trust": 1.9,
"userInteractionRequired": false,
"vectorString": "AV:N/AC:L/Au:N/C:P/I:P/A:P",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"author": "NVD",
"availabilityImpact": "HIGH",
"baseScore": 9.8,
"baseSeverity": "CRITICAL",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 3.9,
"id": "CVE-2018-1126",
"impactScore": 5.9,
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.8,
"userInteraction": "NONE",
"vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "NVD",
"id": "CVE-2018-1126",
"trust": 1.8,
"value": "CRITICAL"
},
{
"author": "CNNVD",
"id": "CNNVD-201805-788",
"trust": 0.6,
"value": "CRITICAL"
},
{
"author": "VULMON",
"id": "CVE-2018-1126",
"trust": 0.1,
"value": "HIGH"
}
]
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1126"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-788"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005229"
},
{
"db": "VULMON",
"id": "CVE-2018-1126"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "procps-ng before version 3.3.15 is vulnerable to an incorrect integer size in proc/alloc.* leading to truncation/integer overflow issues. This flaw is related to CVE-2018-1124. procps-ng Contains an integer overflow vulnerability.Information is obtained, information is altered, and service operation is disrupted (DoS) There is a possibility of being put into a state. Procps-ng Procps is prone to the following security vulnerabilities:\n1. A local security-bypass vulnerability\n2. A local privilege-escalation vulnerability\n3. A local denial-of-service vulnerability\n4. Multiple local integer-overflow vulnerabilities\n5. A stack-based buffer-overflow vulnerability\nAttackers can exploit these issues to execute arbitrary code in the context of the user running the affected application or perform unauthorized actions. Failed exploit attempts will likely cause a denial-of-service condition",
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1126"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005229"
},
{
"db": "BID",
"id": "104214"
},
{
"db": "VULMON",
"id": "CVE-2018-1126"
}
],
"trust": 1.98
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2018-1126",
"trust": 2.8
},
{
"db": "BID",
"id": "104214",
"trust": 2.0
},
{
"db": "SECTRACK",
"id": "1041057",
"trust": 1.7
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005229",
"trust": 0.8
},
{
"db": "AUSCERT",
"id": "ESB-2018.2456.4",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.2859.2",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.2859",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2020.4254",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2021.0001",
"trust": 0.6
},
{
"db": "PACKETSTORM",
"id": "153809",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-201805-788",
"trust": 0.6
},
{
"db": "VULMON",
"id": "CVE-2018-1126",
"trust": 0.1
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1126"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-788"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005229"
},
{
"db": "BID",
"id": "104214"
},
{
"db": "VULMON",
"id": "CVE-2018-1126"
}
]
},
"id": "VAR-201805-0872",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "VARIoT devices database",
"id": null
}
],
"trust": 0.1196509
},
"last_update_date": "2021-12-18T12:29:55.049000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "DSA-4208-1",
"trust": 0.8,
"url": "https://www.debian.org/security/2018/dsa-4208"
},
{
"title": "procps",
"trust": 0.8,
"url": "https://gitlab.com/procps-ng/procps"
},
{
"title": "RHSA-2018:1700",
"trust": 0.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1700"
},
{
"title": "RHSA-2018:1777",
"trust": 0.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1777"
},
{
"title": "RHSA-2018:1820",
"trust": 0.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1820"
},
{
"title": "USN-3658-1",
"trust": 0.8,
"url": "https://usn.ubuntu.com/3658-1/"
},
{
"title": "USN-3658-2",
"trust": 0.8,
"url": "https://usn.ubuntu.com/3658-2/"
},
{
"title": "procps-ng Security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqbyid.tag?id=83672"
},
{
"title": "Red Hat: Important: Red Hat Virtualization security, bug fix, and enhancement update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=rhsa-20181820 - security advisory"
},
{
"title": "Red Hat: Important: procps-ng security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=rhsa-20181700 - security advisory"
},
{
"title": "Red Hat: Important: procps-ng security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=rhsa-20191944 - security advisory"
},
{
"title": "Red Hat: Important: procps security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=rhsa-20182267 - security advisory"
},
{
"title": "Red Hat: Important: procps security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=rhsa-20182268 - security advisory"
},
{
"title": "Red Hat: Important: procps security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=rhsa-20181777 - security advisory"
},
{
"title": "Ubuntu Security Notice: procps vulnerabilities",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=usn-3658-2"
},
{
"title": "Red Hat: CVE-2018-1126",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_cve_database\u0026qid=cve-2018-1126"
},
{
"title": "Arch Linux Issues: ",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_issues\u0026qid=cve-2018-1126"
},
{
"title": "Debian CVElist Bug Report Logs: procps: CVE-2018-1122 CVE-2018-1123 CVE-2018-1124 CVE-2018-1125 CVE-2018-1126",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=debian_cvelist_bugreportlogs\u0026qid=f5176a4090976ca64e2df1278bd3172b"
},
{
"title": "Ubuntu Security Notice: procps vulnerabilities",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=usn-3658-1"
},
{
"title": "Debian Security Advisories: DSA-4208-1 procps -- security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=debian_security_advisories\u0026qid=58a59a2b26fe7d48fb944473493eb87a"
},
{
"title": "Amazon Linux 2: ALAS2-2018-1031",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux2\u0026qid=alas2-2018-1031"
},
{
"title": "Oracle VM Server for x86 Bulletins: Oracle VM Server for x86 Bulletin - April 2018",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=oracle_vm_server_for_x86_bulletins\u0026qid=c0bb087d513b6ab7ce4efb0405158613"
},
{
"title": "Oracle Linux Bulletins: Oracle Linux Bulletin - April 2018",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=oracle_linux_bulletins\u0026qid=ae57a14ec914f60b7203332a77613077"
},
{
"title": "rhel-centos-ec2-vuls",
"trust": 0.1,
"url": "https://github.com/riboseinc/rhel-centos-ec2-vuls "
},
{
"title": "core-kit",
"trust": 0.1,
"url": "https://github.com/funtoo/core-kit "
}
],
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201805-788"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005229"
},
{
"db": "VULMON",
"id": "CVE-2018-1126"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-190",
"trust": 1.8
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1126"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005229"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.8,
"url": "https://www.qualys.com/2018/05/17/procps-ng-audit-report-advisory.txt"
},
{
"trust": 2.3,
"url": "http://www.securityfocus.com/bid/104214"
},
{
"trust": 2.3,
"url": "https://access.redhat.com/errata/rhsa-2019:1944"
},
{
"trust": 1.8,
"url": "https://usn.ubuntu.com/3658-2/"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1820"
},
{
"trust": 1.7,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=cve-2018-1126"
},
{
"trust": 1.7,
"url": "http://seclists.org/oss-sec/2018/q2/122"
},
{
"trust": 1.7,
"url": "https://www.debian.org/security/2018/dsa-4208"
},
{
"trust": 1.7,
"url": "https://usn.ubuntu.com/3658-1/"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1700"
},
{
"trust": 1.7,
"url": "https://lists.debian.org/debian-lts-announce/2018/05/msg00021.html"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1777"
},
{
"trust": 1.7,
"url": "http://www.securitytracker.com/id/1041057"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2268"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2267"
},
{
"trust": 1.7,
"url": "https://help.ecostruxureit.com/display/public/uadce725/security+fixes+in+struxureware+data+center+expert+v7.6.0"
},
{
"trust": 1.1,
"url": "http://lists.opensuse.org/opensuse-security-announce/2019-10/msg00058.html"
},
{
"trust": 1.1,
"url": "http://lists.opensuse.org/opensuse-security-announce/2019-10/msg00059.html"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-1126"
},
{
"trust": 0.8,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1126"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20192730-1.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2018/suse-su-20182451-2/"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20190450-1/"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2018/suse-su-20182451-1/"
},
{
"trust": 0.6,
"url": "https://access.redhat.com/errata/rhsa-2019:2401"
},
{
"trust": 0.6,
"url": "http://www.ibm.com/support/docview.wss?uid=ibm10874468"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.2859/"
},
{
"trust": 0.6,
"url": "https://packetstormsecurity.com/files/153809/red-hat-security-advisory-2019-1944-01.html"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2021.0001/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2018.2456.4/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.2859.2/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2020.4254/"
},
{
"trust": 0.3,
"url": "https://gitlab.com/procps-ng/procps"
},
{
"trust": 0.3,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=1575465"
},
{
"trust": 0.3,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=1575466"
},
{
"trust": 0.3,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=1575473"
},
{
"trust": 0.3,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=1575474"
},
{
"trust": 0.3,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=1575852"
},
{
"trust": 0.3,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=1575853"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-1121"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-1122"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-1123"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-1124"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-1125"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-1126"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/190.html"
},
{
"trust": 0.1,
"url": "https://tools.cisco.com/security/center/viewalert.x?alertid=57950"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov"
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1126"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-788"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005229"
},
{
"db": "BID",
"id": "104214"
},
{
"db": "VULMON",
"id": "CVE-2018-1126"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2018-1126"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-788"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005229"
},
{
"db": "BID",
"id": "104214"
},
{
"db": "VULMON",
"id": "CVE-2018-1126"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2018-05-23T13:29:00",
"db": "NVD",
"id": "CVE-2018-1126"
},
{
"date": "2018-05-24T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201805-788"
},
{
"date": "2018-07-10T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2018-005229"
},
{
"date": "2018-05-17T00:00:00",
"db": "BID",
"id": "104214"
},
{
"date": "2018-05-23T00:00:00",
"db": "VULMON",
"id": "CVE-2018-1126"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-07-30T13:15:00",
"db": "NVD",
"id": "CVE-2018-1126"
},
{
"date": "2021-01-04T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201805-788"
},
{
"date": "2018-07-10T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2018-005229"
},
{
"date": "2018-05-17T00:00:00",
"db": "BID",
"id": "104214"
},
{
"date": "2019-07-30T00:00:00",
"db": "VULMON",
"id": "CVE-2018-1126"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "remote",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201805-788"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "procps-ng Integer overflow vulnerability",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2018-005229"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "input validation error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201805-788"
},
{
"db": "BID",
"id": "104214"
}
],
"trust": 0.9
}
}
var-201805-0613
Vulnerability from variot
procps-ng before version 3.3.15 is vulnerable to multiple integer overflows leading to a heap corruption in file2strvec function. This allows a privilege escalation for a local attacker who can create entries in procfs by starting processes, which could result in crashes or arbitrary code execution in proc utilities run by other users. procps-ng Contains an integer overflow vulnerability.Information is obtained, information is altered, and service operation is disrupted (DoS) There is a possibility of being put into a state. Procps-ng Procps is prone to the following security vulnerabilities: 1. A local security-bypass vulnerability 2. A local privilege-escalation vulnerability 3. A local denial-of-service vulnerability 4. Multiple local integer-overflow vulnerabilities 5. A stack-based buffer-overflow vulnerability Attackers can exploit these issues to execute arbitrary code in the context of the user running the affected application or perform unauthorized actions. Failed exploit attempts will likely cause a denial-of-service condition. - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Gentoo Linux Security Advisory GLSA 201805-14
https://security.gentoo.org/
Severity: Normal Title: procps: Multiple vulnerabilities Date: May 30, 2018 Bugs: #656022 ID: 201805-14
Synopsis
Multiple vulnerabilities have been found in procps, the worst of which could result in the execution of arbitrary code.
Background
A bunch of small useful utilities that give information about processes using the /proc filesystem.
Affected packages
-------------------------------------------------------------------
Package / Vulnerable / Unaffected
-------------------------------------------------------------------
1 sys-process/procps < 3.3.15-r1 >= 3.3.15-r1
Description
Multiple vulnerabilities have been discovered in procps. Please review the CVE identifiers referenced below for details.
Impact
A local attacker could execute arbitrary code, escalate privileges, or cause a Denial of Service condition.
Workaround
There is no known workaround at this time.
Resolution
All procps users should upgrade to the latest version:
# emerge --sync # emerge --ask --oneshot --verbose ">=sys-process/procps-3.3.15-r1"
References
[ 1 ] CVE-2018-1120 https://nvd.nist.gov/vuln/detail/CVE-2018-1120 [ 2 ] CVE-2018-1121 https://nvd.nist.gov/vuln/detail/CVE-2018-1121 [ 3 ] CVE-2018-1122 https://nvd.nist.gov/vuln/detail/CVE-2018-1122 [ 4 ] CVE-2018-1123 https://nvd.nist.gov/vuln/detail/CVE-2018-1123 [ 5 ] CVE-2018-1124 https://nvd.nist.gov/vuln/detail/CVE-2018-1124
Availability
This GLSA and any updates to it are available for viewing at the Gentoo Security Website:
https://security.gentoo.org/glsa/201805-14
Concerns?
Security is a primary focus of Gentoo Linux and ensuring the confidentiality and security of our users' machines is of utmost importance to us. Any security concerns should be addressed to security@gentoo.org or alternatively, you may file a bug at https://bugs.gentoo.org.
License
Copyright 2018 Gentoo Foundation, Inc; referenced text belongs to its owner(s).
The contents of this document are licensed under the Creative Commons - Attribution / Share Alike license.
https://creativecommons.org/licenses/by-sa/2.5
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201805-0613",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "procps-ng",
"scope": "lt",
"trust": 1.8,
"vendor": "procps ng",
"version": "3.3.15"
},
{
"model": "enterprise linux workstation",
"scope": "eq",
"trust": 1.6,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "enterprise linux desktop",
"scope": "eq",
"trust": 1.6,
"vendor": "redhat",
"version": "6.0"
},
{
"model": "enterprise linux desktop",
"scope": "eq",
"trust": 1.6,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "enterprise linux",
"scope": "eq",
"trust": 1.6,
"vendor": "redhat",
"version": "6.0"
},
{
"model": "enterprise linux server",
"scope": "eq",
"trust": 1.6,
"vendor": "redhat",
"version": "6.0"
},
{
"model": "enterprise linux",
"scope": "eq",
"trust": 1.6,
"vendor": "redhat",
"version": "7.5"
},
{
"model": "enterprise linux workstation",
"scope": "eq",
"trust": 1.6,
"vendor": "redhat",
"version": "6.0"
},
{
"model": "enterprise linux",
"scope": "eq",
"trust": 1.6,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "enterprise linux server",
"scope": "eq",
"trust": 1.6,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "18.04"
},
{
"model": "linux",
"scope": "eq",
"trust": 1.0,
"vendor": "debian",
"version": "7.0"
},
{
"model": "leap",
"scope": "eq",
"trust": 1.0,
"vendor": "opensuse",
"version": "15.1"
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "16.04"
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "14.04"
},
{
"model": "struxureware data center expert",
"scope": "lt",
"trust": 1.0,
"vendor": "schneider electric",
"version": "7.6.0"
},
{
"model": "linux",
"scope": "eq",
"trust": 1.0,
"vendor": "debian",
"version": "9.0"
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "17.10"
},
{
"model": "linux",
"scope": "eq",
"trust": 1.0,
"vendor": "debian",
"version": "8.0"
},
{
"model": "leap",
"scope": "eq",
"trust": 1.0,
"vendor": "opensuse",
"version": "15.0"
},
{
"model": "ubuntu",
"scope": null,
"trust": 0.8,
"vendor": "canonical",
"version": null
},
{
"model": "gnu/linux",
"scope": null,
"trust": 0.8,
"vendor": "debian",
"version": null
},
{
"model": "enterprise linux",
"scope": null,
"trust": 0.8,
"vendor": "red hat",
"version": null
},
{
"model": "enterprise linux desktop",
"scope": null,
"trust": 0.8,
"vendor": "red hat",
"version": null
},
{
"model": "enterprise linux server",
"scope": null,
"trust": 0.8,
"vendor": "red hat",
"version": null
},
{
"model": "enterprise linux workstation",
"scope": null,
"trust": 0.8,
"vendor": "red hat",
"version": null
},
{
"model": "enterprise linux",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "7"
},
{
"model": "enterprise linux",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "6"
},
{
"model": "enterprise linux",
"scope": "eq",
"trust": 0.3,
"vendor": "redhat",
"version": "5"
},
{
"model": "procps",
"scope": "eq",
"trust": 0.3,
"vendor": "procps ng",
"version": "0"
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1124"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-789"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005228"
},
{
"db": "BID",
"id": "104214"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:a:procps-ng_project:procps-ng:*:*:*:*:*:*:*:*",
"cpe_name": [],
"versionEndExcluding": "3.3.15",
"vulnerable": true
}
],
"operator": "OR"
},
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:o:canonical:ubuntu_linux:16.04:*:*:*:lts:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:canonical:ubuntu_linux:14.04:*:*:*:lts:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:canonical:ubuntu_linux:18.04:*:*:*:lts:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:canonical:ubuntu_linux:17.10:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
}
],
"operator": "OR"
},
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:o:debian:debian_linux:7.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:debian:debian_linux:9.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:debian:debian_linux:8.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
}
],
"operator": "OR"
},
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_desktop:7.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_server:6.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux:6.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_workstation:7.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux:7.5:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux:7.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_workstation:6.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_server:7.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux_desktop:6.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
}
],
"operator": "OR"
},
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:a:schneider-electric:struxureware_data_center_expert:*:*:*:*:*:*:*:*",
"cpe_name": [],
"versionEndExcluding": "7.6.0",
"vulnerable": true
}
],
"operator": "OR"
},
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:o:opensuse:leap:15.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:opensuse:leap:15.1:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1124"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Red Hat",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201805-789"
}
],
"trust": 0.6
},
"cve": "CVE-2018-1124",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/severity#"
},
"@id": "https://www.variotdbs.pl/ref/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"acInsufInfo": false,
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "NVD",
"availabilityImpact": "PARTIAL",
"baseScore": 4.6,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CVE-2018-1124",
"impactScore": 6.4,
"integrityImpact": "PARTIAL",
"obtainAllPrivilege": false,
"obtainOtherPrivilege": false,
"obtainUserPrivilege": false,
"severity": "MEDIUM",
"trust": 1.9,
"userInteractionRequired": false,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:P/A:P",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"author": "NVD",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 1.8,
"id": "CVE-2018-1124",
"impactScore": 5.9,
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Local",
"author": "NVD",
"availabilityImpact": "High",
"baseScore": 7.8,
"baseSeverity": "High",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "CVE-2018-1124",
"impactScore": null,
"integrityImpact": "High",
"privilegesRequired": "Low",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "NVD",
"id": "CVE-2018-1124",
"trust": 1.8,
"value": "HIGH"
},
{
"author": "CNNVD",
"id": "CNNVD-201805-789",
"trust": 0.6,
"value": "HIGH"
},
{
"author": "VULMON",
"id": "CVE-2018-1124",
"trust": 0.1,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1124"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-789"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005228"
},
{
"db": "VULMON",
"id": "CVE-2018-1124"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "procps-ng before version 3.3.15 is vulnerable to multiple integer overflows leading to a heap corruption in file2strvec function. This allows a privilege escalation for a local attacker who can create entries in procfs by starting processes, which could result in crashes or arbitrary code execution in proc utilities run by other users. procps-ng Contains an integer overflow vulnerability.Information is obtained, information is altered, and service operation is disrupted (DoS) There is a possibility of being put into a state. Procps-ng Procps is prone to the following security vulnerabilities:\n1. A local security-bypass vulnerability\n2. A local privilege-escalation vulnerability\n3. A local denial-of-service vulnerability\n4. Multiple local integer-overflow vulnerabilities\n5. A stack-based buffer-overflow vulnerability\nAttackers can exploit these issues to execute arbitrary code in the context of the user running the affected application or perform unauthorized actions. Failed exploit attempts will likely cause a denial-of-service condition. - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\nGentoo Linux Security Advisory GLSA 201805-14\n- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n https://security.gentoo.org/\n- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n\n Severity: Normal\n Title: procps: Multiple vulnerabilities\n Date: May 30, 2018\n Bugs: #656022\n ID: 201805-14\n\n- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n\nSynopsis\n========\n\nMultiple vulnerabilities have been found in procps, the worst of which\ncould result in the execution of arbitrary code. \n\nBackground\n==========\n\nA bunch of small useful utilities that give information about processes\nusing the /proc filesystem. \n\nAffected packages\n=================\n\n -------------------------------------------------------------------\n Package / Vulnerable / Unaffected\n -------------------------------------------------------------------\n 1 sys-process/procps \u003c 3.3.15-r1 \u003e= 3.3.15-r1 \n\nDescription\n===========\n\nMultiple vulnerabilities have been discovered in procps. Please review\nthe CVE identifiers referenced below for details. \n\nImpact\n======\n\nA local attacker could execute arbitrary code, escalate privileges, or\ncause a Denial of Service condition. \n\nWorkaround\n==========\n\nThere is no known workaround at this time. \n\nResolution\n==========\n\nAll procps users should upgrade to the latest version:\n\n # emerge --sync\n # emerge --ask --oneshot --verbose \"\u003e=sys-process/procps-3.3.15-r1\"\n\nReferences\n==========\n\n[ 1 ] CVE-2018-1120\n https://nvd.nist.gov/vuln/detail/CVE-2018-1120\n[ 2 ] CVE-2018-1121\n https://nvd.nist.gov/vuln/detail/CVE-2018-1121\n[ 3 ] CVE-2018-1122\n https://nvd.nist.gov/vuln/detail/CVE-2018-1122\n[ 4 ] CVE-2018-1123\n https://nvd.nist.gov/vuln/detail/CVE-2018-1123\n[ 5 ] CVE-2018-1124\n https://nvd.nist.gov/vuln/detail/CVE-2018-1124\n\nAvailability\n============\n\nThis GLSA and any updates to it are available for viewing at\nthe Gentoo Security Website:\n\n https://security.gentoo.org/glsa/201805-14\n\nConcerns?\n=========\n\nSecurity is a primary focus of Gentoo Linux and ensuring the\nconfidentiality and security of our users\u0027 machines is of utmost\nimportance to us. Any security concerns should be addressed to\nsecurity@gentoo.org or alternatively, you may file a bug at\nhttps://bugs.gentoo.org. \n\nLicense\n=======\n\nCopyright 2018 Gentoo Foundation, Inc; referenced text\nbelongs to its owner(s). \n\nThe contents of this document are licensed under the\nCreative Commons - Attribution / Share Alike license. \n\nhttps://creativecommons.org/licenses/by-sa/2.5\n",
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1124"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005228"
},
{
"db": "BID",
"id": "104214"
},
{
"db": "VULMON",
"id": "CVE-2018-1124"
},
{
"db": "PACKETSTORM",
"id": "147943"
}
],
"trust": 2.07
},
"exploit_availability": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/exploit_availability#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"reference": "https://vulmon.com/exploitdetails?qidtp=exploitdb\u0026qid=44806",
"trust": 0.1,
"type": "exploit"
}
],
"sources": [
{
"db": "VULMON",
"id": "CVE-2018-1124"
}
]
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2018-1124",
"trust": 2.9
},
{
"db": "BID",
"id": "104214",
"trust": 2.0
},
{
"db": "SECTRACK",
"id": "1041057",
"trust": 1.7
},
{
"db": "EXPLOIT-DB",
"id": "44806",
"trust": 1.7
},
{
"db": "MCAFEE",
"id": "SB10241",
"trust": 1.7
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005228",
"trust": 0.8
},
{
"db": "AUSCERT",
"id": "ESB-2019.2859",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2018.2456.4",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.2859.2",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2020.4254",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2021.0001",
"trust": 0.6
},
{
"db": "PACKETSTORM",
"id": "153967",
"trust": 0.6
},
{
"db": "PACKETSTORM",
"id": "153809",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-201805-789",
"trust": 0.6
},
{
"db": "VULMON",
"id": "CVE-2018-1124",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "147943",
"trust": 0.1
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1124"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-789"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005228"
},
{
"db": "BID",
"id": "104214"
},
{
"db": "VULMON",
"id": "CVE-2018-1124"
},
{
"db": "PACKETSTORM",
"id": "147943"
}
]
},
"id": "VAR-201805-0613",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "VARIoT devices database",
"id": null
}
],
"trust": 0.1196509
},
"last_update_date": "2021-12-18T22:07:19.455000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "DSA-4208-1",
"trust": 0.8,
"url": "https://www.debian.org/security/2018/dsa-4208"
},
{
"title": "procps",
"trust": 0.8,
"url": "https://gitlab.com/procps-ng/procps"
},
{
"title": "RHSA-2018:1700",
"trust": 0.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1700"
},
{
"title": "RHSA-2018:1777",
"trust": 0.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1777"
},
{
"title": "RHSA-2018:1820",
"trust": 0.8,
"url": "https://access.redhat.com/errata/rhsa-2018:1820"
},
{
"title": "USN-3658-1",
"trust": 0.8,
"url": "https://usn.ubuntu.com/3658-1/"
},
{
"title": "USN-3658-2",
"trust": 0.8,
"url": "https://usn.ubuntu.com/3658-2/"
},
{
"title": "procps-ng Fixes for digital error vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqbyid.tag?id=83673"
},
{
"title": "Red Hat: Important: procps-ng security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=rhsa-20192401 - security advisory"
},
{
"title": "Red Hat: Important: Red Hat Virtualization security, bug fix, and enhancement update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=rhsa-20181820 - security advisory"
},
{
"title": "Red Hat: Important: procps-ng security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=rhsa-20181700 - security advisory"
},
{
"title": "Red Hat: Important: procps-ng security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=rhsa-20191944 - security advisory"
},
{
"title": "Red Hat: Important: procps security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=rhsa-20182267 - security advisory"
},
{
"title": "Red Hat: Important: procps security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=rhsa-20182268 - security advisory"
},
{
"title": "Red Hat: Important: procps security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=rhsa-20181777 - security advisory"
},
{
"title": "Ubuntu Security Notice: procps vulnerabilities",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=usn-3658-2"
},
{
"title": "Red Hat: CVE-2018-1124",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_cve_database\u0026qid=cve-2018-1124"
},
{
"title": "Ubuntu Security Notice: procps vulnerabilities",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=usn-3658-1"
},
{
"title": "Arch Linux Issues: ",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_issues\u0026qid=cve-2018-1124"
},
{
"title": "Debian CVElist Bug Report Logs: procps: CVE-2018-1122 CVE-2018-1123 CVE-2018-1124 CVE-2018-1125 CVE-2018-1126",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=debian_cvelist_bugreportlogs\u0026qid=f5176a4090976ca64e2df1278bd3172b"
},
{
"title": "Debian Security Advisories: DSA-4208-1 procps -- security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=debian_security_advisories\u0026qid=58a59a2b26fe7d48fb944473493eb87a"
},
{
"title": "Amazon Linux 2: ALAS2-2018-1031",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux2\u0026qid=alas2-2018-1031"
},
{
"title": "Oracle VM Server for x86 Bulletins: Oracle VM Server for x86 Bulletin - April 2018",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=oracle_vm_server_for_x86_bulletins\u0026qid=c0bb087d513b6ab7ce4efb0405158613"
},
{
"title": "Oracle Linux Bulletins: Oracle Linux Bulletin - April 2018",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=oracle_linux_bulletins\u0026qid=ae57a14ec914f60b7203332a77613077"
},
{
"title": "rhel-centos-ec2-vuls",
"trust": 0.1,
"url": "https://github.com/riboseinc/rhel-centos-ec2-vuls "
},
{
"title": "core-kit",
"trust": 0.1,
"url": "https://github.com/funtoo/core-kit "
}
],
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201805-789"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005228"
},
{
"db": "VULMON",
"id": "CVE-2018-1124"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-190",
"trust": 1.8
},
{
"problemtype": "CWE-787",
"trust": 1.0
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1124"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005228"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.8,
"url": "https://www.qualys.com/2018/05/17/procps-ng-audit-report-advisory.txt"
},
{
"trust": 2.4,
"url": "https://access.redhat.com/errata/rhsa-2019:2401"
},
{
"trust": 2.3,
"url": "http://www.securityfocus.com/bid/104214"
},
{
"trust": 2.3,
"url": "https://access.redhat.com/errata/rhsa-2019:1944"
},
{
"trust": 1.8,
"url": "https://www.exploit-db.com/exploits/44806/"
},
{
"trust": 1.8,
"url": "https://usn.ubuntu.com/3658-2/"
},
{
"trust": 1.8,
"url": "https://security.gentoo.org/glsa/201805-14"
},
{
"trust": 1.7,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=cve-2018-1124"
},
{
"trust": 1.7,
"url": "http://seclists.org/oss-sec/2018/q2/122"
},
{
"trust": 1.7,
"url": "https://www.debian.org/security/2018/dsa-4208"
},
{
"trust": 1.7,
"url": "https://usn.ubuntu.com/3658-1/"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1700"
},
{
"trust": 1.7,
"url": "https://lists.debian.org/debian-lts-announce/2018/05/msg00021.html"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1777"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:1820"
},
{
"trust": 1.7,
"url": "https://kc.mcafee.com/corporate/index?page=content\u0026id=sb10241"
},
{
"trust": 1.7,
"url": "http://www.securitytracker.com/id/1041057"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2268"
},
{
"trust": 1.7,
"url": "https://access.redhat.com/errata/rhsa-2018:2267"
},
{
"trust": 1.7,
"url": "https://help.ecostruxureit.com/display/public/uadce725/security+fixes+in+struxureware+data+center+expert+v7.6.0"
},
{
"trust": 1.7,
"url": "http://lists.opensuse.org/opensuse-security-announce/2019-10/msg00058.html"
},
{
"trust": 1.7,
"url": "http://lists.opensuse.org/opensuse-security-announce/2019-10/msg00059.html"
},
{
"trust": 0.9,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1124"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-1124"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20192730-1.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2018/suse-su-20182451-2/"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20190450-1/"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2018/suse-su-20182451-1/"
},
{
"trust": 0.6,
"url": "http://www.ibm.com/support/docview.wss?uid=ibm10874468"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.2859/"
},
{
"trust": 0.6,
"url": "https://packetstormsecurity.com/files/153967/red-hat-security-advisory-2019-2401-01.html"
},
{
"trust": 0.6,
"url": "https://packetstormsecurity.com/files/153809/red-hat-security-advisory-2019-1944-01.html"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2021.0001/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2018.2456.4/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.2859.2/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2020.4254/"
},
{
"trust": 0.3,
"url": "https://gitlab.com/procps-ng/procps"
},
{
"trust": 0.3,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=1575465"
},
{
"trust": 0.3,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=1575466"
},
{
"trust": 0.3,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=1575473"
},
{
"trust": 0.3,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=1575474"
},
{
"trust": 0.3,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=1575852"
},
{
"trust": 0.3,
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=1575853"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-1121"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-1122"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-1123"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-1124"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-1125"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2018-1126"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/787.html"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/190.html"
},
{
"trust": 0.1,
"url": "https://tools.cisco.com/security/center/viewalert.x?alertid=57956"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1122"
},
{
"trust": 0.1,
"url": "https://bugs.gentoo.org."
},
{
"trust": 0.1,
"url": "https://security.gentoo.org/"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1123"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1121"
},
{
"trust": 0.1,
"url": "https://creativecommons.org/licenses/by-sa/2.5"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-1120"
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2018-1124"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-789"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005228"
},
{
"db": "BID",
"id": "104214"
},
{
"db": "VULMON",
"id": "CVE-2018-1124"
},
{
"db": "PACKETSTORM",
"id": "147943"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2018-1124"
},
{
"db": "CNNVD",
"id": "CNNVD-201805-789"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-005228"
},
{
"db": "BID",
"id": "104214"
},
{
"db": "VULMON",
"id": "CVE-2018-1124"
},
{
"db": "PACKETSTORM",
"id": "147943"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2018-05-23T13:29:00",
"db": "NVD",
"id": "CVE-2018-1124"
},
{
"date": "2018-05-24T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201805-789"
},
{
"date": "2018-07-10T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2018-005228"
},
{
"date": "2018-05-17T00:00:00",
"db": "BID",
"id": "104214"
},
{
"date": "2018-05-23T00:00:00",
"db": "VULMON",
"id": "CVE-2018-1124"
},
{
"date": "2018-05-30T19:59:39",
"db": "PACKETSTORM",
"id": "147943"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-09-09T14:58:00",
"db": "NVD",
"id": "CVE-2018-1124"
},
{
"date": "2021-01-04T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201805-789"
},
{
"date": "2018-07-10T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2018-005228"
},
{
"date": "2018-05-17T00:00:00",
"db": "BID",
"id": "104214"
},
{
"date": "2020-09-09T00:00:00",
"db": "VULMON",
"id": "CVE-2018-1124"
},
{
"date": null,
"db": "PACKETSTORM",
"id": "147943"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201805-789"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "procps-ng Integer overflow vulnerability",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2018-005228"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "input validation error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201805-789"
},
{
"db": "BID",
"id": "104214"
}
],
"trust": 0.9
}
}
cve-2023-37196
Vulnerability from cvelistv5
Published
2023-07-12 06:22
Modified
2024-11-07 14:46
Severity ?
EPSS score ?
Summary
A CWE-89: Improper Neutralization of Special Elements vulnerability used in an SQL Command
('SQL Injection') vulnerability exists that could allow a user already authenticated on DCE to
access unauthorized content, change, or delete content, or perform unauthorized actions when
tampering with the alert settings of endpoints on DCE.
References
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: v7.9.3 and earlier |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T17:09:32.952Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-192-01\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-192-01.pdf"
}
],
"title": "CVE Program Container"
},
{
"affected": [
{
"cpes": [
"cpe:2.3:a:schneider-electric:struxureware_data_center_expert:*:*:*:*:*:*:*:*"
],
"defaultStatus": "unknown",
"product": "struxureware_data_center_expert",
"vendor": "schneider-electric",
"versions": [
{
"lessThanOrEqual": "7.9.3",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
}
],
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-37196",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "total"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-11-07T14:42:31.489133Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-11-07T14:46:44.245Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "StruxureWare Data Center Expert ",
"vendor": "Schneider Electric",
"versions": [
{
"status": "affected",
"version": "v7.9.3 and earlier"
}
]
}
],
"datePublic": "2023-07-11T06:22:00.000Z",
"descriptions": [
{
"lang": "en",
"supportingMedia": [
{
"base64": false,
"type": "text/html",
"value": "\n\nA CWE-89: Improper Neutralization of Special Elements vulnerability used in an SQL Command\n(\u0027SQL Injection\u0027) vulnerability exists that could allow a user already authenticated on DCE to\naccess unauthorized content, change, or delete content, or perform unauthorized actions when\ntampering with the alert settings of endpoints on DCE.\n\n"
}
],
"value": "\nA CWE-89: Improper Neutralization of Special Elements vulnerability used in an SQL Command\n(\u0027SQL Injection\u0027) vulnerability exists that could allow a user already authenticated on DCE to\naccess unauthorized content, change, or delete content, or perform unauthorized actions when\ntampering with the alert settings of endpoints on DCE.\n\n"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 8.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"format": "CVSS",
"scenarios": [
{
"lang": "en",
"value": "GENERAL"
}
]
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-89",
"description": "CWE-89 Improper Neutralization of Special Elements used in an SQL Command (\u0027SQL Injection\u0027)",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-07-12T06:22:46.848Z",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-192-01\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-192-01.pdf"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.1.0-dev"
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2023-37196",
"datePublished": "2023-07-12T06:22:46.848Z",
"dateReserved": "2023-06-28T14:14:13.863Z",
"dateUpdated": "2024-11-07T14:46:44.245Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2023-25554
Vulnerability from cvelistv5
Published
2023-04-18 20:34
Modified
2025-02-12 16:00
Severity ?
EPSS score ?
Summary
A CWE-78: Improper Neutralization of Special Elements used in an OS Command ('OS
Command Injection') vulnerability exists that allows a local privilege escalation on the appliance
when a maliciously crafted Operating System command is entered on the device.
Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)
References
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: All < |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T11:25:19.269Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-25554",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "total"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-02-05T19:37:21.602015Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2025-02-12T16:00:38.815Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "StruxureWare Data Center Expert",
"vendor": "Schneider Electric",
"versions": [
{
"lessThanOrEqual": "V7.9.2",
"status": "affected",
"version": "All",
"versionType": "custom"
}
]
}
],
"datePublic": "2023-02-14T08:00:00.000Z",
"descriptions": [
{
"lang": "en",
"supportingMedia": [
{
"base64": false,
"type": "text/html",
"value": "\u003cp\u003e\n\n\n\n\n\nA CWE-78: Improper Neutralization of Special Elements used in an OS Command (\u0027OS\nCommand Injection\u0027) vulnerability exists that allows a local privilege escalation on the appliance\nwhen a maliciously crafted Operating System command is entered on the device.\n\n \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\u003c/p\u003e"
}
],
"value": "\n\n\n\n\nA CWE-78: Improper Neutralization of Special Elements used in an OS Command (\u0027OS\nCommand Injection\u0027) vulnerability exists that allows a local privilege escalation on the appliance\nwhen a maliciously crafted Operating System command is entered on the device.\n\n \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\n\n"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"format": "CVSS",
"scenarios": [
{
"lang": "en",
"value": "GENERAL"
}
]
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-78",
"description": "CWE-78 Improper Neutralization of Special Elements used in an OS Command (\u0027OS Command Injection\u0027)",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-04-18T20:34:40.438Z",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.0.9"
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2023-25554",
"datePublished": "2023-04-18T20:34:40.438Z",
"dateReserved": "2023-02-07T17:00:03.780Z",
"dateUpdated": "2025-02-12T16:00:38.815Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2023-25553
Vulnerability from cvelistv5
Published
2023-04-18 20:38
Modified
2025-02-05 21:24
Severity ?
EPSS score ?
Summary
A CWE-79: Improper Neutralization of Input During Web Page Generation ('Cross-site
Scripting') vulnerability exists on a DCE endpoint through the logging capabilities of the
webserver.
Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)
References
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: All < |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T11:25:19.183Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-25553",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-02-05T21:24:40.357327Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2025-02-05T21:24:51.230Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "StruxureWare Data Center Expert",
"vendor": "Schneider Electric",
"versions": [
{
"lessThanOrEqual": "V7.9.2",
"status": "affected",
"version": "All",
"versionType": "custom"
}
]
}
],
"datePublic": "2023-02-14T08:00:00.000Z",
"descriptions": [
{
"lang": "en",
"supportingMedia": [
{
"base64": false,
"type": "text/html",
"value": "\u003cp\u003e\n\n\n\n\n\n\n\n\n\n\n\n\n\nA CWE-79: Improper Neutralization of Input During Web Page Generation (\u0027Cross-site\nScripting\u0027) vulnerability exists on a DCE endpoint through the logging capabilities of the\nwebserver. \n\n\n\n\n\n \n\n\n\n\n \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\u003c/p\u003e"
}
],
"value": "\n\n\n\n\n\n\n\n\n\n\n\n\nA CWE-79: Improper Neutralization of Input During Web Page Generation (\u0027Cross-site\nScripting\u0027) vulnerability exists on a DCE endpoint through the logging capabilities of the\nwebserver. \n\n\n\n\n\n \n\n\n\n\n \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\n\n"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "NONE",
"baseScore": 6.1,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"userInteraction": "REQUIRED",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:R/S:U/C:H/I:H/A:N",
"version": "3.1"
},
"format": "CVSS",
"scenarios": [
{
"lang": "en",
"value": "GENERAL"
}
]
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-79",
"description": "CWE-79 Improper Neutralization of Input During Web Page Generation (\u0027Cross-site Scripting\u0027)",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-04-18T20:38:01.298Z",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.0.9"
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2023-25553",
"datePublished": "2023-04-18T20:38:01.298Z",
"dateReserved": "2023-02-07T17:00:03.779Z",
"dateUpdated": "2025-02-05T21:24:51.230Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2023-37198
Vulnerability from cvelistv5
Published
2023-07-12 06:44
Modified
2024-11-07 14:45
Severity ?
EPSS score ?
Summary
A CWE-94: Improper Control of Generation of Code ('Code Injection') vulnerability exists that
could cause remote code execution when an admin user on DCE uploads or tampers with install
packages.
References
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: v7.9.3 and earlier |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T17:09:33.057Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-192-01\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-192-01.pdf"
}
],
"title": "CVE Program Container"
},
{
"affected": [
{
"cpes": [
"cpe:2.3:a:schneider-electric:struxureware_data_center_expert:*:*:*:*:*:*:*:*"
],
"defaultStatus": "unknown",
"product": "struxureware_data_center_expert",
"vendor": "schneider-electric",
"versions": [
{
"lessThanOrEqual": "7.9.3",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
}
],
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-37198",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "total"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-11-07T14:42:18.221049Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-11-07T14:45:30.711Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "StruxureWare Data Center Expert ",
"vendor": "Schneider Electric",
"versions": [
{
"status": "affected",
"version": "v7.9.3 and earlier"
}
]
}
],
"datePublic": "2023-07-11T06:22:00.000Z",
"descriptions": [
{
"lang": "en",
"supportingMedia": [
{
"base64": false,
"type": "text/html",
"value": "\n\n\n\n\n\nA CWE-94: Improper Control of Generation of Code (\u0027Code Injection\u0027) vulnerability exists that\ncould cause remote code execution when an admin user on DCE uploads or tampers with install\npackages. \n\n \n\n\n\n"
}
],
"value": "\n\n\n\n\nA CWE-94: Improper Control of Generation of Code (\u0027Code Injection\u0027) vulnerability exists that\ncould cause remote code execution when an admin user on DCE uploads or tampers with install\npackages. \n\n \n\n\n\n"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 6.8,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"userInteraction": "REQUIRED",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:R/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"format": "CVSS",
"scenarios": [
{
"lang": "en",
"value": "GENERAL"
}
]
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-94",
"description": "CWE-94 Improper Control of Generation of Code (\u0027Code Injection\u0027)",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-07-12T06:44:34.037Z",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-192-01\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-192-01.pdf"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.1.0-dev"
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2023-37198",
"datePublished": "2023-07-12T06:44:34.037Z",
"dateReserved": "2023-06-28T14:14:13.863Z",
"dateUpdated": "2024-11-07T14:45:30.711Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2023-37199
Vulnerability from cvelistv5
Published
2023-07-12 07:04
Modified
2024-11-07 14:44
Severity ?
EPSS score ?
Summary
A CWE-94: Improper Control of Generation of Code ('Code Injection') vulnerability exists that
could cause remote code execution when an admin user on DCE tampers with backups which
are then manually restored.
References
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: v7.9.3 and earlier |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T17:09:33.130Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-192-01\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-192-01.pdf"
}
],
"title": "CVE Program Container"
},
{
"affected": [
{
"cpes": [
"cpe:2.3:a:schneider-electric:struxureware_data_center_expert:*:*:*:*:*:*:*:*"
],
"defaultStatus": "unknown",
"product": "struxureware_data_center_expert",
"vendor": "schneider-electric",
"versions": [
{
"lessThanOrEqual": "7.9.3",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
}
],
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-37199",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "total"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-11-07T14:42:11.667073Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-11-07T14:44:46.940Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "StruxureWare Data Center Expert ",
"vendor": "Schneider Electric",
"versions": [
{
"status": "affected",
"version": "v7.9.3 and earlier"
}
]
}
],
"descriptions": [
{
"lang": "en",
"supportingMedia": [
{
"base64": false,
"type": "text/html",
"value": "\n\nA CWE-94: Improper Control of Generation of Code (\u0027Code Injection\u0027) vulnerability exists that\ncould cause remote code execution when an admin user on DCE tampers with backups which\nare then manually restored. \n\n\n"
}
],
"value": "\nA CWE-94: Improper Control of Generation of Code (\u0027Code Injection\u0027) vulnerability exists that\ncould cause remote code execution when an admin user on DCE tampers with backups which\nare then manually restored. \n\n\n"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 6.8,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"userInteraction": "REQUIRED",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:R/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"format": "CVSS",
"scenarios": [
{
"lang": "en",
"value": "GENERAL"
}
]
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-94",
"description": "CWE-94 Improper Control of Generation of Code (\u0027Code Injection\u0027)",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-07-12T07:04:08.510Z",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-192-01\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-192-01.pdf"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.1.0-dev"
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2023-37199",
"datePublished": "2023-07-12T07:04:08.510Z",
"dateReserved": "2023-06-28T14:14:13.863Z",
"dateUpdated": "2024-11-07T14:44:46.940Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2023-37197
Vulnerability from cvelistv5
Published
2023-07-12 06:41
Modified
2024-11-07 14:46
Severity ?
EPSS score ?
Summary
A CWE-89: Improper Neutralization of Special Elements vulnerability used in an SQL Command
('SQL Injection') vulnerability exists that could allow a user already authenticated on DCE to
access unauthorized content, change, or delete content, or perform unauthorized actions when
tampering with the mass configuration settings of endpoints on DCE.
References
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: v7.9.3 and earlier |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T17:09:33.407Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-192-01\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-192-01.pdf"
}
],
"title": "CVE Program Container"
},
{
"affected": [
{
"cpes": [
"cpe:2.3:a:schneider-electric:struxureware_data_center_expert:*:*:*:*:*:*:*:*"
],
"defaultStatus": "unknown",
"product": "struxureware_data_center_expert",
"vendor": "schneider-electric",
"versions": [
{
"lessThanOrEqual": "7.9.3",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
}
],
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-37197",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "total"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-11-07T14:42:24.492097Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-11-07T14:46:11.017Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "StruxureWare Data Center Expert ",
"vendor": "Schneider Electric",
"versions": [
{
"status": "affected",
"version": "v7.9.3 and earlier"
}
]
}
],
"datePublic": "2023-07-11T06:22:00.000Z",
"descriptions": [
{
"lang": "en",
"supportingMedia": [
{
"base64": false,
"type": "text/html",
"value": "\n\n\n\nA CWE-89: Improper Neutralization of Special Elements vulnerability used in an SQL Command\n(\u0027SQL Injection\u0027) vulnerability exists that could allow a user already authenticated on DCE to\naccess unauthorized content, change, or delete content, or perform unauthorized actions when\ntampering with the mass configuration settings of endpoints on DCE. \n\n\n\n"
}
],
"value": "\n\n\nA CWE-89: Improper Neutralization of Special Elements vulnerability used in an SQL Command\n(\u0027SQL Injection\u0027) vulnerability exists that could allow a user already authenticated on DCE to\naccess unauthorized content, change, or delete content, or perform unauthorized actions when\ntampering with the mass configuration settings of endpoints on DCE. \n\n\n\n"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 8.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"format": "CVSS",
"scenarios": [
{
"lang": "en",
"value": "GENERAL"
}
]
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-89",
"description": "CWE-89 Improper Neutralization of Special Elements used in an SQL Command (\u0027SQL Injection\u0027)",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-07-12T06:41:30.783Z",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-192-01\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-192-01.pdf"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.1.0-dev"
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2023-37197",
"datePublished": "2023-07-12T06:41:30.783Z",
"dateReserved": "2023-06-28T14:14:13.863Z",
"dateUpdated": "2024-11-07T14:46:11.017Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2023-25552
Vulnerability from cvelistv5
Published
2023-04-18 20:33
Modified
2024-08-02 11:25
Severity ?
EPSS score ?
Summary
A CWE-862: Missing Authorization vulnerability exists that could allow viewing of unauthorized
content, changes or deleting of content, or performing unauthorized functions when tampering
the Device File Transfer settings on DCE endpoints.
Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)
References
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: All < |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T11:25:19.289Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "StruxureWare Data Center Expert",
"vendor": "Schneider Electric",
"versions": [
{
"lessThanOrEqual": "V7.9.2",
"status": "affected",
"version": "All",
"versionType": "custom"
}
]
}
],
"datePublic": "2023-02-14T08:00:00.000Z",
"descriptions": [
{
"lang": "en",
"supportingMedia": [
{
"base64": false,
"type": "text/html",
"value": "\u003cp\u003e\n\n\n\nA CWE-862: Missing Authorization vulnerability exists that could allow viewing of unauthorized\ncontent, changes or deleting of content, or performing unauthorized functions when tampering\nthe Device File Transfer settings on DCE endpoints. \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\u003c/p\u003e"
}
],
"value": "\n\n\nA CWE-862: Missing Authorization vulnerability exists that could allow viewing of unauthorized\ncontent, changes or deleting of content, or performing unauthorized functions when tampering\nthe Device File Transfer settings on DCE endpoints. \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\n\n"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "NONE",
"baseScore": 8.1,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:N",
"version": "3.1"
},
"format": "CVSS",
"scenarios": [
{
"lang": "en",
"value": "GENERAL"
}
]
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-862",
"description": "CWE-862 Missing Authorization",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-04-18T20:33:50.548Z",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.0.9"
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2023-25552",
"datePublished": "2023-04-18T20:33:50.548Z",
"dateReserved": "2023-02-07T17:00:03.778Z",
"dateUpdated": "2024-08-02T11:25:19.289Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2023-25548
Vulnerability from cvelistv5
Published
2023-04-18 20:32
Modified
2024-08-02 11:25
Severity ?
EPSS score ?
Summary
A CWE-863: Incorrect Authorization vulnerability exists that could allow access to device
credentials on specific DCE endpoints not being properly secured when a hacker is using a low
privileged user.
Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)
References
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: All < |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T11:25:19.192Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "StruxureWare Data Center Expert",
"vendor": "Schneider Electric",
"versions": [
{
"lessThanOrEqual": "V7.9.2",
"status": "affected",
"version": "All",
"versionType": "custom"
}
]
}
],
"datePublic": "2023-02-14T08:00:00.000Z",
"descriptions": [
{
"lang": "en",
"supportingMedia": [
{
"base64": false,
"type": "text/html",
"value": "\u003cp\u003e\n\nA CWE-863: Incorrect Authorization vulnerability exists that could allow access to device\ncredentials on specific DCE endpoints not being properly secured when a hacker is using a low\nprivileged user. \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\u003c/p\u003e"
}
],
"value": "\nA CWE-863: Incorrect Authorization vulnerability exists that could allow access to device\ncredentials on specific DCE endpoints not being properly secured when a hacker is using a low\nprivileged user. \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\n\n"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 8.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"format": "CVSS",
"scenarios": [
{
"lang": "en",
"value": "GENERAL"
}
]
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-863",
"description": "CWE-863 Incorrect Authorization",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-04-18T20:32:42.718Z",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.0.9"
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2023-25548",
"datePublished": "2023-04-18T20:32:42.718Z",
"dateReserved": "2023-02-07T17:00:03.777Z",
"dateUpdated": "2024-08-02T11:25:19.192Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2023-25547
Vulnerability from cvelistv5
Published
2023-04-18 20:31
Modified
2025-02-12 16:00
Severity ?
EPSS score ?
Summary
A CWE-863: Incorrect Authorization vulnerability exists that could allow remote code execution
on upload and install packages when a hacker is using a low privileged user account. Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)
References
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: All < |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T11:25:18.954Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-25547",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "total"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-02-05T19:40:43.256138Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2025-02-12T16:00:20.177Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "StruxureWare Data Center Expert",
"vendor": "Schneider Electric",
"versions": [
{
"lessThanOrEqual": "V7.9.2",
"status": "affected",
"version": "All",
"versionType": "custom"
}
]
}
],
"datePublic": "2023-02-14T08:00:00.000Z",
"descriptions": [
{
"lang": "en",
"supportingMedia": [
{
"base64": false,
"type": "text/html",
"value": "\u003cp\u003e\n\nA CWE-863: Incorrect Authorization vulnerability exists that could allow remote code execution\non upload and install packages when a hacker is using a low privileged user account. Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\u003c/p\u003e"
}
],
"value": "\nA CWE-863: Incorrect Authorization vulnerability exists that could allow remote code execution\non upload and install packages when a hacker is using a low privileged user account. Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\n\n"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 8.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"format": "CVSS",
"scenarios": [
{
"lang": "en",
"value": "GENERAL"
}
]
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-863",
"description": "CWE-863 Incorrect Authorization",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-04-18T20:31:35.199Z",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.0.9"
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2023-25547",
"datePublished": "2023-04-18T20:31:35.199Z",
"dateReserved": "2023-02-07T17:00:03.777Z",
"dateUpdated": "2025-02-12T16:00:20.177Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2021-22795
Vulnerability from cvelistv5
Published
2022-03-28 16:25
Modified
2024-08-03 18:51
Severity ?
EPSS score ?
Summary
A CWE-78 Improper Neutralization of Special Elements used in an OS Command ('OS Command Injection') vulnerability exists that could cause remote code execution when performed over the network. Affected Product: StruxureWare Data Center Expert (V7.8.1 and prior)
References
| ▼ | URL | Tags |
|---|---|---|
| https://www.se.com/ww/en/download/document/SEVD-2021-257-03/ | x_refsource_MISC |
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: unspecified < V7.8.1 |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-03T18:51:07.444Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "https://www.se.com/ww/en/download/document/SEVD-2021-257-03/"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "StruxureWare Data Center Expert",
"vendor": "Schneider Electric",
"versions": [
{
"lessThan": "V7.8.1",
"status": "affected",
"version": "unspecified",
"versionType": "custom"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "A CWE-78 Improper Neutralization of Special Elements used in an OS Command (\u0027OS Command Injection\u0027) vulnerability exists that could cause remote code execution when performed over the network. Affected Product: StruxureWare Data Center Expert (V7.8.1 and prior)"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 9.1,
"baseSeverity": "CRITICAL",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "HIGH",
"scope": "CHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:N/S:C/C:H/I:H/A:H",
"version": "3.1"
}
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-78",
"description": "CWE-78 OS Command Injection",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2022-03-28T16:25:23",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"tags": [
"x_refsource_MISC"
],
"url": "https://www.se.com/ww/en/download/document/SEVD-2021-257-03/"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.0.9"
},
"x_legacyV4Record": {
"CVE_data_meta": {
"ASSIGNER": "cybersecurity@schneider-electric.com",
"ID": "CVE-2021-22795",
"STATE": "PUBLIC"
},
"affects": {
"vendor": {
"vendor_data": [
{
"product": {
"product_data": [
{
"product_name": "StruxureWare Data Center Expert",
"version": {
"version_data": [
{
"version_affected": "\u003c",
"version_value": "V7.8.1"
}
]
}
}
]
},
"vendor_name": "Schneider Electric"
}
]
}
},
"data_format": "MITRE",
"data_type": "CVE",
"data_version": "4.0",
"description": {
"description_data": [
{
"lang": "eng",
"value": "A CWE-78 Improper Neutralization of Special Elements used in an OS Command (\u0027OS Command Injection\u0027) vulnerability exists that could cause remote code execution when performed over the network. Affected Product: StruxureWare Data Center Expert (V7.8.1 and prior)"
}
]
},
"generator": {
"engine": "Vulnogram 0.0.9"
},
"impact": {
"cvss": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 9.1,
"baseSeverity": "CRITICAL",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "HIGH",
"scope": "CHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:N/S:C/C:H/I:H/A:H",
"version": "3.1"
}
},
"problemtype": {
"problemtype_data": [
{
"description": [
{
"lang": "eng",
"value": "CWE-78 OS Command Injection"
}
]
}
]
},
"references": {
"reference_data": [
{
"name": "https://www.se.com/ww/en/download/document/SEVD-2021-257-03/",
"refsource": "MISC",
"url": "https://www.se.com/ww/en/download/document/SEVD-2021-257-03/"
}
]
},
"source": {
"discovery": "UNKNOWN"
}
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2021-22795",
"datePublished": "2022-03-28T16:25:23",
"dateReserved": "2021-01-06T00:00:00",
"dateUpdated": "2024-08-03T18:51:07.444Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2023-25550
Vulnerability from cvelistv5
Published
2023-04-18 20:36
Modified
2025-02-12 16:00
Severity ?
EPSS score ?
Summary
A CWE-94: Improper Control of Generation of Code ('Code Injection') vulnerability exists that
allows remote code execution via the “hostname” parameter when maliciously crafted hostname
syntax is entered.
Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)
References
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: All < |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T11:25:18.948Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-25550",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "total"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-02-05T19:34:20.655945Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2025-02-12T16:00:58.860Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "StruxureWare Data Center Expert",
"vendor": "Schneider Electric",
"versions": [
{
"lessThanOrEqual": "V7.9.2",
"status": "affected",
"version": "All",
"versionType": "custom"
}
]
}
],
"datePublic": "2023-02-14T08:00:00.000Z",
"descriptions": [
{
"lang": "en",
"supportingMedia": [
{
"base64": false,
"type": "text/html",
"value": "\u003cp\u003e\n\n\n\n\n\n\n\n\n\nA CWE-94: Improper Control of Generation of Code (\u0027Code Injection\u0027) vulnerability exists that\nallows remote code execution via the \u201chostname\u201d parameter when maliciously crafted hostname\nsyntax is entered.\n\n \n\n\n\n\n \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\u003c/p\u003e"
}
],
"value": "\n\n\n\n\n\n\n\n\nA CWE-94: Improper Control of Generation of Code (\u0027Code Injection\u0027) vulnerability exists that\nallows remote code execution via the \u201chostname\u201d parameter when maliciously crafted hostname\nsyntax is entered.\n\n \n\n\n\n\n \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\n\n"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 7.2,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"format": "CVSS",
"scenarios": [
{
"lang": "en",
"value": "GENERAL"
}
]
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-94",
"description": "CWE-94 Improper Control of Generation of Code (\u0027Code Injection\u0027)",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-04-18T20:36:30.681Z",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.0.9"
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2023-25550",
"datePublished": "2023-04-18T20:36:30.681Z",
"dateReserved": "2023-02-07T17:00:03.778Z",
"dateUpdated": "2025-02-12T16:00:58.860Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2023-25555
Vulnerability from cvelistv5
Published
2023-04-18 20:39
Modified
2025-02-05 21:39
Severity ?
EPSS score ?
Summary
A CWE-78: Improper Neutralization of Special Elements used in an OS Command ('OS
Command Injection') vulnerability exists that could allow a user that knows the credentials to
execute unprivileged shell commands on the appliance over SSH.
Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)
References
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: All < |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T11:25:19.309Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-25555",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "total"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-02-05T21:39:21.556512Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2025-02-05T21:39:36.172Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "StruxureWare Data Center Expert",
"vendor": "Schneider Electric",
"versions": [
{
"lessThanOrEqual": "V7.9.2",
"status": "affected",
"version": "All",
"versionType": "custom"
}
]
}
],
"datePublic": "2023-02-14T08:00:00.000Z",
"descriptions": [
{
"lang": "en",
"supportingMedia": [
{
"base64": false,
"type": "text/html",
"value": "\u003cp\u003e\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\nA CWE-78: Improper Neutralization of Special Elements used in an OS Command (\u0027OS\nCommand Injection\u0027) vulnerability exists that could allow a user that knows the credentials to\nexecute unprivileged shell commands on the appliance over SSH. \n\n \n\n\n\n\n\n \n\n\n\n\n \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\u003c/p\u003e"
}
],
"value": "\n\n\n\n\n\n\n\n\n\n\n\n\n\n\nA CWE-78: Improper Neutralization of Special Elements used in an OS Command (\u0027OS\nCommand Injection\u0027) vulnerability exists that could allow a user that knows the credentials to\nexecute unprivileged shell commands on the appliance over SSH. \n\n \n\n\n\n\n\n \n\n\n\n\n \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\n\n"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "HIGH",
"attackVector": "NETWORK",
"availabilityImpact": "LOW",
"baseScore": 5.6,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "LOW",
"integrityImpact": "LOW",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:H/PR:N/UI:N/S:U/C:L/I:L/A:L",
"version": "3.1"
},
"format": "CVSS",
"scenarios": [
{
"lang": "en",
"value": "GENERAL"
}
]
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-78",
"description": "CWE-78 Improper Neutralization of Special Elements used in an OS Command (\u0027OS Command Injection\u0027)",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-04-18T20:39:14.874Z",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.0.9"
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2023-25555",
"datePublished": "2023-04-18T20:39:14.874Z",
"dateReserved": "2023-02-07T17:00:03.780Z",
"dateUpdated": "2025-02-05T21:39:36.172Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2023-25549
Vulnerability from cvelistv5
Published
2023-04-18 20:35
Modified
2024-08-02 11:25
Severity ?
EPSS score ?
Summary
A CWE-94: Improper Control of Generation of Code ('Code Injection') vulnerability exists that
allows for remote code execution when using a parameter of the DCE network settings
endpoint.
Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)
References
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: All < |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T11:25:19.200Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "StruxureWare Data Center Expert",
"vendor": "Schneider Electric",
"versions": [
{
"lessThanOrEqual": "V7.9.2",
"status": "affected",
"version": "All",
"versionType": "custom"
}
]
}
],
"datePublic": "2023-02-14T08:00:00.000Z",
"descriptions": [
{
"lang": "en",
"supportingMedia": [
{
"base64": false,
"type": "text/html",
"value": "\u003cp\u003e\n\n\n\n\n\n\n\nA CWE-94: Improper Control of Generation of Code (\u0027Code Injection\u0027) vulnerability exists that\nallows for remote code execution when using a parameter of the DCE network settings\nendpoint. \n\n\n\n\n \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\u003c/p\u003e"
}
],
"value": "\n\n\n\n\n\n\nA CWE-94: Improper Control of Generation of Code (\u0027Code Injection\u0027) vulnerability exists that\nallows for remote code execution when using a parameter of the DCE network settings\nendpoint. \n\n\n\n\n \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\n\n"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 7.2,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"format": "CVSS",
"scenarios": [
{
"lang": "en",
"value": "GENERAL"
}
]
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-94",
"description": "CWE-94 Improper Control of Generation of Code (\u0027Code Injection\u0027)",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-04-18T20:35:42.008Z",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.0.9"
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2023-25549",
"datePublished": "2023-04-18T20:35:42.008Z",
"dateReserved": "2023-02-07T17:00:03.778Z",
"dateUpdated": "2024-08-02T11:25:19.200Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2021-22794
Vulnerability from cvelistv5
Published
2022-03-28 16:25
Modified
2024-08-03 18:51
Severity ?
EPSS score ?
Summary
A CWE-22 Improper Limitation of a Pathname to a Restricted Directory ('Path Traversal') vulnerability exists that could cause remote code execution. Affected Product: StruxureWare Data Center Expert (V7.8.1 and prior)
References
| ▼ | URL | Tags |
|---|---|---|
| https://www.se.com/ww/en/download/document/SEVD-2021-257-03/ | x_refsource_MISC |
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: unspecified < V7.8.1 |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-03T18:51:07.441Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "https://www.se.com/ww/en/download/document/SEVD-2021-257-03/"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "StruxureWare Data Center Expert",
"vendor": "Schneider Electric",
"versions": [
{
"lessThan": "V7.8.1",
"status": "affected",
"version": "unspecified",
"versionType": "custom"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "A CWE-22 Improper Limitation of a Pathname to a Restricted Directory (\u0027Path Traversal\u0027) vulnerability exists that could cause remote code execution. Affected Product: StruxureWare Data Center Expert (V7.8.1 and prior)"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 9.1,
"baseSeverity": "CRITICAL",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "HIGH",
"scope": "CHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:N/S:C/C:H/I:H/A:H",
"version": "3.1"
}
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-22",
"description": "CWE-22 Improper Limitation of a Pathname to a Restricted Directory (\u0027Path Traversal\u0027)",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2022-03-28T16:25:21",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"tags": [
"x_refsource_MISC"
],
"url": "https://www.se.com/ww/en/download/document/SEVD-2021-257-03/"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.0.9"
},
"x_legacyV4Record": {
"CVE_data_meta": {
"ASSIGNER": "cybersecurity@schneider-electric.com",
"ID": "CVE-2021-22794",
"STATE": "PUBLIC"
},
"affects": {
"vendor": {
"vendor_data": [
{
"product": {
"product_data": [
{
"product_name": "StruxureWare Data Center Expert",
"version": {
"version_data": [
{
"version_affected": "\u003c",
"version_value": "V7.8.1"
}
]
}
}
]
},
"vendor_name": "Schneider Electric"
}
]
}
},
"data_format": "MITRE",
"data_type": "CVE",
"data_version": "4.0",
"description": {
"description_data": [
{
"lang": "eng",
"value": "A CWE-22 Improper Limitation of a Pathname to a Restricted Directory (\u0027Path Traversal\u0027) vulnerability exists that could cause remote code execution. Affected Product: StruxureWare Data Center Expert (V7.8.1 and prior)"
}
]
},
"generator": {
"engine": "Vulnogram 0.0.9"
},
"impact": {
"cvss": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 9.1,
"baseSeverity": "CRITICAL",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "HIGH",
"scope": "CHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:N/S:C/C:H/I:H/A:H",
"version": "3.1"
}
},
"problemtype": {
"problemtype_data": [
{
"description": [
{
"lang": "eng",
"value": "CWE-22 Improper Limitation of a Pathname to a Restricted Directory (\u0027Path Traversal\u0027)"
}
]
}
]
},
"references": {
"reference_data": [
{
"name": "https://www.se.com/ww/en/download/document/SEVD-2021-257-03/",
"refsource": "MISC",
"url": "https://www.se.com/ww/en/download/document/SEVD-2021-257-03/"
}
]
},
"source": {
"discovery": "UNKNOWN"
}
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2021-22794",
"datePublished": "2022-03-28T16:25:21",
"dateReserved": "2021-01-06T00:00:00",
"dateUpdated": "2024-08-03T18:51:07.441Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
cve-2023-25551
Vulnerability from cvelistv5
Published
2023-04-18 20:37
Modified
2025-02-12 16:01
Severity ?
EPSS score ?
Summary
A CWE-79: Improper Neutralization of Input During Web Page Generation ('Cross-site
Scripting') vulnerability exists on a DCE file upload endpoint when tampering with parameters
over HTTP.
Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)
References
Impacted products
| Vendor | Product | Version | ||
|---|---|---|---|---|
| Schneider Electric | StruxureWare Data Center Expert |
Version: All < |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T11:25:19.227Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-25551",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "total"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-02-05T19:26:49.222347Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2025-02-12T16:01:18.080Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "StruxureWare Data Center Expert",
"vendor": "Schneider Electric",
"versions": [
{
"lessThanOrEqual": "V7.9.2",
"status": "affected",
"version": "All",
"versionType": "custom"
}
]
}
],
"datePublic": "2023-02-14T08:00:00.000Z",
"descriptions": [
{
"lang": "en",
"supportingMedia": [
{
"base64": false,
"type": "text/html",
"value": "\u003cp\u003e\n\n\n\n\n\n\n\n\n\n\n\nA CWE-79: Improper Neutralization of Input During Web Page Generation (\u0027Cross-site\nScripting\u0027) vulnerability exists on a DCE file upload endpoint when tampering with parameters\nover HTTP.\n\n\n\n \n\n\n\n\n \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\u003c/p\u003e"
}
],
"value": "\n\n\n\n\n\n\n\n\n\n\nA CWE-79: Improper Neutralization of Input During Web Page Generation (\u0027Cross-site\nScripting\u0027) vulnerability exists on a DCE file upload endpoint when tampering with parameters\nover HTTP.\n\n\n\n \n\n\n\n\n \n\n \n\n Affected products: StruxureWare Data Center Expert (V7.9.2 and prior)\n\n"
}
],
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "NONE",
"baseScore": 6.1,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"userInteraction": "REQUIRED",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:R/S:U/C:H/I:H/A:N",
"version": "3.1"
},
"format": "CVSS",
"scenarios": [
{
"lang": "en",
"value": "GENERAL"
}
]
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-79",
"description": "CWE-79 Improper Neutralization of Input During Web Page Generation (\u0027Cross-site Scripting\u0027)",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-04-18T20:37:23.329Z",
"orgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"shortName": "schneider"
},
"references": [
{
"url": "https://download.schneider-electric.com/files?p_Doc_Ref=SEVD-2023-045-02\u0026p_enDocType=Security+and+Safety+Notice\u0026p_File_Name=SEVD-2023-045-02.pdf"
}
],
"source": {
"discovery": "UNKNOWN"
},
"x_generator": {
"engine": "Vulnogram 0.0.9"
}
}
},
"cveMetadata": {
"assignerOrgId": "076d1eb6-cfab-4401-b34d-6dfc2a413bdb",
"assignerShortName": "schneider",
"cveId": "CVE-2023-25551",
"datePublished": "2023-04-18T20:37:23.329Z",
"dateReserved": "2023-02-07T17:00:03.778Z",
"dateUpdated": "2025-02-12T16:01:18.080Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}